{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "fc63d1df-6325-4d00-85b5-ee0a479df63e",
          "code": "2530-97-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2530-97-4",
          "code_system": "CAS",
          "references": [
            "dcc8da91-61a5-4c92-a126-15ca0c91970c",
            "1b66e853-419e-4d05-9557-526758edc79e"
          ]
        },
        {
          "uuid": "0d3a499d-0554-4faa-9755-0238949af876",
          "code": "89795",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/89795/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "dcc8da91-61a5-4c92-a126-15ca0c91970c"
          ]
        },
        {
          "uuid": "6a2fba14-4be6-44ec-b2e5-3dcaa5888a35",
          "code": "DB09092",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB09092",
          "code_system": "DRUG BANK",
          "references": [
            "dcc8da91-61a5-4c92-a126-15ca0c91970c"
          ]
        },
        {
          "uuid": "306d698e-71f1-4b06-8fb9-e56ed546c7bf",
          "code": "SUB126903",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "dcc8da91-61a5-4c92-a126-15ca0c91970c"
          ]
        },
        {
          "uuid": "592bb9d6-3b3b-4f22-a9c3-d2f05f0d8746",
          "code": "9913",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9913",
          "code_system": "PUBCHEM",
          "references": [
            "dcc8da91-61a5-4c92-a126-15ca0c91970c"
          ]
        },
        {
          "uuid": "bdf14cae-f2ad-0107-af9d-970eaa5dc7f6",
          "code": "Xanthinol",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Xanthinol",
          "code_system": "WIKIPEDIA",
          "references": [
            "34d4180d-df40-9eb0-cf99-28a02307ca7f"
          ]
        },
        {
          "uuid": "eeee9ed1-7466-c1ef-0a6b-dd0d0525898d",
          "code": "DTXSID1048255",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1048255",
          "code_system": "EPA CompTox",
          "references": [
            "6ab42246-9e2c-09b8-b299-41d11de6d7f1"
          ]
        },
        {
          "uuid": "b97cf11a-9751-fe38-5912-41011ef1f856",
          "code": "4368",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/4368",
          "code_system": "DRUG CENTRAL",
          "references": [
            "e37a4643-27d5-e113-f6cf-7c216355643c"
          ]
        },
        {
          "uuid": "72814609-f61d-48a7-adb8-6b43c8e20a24",
          "code": "TN1B5910V2",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5df20a34-0ca7-7083-9308-ff0693a56101",
          "code": "100000153088",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "b1869224-75e3-d680-ac8f-8e5deda3d23e"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "436d30ab-84f1-4547-a553-54751837c6a3",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "c5c1b0cf-645d-401c-8aad-456be0767d8b",
            "refuuid": "e5646254-e84a-4dc2-9968-6fea1bd72f45",
            "name": "XANTHINOL",
            "unii": "TN1B5910V2",
            "linking_id": "TN1B5910V2",
            "ref_pname": "XANTHINOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "bfb27bd7-da7c-4b13-a20f-4dd65adc8825",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "26c2eefa-a099-4425-b9b1-a39b4a8f294d",
            "refuuid": "b1ca9890-18cc-4fb9-914b-ce510f9ae7ef",
            "name": "XANTHINOL NIACINATE",
            "unii": "8G60H12X2D",
            "linking_id": "8G60H12X2D",
            "ref_pname": "XANTHINOL NIACINATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f882ac78-092b-42be-aca0-8a3daea7a67d",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "c7324ad3-4284-4151-aa4a-f30b8b0cd463",
            "refuuid": "80d5ef45-2e46-42f9-87ad-30b54c39b48f",
            "name": "XANTIFIBRATE",
            "unii": "9FEN3M88VP",
            "linking_id": "9FEN3M88VP",
            "ref_pname": "XANTIFIBRATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6701042b-9b88-4ed6-bcf8-223cd0fad2ad",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "87a4964d-d6cc-4592-a6d7-2d4dd17d0697",
            "refuuid": "2400937a-4779-4fd2-b7dd-5badaddd3459",
            "name": "FUROSEMIDE XANTINOL",
            "unii": "Y1P3P1MD0G",
            "linking_id": "Y1P3P1MD0G",
            "ref_pname": "FUROSEMIDE XANTINOL",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "0d920264-e85a-4192-a274-8b2c7bed314c",
          "name": "XANTHINOL",
          "stdName": "XANTHINOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "07b463b9-3a29-4fd5-9f43-3a368f2234e4"
          ],
          "display_name": true
        },
        {
          "uuid": "5576a17c-b387-4c97-89db-b6aa6d99b212",
          "name": "XANTINOL",
          "stdName": "XANTINOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2cbe00bc-aa3d-4082-a413-0c4ef2546e13",
            "0826a88d-67b8-4d02-8acb-59f7c42d383c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "07b463b9-3a29-4fd5-9f43-3a368f2234e4",
          "citation": "RXNORM",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2cbe00bc-aa3d-4082-a413-0c4ef2546e13",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0826a88d-67b8-4d02-8acb-59f7c42d383c",
          "citation": "WHO DRUG DICTIONARY",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dcc8da91-61a5-4c92-a126-15ca0c91970c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391541000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "114413f2-c898-4234-a106-6570a0a92281",
          "citation": "SRS import [TN1B5910V2]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=TN1B5910V2",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391541000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "012b8de8-a89b-4c19-b04a-9c19e7508ccc",
