{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6ea9455c-f47f-4987-9f17-17e71338154d",
          "code": "R03DC02",
          "comments": "ATC|RESPIRATORY SYSTEM|DRUGS FOR OBSTRUCTIVE AIRWAY DISEASES|OTHER SYSTEMIC DRUGS FOR OBSTRUCTIVE AIRWAY DISEASES|Leukotriene receptor antagonists|pranlukast",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=R03DC02&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "d82e06a9-f57d-40b6-afcb-2e7fdb8fad3b"
          ]
        },
        {
          "uuid": "207b61a8-d609-4533-98f5-e89664283528",
          "code": "QR03DC02",
          "comments": "VATC|DRUGS FOR OBSTRUCTIVE AIRWAY DISEASES|OTHER SYSTEMIC DRUGS FOR OBSTRUCTIVE AIRWAY DISEASES|Leukotriene receptor antagonists|pranlukast",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QR03DC02&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "d82e06a9-f57d-40b6-afcb-2e7fdb8fad3b"
          ]
        },
        {
          "uuid": "d826d9ce-0f07-4412-9066-6c77e2a74908",
          "code": "103177-37-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=103177-37-3",
          "code_system": "CAS",
          "references": [
            "d82e06a9-f57d-40b6-afcb-2e7fdb8fad3b",
            "aafa1c3c-0e9a-488c-95f3-51a84448400a"
          ]
        },
        {
          "uuid": "9ba660ff-5991-4cda-9ac3-c19d2ea07fb9",
          "code": "C96712",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C96712",
          "code_system": "NCI_THESAURUS",
          "references": [
            "d82e06a9-f57d-40b6-afcb-2e7fdb8fad3b"
          ]
        },
        {
          "uuid": "a9f0a38e-250d-4c2d-ba3b-9558a81a974b",
          "code": "C047681",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67047681",
          "code_system": "MESH",
          "references": [
            "d82e06a9-f57d-40b6-afcb-2e7fdb8fad3b"
          ]
        },
        {
          "uuid": "78e855c1-d83e-4643-a360-b304b4b8bb3c",
          "code": "PRANLUKAST",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Pranlukast",
          "code_system": "WIKIPEDIA",
          "references": [
            "d82e06a9-f57d-40b6-afcb-2e7fdb8fad3b"
          ]
        },
        {
          "uuid": "955a7cdc-8107-48e6-9594-16bcd8f26bc1",
          "code": "6943",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=6943",
          "code_system": "INN",
          "references": [
            "d82e06a9-f57d-40b6-afcb-2e7fdb8fad3b"
          ]
        },
        {
          "uuid": "bf909ece-c121-4c7f-a6cf-3edaae899377",
          "code": "3634",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=3634",
          "code_system": "IUPHAR",
          "references": [
            "d82e06a9-f57d-40b6-afcb-2e7fdb8fad3b"
          ]
        },
        {
          "uuid": "32056241-4725-4904-97f1-9c4475ae9184",
          "code": "m9100",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9100?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "d82e06a9-f57d-40b6-afcb-2e7fdb8fad3b"
          ]
        },
        {
          "uuid": "caf33b3c-7a20-445a-9a9a-6412b69c150b",
          "code": "DB01411",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB01411",
          "code_system": "DRUG BANK",
          "references": [
            "d82e06a9-f57d-40b6-afcb-2e7fdb8fad3b"
          ]
        },
        {
          "uuid": "a5ad27ac-992b-4c1d-a31c-a5152c7c7c3e",
          "code": "SUB09998MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "d82e06a9-f57d-40b6-afcb-2e7fdb8fad3b"
          ]
        },
        {
          "uuid": "2ce56773-e730-47c7-804b-6ffba1d711b1",
          "code": "CHEMBL21333",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL21333",
          "code_system": "ChEMBL",
          "references": [
            "d82e06a9-f57d-40b6-afcb-2e7fdb8fad3b"
          ]
        },
        {
          "uuid": "6fa6c32f-6265-4c82-b847-5490874f441c",
          "code": "4887",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/4887",
          "code_system": "PUBCHEM",
          "references": [
            "d82e06a9-f57d-40b6-afcb-2e7fdb8fad3b"
          ]
        },
        {
          "uuid": "4331df48-f462-0b1c-66a2-93d933f140bf",
          "code": "DTXSID3043782",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3043782",
          "code_system": "EPA CompTox",
          "references": [
            "72e676cd-836f-7c64-9728-564e0684f452"
          ]
        },
        {
          "uuid": "4de9e6cb-d976-8d32-b7d3-92fcd69852f5",
          "code": "C29712",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Respiratory System[C78273]|Anti-asthmatic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29712",
          "code_system": "NCI_THESAURUS",
