{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c0d55c4e-461b-4a66-9e61-e2d0113cbe19",
          "code": "493-75-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=493-75-4",
          "code_system": "CAS",
          "references": [
            "10640c79-47ea-4f5f-83d2-c82b04438e7c",
            "c0945a5f-f167-4f61-89f4-56b51fd6ef6c"
          ]
        },
        {
          "uuid": "08ad38c4-bfa1-4aec-9685-4e723a5c1917",
          "code": "C83555",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C83555",
          "code_system": "NCI_THESAURUS",
          "references": [
            "10640c79-47ea-4f5f-83d2-c82b04438e7c"
          ]
        },
        {
          "uuid": "e2072b3e-5d01-4799-ae66-f79ef96b7e08",
          "code": "747",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=747",
          "code_system": "INN",
          "references": [
            "10640c79-47ea-4f5f-83d2-c82b04438e7c"
          ]
        },
        {
          "uuid": "865605af-4d0f-429c-87b7-a8fb416d2320",
          "code": "m586",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m586?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "10640c79-47ea-4f5f-83d2-c82b04438e7c"
          ]
        },
        {
          "uuid": "0e53d042-5b9f-4a80-8891-1b2e959edc27",
          "code": "SUB05812MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "10640c79-47ea-4f5f-83d2-c82b04438e7c"
          ]
        },
        {
          "uuid": "54b8b6fc-0800-4a06-8911-c2b396aa2731",
          "code": "CHEMBL1197792",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1197792",
          "code_system": "ChEMBL",
          "references": [
            "10640c79-47ea-4f5f-83d2-c82b04438e7c"
          ]
        },
        {
          "uuid": "da652caf-04d8-479a-ab80-acbdc9730980",
          "code": "10304",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10304",
          "code_system": "PUBCHEM",
          "references": [
            "10640c79-47ea-4f5f-83d2-c82b04438e7c"
          ]
        },
        {
          "uuid": "1ffeeeb9-e48f-e37b-d0a9-f503316b9fe3",
          "code": "DTXSID60197763",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60197763",
          "code_system": "EPA CompTox",
          "references": [
            "4df75cb1-0fcb-b958-4c65-44e419a00202"
          ]
        },
        {
          "uuid": "25bde673-ffa1-4f75-b910-f684bafe31ec",
          "code": "TA5NM093QJ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "500cd2eb-e17f-cdaf-0ea8-d8681865c2da",
          "code": "364",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/364",
          "code_system": "DRUG CENTRAL",
          "references": [
            "da6e566a-1121-bd53-7a74-4bd509833cb0"
          ]
        },
        {
          "uuid": "133b86f5-5000-b504-a4af-81c59a82644a",
          "code": "100000085895",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "ce547988-ff05-5a9d-b13d-9c60704699e7"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "f44b06b8-4740-490c-8a84-49e97d1230be",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "540ec4df-110d-443a-9d7a-18ab22f48e9e",
            "refuuid": "a3f1994d-af05-4c5c-aa74-5dd2e10f45b9",
            "name": "BIALAMICOL",
            "unii": "TA5NM093QJ",
            "linking_id": "TA5NM093QJ",
            "ref_pname": "BIALAMICOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b8ba5743-5ea1-4479-b577-07d959e929c5",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "0314ec27-304e-496a-bff3-936e6d39beeb",
            "refuuid": "a627026c-4205-4011-b7e7-ade8467fed37",
            "name": "BIALAMICOL HYDROCHLORIDE",
            "unii": "VIQ3X36S8C",
            "linking_id": "VIQ3X36S8C",
            "ref_pname": "BIALAMICOL HYDROCHLORIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "aeca99d0-4950-4025-8ebc-6e1cbc3dba52",
          "name": "(1,1'-BIPHENYL)-4,4'-DIOL, 3,3'-BIS((DIETHYLAMINO)METHY)-5,5'-DI-2-PROPENYL",
          "stdName": "(1,1'-BIPHENYL)-4,4'-DIOL, 3,3'-BIS((DIETHYLAMINO)METHY)-5,5'-DI-2-PROPENYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "34e6fdf9-d481-4748-818f-c61bff0f2962",
            "eb3b2c22-3364-451d-a420-85d786ec4c70"
          ],
          "display_name": false
        },
        {
          "uuid": "c599a4f6-67d2-4fb6-af56-a13a722ad14d",
