{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "739d1cdd-6972-4708-b31e-4f9dd1ae2e55",
          "code": "762268-78-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=762268-78-0",
          "code_system": "CAS",
          "references": [
            "d656e7ff-4aa6-41b2-b50f-029c5f792191",
            "4b9f555e-d5b2-405d-bf8e-edc34ddf99c8"
          ]
        },
        {
          "uuid": "992f0d4d-1236-4582-a395-db12ed0c98b4",
          "code": "11278886",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11278886",
          "code_system": "PUBCHEM",
          "references": [
            "d656e7ff-4aa6-41b2-b50f-029c5f792191"
          ]
        },
        {
          "uuid": "09775f74-824b-4e62-b405-d159f14d8250",
          "code": "T98243MF1L",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ab778788-c6aa-409f-877e-e78c1349b88d",
          "name": "DIETHYLPENTANEDIOL DINEOPENTANOATE",
          "stdName": "DIETHYLPENTANEDIOL DINEOPENTANOATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6426537-7fe9-4c14-9ed7-8dd2b32786ef",
            "45a13e1e-5866-4315-99f5-b00cf5085379",
            "76f41bc7-4102-4414-ba71-cc1f28097eb3"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "3ee3163e-f1b6-4fb7-aafb-c59fde40c253",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "40beb2d0-59bc-45bd-8762-5cd9621ed60b",
          "name": "DINEOPENTANOIC ACID 2,4-DIETHYL-1,5-PENTANEDIOL",
          "stdName": "DINEOPENTANOIC ACID 2,4-DIETHYL-1,5-PENTANEDIOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5ebace6a-9ddb-4fa0-a76f-dbfb22b8b40d",
            "76f41bc7-4102-4414-ba71-cc1f28097eb3"
          ],
          "display_name": false
        },
        {
          "uuid": "02c971c0-b3e2-4a08-b1a5-0934e00ee64d",
          "name": "NEOSOLUE-DEPD",
          "stdName": "NEOSOLUE-DEPD",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "45a13e1e-5866-4315-99f5-b00cf5085379",
            "76f41bc7-4102-4414-ba71-cc1f28097eb3"
          ],
          "display_name": false
        },
        {
          "uuid": "2da75559-f335-4baf-9fb2-331f6712f074",
          "name": "PROPANOIC ACID, 2,2-DIMETHYL-, 2,4-DIETHYL-1,5-PENTANEDIYL ESTER",
          "stdName": "PROPANOIC ACID, 2,2-DIMETHYL-, 2,4-DIETHYL-1,5-PENTANEDIYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5ebace6a-9ddb-4fa0-a76f-dbfb22b8b40d",
            "76f41bc7-4102-4414-ba71-cc1f28097eb3"
          ],
          "display_name": false
        },
        {
          "uuid": "b38093cd-d491-4375-8bfa-3c2a8cae8140",
          "name": "PROPANOIC ACID, 2,2-DIMETHYL-, 4-((2,2-DIMETHYL-1-OXOPROPOXY)METHYL)-2-ETHYLHEXYL ESTER",
          "stdName": "PROPANOIC ACID, 2,2-DIMETHYL-, 4-((2,2-DIMETHYL-1-OXOPROPOXY)METHYL)-2-ETHYLHEXYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5ebace6a-9ddb-4fa0-a76f-dbfb22b8b40d",
            "76f41bc7-4102-4414-ba71-cc1f28097eb3"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "45a13e1e-5866-4315-99f5-b00cf5085379",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "76f41bc7-4102-4414-ba71-cc1f28097eb3",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5ebace6a-9ddb-4fa0-a76f-dbfb22b8b40d",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d656e7ff-4aa6-41b2-b50f-029c5f792191",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391493000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a9aa437b-3f87-4a2c-8f87-b0977910e8b7",
          "citation": "SRS import [T98243MF1L]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=T98243MF1L",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391493000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f6426537-7fe9-4c14-9ed7-8dd2b32786ef",
          "citation": "DIETHYLPENTANEDIOL DINEOPENTANOATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4b9f555e-d5b2-405d-bf8e-edc34ddf99c8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2d174759-a8cd-4bf6-bdd3-5bdfc9840074",
          "id": "2d174759-a8cd-4bf6-bdd3-5bdfc9840074",
          "molfile": "\n  Marvin  01132102262D          \n\n 23 22  0  0  0  0            999 V2000\n    7.6844   -4.0449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3989   -4.4574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3989   -5.2824    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    9.1134   -5.6948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8279   -5.2824    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5423   -5.6948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5423   -6.5199    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2568   -5.2824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9713   -5.6949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2568   -4.4574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9713   -4.8699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6844   -5.6948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9700   -5.2824    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    6.9700   -4.4574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2555   -4.0449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2555   -5.6948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5410   -5.2824    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8266   -5.6948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8266   -6.5199    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1121   -5.2824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3976   -4.8699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1121   -4.4574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3976   -5.6949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n 12  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  8 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 16 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  2  0  0  0  0\n 20 18  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  1  0  0  0  0\n 23 20  1  0  0  0  0\nM  END",
          "smiles": "CCC(CC(CC)COC(=O)C(C)(C)C)COC(=O)C(C)(C)C",
          "formula": "C19H36O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "bc2b4d88-ea26-438d-8f3a-5d7f3e048c53"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "328.4875",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a657404d-4821-43c2-96af-0df557defb69",
      "version": "3",
      "structure": {
        "id": "e4faf198-a67c-4dbe-8636-c6414d79cd35",
        "molfile": "\n  Marvin  01132111512D          \n\n 23 22  0  0  0  0            999 V2000\n    9.8279   -5.2824    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5423   -5.6948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2568   -5.2824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9713   -5.6949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5423   -6.5199    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2568   -4.4574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9713   -4.8699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6844   -4.0449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3989   -4.4574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2555   -4.0449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9700   -4.4574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3976   -4.8699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1121   -4.4574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8266   -6.5199    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1134   -5.6948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3989   -5.2824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6844   -5.6948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9700   -5.2824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2555   -5.6948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5410   -5.2824    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8266   -5.6948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1121   -5.2824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3976   -5.6949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  2  5  2  0  0  0  0\n  3  6  1  0  0  0  0\n  3  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 16  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 18 11  1  0  0  0  0\n 22 12  1  0  0  0  0\n 22 13  1  0  0  0  0\n 21 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 15  1  1  0  0  0  0\nM  END",
        "smiles": "CCC(CC(CC)COC(=O)C(C)(C)C)COC(=O)C(C)(C)C",
        "formula": "C19H36O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "328.4875",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "a9aa437b-3f87-4a2c-8f87-b0977910e8b7",
          "5ebace6a-9ddb-4fa0-a76f-dbfb22b8b40d"
        ],
        "stereo_centers": 2
      },
      "unii": "T98243MF1L"
    }
  ]
}