{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e3c924e3-4c0e-4554-aa1e-f69a3a68bb9e",
          "code": "20362-31-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=20362-31-6",
          "code_system": "CAS",
          "references": [
            "948d7e20-c43c-4382-9fda-b3d4f7f580e7",
            "a353e67f-bc1e-4d4b-82fa-6c8333e55389"
          ]
        },
        {
          "uuid": "5c7b5024-f3bd-4ddd-b3b8-880125b990df",
          "code": "C077992",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67077992",
          "code_system": "MESH",
          "references": [
            "948d7e20-c43c-4382-9fda-b3d4f7f580e7"
          ]
        },
        {
          "uuid": "b5ea6673-1df0-48c4-97e7-1b9ba21b056d",
          "code": "ARCTIIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Arctiin",
          "code_system": "WIKIPEDIA",
          "references": [
            "948d7e20-c43c-4382-9fda-b3d4f7f580e7"
          ]
        },
        {
          "uuid": "367fbd47-7667-44f9-932b-1566604b9cf3",
          "code": "C93250",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C93250",
          "code_system": "NCI_THESAURUS",
          "references": [
            "948d7e20-c43c-4382-9fda-b3d4f7f580e7"
          ]
        },
        {
          "uuid": "1b000cc7-4b2c-4b3e-940d-4f85b37ef250",
          "code": "100528",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/100528",
          "code_system": "PUBCHEM",
          "references": [
            "948d7e20-c43c-4382-9fda-b3d4f7f580e7"
          ]
        },
        {
          "uuid": "5bc72e3d-a4d9-c8ab-92c3-ec02efc69a05",
          "code": "C1145",
          "comments": "Food or Food Product[C1949]|Food Component[C1930]|Bioactive Food Component[C54060]|Dietary Polyphenol[C70553]|Lignan",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1145",
          "code_system": "NCI_THESAURUS",
          "references": [
            "2d6a21bc-9490-9506-ac5d-87417ad1f4f5"
          ]
        },
        {
          "uuid": "847c1b3b-3a00-480f-826e-bc4828eae5c2",
          "code": "TM5RQ949K7",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "1c5b4715-029c-33b3-1ebe-1323e8e8fd05",
          "code": "DTXSID20942519",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20942519",
          "code_system": "EPA CompTox",
          "references": [
            "2d6a21bc-9490-9506-ac5d-87417ad1f4f5"
          ]
        },
        {
          "uuid": "89087cb9-a782-f48e-81eb-ca4c7193c6e2",
          "code": "315527",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=315527",
          "code_system": "NSC",
          "references": [
            "cf7ab9c6-98bd-cf26-0d48-b187a1234aae"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "d674feac-95d3-4b1a-8b72-6d7adbcf5d7d",
          "amount": {
            "uuid": "3ae135ca-5cba-4de4-8047-ed97ce5a6942"
          },
          "comments": "36% Cell growth rate of M1 cells at 50 uM of compound vs control",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "8bf598c5-b322-466e-9389-7538fa1dccfe"
          ],
          "related_substance": {
            "uuid": "5f86d5ca-9d7e-4a08-b876-d09206a5f0cb",
            "refuuid": "b506570b-ecfa-460f-b44b-8541597b0ac5",
            "name": "ARCTIUM LAPPA FRUIT",
            "unii": "EA541308MV",
            "linking_id": "EA541308MV",
            "ref_pname": "ARCTIUM LAPPA FRUIT",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "53705523-6205-4261-bf61-e912fa0f1a32",
          "amount": {
            "uuid": "7c38e1af-61fb-4b9f-9474-9ab4d31bad8f"
          },
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "b03e68d1-5119-4bdb-b82b-bc14739aa9fe"
          ],
          "related_substance": {
            "uuid": "f664ae90-974c-4ee7-811f-19109ece1887",
            "refuuid": "6f4c446b-8b2d-4b3a-b5e4-124bd57ca28a",
            "name": "ARCTIUM LAPPA ROOT",
            "unii": "597E9BI3Z3",
            "linking_id": "597E9BI3Z3",
            "ref_pname": "ARCTIUM LAPPA ROOT",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "bb82b5de-5746-493d-925e-62ab32f20e33",
          "amount": {
            "uuid": "f34cdd21-ebdb-48b4-904a-41d4f69565aa"
          },
          "type": "TARGET->AGONIST",
          "references": [
            "35665cd6-81de-4fda-92f3-d8d792201158"
          ],
          "related_substance": {
            "uuid": "73cd9a89-99a9-47ce-a7a8-ab4a6eb5e025",
            "refuuid": "a13d00ab-92d4-497a-ae83-f5fdbd2c3996",
