{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "60b0a520-0ed2-4616-b7d9-18e04c09978e",
          "code": "116-29-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=116-29-0",
          "code_system": "CAS",
          "references": [
            "a3f5a054-d3e9-4945-93a9-6c0d1b2e4d14",
            "d8909a9e-762f-4297-bcb5-722155fb8928"
          ]
        },
        {
          "uuid": "31510227-8e24-4f8e-a4c0-0edd59b3f790",
          "code": "TETRADIFON",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Tetradifon",
          "code_system": "WIKIPEDIA",
          "references": [
            "a3f5a054-d3e9-4945-93a9-6c0d1b2e4d14"
          ]
        },
        {
          "uuid": "e36395de-725c-4bda-abac-2815bd286fb6",
          "code": "79202",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:4015",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "a3f5a054-d3e9-4945-93a9-6c0d1b2e4d14"
          ]
        },
        {
          "uuid": "a091d222-34fc-46ed-8be7-b07310a8713b",
          "code": "m10613",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10613?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "a3f5a054-d3e9-4945-93a9-6c0d1b2e4d14"
          ]
        },
        {
          "uuid": "52f3d77b-c99d-4317-864f-88d52f77565c",
          "code": "204-134-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.003.759",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a3f5a054-d3e9-4945-93a9-6c0d1b2e4d14"
          ]
        },
        {
          "uuid": "d4b1b373-0d83-498f-bf7b-3b1c92a9bcbf",
          "code": "8305",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/8305",
          "code_system": "PUBCHEM",
          "references": [
            "a3f5a054-d3e9-4945-93a9-6c0d1b2e4d14"
          ]
        },
        {
          "uuid": "018f8a5b-386c-409b-b2df-86d46ef8a178",
          "code": "C005807",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67005807",
          "code_system": "MESH",
          "references": [
            "a3f5a054-d3e9-4945-93a9-6c0d1b2e4d14"
          ]
        },
        {
          "uuid": "17450eff-f0d6-838e-c4b3-1844f4a700b3",
          "code": "1773",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/1773",
          "code_system": "HSDB",
          "references": [
            "ce834cd9-6e04-b510-3da3-5dfffa90a1f7"
          ]
        },
        {
          "uuid": "135e6341-2a0a-afe7-0492-310c7366d1d1",
          "code": "DTXSID7021316",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7021316",
          "code_system": "EPA CompTox",
          "references": [
            "edfaa16c-51d5-c1f7-6153-d8733db1437d"
          ]
        },
        {
          "uuid": "573bcd71-8022-4a77-82da-19934b5860d0",
          "code": "TIP8EA8VTS",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ebe1cb6e-cae1-a2b1-d25c-0bb8636185f1",
          "code": "39330",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:39330",
          "code_system": "CHEBI",
          "references": [
            "a04dddda-a980-c5aa-e03a-b79dd6d8155f"
          ]
        },
        {
          "uuid": "8c91a62b-03f4-9c8d-4cc3-baf8eba2db20",
          "code": "tetradifon",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/tetradifon.html",
          "code_system": "ALANWOOD",
          "references": [
            "1cdab0ed-3d5e-6c86-0025-a0801dd703b9"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ac95674f-8450-4d22-a375-9ea2f7a3eb70",
          "name": "1,2,4-TRICHLORO-5-((4-CHLOROPHENYL)SULFONYL)BENZENE",
          "stdName": "1,2,4-TRICHLORO-5-((4-CHLOROPHENYL)SULFONYL)BENZENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "86033f3c-f224-4184-988e-b6c8febdba3d",
            "94e055ec-0172-4e8d-a849-a2a74d70698d"
          ],
          "display_name": false
        },
        {
          "uuid": "be2e31c7-ce21-47f7-8ec3-2ff7017d6203",
          "name": "4-CHLOROPHENYL 2,4,5-TRICHLOROPHENYL SULFONE",
          "stdName": "4-CHLOROPHENYL 2,4,5-TRICHLOROPHENYL SULFONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "86033f3c-f224-4184-988e-b6c8febdba3d",
            "e55d5389-38fd-4f0f-a5fc-63cd0c356066"
          ],
          "display_name": false
        },
        {
          "uuid": "7cf66f52-fd6d-4316-85cc-6fd59b14a185",
          "name": "TETRADIFON",
          "stdName": "TETRADIFON",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "920fc80f-fe91-48c5-9cef-82287e5925c4",
            "26cec47d-cbc8-4ced-a5b7-072276d8db66",
            "a47c9e8f-9dd3-4feb-b581-2a1828f00fe1",
            "27b3fd62-0942-419a-9719-0282a01159e1",
            "f2d1f252-edb8-4092-ac6a-42893f85b1e1",
            "fd775d53-f981-480d-83f9-bcac1b5a1efd",
            "a2ebd61e-1a77-4ba9-ac46-3a918abf890f",
            "4d9f20df-69c4-49c9-8d0c-156c871416c1"
          ],
          "display_name": true
        },
        {
          "uuid": "7006f8c9-3ff2-46db-959c-4cc62ca7899a",
          "name": "TETRADIFON [HSDB]",
          "stdName": "TETRADIFON [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a47c9e8f-9dd3-4feb-b581-2a1828f00fe1",
            "27b3fd62-0942-419a-9719-0282a01159e1"
          ],
          "display_name": false
        },
        {
          "uuid": "0cf51768-6fd8-43b8-b274-9e9dacd92696",
          "name": "TETRADIFON [ISO]",
          "stdName": "TETRADIFON [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "27b3fd62-0942-419a-9719-0282a01159e1",
            "4d9f20df-69c4-49c9-8d0c-156c871416c1"
          ],
          "display_name": false
        },
        {
          "uuid": "95ca7153-bf33-4000-90e1-e96b917dfea9",
          "name": "TETRADIFON [MI]",
          "stdName": "TETRADIFON [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "27b3fd62-0942-419a-9719-0282a01159e1",
            "fd775d53-f981-480d-83f9-bcac1b5a1efd"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "26cec47d-cbc8-4ced-a5b7-072276d8db66",
          "citation": "http://www.alanwood.net/pesticides/tetradifon.html",
