{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "02332569-78df-477d-b8b1-828e068b5f05",
          "code": "45021-77-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=45021-77-0",
          "code_system": "CAS",
          "references": [
            "5a8abfab-f5c9-46ac-98be-8c5adea790ed",
            "9a61b333-4bd3-4475-9537-90037e27d2e3"
          ]
        },
        {
          "uuid": "432bbb2c-8900-4c55-8c18-4d7ffa11869b",
          "code": "256-181-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.051.057",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "5a8abfab-f5c9-46ac-98be-8c5adea790ed"
          ]
        },
        {
          "uuid": "416d1d0b-8333-410d-a1f7-307b81b2b03e",
          "code": "170750",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/170750",
          "code_system": "PUBCHEM",
          "references": [
            "5a8abfab-f5c9-46ac-98be-8c5adea790ed"
          ]
        },
        {
          "uuid": "294fac0d-f53f-4e87-bbc4-079c84a9d482",
          "code": "T8AN58F7LI",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b9f72c77-16d9-056a-ff17-3f33c748e716",
          "code": "DTXSID20885891",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20885891",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "0162f897-b907-4190-a68e-af779d6d1ac1",
          "code": "2093174-60-6",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2093174-60-6",
          "code_system": "CAS",
          "references": [
            "9a61b333-4bd3-4475-9537-90037e27d2e3"
          ]
        },
        {
          "uuid": "dc2586d6-0fdb-44b0-ab99-967cd26c4f97",
          "code": "202719-73-1",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=202719-73-1",
          "code_system": "CAS"
        },
        {
          "uuid": "3e1a4098-82e1-4596-a20e-037017cd70cd",
          "code": "173027-27-5",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=173027-27-5",
          "code_system": "CAS",
          "references": [
            "9a61b333-4bd3-4475-9537-90037e27d2e3"
          ]
        },
        {
          "uuid": "3e35a123-9752-4710-8918-d52a3bee584d",
          "code": "131479-64-6",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=131479-64-6",
          "code_system": "CAS",
          "references": [
            "9a61b333-4bd3-4475-9537-90037e27d2e3"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "50598f16-c8b1-4b2f-815a-d9241703874e",
          "name": "(3-Acrylamidopropyl)trimethylammonium chloride",
          "stdName": "(3-ACRYLAMIDOPROPYL)TRIMETHYLAMMONIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d0515855-7754-42ad-bf92-71f26b074f43"
          ],
          "display_name": true
        },
        {
          "uuid": "e2dd9579-537e-499b-b217-62446b6141ae",
          "name": "(Acrylamidopropyl)trimethylammonium chloride",
          "stdName": "(ACRYLAMIDOPROPYL)TRIMETHYLAMMONIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d0515855-7754-42ad-bf92-71f26b074f43",
            "f3c5d168-df1c-4749-a2ba-f6858ee31bc0"
          ],
          "display_name": false
        },
        {
          "uuid": "56bee74e-9ad5-4005-8676-648841c1b001",
          "name": "1-Propanaminium, N,N,N-trimethyl-3-[(1-oxo-2-propen-1-yl)amino]-, chloride (1:1)",
          "stdName": "1-PROPANAMINIUM, N,N,N-TRIMETHYL-3-((1-OXO-2-PROPEN-1-YL)AMINO)-, CHLORIDE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f3c5d168-df1c-4749-a2ba-f6858ee31bc0",
            "54c0a48f-7279-4ee9-b4ed-323f39e7ce2d"
          ],
          "display_name": false
        },
        {
          "uuid": "01374df5-c199-49bb-9c4c-785c90af4de7",
          "name": "1-Propanaminium, N,N,N-trimethyl-3-[(1-oxo-2-propenyl)amino]-, chloride",
          "stdName": "1-PROPANAMINIUM, N,N,N-TRIMETHYL-3-((1-OXO-2-PROPENYL)AMINO)-, CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f3c5d168-df1c-4749-a2ba-f6858ee31bc0",
            "d3a23c86-d384-46cc-b854-543f46af0eb9"
          ],
          "display_name": false
        },
        {
          "uuid": "a4d77afb-6078-4c11-b7a3-2a54741d6b8e",
          "name": "3-Acrylamido-N,N,N-trimethylpropan-1-aminium chloride",
          "stdName": "3-ACRYLAMIDO-N,N,N-TRIMETHYLPROPAN-1-AMINIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f3c5d168-df1c-4749-a2ba-f6858ee31bc0",
            "47005765-022b-4fcc-8de3-d79a268e3855"
          ],
          "display_name": false
        },
        {
          "uuid": "f86a9904-b032-49e1-b000-d77961a7c797",
          "name": "Acryloylaminopropyltrimethylammonium chloride",
          "stdName": "ACRYLOYLAMINOPROPYLTRIMETHYLAMMONIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d0515855-7754-42ad-bf92-71f26b074f43",
            "f3c5d168-df1c-4749-a2ba-f6858ee31bc0"
          ],
          "display_name": false
        },
        {
          "uuid": "2e94623a-e8a9-4254-9ad7-049762051d3c",
          "name": "DMAPAA-Q",
          "stdName": "DMAPAA-Q",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d0515855-7754-42ad-bf92-71f26b074f43",
            "f3c5d168-df1c-4749-a2ba-f6858ee31bc0"
          ],
          "display_name": false
        },
        {
          "uuid": "0ccbed43-4e80-4498-9e38-2dd7af022a50",
          "name": "TRIMETHYL-3-((1-OXOALLYL)AMINO)PROPYLAMMONIUM CHLORIDE",
          "stdName": "TRIMETHYL-3-((1-OXOALLYL)AMINO)PROPYLAMMONIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f3c5d168-df1c-4749-a2ba-f6858ee31bc0",
            "54c0a48f-7279-4ee9-b4ed-323f39e7ce2d"
          ],
          "display_name": false
        },
        {
          "uuid": "e3021f7d-942b-4249-bf03-6b51c65ea91a",