            "name": "ADIPONECTIN RECEPTOR PROTEIN 1",
            "unii": "02I1S1047P",
            "linking_id": "02I1S1047P",
            "ref_pname": "ADIPONECTIN RECEPTOR PROTEIN 1",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a63e3c89-174e-4c63-91cb-3b881ecd71be",
          "amount": {
            "uuid": "24746569-4256-4414-b64a-6ed08a3feaf6"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "fba63196-b3a5-4fc2-94fd-0a213e6737f6",
            "refuuid": "2e245d13-a049-472b-867a-c39c587f3600",
            "name": "ARCTIIN",
            "unii": "TM5RQ949K7",
            "linking_id": "TM5RQ949K7",
            "ref_pname": "ARCTIIN",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "642147fe-5dd6-4b6f-b1fd-de38c89466aa",
          "name": "2(3H)-FURANONE, 4-((3,4-DIMETHOXYPHENYL)METHYL)-3-((4-(.BETA.-D-GLUCOPYRANOSYLOXY)-3-METHOXYPHENYL)METHYL)DIHYDRO-, (3R,4R)-",
          "stdName": "2(3H)-FURANONE, 4-((3,4-DIMETHOXYPHENYL)METHYL)-3-((4-(.BETA.-D-GLUCOPYRANOSYLOXY)-3-METHOXYPHENYL)METHYL)DIHYDRO-, (3R,4R)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b2eeb67-03ef-4b06-b8b2-26d25f319726",
            "76ced50b-5fe4-4813-90f3-b953a6fd1599"
          ],
          "display_name": false
        },
        {
          "uuid": "4ce33bf0-80c7-4c0a-b98c-a1ddf65814f1",
          "name": "2(3H)-FURANONE, 4-((3,4-DIMETHOXYPHENYL)METHYL)-3-((4-(.BETA.-D-GLUCOPYRANOSYLOXY)-3-METHOXYPHENYL)METHYL)DIHYDRO-, (3R-TRANS)-",
          "stdName": "2(3H)-FURANONE, 4-((3,4-DIMETHOXYPHENYL)METHYL)-3-((4-(.BETA.-D-GLUCOPYRANOSYLOXY)-3-METHOXYPHENYL)METHYL)DIHYDRO-, (3R-TRANS)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b1428031-6bcc-42a4-a5d0-a0d56e3f48af",
            "76ced50b-5fe4-4813-90f3-b953a6fd1599"
          ],
          "display_name": false
        },
        {
          "uuid": "01637e7e-d65b-47e9-bd01-069c1c3d05b6",
          "name": "ARCTIGENIN-4-GLUCOSIDE",
          "stdName": "ARCTIGENIN-4-GLUCOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "76ced50b-5fe4-4813-90f3-b953a6fd1599",
            "521690c1-c0e4-450f-94df-81e76124d9d8"
          ],
          "display_name": false
        },
        {
          "uuid": "a78af0c1-ea94-41f5-86c5-b138221b9569",
          "name": "ARCTII",
          "stdName": "ARCTII",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b2eeb67-03ef-4b06-b8b2-26d25f319726",
            "76ced50b-5fe4-4813-90f3-b953a6fd1599"
          ],
          "display_name": false
        },
        {
          "uuid": "21351bb0-cb24-49ba-bf8f-79311c49eb53",
          "name": "ARCTIIN",
          "stdName": "ARCTIIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b1428031-6bcc-42a4-a5d0-a0d56e3f48af",
            "81a21a01-0e3f-4a08-a42e-3e85b0ed7558",
            "76ced50b-5fe4-4813-90f3-b953a6fd1599",
            "04720071-99aa-4c7c-b954-e9b13b0d1533"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "43d7a3d8-7996-466a-9b23-14e971848e86",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "28f2ce0f-acf9-42e8-ba4b-b6f600abf573",
          "name": "NSC-315527",
          "stdName": "NSC-315527",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b1428031-6bcc-42a4-a5d0-a0d56e3f48af",
            "76ced50b-5fe4-4813-90f3-b953a6fd1599"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b1428031-6bcc-42a4-a5d0-a0d56e3f48af",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "76ced50b-5fe4-4813-90f3-b953a6fd1599",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3b2eeb67-03ef-4b06-b8b2-26d25f319726",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "04720071-99aa-4c7c-b954-e9b13b0d1533",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "521690c1-c0e4-450f-94df-81e76124d9d8",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "948d7e20-c43c-4382-9fda-b3d4f7f580e7",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391341000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8bf598c5-b322-466e-9389-7538fa1dccfe",
          "citation": "UMEHARA K, CHEM PHARM BULL 41(10)1774-79(1993)",
          "url": "https://www.jstage.jst.go.jp/article/cpb1958/41/10/41_10_1774/_pdf",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b03e68d1-5119-4bdb-b82b-bc14739aa9fe",
          "citation": "HERBAL MEDICINES 4TH ED 2013",
          "doc_type": "BOOK",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4f7a8efe-b6d6-415c-a2b8-bd7793e44cc7",
