{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "422cf11d-6ec8-49b1-8af6-4849dff195d0",
          "code": "112410-23-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=112410-23-8",
          "code_system": "CAS",
          "references": [
            "85ead7b8-ed84-4a2d-b51c-c3e8e6293d72",
            "a71058fe-773e-49bf-868b-9ef0bd001b9e"
          ]
        },
        {
          "uuid": "bf13c36c-1d77-41cc-844c-7e345c25a587",
          "code": "C082026",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67082026",
          "code_system": "MESH",
          "references": [
            "85ead7b8-ed84-4a2d-b51c-c3e8e6293d72"
          ]
        },
        {
          "uuid": "fc7b4270-97d4-42b9-ae8e-286adcd548d6",
          "code": "TEBUFENOZIDE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Tebufenozide",
          "code_system": "WIKIPEDIA",
          "references": [
            "85ead7b8-ed84-4a2d-b51c-c3e8e6293d72"
          ]
        },
        {
          "uuid": "c6a018a1-d10d-41ef-8bd8-a76213f2eb7a",
          "code": "129026",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3985",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "85ead7b8-ed84-4a2d-b51c-c3e8e6293d72"
          ]
        },
        {
          "uuid": "60068d67-63ad-4838-b2ed-7062221c948b",
          "code": "m10500",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10500?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "85ead7b8-ed84-4a2d-b51c-c3e8e6293d72"
          ]
        },
        {
          "uuid": "4b0bfa3c-4355-4344-aa60-6df45688871b",
          "code": "91773",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91773",
          "code_system": "PUBCHEM",
          "references": [
            "85ead7b8-ed84-4a2d-b51c-c3e8e6293d72"
          ]
        },
        {
          "uuid": "948f219a-66d5-4569-5b36-b159e98173d3",
          "code": "7050",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7050",
          "code_system": "HSDB",
          "references": [
            "19077eb4-768b-3385-9490-ed5fbf883a52"
          ]
        },
        {
          "uuid": "810cdeb0-b634-8888-9b50-163ad72877b1",
          "code": "DTXSID4034948",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4034948",
          "code_system": "EPA CompTox",
          "references": [
            "63726b33-4002-449c-692c-3e9c83b1432b"
          ]
        },
        {
          "uuid": "aef4ed51-8ade-43d4-992a-02f9df75cf93",
          "code": "TNN5MI5EKF",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c255bc65-1932-0ded-1ed5-54effbcdc171",
          "code": "38452",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:38452",
          "code_system": "CHEBI",
          "references": [
            "cf13546c-15fc-fa92-df37-44d9ad23fbad"
          ]
        },
        {
          "uuid": "795db038-94a8-8bfb-c750-c886e1a5fdb9",
          "code": "tebufenozide",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/tebufenozide.html",
          "code_system": "ALANWOOD",
          "references": [
            "409cccff-7b3a-75d7-36ba-b05ef38d18c2"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "78c7c609-2e86-4917-8be0-1686266deb83",
          "name": "3,5-DIMETHYLBENZOIC ACID 1-(1,1-DIMETHYLETHYL)-2-(4-ETHYLBENZOYL)HYDRAZIDE",
          "stdName": "3,5-DIMETHYLBENZOIC ACID 1-(1,1-DIMETHYLETHYL)-2-(4-ETHYLBENZOYL)HYDRAZIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "31e96a83-7040-4bef-9ed3-6d779b3af1af",
            "028ad920-11ba-417c-913d-20af73857f3f"
          ],
          "display_name": false
        },
        {
          "uuid": "b70de7b2-4d3a-4647-bc5e-8908ae25a4a3",
          "name": "3,5-DIMETHYLBENZOIC ACID 1-(1,1-DIMETHYLETHYL)-2-(4-ETHYLBENZOYL)HYDRAZINE",
          "stdName": "3,5-DIMETHYLBENZOIC ACID 1-(1,1-DIMETHYLETHYL)-2-(4-ETHYLBENZOYL)HYDRAZINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cb6229e2-332c-4bec-a13f-91afbf691111",
            "f653e138-1ebc-4646-9921-104677df8e6c"
          ],
          "display_name": false
        },
        {
          "uuid": "01ed6499-0386-4af9-aeba-5a7b7c43e8c9",
          "name": "CONFIRM",
          "stdName": "CONFIRM",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cb6229e2-332c-4bec-a13f-91afbf691111",
            "f653e138-1ebc-4646-9921-104677df8e6c"
          ],
          "display_name": false
        },
        {
          "uuid": "4a0341b7-4431-40a3-acc9-fc797af45a23",
          "name": "MIMIC",
          "stdName": "MIMIC",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cb6229e2-332c-4bec-a13f-91afbf691111",
            "f653e138-1ebc-4646-9921-104677df8e6c"
          ],
          "display_name": false
        },
        {
          "uuid": "142012c9-9ef5-4f4a-a8bb-f4deecb77bfb",
          "name": "N-TERT-BUTYL-N'-(4-ETHYLBENZOYL)-3,5-DIMETHYLBENZOHYDRAZIDE",
          "stdName": "N-TERT-BUTYL-N'-(4-ETHYLBENZOYL)-3,5-DIMETHYLBENZOHYDRAZIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cb173bd8-85c9-4c6d-be38-3411ef56fa20",