          "name": "3,3'-BIS((DIETHYLAMINO)METHYL)-5,5'-DI-2-PROPENYL-(1,1'-BIPHENYL)-4,4'-DIOL",
          "stdName": "3,3'-BIS((DIETHYLAMINO)METHYL)-5,5'-DI-2-PROPENYL-(1,1'-BIPHENYL)-4,4'-DIOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0b9a15d1-1cd0-49c6-925f-0370bfc144ac",
            "eb3b2c22-3364-451d-a420-85d786ec4c70"
          ],
          "display_name": false
        },
        {
          "uuid": "ea158cd7-1a99-4ca5-afd0-7e412781f202",
          "name": "5,5'-DIALLYL-.ALPHA.,.ALPHA.'-BIS(DIETHYLAMINO)-M,M'-BITOLYL-4,4'-DIOL",
          "stdName": "5,5'-DIALLYL-.ALPHA.,.ALPHA.'-BIS(DIETHYLAMINO)-M,M'-BITOLYL-4,4'-DIOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f3b50bd7-feb3-4d24-a200-1316bfb4b475",
            "eb3b2c22-3364-451d-a420-85d786ec4c70"
          ],
          "display_name": false
        },
        {
          "uuid": "3d9a7bd5-36e5-49af-8de3-63c87df8e572",
          "name": "6,6'-DIALLYL-.ALPHA.,.ALPHA.'-BIS(DIETHYLAMINO)-4,4'-BI-O-CRESOL",
          "stdName": "6,6'-DIALLYL-.ALPHA.,.ALPHA.'-BIS(DIETHYLAMINO)-4,4'-BI-O-CRESOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0b9a15d1-1cd0-49c6-925f-0370bfc144ac",
            "eb3b2c22-3364-451d-a420-85d786ec4c70"
          ],
          "display_name": false
        },
        {
          "uuid": "6184860a-cb15-42b8-b6d8-f1b2406d273f",
          "name": "BIALAMICOL",
          "stdName": "BIALAMICOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "394e76ff-debf-4682-b8c3-06444df47d93",
            "e6a77e2b-fc9d-4b6f-81a5-c47821e856b3",
            "b3180a3f-0a72-45eb-b99d-fe84d092b110",
            "edf4ffdc-87b3-427b-826e-feccf8bde6f8",
            "f3b50bd7-feb3-4d24-a200-1316bfb4b475",
            "d3e65f90-3838-4fd2-b267-31804ea925a6",
            "eb3b2c22-3364-451d-a420-85d786ec4c70",
            "4ac6cb2e-9a3b-41b5-88f9-337aeceed476"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "3f161cac-23fc-435c-ab0b-04ab15a94574",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "34099789-d924-4c58-af14-05ff82c7d4ff",
          "name": "BIALAMICOL [MI]",
          "stdName": "BIALAMICOL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e6a77e2b-fc9d-4b6f-81a5-c47821e856b3",
            "eb3b2c22-3364-451d-a420-85d786ec4c70"
          ],
          "display_name": false
        },
        {
          "uuid": "9f3993f2-6c58-4b72-9525-02fc1a985e4b",
          "name": "BIALLYLAMICOL",
          "stdName": "BIALLYLAMICOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0b9a15d1-1cd0-49c6-925f-0370bfc144ac",
            "eb3b2c22-3364-451d-a420-85d786ec4c70"
          ],
          "display_name": false
        },
        {
          "uuid": "a43870c8-647e-35ad-c947-e8142bfb9fc8",
          "name": "Bialamicol [WHO-DD]",
          "stdName": "BIALAMICOL [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "71d9f09f-1350-fbd8-1857-5d52ec024e17"
          ],
          "display_name": false
        },
        {
          "uuid": "706dd630-8429-4467-bdca-8f1a99372083",
          "name": "GNF-PF-4303",
          "stdName": "GNF-PF-4303",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b90b3441-b6bb-4397-8207-574b84d65664",
            "eb3b2c22-3364-451d-a420-85d786ec4c70"
          ],
          "display_name": false
        },
        {
          "uuid": "b0e1a028-f5ee-4b2f-b306-bd47630e9a94",
          "name": "SN-6771PAA-701",
          "stdName": "SN-6771PAA-701",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0b9a15d1-1cd0-49c6-925f-0370bfc144ac",
            "eb3b2c22-3364-451d-a420-85d786ec4c70"
          ],
          "display_name": false
        },
        {
          "uuid": "72f4c8cb-c787-4585-815b-fdb7df4da15a",
          "name": "bialamicol [INN]",
          "stdName": "BIALAMICOL [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b3180a3f-0a72-45eb-b99d-fe84d092b110"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f3b50bd7-feb3-4d24-a200-1316bfb4b475",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0b9a15d1-1cd0-49c6-925f-0370bfc144ac",
          "citation": "Merck 14.3",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eb3b2c22-3364-451d-a420-85d786ec4c70",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "34e6fdf9-d481-4748-818f-c61bff0f2962",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b3180a3f-0a72-45eb-b99d-fe84d092b110",