          "references": [
            "d44de3e5-9dd1-d585-00b3-49727effa636"
          ]
        },
        {
          "uuid": "1010a817-73e5-42a6-ab18-234619cad860",
          "code": "TB8Z891092",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8bdd74a5-c1e9-91ec-c926-7e2d042f1705",
          "code": "2237",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2237",
          "code_system": "DRUG CENTRAL",
          "references": [
            "d44de3e5-9dd1-d585-00b3-49727effa636"
          ]
        },
        {
          "uuid": "7b12e8f2-6e2f-0dcb-e20f-822ac6d9ea04",
          "code": "100000091523",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "c32a363d-b752-afba-baad-eee755c5b441"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "20826961-0eca-46b0-9171-f61ac3c514af",
          "amount": {
            "uuid": "d209d0bc-f489-4f0d-82fe-16e8b7824777"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "4c25785c-7362-4d5f-8721-962b6fc825a8",
            "refuuid": "0560839f-ce28-4d7a-9d6c-a06f7fa876d2",
            "name": "PRANLUKAST",
            "unii": "TB8Z891092",
            "linking_id": "TB8Z891092",
            "ref_pname": "PRANLUKAST",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b35efbda-d835-4a29-9608-518d2b2c904f",
          "amount": {
            "uuid": "357234cb-d3d7-4a31-9aa8-edebe634ba7a"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "b6d04fdf-6da3-47d6-a434-5825e13174fc",
            "refuuid": "a2dba13c-2a50-42f1-9638-1d2049a38717",
            "name": "PRANLUKAST HEMIHYDRATE",
            "unii": "FR702N558K",
            "linking_id": "FR702N558K",
            "ref_pname": "PRANLUKAST HEMIHYDRATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "16b0a981-089e-4ac0-a4dd-94b1a5bf29e1",
          "amount": {
            "uuid": "d77f3ccb-44c4-4534-9a4f-e266d83b9cc4"
          },
          "type": "TARGET->INHIBITOR",
          "references": [
            "52062de8-26ae-bfdc-3769-d19089ceb1c9"
          ],
          "related_substance": {
            "uuid": "0a8d9be8-5500-4639-a385-8eee8ed8aa9a",
            "refuuid": "efed9e06-ad0e-4c4e-b273-8e3ca01abfae",
            "name": "CYSTEINYL LEUKOTRIENE RECEPTOR 1",
            "unii": "LRF7RW46ID",
            "linking_id": "LRF7RW46ID",
            "ref_pname": "CYSTEINYL LEUKOTRIENE RECEPTOR 1",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "22ec9a98-6da2-b828-d198-9a4f667ad554",
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "aafa1c3c-0e9a-488c-95f3-51a84448400a"
          ],
          "related_substance": {
            "uuid": "3deb068e-b9bf-466f-8cc5-dd17831671b1",
            "refuuid": "a2dba13c-2a50-42f1-9638-1d2049a38717",
            "name": "PRANLUKAST HEMIHYDRATE",
            "unii": "FR702N558K",
            "linking_id": "FR702N558K",
            "ref_pname": "PRANLUKAST HEMIHYDRATE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d66ceb68-aed6-4d81-b5dd-dd9b2d571d6e",
          "name": "AZLAIRE",
          "stdName": "AZLAIRE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "173dd5a9-3a91-4815-8609-f9326a5cb961",
            "98b8c3a5-57ff-4520-aaa8-3706583ba58c"
          ],
          "display_name": false
        },
        {
          "uuid": "9faaaf57-6909-45d0-b90f-961ba9b0db33",
          "name": "BENZAMIDE, N-(4-OXO-2-(2H-TETRAZOL-5-YL)-4H-1-BENZOPYRAN-8-YL)-4-(4-PHENYLBUTOXY)-",
          "stdName": "BENZAMIDE, N-(4-OXO-2-(2H-TETRAZOL-5-YL)-4H-1-BENZOPYRAN-8-YL)-4-(4-PHENYLBUTOXY)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd173dba-22a5-4be5-bd13-30f0c7a2d6b9"
          ],
          "display_name": false
        },
        {
          "uuid": "f5c0acbb-fbed-4672-82b3-0887979ec5c9",
          "name": "CCN 00401",
          "stdName": "CCN 00401",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd173dba-22a5-4be5-bd13-30f0c7a2d6b9"
          ],
          "display_name": false
        },
        {
          "uuid": "db058e80-f9e8-455b-af84-6bc9a103ecf7",
          "name": "CCN-00401",
          "stdName": "CCN-00401",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ce5ccc3e-add4-4c7a-9608-877b83c67f6d"
          ],
          "display_name": false
        },
        {
          "uuid": "f6140f7c-d2e9-443a-aa11-00be7c4a2bb0",
          "name": "N-(4-OXO-2-(1H-TETRAZOL-5-YL)-4H-1-BENZOPYRAN-8-YL)-P-(4-PHENYLBUTOXY)BENZAMIDE",
          "stdName": "N-(4-OXO-2-(1H-TETRAZOL-5-YL)-4H-1-BENZOPYRAN-8-YL)-P-(4-PHENYLBUTOXY)BENZAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3e91cb36-1c68-49df-8030-a4f398a75fa0"
          ],
          "display_name": false
        },
        {
          "uuid": "ad1eb1a1-9c3c-48a2-b935-7c455a168cbe",
