{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e6fe8123-43dd-4a58-a245-56a0a713ec94",
          "code": "10389-09-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=10389-09-0",
          "code_system": "CAS",
          "references": [
            "43ddbc89-e376-416e-9e47-8748d45cda2a",
            "6b54e76f-0cdc-4237-a0fa-23568e8d46f8"
          ]
        },
        {
          "uuid": "a4af66d5-182f-4820-a487-6cc23dda2143",
          "code": "C87332",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C87332",
          "code_system": "NCI_THESAURUS",
          "references": [
            "43ddbc89-e376-416e-9e47-8748d45cda2a"
          ]
        },
        {
          "uuid": "16cd7696-42bc-4f43-a107-bc56167276a1",
          "code": "287637",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/287637/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "43ddbc89-e376-416e-9e47-8748d45cda2a"
          ]
        },
        {
          "uuid": "e2bf8836-6728-496e-84e6-28e793f466c0",
          "code": "SUB00605MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "43ddbc89-e376-416e-9e47-8748d45cda2a"
          ]
        },
        {
          "uuid": "633207a2-dfc8-4b37-973b-32d4d94a9baf",
          "code": "SUB16403MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "43ddbc89-e376-416e-9e47-8748d45cda2a"
          ]
        },
        {
          "uuid": "5caba904-c22f-408a-b90d-1e098369d3ee",
          "code": "CHEMBL2106115",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2106115",
          "code_system": "ChEMBL",
          "references": [
            "43ddbc89-e376-416e-9e47-8748d45cda2a"
          ]
        },
        {
          "uuid": "576cffb9-f4c8-8f60-f722-3d11a432050b",
          "code": "Calcium aspartate",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Calcium_aspartate",
          "code_system": "WIKIPEDIA",
          "references": [
            "1871dd7e-3817-0119-8f43-ca733ac1fb32"
          ]
        },
        {
          "uuid": "9756d73e-bc50-a988-b442-5b7f7bb48b43",
          "code": "C1505",
          "comments": "Dietary Supplement",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1505",
          "code_system": "NCI_THESAURUS",
          "references": [
            "4ca3c113-426c-e484-a674-74b03a83e7c4"
          ]
        },
        {
          "uuid": "25cd798f-6630-3d26-aa60-8106e14a53f1",
          "code": "30465",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/30465",
          "code_system": "PUBCHEM",
          "references": [
            "d0bc5ffc-7ac6-891a-b3e8-d1ca7adde202"
          ]
        },
        {
          "uuid": "955294f8-d807-48af-bfdc-527a9be3da59",
          "code": "T9680JD4IY",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d7c11efb-34ae-1a9a-74ac-ccfcf8b46b11",
          "code": "100000085323",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "f07f078a-1993-1e55-ed7e-50943b49745c"
          ]
        },
        {
          "uuid": "b3d84555-8432-751c-af7d-845acd41b363",
          "code": "DTXSID60908654",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60908654",
          "code_system": "EPA CompTox",
          "references": [
            "4ca3c113-426c-e484-a674-74b03a83e7c4"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "5ced3560-4dbb-4d1f-bdd7-9c5f4c607716",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "0b43dfbb-da35-4185-841c-942262b7dc35",
            "refuuid": "1c8a5cbe-4530-4f80-bdd4-724b796c7d19",
            "name": "CALCIUM CATION",
            "unii": "2M83C4R6ZB",
            "linking_id": "2M83C4R6ZB",
            "ref_pname": "CALCIUM CATION",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a0f6ba66-9616-4424-a1e2-78573549e020",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "8b4e48c6-9a03-4551-88a0-d49e384e4ad2",
            "refuuid": "a8521c7c-75bd-4430-9468-dbd72574b575",
            "name": "ASPARTIC ACID",
            "unii": "30KYC7MIAI",
            "linking_id": "30KYC7MIAI",
            "ref_pname": "ASPARTIC ACID",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "83266f04-2b7a-456d-ad22-1f046c28017a",
          "name": "ASPARTATE CALCIUM",
          "stdName": "ASPARTATE CALCIUM",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6c789d92-e590-4444-a80a-2aece5550969",
            "73750f3e-958f-48ad-b91a-599312f8f6cf",
            "5da3a5e0-6030-42da-bb5d-343c19a02bbe"
          ],
          "display_name": false
        },
        {
          "uuid": "1bf99897-aee7-4cd1-997e-2e8742ff585a",
          "name": "ASPARTIC ACID, CALCIUM SALT (1:1), L-",
          "stdName": "ASPARTIC ACID, CALCIUM SALT (1:1), L-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "806d8773-0304-4750-9b44-da65bad9a127"
          ],
          "display_name": false
        },
        {
          "uuid": "48ea5863-a64b-0693-d619-69f3a07a47c8",
          "name": "Aspartate calcium [WHO-DD]",
          "stdName": "ASPARTATE CALCIUM [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e9a17ece-8959-d0d5-d70d-1544ca15e8a2"
          ],
          "display_name": false
        },
        {
          "uuid": "5b801237-341b-4367-b461-9098fb30f051",
          "name": "CALCIUM ASPARTATE",
          "stdName": "CALCIUM ASPARTATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b3f4a4b1-4298-4f51-9de2-73272199fd3d",
            "cf0c0f53-c303-4448-8df9-8b4e0246af55",
            "d93cec5e-7e1c-46e7-b7be-21ae115e7905"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "12151afd-062c-4ed7-8545-cbd76da66e01",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "de1fd7ef-da9d-45b5-ae68-90e4eb7aa5c4",
          "name": "CALCIUM ASPARTATE ANHYDROUS",
          "stdName": "CALCIUM ASPARTATE ANHYDROUS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bc7c4347-0f1e-4182-80f0-039b1035affc"
          ],
          "display_name": false
        },
        {
          "uuid": "cd253504-e39b-43fb-b9af-ef68203d5962",
          "name": "CALCIUM L-ASPARTATE",
          "stdName": "CALCIUM L-ASPARTATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cf0c0f53-c303-4448-8df9-8b4e0246af55"