            "028ad920-11ba-417c-913d-20af73857f3f"
          ],
          "display_name": false
        },
        {
          "uuid": "a58987a5-9620-414f-9443-858f24a3da14",
          "name": "RH-5992",
          "stdName": "RH-5992",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cb6229e2-332c-4bec-a13f-91afbf691111",
            "f653e138-1ebc-4646-9921-104677df8e6c"
          ],
          "display_name": false
        },
        {
          "uuid": "af3822db-1859-4225-81e3-0b20118f7a10",
          "name": "TEBUFENOZIDE",
          "stdName": "TEBUFENOZIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0aa255e2-5ceb-4c89-ac0c-4086a33874b7",
            "0eca8fd9-1b84-439a-af05-7c6449328fae",
            "e408d796-2b79-42df-8577-5c4261a6b4dd",
            "f653e138-1ebc-4646-9921-104677df8e6c",
            "ece63003-cc30-482f-bb12-57569dde2601",
            "3ae25f78-2a07-493b-8f46-eddc263670a4",
            "706b13c0-ee3d-4aef-aeea-569deebb2780",
            "2ddcf4e2-ba00-4a4e-9f64-89173f7a4fc0"
          ],
          "display_name": true
        },
        {
          "uuid": "d6382963-16c6-48c5-b2f3-0d85d4b6c729",
          "name": "TEBUFENOZIDE [HSDB]",
          "stdName": "TEBUFENOZIDE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f653e138-1ebc-4646-9921-104677df8e6c",
            "3ae25f78-2a07-493b-8f46-eddc263670a4"
          ],
          "display_name": false
        },
        {
          "uuid": "e873a2de-610c-49de-9df2-6a57ffc3bf51",
          "name": "TEBUFENOZIDE [ISO]",
          "stdName": "TEBUFENOZIDE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e408d796-2b79-42df-8577-5c4261a6b4dd",
            "f653e138-1ebc-4646-9921-104677df8e6c"
          ],
          "display_name": false
        },
        {
          "uuid": "72487347-6252-476e-ac62-1aa463a83476",
          "name": "TEBUFENOZIDE [MI]",
          "stdName": "TEBUFENOZIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0aa255e2-5ceb-4c89-ac0c-4086a33874b7",
            "f653e138-1ebc-4646-9921-104677df8e6c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "706b13c0-ee3d-4aef-aeea-569deebb2780",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "028ad920-11ba-417c-913d-20af73857f3f",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cb173bd8-85c9-4c6d-be38-3411ef56fa20",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "31e96a83-7040-4bef-9ed3-6d779b3af1af",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0aa255e2-5ceb-4c89-ac0c-4086a33874b7",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f653e138-1ebc-4646-9921-104677df8e6c",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cb6229e2-332c-4bec-a13f-91afbf691111",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3ae25f78-2a07-493b-8f46-eddc263670a4",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e408d796-2b79-42df-8577-5c4261a6b4dd",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "85ead7b8-ed84-4a2d-b51c-c3e8e6293d72",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390960000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6c678a2d-abe9-48dc-b6c6-dfd3e99252a1",
          "citation": "SRS import [TNN5MI5EKF]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=TNN5MI5EKF",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390960000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c1ac7e26-dcdc-4351-9db3-2a50494e3ced",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0eca8fd9-1b84-439a-af05-7c6449328fae",
          "citation": "TEBUFENOZIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ece63003-cc30-482f-bb12-57569dde2601",
          "citation": "TEBUFENOZIDE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2ddcf4e2-ba00-4a4e-9f64-89173f7a4fc0",
          "citation": "TEBUFENOZIDE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "19077eb4-768b-3385-9490-ed5fbf883a52",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+112410-23-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "63726b33-4002-449c-692c-3e9c83b1432b",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=112410-23-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "409cccff-7b3a-75d7-36ba-b05ef38d18c2",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "cf13546c-15fc-fa92-df37-44d9ad23fbad",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "a71058fe-773e-49bf-868b-9ef0bd001b9e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7219a8c9-7774-41e5-96fe-63e79bc683b1",
          "id": "7219a8c9-7774-41e5-96fe-63e79bc683b1",
