{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d7f07cc4-cc6f-4237-a0bf-37d3e78d8fba",
          "code": "18604-50-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=18604-50-7",
          "code_system": "CAS",
          "references": [
            "4b2a9bc0-b52c-47f1-af91-2de2b98eab96",
            "50b9907e-7fd7-49e8-ab4b-f7660ed80aa4"
          ]
        },
        {
          "uuid": "ad4b84ed-07fe-43f1-a46d-ca8302d035dd",
          "code": "3084296",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3084296",
          "code_system": "PUBCHEM",
          "references": [
            "4b2a9bc0-b52c-47f1-af91-2de2b98eab96"
          ]
        },
        {
          "uuid": "d16496b7-a10e-d3fd-54f6-df0e4bff0db8",
          "code": "DTXSID201318555",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID201318555",
          "code_system": "EPA CompTox",
          "references": [
            "467c3acc-5fb5-ac6c-1780-83741849aea8"
          ]
        },
        {
          "uuid": "e9b7f457-b776-43fe-92f5-04ade5c3ecaa",
          "code": "TF6DX3Y0J8",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c71df780-ccb3-457e-91d2-445dd9f440f7",
          "name": ".BETA.-D-GLUCOPYRANOSIDE, 2-METHOXY-4-(2-PROPENYL)PHENYL",
          "stdName": ".BETA.-D-GLUCOPYRANOSIDE, 2-METHOXY-4-(2-PROPENYL)PHENYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cce3246c-b566-4dcb-9c5f-564256e4c3ea",
            "2dea138c-e595-47fa-99fa-142288596264"
          ],
          "display_name": false
        },
        {
          "uuid": "e9f1638e-b167-44f7-9d8c-ad3eefb051d4",
          "name": "EUGENYL .BETA.-D-GLUCOPYRANOSIDEPHENYL",
          "stdName": "EUGENYL .BETA.-D-GLUCOPYRANOSIDEPHENYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "271bbdd1-0dde-4009-b8b1-488bcb63edc9",
            "cce3246c-b566-4dcb-9c5f-564256e4c3ea"
          ],
          "display_name": false
        },
        {
          "uuid": "bcb63b7a-461d-44a8-ba05-91f78bcd48c0",
          "name": "EUGENYL GLUCOSIDE",
          "stdName": "EUGENYL GLUCOSIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cce3246c-b566-4dcb-9c5f-564256e4c3ea",
            "78a7a396-22e0-4bfe-ad11-1815782db9ff",
            "2dea138c-e595-47fa-99fa-142288596264"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "d3c13031-3e2f-419c-96af-da4a0b76daae",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "a98d7ef1-f62a-4c8c-8685-36c87f92dc38",
          "name": "EUGENYL GLUCOSIDE TH",
          "stdName": "EUGENYL GLUCOSIDE TH",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cce3246c-b566-4dcb-9c5f-564256e4c3ea",
            "2dea138c-e595-47fa-99fa-142288596264"
          ],
          "display_name": false
        },
        {
          "uuid": "8c30d493-624b-4f93-af2e-0971b8ffd091",
          "name": "EUGENYL O-.BETA.-D-GLUCOPYRANOSIDE",
          "stdName": "EUGENYL O-.BETA.-D-GLUCOPYRANOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "271bbdd1-0dde-4009-b8b1-488bcb63edc9",
            "cce3246c-b566-4dcb-9c5f-564256e4c3ea"
          ],
          "display_name": false
        },
        {
          "uuid": "10a470b2-915c-47b2-bb0b-54d0223acd2d",
          "name": "GLUCOPYRANOSIDE, 4-ALLYL-2-METHOXYPHENYL, .BETA.-D-",
          "stdName": "GLUCOPYRANOSIDE, 4-ALLYL-2-METHOXYPHENYL, .BETA.-D-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "271bbdd1-0dde-4009-b8b1-488bcb63edc9",
            "cce3246c-b566-4dcb-9c5f-564256e4c3ea"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2dea138c-e595-47fa-99fa-142288596264",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "cce3246c-b566-4dcb-9c5f-564256e4c3ea",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "271bbdd1-0dde-4009-b8b1-488bcb63edc9",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4b2a9bc0-b52c-47f1-af91-2de2b98eab96",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391501000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "987f3e8e-3a50-4919-a6aa-5d2aebe1b050",
          "citation": "SRS import [TF6DX3Y0J8]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=TF6DX3Y0J8",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391501000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "78a7a396-22e0-4bfe-ad11-1815782db9ff",
          "citation": "EUGENYL GLUCOSIDE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "50b9907e-7fd7-49e8-ab4b-f7660ed80aa4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "467c3acc-5fb5-ac6c-1780-83741849aea8",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5a267a94-e8ae-4aac-a464-23710c56379f",
          "id": "5a267a94-e8ae-4aac-a464-23710c56379f",