          "citation": "ACTIVE MOIETY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "34d4180d-df40-9eb0-cf99-28a02307ca7f",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Xanthinol",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6ab42246-9e2c-09b8-b299-41d11de6d7f1",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2530-97-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e37a4643-27d5-e113-f6cf-7c216355643c",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "1b66e853-419e-4d05-9557-526758edc79e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b1869224-75e3-d680-ac8f-8e5deda3d23e",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1b39f7cc-8c92-4aa2-8341-9fddca3ab639",
          "id": "1b39f7cc-8c92-4aa2-8341-9fddca3ab639",
          "molfile": "\n  Marvin  01132101352D          \n\n 22 23  0  0  0  0            999 V2000\n    8.5506   -4.3429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9927   -3.7342    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2509   -2.9505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0579   -2.7798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3114   -1.9960    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1859   -3.9002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9322   -4.6933    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    7.4902   -5.2973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1253   -4.8546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8763   -5.6431    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3513   -6.3117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8763   -6.9756    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0879   -6.7312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3825   -7.1323    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3825   -7.9622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6678   -6.7312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9439   -7.1323    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6678   -5.9012    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9439   -5.4863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3825   -5.4863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3825   -4.6610    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0879   -5.9012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  6  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 22  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 22 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 14  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 16  1  0  0  0  0\n 19 18  1  0  0  0  0\n 18 20  1  0  0  0  0\n 21 20  2  0  0  0  0\n 20 22  1  0  0  0  0\nM  END",
          "smiles": "CN(CCO)CC(Cn1cnc2c1c(=O)n(C)c(=O)n2C)O",
          "formula": "C13H21N5O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7c0c7bcc-a589-4c67-bbf3-2c0b5d0531ce"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "311.3375",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e5646254-e84a-4dc2-9968-6fea1bd72f45",
      "version": "7",
      "structure": {
        "id": "4218ed28-b95c-46d6-98d5-e4276baa895e",
        "molfile": "\n  Marvin  01132103292D          \n\n 22 23  0  0  0  0            999 V2000\n    5.0879   -6.7312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0879   -5.9012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3825   -5.4863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3825   -4.6610    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6678   -5.9012    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9439   -5.4863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6678   -6.7312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3825   -7.1323    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3825   -7.9622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9439   -7.1323    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8763   -5.6431    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3513   -6.3117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8763   -6.9756    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1253   -4.8546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9322   -4.6933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1859   -3.9002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9927   -3.7342    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2509   -2.9505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0579   -2.7798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3114   -1.9960    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5506   -4.3429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4902   -5.2973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  3  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8  1  1  0  0  0  0\n 10  7  2  0  0  0  0\n 11  2  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13  1  1  0  0  0  0\n 14 11  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 17  1  0  0  0  0\n 15 22  1  0  0  0  0\nM  END",
        "smiles": "CN(CCO)CC(Cn1cnc2c1c(=O)n(C)c(=O)n2C)O",
        "formula": "C13H21N5O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "311.3375",
        "optical_activity": "( + / - )",
        "references": [
          "012b8de8-a89b-4c19-b04a-9c19e7508ccc",
          "114413f2-c898-4234-a106-6570a0a92281"
        ],
        "stereo_centers": 1
      },
      "unii": "TN1B5910V2"
    }
  ]
}