{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "c325f754-206c-46df-bc2f-662c3593daf8", "code": "7554-16-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=7554-16-7", "code_system": "CAS", "references": [ "c55927aa-a399-4503-8580-5be2a1803001", "fb593c69-b62f-43fa-82e3-83dedc87ae63" ] }, { "uuid": "d0524494-5789-47fc-8e35-3945ec00fa3a", "code": "C78768", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C78768", "code_system": "NCI_THESAURUS", "references": [ "c55927aa-a399-4503-8580-5be2a1803001" ] }, { "uuid": "a9db06bb-420d-43b7-9840-f3aa65892024", "code": "C004991", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67004991", "code_system": "MESH", "references": [ "c55927aa-a399-4503-8580-5be2a1803001" ] }, { "uuid": "a751fb06-c4d7-4295-8eae-d94c557eb021", "code": "9394", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9394", "code_system": "PUBCHEM", "references": [ "c55927aa-a399-4503-8580-5be2a1803001" ] }, { "uuid": "47272bac-54f7-6a4b-621f-10ae981f4e17", "code": "C66886", "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Anticholinergic Agent[C66880]|Nicotinic Antagonist", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C66886", "code_system": "NCI_THESAURUS", "references": [ "b85da6cc-231f-0340-e2bf-04b326cf97e6" ] }, { "uuid": "8e335768-eb23-4916-8e55-dad264a594a5", "code": "T91WJ82JOZ", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "cca34183-02de-f547-7736-b59211ab4c5c", "code": "DTXSID60997003", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60997003", "code_system": "EPA CompTox", "references": [ "b85da6cc-231f-0340-e2bf-04b326cf97e6" ] } ], "relationships": [ { "uuid": "28301352-2c9b-423f-9e41-cf357fdb09d6", "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "e602777c-b76f-4002-b3cb-8b8b0f511b60", "refuuid": "7140b5cd-c96c-4466-b783-9b3c6147ef29", "name": "BENZOQUINONIUM CHLORIDE", "unii": "O6HVT48T15", "linking_id": "O6HVT48T15", "ref_pname": "BENZOQUINONIUM CHLORIDE", "substance_class": "reference" } }, { "uuid": "dab2c6e8-7a90-4de2-8c71-e09dc183b35b", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "3fcfcedc-3899-48ed-a60a-334682f7873d", "refuuid": "381d3fdd-0a83-418a-8896-daaa4800eda2", "name": "BENZOQUINONIUM", "unii": "T91WJ82JOZ", "linking_id": "T91WJ82JOZ", "ref_pname": "BENZOQUINONIUM", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "272afb68-cb06-4dca-9b71-d1712ec508cb", "name": "BENZOQUINONIUM", "stdName": "BENZOQUINONIUM", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "7755456a-6f95-4622-8d0b-611b132e6aa0" ], "display_name": true }, { "uuid": "fb2fa5f8-336e-40d5-9580-f10dcb670c97", "name": "BENZOQUINONIUM CATION", "stdName": "BENZOQUINONIUM CATION", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "26c06450-4e57-448e-83f8-39c497981beb" ], "display_name": false }, { "uuid": "95ab49e2-b225-48f1-b9ac-246714dc4ad2", "name": "BENZOQUINONIUM ION", "stdName": "BENZOQUINONIUM ION", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "26c06450-4e57-448e-83f8-39c497981beb" ], "display_name": false }, { "uuid": "25c01d3a-9ec0-4219-a220-37d1f4c0cf84", "name": "N,N'-((3,6-DIOXO-1,4-CYCLOHEXADIENE-1,4-DIYL)BIS(IMINO-3,1-PROPANEDIYL))BIS(N,N-DIETHYLBENZENEMETHANAMINIUM", "stdName": "N,N'-((3,6-DIOXO-1,4-CYCLOHEXADIENE-1,4-DIYL)BIS(IMINO-3,1-PROPANEDIYL))BIS(N,N-DIETHYLBENZENEMETHANAMINIUM", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2b04109b-d9d1-4a33-9ffb-806b77c97df5", "2dd211c4-85a5-4235-a161-fa163ba58d70" ], "display_name": false } ], "references": [ { "uuid": "7755456a-6f95-4622-8d0b-611b132e6aa0", "citation": "USP DICTIONARY 2008", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "2dd211c4-85a5-4235-a161-fa163ba58d70", "citation": "MERCK", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "2b04109b-d9d1-4a33-9ffb-806b77c97df5", "citation": "MERCK 13", "doc_type": "MERCK INDEX", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "26c06450-4e57-448e-83f8-39c497981beb", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c55927aa-a399-4503-8580-5be2a1803001", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390771000, "tags": [ "NOMEN" ] }, { "uuid": "23dfff85-b247-417d-ba54-483866983122", "citation": "SRS import [T91WJ82JOZ]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=T91WJ82JOZ", "doc_type": "SRS", "public_domain": true, "document_date": 1493390771000, "tags": [ "NOMEN" ] }, { "uuid": "b85da6cc-231f-0340-e2bf-04b326cf97e6", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "fb593c69-b62f-43fa-82e3-83dedc87ae63", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "ce92645d-7934-47cc-bc5e-e75ff82d943c", "id": "ce92645d-7934-47cc-bc5e-e75ff82d943c", "molfile": "\n Marvin 01132110402D \n\n 40 42 0 0 0 0 999 V2000\n 9.3060 -4.2499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8935 -3.5355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0685 -3.5355 0.0000 N 0 3 0 0 0 0 0 0 0 3 0 0\n 8.0685 -4.3605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7829 -4.7730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2435 -3.5355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8310 -2.8210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0060 -2.8210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5935 -2.1065 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7685 -2.1065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3560 -2.8210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5310 -2.8210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1185 -3.5355 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1185 -2.1065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2935 -2.1065 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8810 -1.3921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0560 -1.3921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6435 -0.6776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1815 -0.6776 0.0000 N 0 3 0 0 0 0 0 0 0 3 0 0\n -1.0065 -0.6776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4190 0.0369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1815 0.1474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8960 