          "url": "http://www.alanwood.net/pesticides/tetradifon.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "27b3fd62-0942-419a-9719-0282a01159e1",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "86033f3c-f224-4184-988e-b6c8febdba3d",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e55d5389-38fd-4f0f-a5fc-63cd0c356066",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "94e055ec-0172-4e8d-a849-a2a74d70698d",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fd775d53-f981-480d-83f9-bcac1b5a1efd",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a47c9e8f-9dd3-4feb-b581-2a1828f00fe1",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4d9f20df-69c4-49c9-8d0c-156c871416c1",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a3f5a054-d3e9-4945-93a9-6c0d1b2e4d14",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389702000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "62dd9991-cf12-44ef-b751-4cf3591befcf",
          "citation": "SRS import [TIP8EA8VTS]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=TIP8EA8VTS",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389702000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f2d1f252-edb8-4092-ac6a-42893f85b1e1",
          "citation": "TETRADIFON [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a2ebd61e-1a77-4ba9-ac46-3a918abf890f",
          "citation": "TETRADIFON [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "920fc80f-fe91-48c5-9cef-82287e5925c4",
          "citation": "TETRADIFON [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ce834cd9-6e04-b510-3da3-5dfffa90a1f7",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+116-29-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "edfaa16c-51d5-c1f7-6153-d8733db1437d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=116-29-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1cdab0ed-3d5e-6c86-0025-a0801dd703b9",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "a04dddda-a980-c5aa-e03a-b79dd6d8155f",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "d8909a9e-762f-4297-bcb5-722155fb8928",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "13034e12-42e2-4330-812a-6a39fd9c913f",
          "id": "13034e12-42e2-4330-812a-6a39fd9c913f",
          "molfile": "\n  Marvin  01132101122D          \n\n 19 20  0  0  0  0            999 V2000\n    0.0000   -0.6901    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.6591   -1.1782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5661   -1.9950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2273   -2.4856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9846   -2.1630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0803   -1.3436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4212   -0.8525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6614   -2.6510    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2120   -3.2507    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1010   -3.2662    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2895   -2.1475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1732   -1.3281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8246   -0.8060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6979    0.0000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.5918   -1.1161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2405   -0.5997    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.7081   -1.9330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0645   -2.4443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1859   -3.2636    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  7  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  2  0  0  0  0\n  5  8  1  0  0  0  0\n  7  6  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  8  2  0  0  0  0\n 11  8  1  0  0  0  0\n 12 11  1  0  0  0  0\n 18 11  2  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 13 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 15 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 19 18  1  0  0  0  0\nM  END",
          "smiles": "c1cc(ccc1Cl)S(=O)(=O)c2cc(c(cc2Cl)Cl)Cl",
          "formula": "C12H6Cl4O2S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c962ecf0-14d9-4f8f-9352-70cbaee5852f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "356.0531",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e264b5dc-de89-4d01-aba7-702c217f185b",
      "version": "6",
      "structure": {
        "id": "7e548e3a-7989-4e20-abb0-b234c4bd0502",
        "molfile": "\n  Marvin  01132106342D          \n\n 19 20  0  0  0  0            999 V2000\n    2.6616   -2.6512    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2897   -2.1476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1734   -1.3282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0648   -2.4445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7084   -1.9331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8248   -0.8061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9847   -2.1631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5921   -1.1162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2122   -3.2509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1011   -3.2664    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2274   -2.4858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0804   -1.3437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1862   -3.2638    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.6981    0.0000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.2408   -0.5997    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.6591   -1.1783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5661   -1.9951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4213   -0.8526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.6901    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  3  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  5  1  0  0  0  0\n  9  1  2  0  0  0  0\n 10  1  2  0  0  0  0\n 11  7  2  0  0  0  0\n 12  7  1  0  0  0  0\n 13  4  1  0  0  0  0\n 14  6  1  0  0  0  0\n 15  8  1  0  0  0  0\n 16 18  1  0  0  0  0\n 17 11  1  0  0  0  0\n 18 12  2  0  0  0  0\n 19 16  1  0  0  0  0\n 17 16  2  0  0  0  0\n  6  8  2  0  0  0  0\nM  END",
        "smiles": "c1cc(ccc1Cl)S(=O)(=O)c2cc(c(cc2Cl)Cl)Cl",
        "formula": "C12H6Cl4O2S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "356.0531",
        "optical_activity": "NONE",
        "references": [
          "26cec47d-cbc8-4ced-a5b7-072276d8db66",
          "62dd9991-cf12-44ef-b751-4cf3591befcf"
        ],
        "stereo_centers": 0
      },
      "unii": "TIP8EA8VTS"
    }
  ]
}