          "name": "ONO 1078",
          "stdName": "ONO 1078",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd173dba-22a5-4be5-bd13-30f0c7a2d6b9"
          ],
          "display_name": false
        },
        {
          "uuid": "4ebbfdeb-fb74-459e-92d5-78590eeb5f9b",
          "name": "ONO-1078",
          "stdName": "ONO-1078",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3e91cb36-1c68-49df-8030-a4f398a75fa0"
          ],
          "display_name": false
        },
        {
          "uuid": "e7b033e3-e7bb-43e5-9be1-91af1428cffd",
          "name": "ONON",
          "stdName": "ONON",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd173dba-22a5-4be5-bd13-30f0c7a2d6b9"
          ],
          "display_name": false
        },
        {
          "uuid": "97b53c5d-db37-4487-9b8d-6553f645bf9b",
          "name": "PRANLUKAST",
          "stdName": "PRANLUKAST",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b2912cba-d245-42c9-942a-12c975179a48",
            "c24bf20a-aa38-4c78-a7a4-a6105b7fcd53",
            "a102802a-658c-4293-900f-d22bee972324",
            "d76575ff-2607-4ace-baf4-7fe3962ecdc8",
            "3e91cb36-1c68-49df-8030-a4f398a75fa0",
            "02cc7578-0fd9-4ca3-b4f4-bd8ce2a9b711",
            "e7d0edfb-cf65-48f5-bded-ac3edcd1fb5d",
            "2b815740-bfca-4fca-b7e5-7355af032fad",
            "c3741f92-3fcd-45e8-8ad2-f6d087e15709"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "f099b274-1bba-43c8-8ab5-42af7c90eabe",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "19d0f381-4e23-4d96-81c9-e0616a15d7b5",
          "name": "PRANLUKAST [MART.]",
          "stdName": "PRANLUKAST [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b2912cba-d245-42c9-942a-12c975179a48"
          ],
          "display_name": false
        },
        {
          "uuid": "ab603b11-3f05-4ed3-accb-527ff3ffdeeb",
          "name": "PRANLUKAST [MI]",
          "stdName": "PRANLUKAST [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a102802a-658c-4293-900f-d22bee972324"
          ],
          "display_name": false
        },
        {
          "uuid": "8adc1017-f086-767c-ef58-7bbbaccff552",
          "name": "Pranlukast [WHO-DD]",
          "stdName": "PRANLUKAST [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1ad1391e-0a5f-fcd1-5308-d4162eb92172"
          ],
          "display_name": false
        },
        {
          "uuid": "81a26e81-7816-4da7-a1cb-a5599a81a4b9",
          "name": "RS 411",
          "stdName": "RS 411",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd173dba-22a5-4be5-bd13-30f0c7a2d6b9"
          ],
          "display_name": false
        },
        {
          "uuid": "4f659f20-8a2f-4313-a97c-14947fe9884a",
          "name": "RS-411",
          "stdName": "RS-411",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ce5ccc3e-add4-4c7a-9608-877b83c67f6d"
          ],
          "display_name": false
        },
        {
          "uuid": "a0f0de5e-f64f-4312-b26a-691aeae981ad",
          "name": "SB 205312",
          "stdName": "SB 205312",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3e91cb36-1c68-49df-8030-a4f398a75fa0"
          ],
          "display_name": false
        },
        {
          "uuid": "5c8e7c45-570d-4bc0-b53a-93735a0b771f",
          "name": "SB-205312",
          "stdName": "SB-205312",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ce5ccc3e-add4-4c7a-9608-877b83c67f6d"
          ],
          "display_name": false
        },
        {
          "uuid": "72fb37c9-c2c1-417e-a014-bc96f9d3c949",
          "name": "pranlukast [INN]",
          "stdName": "PRANLUKAST [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c3741f92-3fcd-45e8-8ad2-f6d087e15709"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ce5ccc3e-add4-4c7a-9608-877b83c67f6d",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3e91cb36-1c68-49df-8030-a4f398a75fa0",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c3741f92-3fcd-45e8-8ad2-f6d087e15709",
          "citation": "INN Proposed List 67",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL67.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b2912cba-d245-42c9-942a-12c975179a48",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "173dd5a9-3a91-4815-8609-f9326a5cb961",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "98b8c3a5-57ff-4520-aaa8-3706583ba58c",
          "citation": "D08408",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cd173dba-22a5-4be5-bd13-30f0c7a2d6b9",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c24bf20a-aa38-4c78-a7a4-a6105b7fcd53",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a102802a-658c-4293-900f-d22bee972324",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d82e06a9-f57d-40b6-afcb-2e7fdb8fad3b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390467000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1e1682b5-3c74-49b4-b020-747e234ce78b",
