{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8fdb2647-936b-4e15-be81-d23f0df35088",
          "code": "480-47-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=480-47-7",
          "code_system": "CAS",
          "references": [
            "52b2337a-9fe8-44eb-907b-f4664d26496a",
            "579a70c6-749d-40f3-baf1-f5a150350069"
          ]
        },
        {
          "uuid": "87c2a4a4-2ece-4d1a-9c37-7ce71dd61b58",
          "code": "119199",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/119199",
          "code_system": "PUBCHEM",
          "references": [
            "52b2337a-9fe8-44eb-907b-f4664d26496a"
          ]
        },
        {
          "uuid": "978b2d0b-6baa-50e0-cfa7-64093728506e",
          "code": "Hydrangenol",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Hydrangenol",
          "code_system": "WIKIPEDIA",
          "references": [
            "fcbe0063-139e-be37-071c-ceac1e569ce9"
          ]
        },
        {
          "uuid": "e41c6efd-bd19-4d05-a834-74ea48886fad",
          "code": "TL8PI7PHV1",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "612beaf7-4d85-916c-d018-7b4d0d47f172",
          "code": "DTXSID20963981",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20963981",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ad40ce64-2886-46cd-8967-d7670d8b647a",
          "name": "(±)-HYDRANGENOL",
          "stdName": "(+/-)-HYDRANGENOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3bda4ae-6b97-42fd-97cd-ccd91c0b8324",
            "c0e2f813-7f9f-40c5-8807-b7613034dd34"
          ],
          "display_name": false
        },
        {
          "uuid": "b8e00708-a573-480e-9030-577b4aac2ea2",
          "name": "1H-2-BENZOPYRAN-1-ONE, 3,4-DIHYDRO-8-HYDROXY-3-(4-HYDROXYPHENYL)-",
          "stdName": "1H-2-BENZOPYRAN-1-ONE, 3,4-DIHYDRO-8-HYDROXY-3-(4-HYDROXYPHENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3bda4ae-6b97-42fd-97cd-ccd91c0b8324",
            "c0e2f813-7f9f-40c5-8807-b7613034dd34"
          ],
          "display_name": false
        },
        {
          "uuid": "4d0583e8-d835-44df-bdf5-e463afb28956",
          "name": "3,4-DIHYDRO-8-HYDROXY-3-(4-HYDROXYPHENYL)-1H-2-BENZOPYRAN-1-ONE",
          "stdName": "3,4-DIHYDRO-8-HYDROXY-3-(4-HYDROXYPHENYL)-1H-2-BENZOPYRAN-1-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3bda4ae-6b97-42fd-97cd-ccd91c0b8324",
            "c0e2f813-7f9f-40c5-8807-b7613034dd34"
          ],
          "display_name": false
        },
        {
          "uuid": "b1b06c43-7e82-4f07-ba01-5ce2f039c691",
          "name": "HYDRANGENOL",
          "stdName": "HYDRANGENOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "43b7b269-0de9-4cc9-9ba5-487d3015b7fc",
            "a3bda4ae-6b97-42fd-97cd-ccd91c0b8324"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "4a80b17d-831f-46a6-98bb-2285e10293b0",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "c3fd7707-a4ea-4d96-9333-0d3c72fa6560",
          "name": "ISOCOUMARIN, 3,4-DIHYDRO-8-HYDROXY-3-(P-HYDROXYPHENYL)-",
          "stdName": "ISOCOUMARIN, 3,4-DIHYDRO-8-HYDROXY-3-(P-HYDROXYPHENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3bda4ae-6b97-42fd-97cd-ccd91c0b8324",
            "c0e2f813-7f9f-40c5-8807-b7613034dd34"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c0e2f813-7f9f-40c5-8807-b7613034dd34",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a3bda4ae-6b97-42fd-97cd-ccd91c0b8324",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "43b7b269-0de9-4cc9-9ba5-487d3015b7fc",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "52b2337a-9fe8-44eb-907b-f4664d26496a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393624000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a263f856-4c47-41cb-93da-257ece43528d",
          "citation": "SRS import [TL8PI7PHV1]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=TL8PI7PHV1",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393624000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fcbe0063-139e-be37-071c-ceac1e569ce9",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Hydrangenol",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "30995fda-7586-3f40-c6e0-17f3c13b1e11",
          "citation": "PCPC",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true
        },
        {
          "uuid": "579a70c6-749d-40f3-baf1-f5a150350069",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ce9eee97-c516-43ab-a9f2-cca24df02003",
          "id": "ce9eee97-c516-43ab-a9f2-cca24df02003",
          "molfile": "\n  Marvin  01132110402D          \n\n 19 21  0  0  0  0            999 V2000\n   11.6830   -2.9535    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9685   -3.3660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9685   -4.1910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2541   -4.6035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5396   -4.1910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5396   -3.3660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2541   -2.9535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8251   -4.6035    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    8.1106   -4.1910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3962   -4.6035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6817   -4.1910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9672   -4.6035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9672   -5.4285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6817   -5.8410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6817   -6.6660    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3962   -5.4285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1106   -5.8410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1106   -6.6660    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8251   -5.4285    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  7  2  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  8  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n 19  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 16 10  2  0  0  0  0\n 11 12  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 14  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 17 19  1  0  0  0  0\nM  END",
          "smiles": "c1cc2CC(c3ccc(cc3)O)OC(=O)c2c(c1)O",
          "formula": "C15H12O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ad78fbda-22de-4707-b7a7-1c59a9e11bad"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "256.2539",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ccbbb15d-d670-436d-9a52-133c8e743467",
      "version": "7",
      "structure": {
        "id": "c13d6f86-668c-4421-a0ac-2b6fb52db13d",
        "molfile": "\n  Marvin  01132109592D          \n\n 19 21  0  0  0  0            999 V2000\n    8.1106   -6.6660    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1106   -5.8410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8251   -5.4285    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8251   -4.6035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5396   -4.1910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2541   -4.6035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9685   -4.1910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9685   -3.3660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6830   -2.9535    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2541   -2.9535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5396   -3.3660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1106   -4.1910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3962   -4.6035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6817   -4.1910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9672   -4.6035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9672   -5.4285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6817   -5.8410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6817   -6.6660    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3962   -5.4285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  8  2  0  0  0  0\n 11 10  1  0  0  0  0\n  5 11  2  0  0  0  0\n  4 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 17  2  0  0  0  0\n 19 13  1  0  0  0  0\n  2 19  1  0  0  0  0\nM  END",
        "smiles": "c1cc2CC(c3ccc(cc3)O)OC(=O)c2c(c1)O",
        "formula": "C15H12O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "256.2539",
        "optical_activity": "( + / - )",
        "references": [
          "43b7b269-0de9-4cc9-9ba5-487d3015b7fc",
          "a263f856-4c47-41cb-93da-257ece43528d"
        ],
        "stereo_centers": 1
      },
      "unii": "TL8PI7PHV1"
    }
  ]
}