0.5599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1815 -1.5026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8960 -1.9151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8960 -2.7401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6070 -3.1526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3226 -2.7401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3226 -1.9151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6070 -1.5026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5310 -1.3921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3560 -1.3921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7685 -0.6776 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0685 -2.7105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7829 -2.2980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7829 -1.4730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4975 -1.0605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2119 -1.4730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2119 -2.2980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4975 -2.7105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 6 3 1 0 0 0 0\n 34 3 1 0 0 0 0\n 4 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 2 0 0 0 0\n 10 32 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 12 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 14 31 2 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 19 22 1 0 0 0 0\n 24 19 1 0 0 0 0\n 20 21 1 0 0 0 0\n 22 23 1 0 0 0 0\n 25 24 1 0 0 0 0\n 25 26 1 0 0 0 0\n 25 30 2 0 0 0 0\n 26 27 2 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 2 0 0 0 0\n 29 30 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 2 0 0 0 0\n 35 34 1 0 0 0 0\n 35 36 1 0 0 0 0\n 35 40 2 0 0 0 0\n 36 37 2 0 0 0 0\n 37 38 1 0 0 0 0\n 38 39 2 0 0 0 0\n 39 40 1 0 0 0 0\nM CHG 2 3 1 19 1\nM END", "smiles": "CC[N+](CC)(CCCNC1=CC(=O)C(=CC1=O)NCCC[N+](CC)(CC)Cc2ccccc2)Cc3ccccc3", "formula": "C34H50N4O2", "atropisomerism": "No", "charge": 2, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "9009ee1d-48e3-4478-86ec-85c309576380" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "546.7877", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "381d3fdd-0a83-418a-8896-daaa4800eda2", "version": "4", "structure": { "id": "d9039469-e78f-419d-a3fb-b12d204fb2b9", "molfile": "\n Marvin 01132111152D \n\n 40 42 0 0 0 0 999 V2000\n 4.7685 -2.1065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3560 -2.8210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5310 -2.8210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1185 -2.1065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5310 -1.3921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3560 -1.3921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7685 -0.6776 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1185 -3.5355 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2435 -3.5355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8310 -2.8210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0060 -2.8210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5935 -2.1065 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6435 -0.6776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0560 -1.3921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8810 -1.3921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2935 -2.1065 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7829 -2.2980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7829 -1.4730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4975 -1.0605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2119 -1.4730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2119 -2.2980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4975 -2.7105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0685 -2.7105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0685 -3.5355 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 8.8935 -3.5355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3060 -4.2499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0685 -4.3605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7829 -4.7730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8960 -1.9151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8960 -2.7401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6070 -3.1526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3226 -2.7401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3226 -1.9151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6070 -1.5026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1815 -1.5026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1815 -0.6776 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n -1.0065 -0.6776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4190 0.0369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1815 0.1474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8960 0.5599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 1 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 3 8 2 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 1 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 4 16 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 21 22 1 0 0 0 0\n 17 22 2 0 0 0 0\n 23 24 1 0 0 0 0\n 17 23 1 0 0 0 0\n 25 26 1 0 0 0 0\n 24 25 1 0 0 0 0\n 27 28 1 0 0 0 0\n 24 27 1 0 0 0 0\n 9 24 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 2 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 2 0 0 0 0\n 33 34 1 0 0 0 0\n 29 34 2 0 0 0 0\n 35 36 1 0 0 0 0\n 29 35 1 0 0 0 0\n 37 38 1 0 0 0 0\n 36 37 1 0 0 0 0\n 39 40 1 0 0 0 0\n 36 39 1 0 0 0 0\n 13 36 1 0 0 0 0\nM CHG 2 24 1 36 1\nM END", "smiles": "CC[N+](CC)(CCCNC1=CC(=O)C(=CC1=O)NCCC[N+](CC)(CC)Cc2ccccc2)Cc3ccccc3", "formula": "C34H50N4O2", "atropisomerism": "No", "charge": 2, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "546.7877", "optical_activity": "NONE", "references": [ "7755456a-6f95-4622-8d0b-611b132e6aa0", "23dfff85-b247-417d-ba54-483866983122" ], "stereo_centers": 0 }, "unii": "T91WJ82JOZ" } ] }