          "citation": "SRS import [TM5RQ949K7]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=TM5RQ949K7",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391341000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "81a21a01-0e3f-4a08-a42e-3e85b0ed7558",
          "citation": "ARCTIIN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2d6a21bc-9490-9506-ac5d-87417ad1f4f5",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "35665cd6-81de-4fda-92f3-d8d792201158",
          "citation": "https://en.wikipedia.org/wiki/Arctiin",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a353e67f-bc1e-4d4b-82fa-6c8333e55389",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "cf7ab9c6-98bd-cf26-0d48-b187a1234aae",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0983d293-1d8c-46de-91d9-cdf49243451f",
          "id": "0983d293-1d8c-46de-91d9-cdf49243451f",
          "molfile": "\n  Marvin  01132100452D          \n\n 38 41  0  0  1  0            999 V2000\n   11.3268  -10.8368    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   11.5245  -10.0358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9297   -9.4641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1373   -9.6935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5424   -9.1218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7401   -8.3208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1453   -7.7491    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3528   -7.9784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5325   -8.0915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7302   -7.2906    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1354   -6.7189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1274   -8.6631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8587  -11.4675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4232  -12.1682    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6223  -11.9705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9915  -12.5023    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5627  -11.1477    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    9.8620  -10.7121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1345  -11.1012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4339  -10.6657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7063  -11.0548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6795  -11.8793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9520  -12.2683    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2513  -11.8328    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.2782  -11.0083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5775  -10.5728    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.6043   -9.7482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9036   -9.3127    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8500  -10.9618    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    4.1493  -10.5263    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8232  -11.7864    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    4.0956  -12.1754    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5239  -12.2220    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.4970  -13.0465    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3802  -12.3149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3534  -13.1394    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0541  -13.5749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1077  -11.9257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1 13  1  0  0  0  0\n 17  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n 12  3  2  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  9  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n  9 12  1  0  0  0  0\n 11 10  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 15  1  0  0  0  0\n 17 18  1  6  0  0  0\n 18 19  1  0  0  0  0\n 20 19  1  0  0  0  0\n 19 38  2  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 35 22  2  0  0  0  0\n 24 23  1  1  0  0  0\n 24 25  1  0  0  0  0\n 33 24  1  0  0  0  0\n 26 25  1  0  0  0  0\n 26 27  1  1  0  0  0\n 29 26  1  0  0  0  0\n 28 27  1  0  0  0  0\n 29 30  1  6  0  0  0\n 31 29  1  0  0  0  0\n 31 32  1  1  0  0  0\n 33 31  1  0  0  0  0\n 33 34  1  6  0  0  0\n 36 35  1  0  0  0  0\n 38 35  1  0  0  0  0\n 37 36  1  0  0  0  0\nM  END",
          "smiles": "COc1ccc(C[C@H]2COC(=O)[C@@H]2Cc3ccc(c(c3)OC)O[C@H]4[C@@H]([C@H]([C@@H]([C@@H](CO)O4)O)O)O)cc1OC",