          "citation": "INN Proposed List 8",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL08.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4ac6cb2e-9a3b-41b5-88f9-337aeceed476",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e6a77e2b-fc9d-4b6f-81a5-c47821e856b3",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b90b3441-b6bb-4397-8207-574b84d65664",
          "citation": "CHEMBL",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "10640c79-47ea-4f5f-83d2-c82b04438e7c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389670000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1cf53d0f-be59-4d18-a264-8267eae197a1",
          "citation": "SRS import [TA5NM093QJ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=TA5NM093QJ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389670000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d3e65f90-3838-4fd2-b267-31804ea925a6",
          "citation": "BIALAMICOL [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "394e76ff-debf-4682-b8c3-06444df47d93",
          "citation": "BIALAMICOL [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "edf4ffdc-87b3-427b-826e-feccf8bde6f8",
          "citation": "BIALAMICOL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4df75cb1-0fcb-b958-4c65-44e419a00202",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=493-75-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c0945a5f-f167-4f61-89f4-56b51fd6ef6c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "da6e566a-1121-bd53-7a74-4bd509833cb0",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "71d9f09f-1350-fbd8-1857-5d52ec024e17",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "ce547988-ff05-5a9d-b13d-9c60704699e7",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1514b865-cde6-4277-bf71-88b0d9ee4ca6",
          "id": "1514b865-cde6-4277-bf71-88b0d9ee4ca6",
          "molfile": "\n  Marvin  01132101182D          \n\n 32 33  0  0  0  0            999 V2000\n    2.7884   -2.9692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9984   -2.7368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3813   -3.2996    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5990   -3.0518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -3.6043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5750   -4.0974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3650   -4.3453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9692   -3.7798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7592   -4.0225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9296   -4.8332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3383   -5.3909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5113   -6.1913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3065   -6.4392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4950   -7.2370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5405   -5.1431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9467   -5.7033    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3530   -3.4571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1508   -3.7050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7421   -3.1396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5476   -3.3952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7258   -4.1930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5158   -4.4408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5717   -2.3418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1655   -1.7815    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7816   -2.0939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6009   -1.2961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8108   -1.0483    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6275   -0.2479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8375    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2093   -1.6059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4192   -1.3581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1775   -2.6593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3  6  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n 15  7  2  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 17  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 11  1  0  0  0  0\n 11 15  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 16 15  1  0  0  0  0\n 18 17  1  0  0  0  0\n 32 17  2  0  0  0  0\n 19 18  2  0  0  0  0\n 20 19  1  0  0  0  0\n 23 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  2  0  0  0  0\n 24 23  1  0  0  0  0\n 23 25  2  0  0  0  0\n 26 25  1  0  0  0  0\n 25 32  1  0  0  0  0\n 27 26  1  0  0  0  0\n 28 27  1  0  0  0  0\n 30 27  1  0  0  0  0\n 29 28  1  0  0  0  0\n 31 30  1  0  0  0  0\nM  END",