          "molfile": "\n  Marvin  01132104402D          \n\n 23 24  0  0  1  0            999 V2000\n    6.4564   -7.0764    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.4564   -6.2514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7419   -5.8388    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1709   -7.4889    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1709   -8.3139    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.8853   -8.7264    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5402   -8.4400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5402   -7.6115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2548   -7.1992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9667   -7.6111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6791   -7.1998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6791   -6.3773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3914   -5.9660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9667   -8.4364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2566   -8.8482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2566   -9.6691    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9675  -10.0796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4564   -8.7264    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.4564   -9.5514    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7419   -8.3139    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.0275   -8.7264    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7419   -7.4889    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.0275   -7.0764    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  4  1  0  0  0  0\n 22  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n 18  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7 15  2  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 14 10  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 19  1  6  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  1  0  0  0\n 20 22  1  0  0  0  0\n 22 23  1  6  0  0  0\nM  END",
          "smiles": "C=CCc1ccc(c(c1)OC)O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O",
          "formula": "C16H22O7",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c3c994ba-a63b-42f9-8547-45a5549570a0"
          },
          "defined_stereo": 5,
          "ez_centers": 0,
          "molecular_weight": "326.3423",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2036919e-68f7-446a-b32c-3faedd2d0055",
      "version": "4",
      "structure": {
        "id": "ea0ef715-56dc-4f73-8f21-3018537af44a",
        "molfile": "\n  Marvin  01132112062D          \n\n 23 24  0  0  1  0            999 V2000\n    8.5402   -7.6115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2548   -7.1992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9667   -7.6111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6791   -7.1998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6791   -6.3773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3914   -5.9660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9667   -8.4364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2566   -8.8482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2566   -9.6691    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9675  -10.0796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5402   -8.4400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8853   -8.7264    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1709   -8.3139    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.4564   -8.7264    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.4564   -9.5514    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7419   -8.3139    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.0275   -8.7264    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7419   -7.4889    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.0275   -7.0764    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4564   -7.0764    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.4564   -6.2514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7419   -5.8388    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1709   -7.4889    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  7  3  2  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11  8  2  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  1  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  6  0  0  0\n 16 14  1  0  0  0  0\n 16 17  1  1  0  0  0\n 18 16  1  0  0  0  0\n 18 19  1  6  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  1  0  0  0\n 21 22  1  0  0  0  0\n 23 20  1  0  0  0  0\n 13 23  1  0  0  0  0\n  1 11  1  0  0  0  0\nM  END",
        "smiles": "C=CCc1ccc(c(c1)OC)O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O",
        "formula": "C16H22O7",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 5,
        "ez_centers": 0,
        "molecular_weight": "326.3423",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "271bbdd1-0dde-4009-b8b1-488bcb63edc9",
          "987f3e8e-3a50-4919-a6aa-5d2aebe1b050"
        ],
        "stereo_centers": 5
      },
      "unii": "TF6DX3Y0J8"
    }
  ]
}