          "name": "Trimethyl(3-acrylamidopropyl)ammonium chloride",
          "stdName": "TRIMETHYL(3-ACRYLAMIDOPROPYL)AMMONIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d0515855-7754-42ad-bf92-71f26b074f43",
            "f3c5d168-df1c-4749-a2ba-f6858ee31bc0"
          ],
          "display_name": false
        },
        {
          "uuid": "2f868e16-4550-4291-8cba-c665dd5d7f1c",
          "name": "[3-(Acryloylamino)propyl]trimethylammonium chloride",
          "stdName": "(3-(ACRYLOYLAMINO)PROPYL)TRIMETHYLAMMONIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d0515855-7754-42ad-bf92-71f26b074f43",
            "f3c5d168-df1c-4749-a2ba-f6858ee31bc0"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "d0515855-7754-42ad-bf92-71f26b074f43",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "54c0a48f-7279-4ee9-b4ed-323f39e7ce2d",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f3c5d168-df1c-4749-a2ba-f6858ee31bc0",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "47005765-022b-4fcc-8de3-d79a268e3855",
          "citation": "CHEMDRAW",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d3a23c86-d384-46cc-b854-543f46af0eb9",
          "citation": "chemid",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5a8abfab-f5c9-46ac-98be-8c5adea790ed",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391023000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "319695b3-537c-4dc3-9f3b-2f2a5be17fb1",
          "citation": "SRS import [T8AN58F7LI]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=T8AN58F7LI",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391023000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "638a0dcb-d641-48c0-a6a2-369ed245e462",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9a61b333-4bd3-4475-9537-90037e27d2e3",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c0761305-b8dd-4012-8bcb-9e1c29ea1972",
          "id": "c0761305-b8dd-4012-8bcb-9e1c29ea1972",
          "molfile": "\n  CDK     05222422262D\n\n 12 11  0  0  0  0  0  0  0  0999 V2000\n    2.6673    3.0800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3337    3.8501    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    4.0012    3.8501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    4.6201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5637    2.5164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1037    5.1837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3348    3.0800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6685    3.8501    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0023    3.0800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3360    3.8501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0023    1.5400    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6697    3.0800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  2  6  1  0  0  0  0\n  3  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  2  0  0  0  0\n 10 12  2  0  0  0  0\nM  CHG  1   2   1\nM  END",
          "smiles": "C=CC(=O)NCCC[N+](C)(C)C",
          "formula": "C9H19N2O",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6ff7d75b-4d59-4ca3-9879-2c04669f31b8"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "171.2603",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "c26cab86-3919-4802-b45c-e9034c9ca09f",
          "id": "c26cab86-3919-4802-b45c-e9034c9ca09f",
          "molfile": "\n  CDK     05222422262D\n\n  1  0  0  0  0  0  0  0  0  0999 V2000\n    5.3348    0.0000    0.0000 Cl  0  5  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1  -1\nM  END",
          "smiles": "[Cl-]",
          "formula": "Cl",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "383e7601-5195-45a9-a273-a1c053d65517"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "35.4529",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f4dba1e7-61a5-421d-a00e-d03dd9a952b6",
      "version": "6",
      "structure": {
        "id": "da943212-192e-4112-ad42-d4a9b7caac48",
        "molfile": "(Acrylamidopropyl)trimethylammonium chloride\n   JSDraw205222422262D\n\n 13 11  0  0  0  0              0 V2000\n   18.4619   -7.2015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1111   -6.4215    0.0000 N   0  3  0  0  0  0  4  0  0  0  0  0\n   19.8131   -6.4215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7601   -5.6415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3311   -7.7724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.8910   -5.0706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1639   -7.2015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.5149   -6.4215    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8660   -7.2015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.2169   -6.4215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8660   -8.7615    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   26.5679   -7.2015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1639  -10.3214    0.0000 Cl  0  5  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  2  6  1  0  0  0  0\n  3  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  2  0  0  0  0\n 10 12  2  0  0  0  0\nM  CHG  2   2   1  13  -1\nM  END",
        "smiles": "C=CC(=O)NCCC[N+](C)(C)C.[Cl-]",
        "formula": "C9H19N2O.Cl",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "206.7132",
        "optical_activity": "NONE",
        "references": [
          "319695b3-537c-4dc3-9f3b-2f2a5be17fb1",
          "638a0dcb-d641-48c0-a6a2-369ed245e462"
        ],
        "stereo_centers": 0
      },
      "unii": "T8AN58F7LI"
    }
  ]
}