          "molfile": "\n  Marvin  01132105552D          \n\n 26 27  0  0  0  0            999 V2000\n    2.7888   -4.5946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5020   -4.1909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2237   -4.5956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9293   -4.1678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6629   -4.5700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6629   -5.3952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9527   -5.8184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2237   -5.4159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3813   -5.7974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3813   -6.6228    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0889   -5.3792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8133   -4.9681    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8110   -5.5480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8110   -6.3743    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5221   -5.1376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5221   -4.3120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2385   -3.9068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2385   -3.0804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9527   -4.3172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9527   -5.1376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6673   -5.5505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2398   -5.5529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8133   -4.1477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5050   -4.1477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0126   -4.1477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8133   -3.3828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  8  3  2  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6  9  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 23  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 22 15  2  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  1  0  0  0  0\n 23 24  1  0  0  0  0\n 23 25  1  0  0  0  0\n 23 26  1  0  0  0  0\nM  END",
          "smiles": "CCc1ccc(cc1)C(=O)NN(C(=O)c2cc(C)cc(C)c2)C(C)(C)C",
          "formula": "C22H28N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "64597f31-0977-4660-a1d1-a731291b81f9"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "352.4707",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "082bea40-7861-4536-9ee0-4f78e6d4db76",
      "version": "6",
      "structure": {
        "id": "d382c84d-6cfe-4156-bc6b-ba53e5938e97",
        "molfile": "\n  Marvin  01132110562D          \n\n 26 27  0  0  0  0            999 V2000\n    4.9527   -5.8184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6629   -5.3952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6629   -4.5700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9293   -4.1678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2237   -4.5956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2237   -5.4159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5020   -4.1909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7888   -4.5946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3813   -5.7974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3813   -6.6228    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0889   -5.3792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8133   -4.9681    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8133   -4.1477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5050   -4.1477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0126   -4.1477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8133   -3.3828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8110   -5.5480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8110   -6.3743    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5221   -5.1376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5221   -4.3120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2385   -3.9068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2385   -3.0804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9527   -4.3172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9527   -5.1376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6673   -5.5505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2398   -5.5529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  1  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  2  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 13 16  1  0  0  0  0\n 12 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 17 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  1  0  0  0  0\n 23 24  2  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  1  0  0  0  0\n 26 19  2  0  0  0  0\nM  END",
        "smiles": "CCc1ccc(cc1)C(=O)NN(C(=O)c2cc(C)cc(C)c2)C(C)(C)C",
        "formula": "C22H28N2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "352.4707",
        "optical_activity": "NONE",
        "references": [
          "c1ac7e26-dcdc-4351-9db3-2a50494e3ced",
          "6c678a2d-abe9-48dc-b6c6-dfd3e99252a1"
        ],
        "stereo_centers": 0
      },
      "unii": "TNN5MI5EKF"
    }
  ]
}