          "citation": "SRS import [TB8Z891092]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=TB8Z891092",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390467000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2b815740-bfca-4fca-b7e5-7355af032fad",
          "citation": "PRANLUKAST [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "02cc7578-0fd9-4ca3-b4f4-bd8ce2a9b711",
          "citation": "PRANLUKAST [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e7d0edfb-cf65-48f5-bded-ac3edcd1fb5d",
          "citation": "PRANLUKAST [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d76575ff-2607-4ace-baf4-7fe3962ecdc8",
          "citation": "PRANLUKAST [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "52062de8-26ae-bfdc-3769-d19089ceb1c9",
          "citation": "Kim, Ja‐Hyung, et al. \"Prolonged effect of montelukast in asthmatic children with exercise‐induced bronchoconstriction.\" Pediatric pulmonology 39.2 (2005): 162-166.",
          "url": "https://ic.ucsc.edu/~drsmith/metx270/html/Poff%20and%20Balazy%202004.pdf",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "72e676cd-836f-7c64-9728-564e0684f452",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=103177-37-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d44de3e5-9dd1-d585-00b3-49727effa636",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "25363e4a-ec3e-0cff-3086-215c07e38ef1",
          "citation": "USAD COUN",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "aafa1c3c-0e9a-488c-95f3-51a84448400a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "1ad1391e-0a5f-fcd1-5308-d4162eb92172",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "c32a363d-b752-afba-baad-eee755c5b441",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "cb166923-7612-4918-9f59-be14282b54a0",
          "id": "cb166923-7612-4918-9f59-be14282b54a0",
          "molfile": "\n  Marvin  01132110292D          \n\n 36 40  0  0  0  0            999 V2000\n   -0.3456    1.1438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3456    0.2707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5510   -0.1354    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2980    0.2147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2980    1.0411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0123    1.4427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7033    0.9991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7033    0.2101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9796   -0.1915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9796   -0.9898    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6658   -1.4147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3756   -1.0225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3756   -0.2148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0385    0.2847    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6658   -2.2224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0264   -2.6800    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2551   -3.4503    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0674   -3.4503    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3196   -2.6847    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1018   -0.0793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7648    0.3502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5539   -0.0420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5539   -0.8498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2309   -1.2840    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2309   -2.1150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5445   -2.5399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5445   -3.4969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7462   -3.9686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7462   -4.7342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9945   -5.2198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9945   -6.0602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7462   -6.5271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4604   -6.