          ],
          "display_name": false
        },
        {
          "uuid": "8f91fa40-acf7-4685-a90a-aadf66c61163",
          "name": "L-ASPARTIC ACID CALCIUM SALT (1:1)",
          "stdName": "L-ASPARTIC ACID CALCIUM SALT (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bc7c4347-0f1e-4182-80f0-039b1035affc"
          ],
          "display_name": false
        },
        {
          "uuid": "84aefc07-02c7-4f2c-ac86-b3f3cd7b74e8",
          "name": "L-ASPARTIC ACID, CALCIUM SALT (1:1)",
          "stdName": "L-ASPARTIC ACID, CALCIUM SALT (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "806d8773-0304-4750-9b44-da65bad9a127"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "cf0c0f53-c303-4448-8df9-8b4e0246af55",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "bc7c4347-0f1e-4182-80f0-039b1035affc",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "806d8773-0304-4750-9b44-da65bad9a127",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6c789d92-e590-4444-a80a-2aece5550969",
          "citation": "EMA LIST",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d93cec5e-7e1c-46e7-b7be-21ae115e7905",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "73750f3e-958f-48ad-b91a-599312f8f6cf",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "43ddbc89-e376-416e-9e47-8748d45cda2a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390749000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "952a7e3c-ebd8-4ea1-9e50-8e9df42c0157",
          "citation": "SRS import [T9680JD4IY]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=T9680JD4IY",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390749000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b3f4a4b1-4298-4f51-9de2-73272199fd3d",
          "citation": "CALCIUM ASPARTATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5da3a5e0-6030-42da-bb5d-343c19a02bbe",
          "citation": "ASPARTATE CALCIUM [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1871dd7e-3817-0119-8f43-ca733ac1fb32",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Calcium_aspartate",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4ca3c113-426c-e484-a674-74b03a83e7c4",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "d0bc5ffc-7ac6-891a-b3e8-d1ca7adde202",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "6b54e76f-0cdc-4237-a0fa-23568e8d46f8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d1b1582a-ffcd-309b-9269-30b82f74fbef",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "e9a17ece-8959-d0d5-d70d-1544ca15e8a2",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "f07f078a-1993-1e55-ed7e-50943b49745c",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8b4fa215-4f87-4af3-b464-6dba0aec3a93",
          "id": "8b4fa215-4f87-4af3-b464-6dba0aec3a93",
          "molfile": "\n  Marvin  01132107142D          \n\n  1  0  0  0  1  0            999 V2000\n    6.0409   -3.7495    0.0000 Ca  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Ca+2]",
          "formula": "Ca",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "14d75dd9-3e38-4349-a8e7-52cde5ee53ed"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "40.078",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "cf3037b3-fc8c-407c-9675-ff9b79b6c4bb",
          "id": "cf3037b3-fc8c-407c-9675-ff9b79b6c4bb",
          "molfile": "\n  Marvin  01132110422D          \n\n  9  8  0  0  1  0            999 V2000\n   10.5207   -4.5493    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   10.5207   -5.3733    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2197   -4.1467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9557   -4.5493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6641   -4.1420    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   11.9557   -5.3686    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8032   -4.1420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8032   -3.3181    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    9.0580   -4.5586    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  7  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  4  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  2  0  0  0  0\nM  CHG  2   5  -1   8  -1\nM  END",
          "smiles": "C([C@@H](C(=O)[O-])N)C(=O)[O-]",
          "formula": "C4H5NO4",
          "atropisomerism": "No",
          "charge": -2,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9dd588e8-fa52-4479-9ce9-bb6e572efb0d"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "131.087",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "34bef825-2459-4fc6-9f27-04a17527fa1c",
      "version": "12",
      "structure": {
        "id": "8dd0b954-05aa-4cd1-81bd-1717e17ddc13",
        "molfile": "\n  Marvin  01132107212D          \n\n 10  8  0  0  1  0            999 V2000\n   11.2197   -4.1467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5207   -4.5493    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.5207   -5.3733    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8032   -4.1420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8032   -3.3181    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0580   -4.5586    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   11.9557   -4.5493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6641   -4.1420    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   11.9557   -5.3686    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0409   -3.7495    0.0000 Ca  0  2  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  6  0  0  0\n  4  2  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  4  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  2  0  0  0  0\nM  CHG  3   6  -1   8  -1  10   2\nM  END",
        "smiles": "C([C@@H](C(=O)[O-])N)C(=O)[O-].[Ca+2]",
        "formula": "C4H5NO4.Ca",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "171.165",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "806d8773-0304-4750-9b44-da65bad9a127",
          "952a7e3c-ebd8-4ea1-9e50-8e9df42c0157"
        ],
        "stereo_centers": 1
      },
      "unii": "T9680JD4IY"
    }
  ]
}