          "smiles": "C=CCc1cc(cc(CN(CC)CC)c1O)-c2cc(CC=C)c(c(c2)CN(CC)CC)O",
          "formula": "C28H40N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "cf04f4e6-4209-49af-b872-8379827aebc9"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "436.6305",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a3f1994d-af05-4c5c-aa74-5dd2e10f45b9",
      "version": "9",
      "structure": {
        "id": "b68b58ad-470b-42e7-8c02-db89b44a0902",
        "molfile": "\n  Marvin  01132109272D          \n\n 32 33  0  0  0  0            999 V2000\n    2.3650   -4.3453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7816   -2.0939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3530   -3.4571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7592   -4.0225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5717   -2.3418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5405   -5.1431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9692   -3.7798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1775   -2.6593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7421   -3.1396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3383   -5.3909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9296   -4.8332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1508   -3.7050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5750   -4.0974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6009   -1.2961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7258   -4.1930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3065   -6.4392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3813   -3.2996    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8108   -1.0483    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4950   -7.2370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5158   -4.4408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9467   -5.7033    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1655   -1.7815    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5113   -6.1913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5476   -3.3952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9984   -2.7368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5990   -3.0518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6275   -0.2479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2093   -1.6059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7884   -2.9692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8375    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -3.6043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4192   -1.3581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  8  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  7  2  0  0  0  0\n  5  9  2  0  0  0  0\n  6  1  2  0  0  0  0\n  7  1  1  0  0  0  0\n  8  3  1  0  0  0  0\n  9 12  1  0  0  0  0\n 10  6  1  0  0  0  0\n 11  4  1  0  0  0  0\n 12  3  2  0  0  0  0\n 13  1  1  0  0  0  0\n 14  2  1  0  0  0  0\n 15 24  1  0  0  0  0\n 16 23  1  0  0  0  0\n 17 13  1  0  0  0  0\n 18 14  1  0  0  0  0\n 19 16  2  0  0  0  0\n 20 15  2  0  0  0  0\n 21  6  1  0  0  0  0\n 22  5  1  0  0  0  0\n 23 10  1  0  0  0  0\n 24  9  1  0  0  0  0\n 25 17  1  0  0  0  0\n 26 17  1  0  0  0  0\n 27 18  1  0  0  0  0\n 28 18  1  0  0  0  0\n 29 25  1  0  0  0  0\n 30 27  1  0  0  0  0\n 31 26  1  0  0  0  0\n 32 28  1  0  0  0  0\n 11 10  2  0  0  0  0\n  5  2  1  0  0  0  0\nM  END",
        "smiles": "C=CCc1cc(cc(CN(CC)CC)c1O)-c2cc(CC=C)c(c(c2)CN(CC)CC)O",
        "formula": "C28H40N2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "436.6305",
        "optical_activity": "NONE",
        "references": [
          "1cf53d0f-be59-4d18-a264-8267eae197a1",
          "f3b50bd7-feb3-4d24-a200-1316bfb4b475",
          "b3180a3f-0a72-45eb-b99d-fe84d092b110"
        ],
        "stereo_centers": 0
      },
      "unii": "TA5NM093QJ"
    }
  ]
}