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4604   -5.1544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8068   -1.3353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1018   -0.9198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n 20  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4  9  2  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9  8  1  0  0  0  0\n  8 13  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  2  0  0  0  0\n 11 15  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 16 15  1  0  0  0  0\n 19 15  2  0  0  0  0\n 17 16  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 36 20  2  0  0  0  0\n 22 21  2  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 23 35  2  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  1  0  0  0  0\n 27 26  1  0  0  0  0\n 28 27  1  0  0  0  0\n 29 28  1  0  0  0  0\n 30 29  1  0  0  0  0\n 34 29  2  0  0  0  0\n 31 30  2  0  0  0  0\n 31 32  1  0  0  0  0\n 32 33  2  0  0  0  0\n 33 34  1  0  0  0  0\n 35 36  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)CCCCOc2ccc(cc2)C(=O)Nc3cccc4c(=O)cc(-c5n[nH]nn5)oc43",
          "formula": "C27H23N5O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "37cab81a-f884-4580-b07f-667cbf2517ba"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "481.5036",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0560839f-ce28-4d7a-9d6c-a06f7fa876d2",
      "version": "17",
      "structure": {
        "id": "195fa916-d5b3-481c-8092-984e41cd58ac",
        "molfile": "\n  Marvin  01132101302D          \n\n 36 40  0  0  0  0            999 V2000\n    2.6658   -2.2224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3196   -2.6847    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0674   -3.4503    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2551   -3.4503    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0264   -2.6800    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6658   -1.4147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9796   -0.9898    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9796   -0.1915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7033    0.2101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7033    0.9991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0123    1.4427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2980    1.0411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2980    0.2147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5510   -0.1354    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3456    0.2707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1018   -0.0793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7648    0.3502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5539   -0.0420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5539   -0.8498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8068   -1.3353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1018   -0.9198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2309   -1.2840    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2309   -2.1150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5445   -2.5399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5445   -3.4969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7462   -3.9686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7462   -4.7342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9945   -5.2198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9945   -6.0602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7462   -6.5271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4604   -6.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4604   -5.1544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3456    1.1438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3756   -0.2148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0385    0.2847    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3756   -1.0225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  1  2  0  0  0  0\n  6  1  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 16  1  0  0  0  0\n 22 19  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  1  0  0  0  0\n 27 26  1  0  0  0  0\n 28 27  2  0  0  0  0\n 29 28  1  0  0  0  0\n 29 30  2  0  0  0  0\n 30 31  1  0  0  0  0\n 31 32  2  0  0  0  0\n 32 27  1  0  0  0  0\n 33 15  2  0  0  0  0\n 13  8  1  0  0  0  0\n  9 34  1  0  0  0  0\n 35 34  2  0  0  0  0\n 34 36  1  0  0  0  0\n 36  6  2  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)CCCCOc2ccc(cc2)C(=O)Nc3cccc4c(=O)cc(-c5[nH]nnn5)oc43",
        "formula": "C27H23N5O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "481.5036",
        "optical_activity": "NONE",
        "references": [
          "1e1682b5-3c74-49b4-b020-747e234ce78b",
          "3e91cb36-1c68-49df-8030-a4f398a75fa0",
          "c3741f92-3fcd-45e8-8ad2-f6d087e15709"
        ],
        "stereo_centers": 0
      },
      "unii": "TB8Z891092"
    }
  ]
}