          "formula": "C27H34O11",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "38f71aab-700a-4931-a7bb-e84350150fd9"
          },
          "defined_stereo": 7,
          "ez_centers": 0,
          "molecular_weight": "534.5533",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 7
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2e245d13-a049-472b-867a-c39c587f3600",
      "version": "9",
      "structure": {
        "id": "1fdaa1e8-16db-4d9d-b07d-2cd0802da43c",
        "molfile": "\n  Marvin  01132101492D          \n\n 38 41  0  0  1  0            999 V2000\n    5.4970  -13.0465    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5239  -12.2220    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.2513  -11.8328    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.9520  -12.2683    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6795  -11.8793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7063  -11.0548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4339  -10.6657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1345  -11.1012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8620  -10.7121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5627  -11.1477    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   11.3268  -10.8368    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   11.5245  -10.0358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9297   -9.4641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1274   -8.6631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5325   -8.0915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7401   -8.3208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5424   -9.1218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1373   -9.6935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1453   -7.7491    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3528   -7.9784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7302   -7.2906    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1354   -6.7189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8587  -11.4675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4232  -12.1682    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6223  -11.9705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9915  -12.5023    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1077  -11.9257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3802  -12.3149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3534  -13.1394    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0541  -13.5749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2782  -11.0083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5775  -10.5728    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.8500  -10.9618    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.1493  -10.5263    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8232  -11.7864    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.0956  -12.1754    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6043   -9.7482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9036   -9.3127    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  6  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  1  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  6  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  1  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 13  2  0  0  0  0\n 19 16  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 15  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 11  1  0  0  0  0\n 24 23  1  0  0  0  0\n 24 25  1  0  0  0  0\n 26 25  2  0  0  0  0\n 25 10  1  0  0  0  0\n  8 27  1  0  0  0  0\n 27 28  2  0  0  0  0\n 28  5  1  0  0  0  0\n 29 28  1  0  0  0  0\n 30 29  1  0  0  0  0\n 31  3  1  0  0  0  0\n 32 31  1  0  0  0  0\n 33 32  1  0  0  0  0\n 33 34  1  6  0  0  0\n 35 33  1  0  0  0  0\n 35 36  1  1  0  0  0\n 35  2  1  0  0  0  0\n 32 37  1  1  0  0  0\n 38 37  1  0  0  0  0\nM  END",
        "smiles": "COc1ccc(C[C@H]2COC(=O)[C@@H]2Cc3ccc(c(c3)OC)O[C@H]4[C@@H]([C@H]([C@@H]([C@@H](CO)O4)O)O)O)cc1OC",
        "formula": "C27H34O11",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 7,
        "ez_centers": 0,
        "molecular_weight": "534.5533",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "b1428031-6bcc-42a4-a5d0-a0d56e3f48af",
          "4f7a8efe-b6d6-415c-a2b8-bd7793e44cc7"
        ],
        "stereo_centers": 7
      },
      "unii": "TM5RQ949K7"
    }
  ]
}