{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "c348240d-36cd-4d53-ab6b-de846de5087e", "code": "62001", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/62001", "code_system": "PUBCHEM", "references": [ "404a8018-7e86-432c-a35d-2a84f0c2a2bc" ] }, { "uuid": "f8ced403-2487-4b3f-9d8f-ba3d6c2b9301", "code": "42966-30-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=42966-30-3", "code_system": "CAS", "references": [ "404a8018-7e86-432c-a35d-2a84f0c2a2bc", "c6bed2cf-7b58-4800-8820-ed8ea0933b91" ] }, { "uuid": "00e59212-7f85-4216-bfbe-5cef2fe1d8d4", "code": "256-025-4", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.050.915", "code_system": "ECHA (EC/EINECS)", "references": [ "404a8018-7e86-432c-a35d-2a84f0c2a2bc" ] }, { "uuid": "3c4e031d-610d-46f2-8ed8-66a7f51b11c2", "code": "T990IJT28F", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "f19bfd1e-0f57-563f-f5b9-e28c5d1976d3", "code": "DTXSID80890860", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80890860", "code_system": "EPA CompTox" } ], "relationships": [ { "uuid": "0328cd8d-990b-4f14-a133-537065dce453", "type": "PARENT->SALT/SOLVATE", "related_substance": { "uuid": "2c675376-bab8-431d-84a8-d9ed4346bf77", "refuuid": "135c07ba-d332-4820-8895-ff28dfa13135", "name": "CAPRIC ACID", "unii": "4G9EDB6V73", "linking_id": "4G9EDB6V73", "ref_pname": "CAPRIC ACID", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "7ed4ccb5-e615-46d1-bf93-f1c06ff517d7", "name": "DECANOIC ACID, MAGNESIUM SALT", "stdName": "DECANOIC ACID, MAGNESIUM SALT", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "959083c7-0e00-4073-ab84-5eac8201294d", "c5587ca8-c12c-4a65-8f00-a0c1496403f0" ], "display_name": false }, { "uuid": "0438c41e-bc26-4a43-baca-6bd4fcc82633", "name": "DECANOIC ACID, MAGNESIUM SALT (2:1)", "stdName": "DECANOIC ACID, MAGNESIUM SALT (2:1)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "959083c7-0e00-4073-ab84-5eac8201294d", "c5587ca8-c12c-4a65-8f00-a0c1496403f0" ], "display_name": false }, { "uuid": "d4137082-8523-484c-8a8c-6b2b55791f58", "name": "MAGNESIUM CAPRATE", "stdName": "MAGNESIUM CAPRATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "959083c7-0e00-4073-ab84-5eac8201294d", "c5587ca8-c12c-4a65-8f00-a0c1496403f0" ], "display_name": false }, { "uuid": "06f50dfd-6647-4b5b-98ba-974a09827aaf", "name": "MAGNESIUM DECANOATE", "stdName": "MAGNESIUM DECANOATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "9085ca79-71f3-4d93-9a73-2fd8fc76a24e" ], "display_name": true } ], "references": [ { "uuid": "9085ca79-71f3-4d93-9a73-2fd8fc76a24e", "citation": "stn", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "c5587ca8-c12c-4a65-8f00-a0c1496403f0", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "959083c7-0e00-4073-ab84-5eac8201294d", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "404a8018-7e86-432c-a35d-2a84f0c2a2bc", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391024000, "tags": [ "NOMEN" ] }, { "uuid": "a633b07a-33b9-4c7b-937c-47a14d41e03f", "citation": "SRS import [T990IJT28F]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=T990IJT28F", "doc_type": "SRS", "public_domain": true, "document_date": 1493391024000, "tags": [ "NOMEN" ] }, { "uuid": "2eee73b3-03b5-45da-b872-9acee35104ab", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c6bed2cf-7b58-4800-8820-ed8ea0933b91", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "ca009e2c-5e9b-4d41-9890-146616ba560b", "id": "ca009e2c-5e9b-4d41-9890-146616ba560b", "molfile": "\n Marvin 01132110262D \n\n 1 0 0 0 0 0 999 V2000\n 11.6045 -2.6807 0.0000 Mg 0 2 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 2\nM END", "smiles": "[Mg+2]", "formula": "Mg", "atropisomerism": "No", "charge": 2, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "56c3d3ac-dfcf-4779-80a6-ac1c2b49d998" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "24.3051", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "b88cdf83-f3af-480c-a562-51b2f51f4832", "id": "b88cdf83-f3af-480c-a562-51b2f51f4832", "molfile": "\n Marvin 01132109332D \n\n 12 11 0 0 0 0 999 V2000\n 1.8812 -2.7033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5944 -2.2898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3129 -2.7033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0314 -2.2898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7445 -2.7033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4584 -2.2898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1717 -2.7033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8901 -2.2898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6085 -2.7033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3218 -2.2898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0404 -2.7033 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 8.3218 -1.4627 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 12 2 0 0 0 0\nM CHG 1 11 -1\nM END", "smiles": "CCCCCCCCCC(=O)[O-]", "formula": "C10H19O2", "atropisomerism": "No", "charge": -1, "count": 2, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 2, "units": "MOL RATIO", "uuid": "92a8ada0-34ba-4e11-ad82-0246194a10d4" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "171.257", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "b28bb939-0023-45e4-9b91-5ceea6ac585a", "version": "3", "structure": { "id": "a209e2ba-581a-42e9-af46-ed1145f20a77", "molfile": "\n Marvin 01132108252D \n\n 25 22 0 0 0 0 999 V2000\n 11.6045 -2.6807 0.0000 Mg 0 2 0 0 0 0 0 0 0 0 0 0\n 1.8812 -2.7033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5944 -2.2898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3129 -2.7033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0314 -2.2898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7445 -2.7033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4584 -2.2898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1717 -2.7033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8901 -2.2898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6085 -2.7033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3218 -2.2898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0404 -2.7033 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 8.3218 -1.4627 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8812 -2.7033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5944 -2.2898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3129 -2.7033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0314 -2.2898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7445 -2.7033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4584 -2.2898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1717 -2.7033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8901 -2.2898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6085 -2.7033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3218 -2.2898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0404 -2.7033 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 8.3218 -1.4627 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 23 25 2 0 0 0 0\nM CHG 3 1 2 12 -1 24 -1\nM STY 1 1 MUL\nM SCN 1 1 HT \nM SAL 1 15 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16\nM SAL 1 9 17 18 19 20 21 22 23 24 25\nM SPA 1 12 2 3 4 5 6 7 8 9 10 11 12 13\nM SDI 1 4 1.4612 -3.1233 1.4612 -1.0427\nM SDI 1 4 9.4604 -1.0427 9.4604 -3.1233\nM SMT 1 2\nM END", "smiles": "CCCCCCCCCC(=O)[O-].CCCCCCCCCC(=O)[O-].[Mg+2]", "formula": "2C10H19O2.Mg", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "366.8191", "optical_activity": "NONE", "references": [ "2eee73b3-03b5-45da-b872-9acee35104ab", "a633b07a-33b9-4c7b-937c-47a14d41e03f" ], "stereo_centers": 0 }, "unii": "T990IJT28F" } ] }