{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "125a7d97-674a-4b79-b1e4-0b58fbf0b38c",
          "code": "1605-89-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1605-89-6",
          "code_system": "CAS",
          "references": [
            "435a1382-c9be-4ff9-8dc3-881bfa7fbb69",
            "42ab7b9c-a20d-494a-a1e3-216a1d9f835b"
          ]
        },
        {
          "uuid": "0a8a4eec-0807-48a0-8a29-720780c62985",
          "code": "C74111",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C74111",
          "code_system": "NCI_THESAURUS",
          "references": [
            "435a1382-c9be-4ff9-8dc3-881bfa7fbb69"
          ]
        },
        {
          "uuid": "c5fcd2ea-a3bb-44dc-901b-2acc9b52197d",
          "code": "C414827",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67414827",
          "code_system": "MESH",
          "references": [
            "435a1382-c9be-4ff9-8dc3-881bfa7fbb69"
          ]
        },
        {
          "uuid": "fea88b88-905e-4e01-9672-1417fc4285f6",
          "code": "BOLASTERONE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Bolasterone",
          "code_system": "WIKIPEDIA",
          "references": [
            "435a1382-c9be-4ff9-8dc3-881bfa7fbb69"
          ]
        },
        {
          "uuid": "11812207-35ba-4495-822a-e603714d5d28",
          "code": "1479",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1479",
          "code_system": "INN",
          "references": [
            "435a1382-c9be-4ff9-8dc3-881bfa7fbb69"
          ]
        },
        {
          "uuid": "cd941976-3acc-40e1-b888-41a8315fa7ec",
          "code": "4000",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule III.|Anabolic Steroids",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "435a1382-c9be-4ff9-8dc3-881bfa7fbb69"
          ]
        },
        {
          "uuid": "7845e3ba-496f-46da-8649-83950abd0359",
          "code": "m2596",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2596?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "435a1382-c9be-4ff9-8dc3-881bfa7fbb69"
          ]
        },
        {
          "uuid": "ea4f2353-aa75-4bef-8d23-4aa1456befba",
          "code": "SUB05867MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "435a1382-c9be-4ff9-8dc3-881bfa7fbb69"
          ]
        },
        {
          "uuid": "39b99992-7dcc-463c-b283-369486e5d738",
          "code": "CHEMBL259548",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL259548",
          "code_system": "ChEMBL",
          "references": [
            "435a1382-c9be-4ff9-8dc3-881bfa7fbb69"
          ]
        },
        {
          "uuid": "46ae2878-9c5e-4407-be36-6e40c78e5e02",
          "code": "216-519-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.015.018",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "435a1382-c9be-4ff9-8dc3-881bfa7fbb69"
          ]
        },
        {
          "uuid": "b1fc70d4-a8d1-4dcc-9644-af7c9d57c8c8",
          "code": "102146",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/102146",
          "code_system": "PUBCHEM",
          "references": [
            "435a1382-c9be-4ff9-8dc3-881bfa7fbb69"
          ]
        },
        {
          "uuid": "1ad9c608-28c2-02b5-2b33-a6ba6c443eb5",
          "code": "DTXSID40166896",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40166896",
          "code_system": "EPA CompTox",
          "references": [
            "40d84e10-9fba-184c-33e0-ef820dbade58"
          ]
        },
        {
          "uuid": "847c08d9-1b4b-0fb7-a316-84ce01ca5559",
          "code": "C2360",
          "comments": "Pharmacologic Substance[C1909]|Hormone Therapy Agent[C147908]|Therapeutic Hormone[C548]|Anabolic Steroid",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2360",
          "code_system": "NCI_THESAURUS",
          "references": [
            "8e335ff8-4062-1b93-8b92-4df9c4282786"
          ]
        },
        {
          "uuid": "54cf5c31-3e58-4da3-bfc8-1e9ab432da6d",
          "code": "T7ZM08F7FU",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ffa51999-6230-6693-f6af-956b1de04f48",
          "code": "DB01471",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB01471",
          "code_system": "DRUG BANK",
          "references": [
            "8e335ff8-4062-1b93-8b92-4df9c4282786"
          ]
        },
        {
          "uuid": "7a6c23e8-360d-c0f6-00a9-7d10d0d09ae5",
          "code": "66233",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=66233",
          "code_system": "NSC",
          "references": [
            "223c28c5-8e68-c42c-6781-2e05dd5267c3"
          ]
        },
        {
          "uuid": "a44b0620-bc7d-de44-e523-dfe0aa4c07d9",
          "code": "100000086346",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "b0e66d68-1d14-7fd3-08e8-9721f2607e97"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "a3ce9c4f-5edc-45e4-b48f-1a1978e7c8e3",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "df4540b7-5412-41f9-b225-3ed88643ba64",
            "refuuid": "7db8c0ff-2f99-428a-9691-fdd0e7bf57d4",
            "name": "BOLASTERONE",
            "unii": "T7ZM08F7FU",
            "linking_id": "T7ZM08F7FU",
            "ref_pname": "BOLASTERONE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "adbed13e-3c62-4584-a337-99beaf8e60b1",
          "name": "17β-Hydroxy-7α,17-dimethylandrost-4-en-3-one",
          "stdName": "17.BETA.-HYDROXY-7.ALPHA.,17-DIMETHYLANDROST-4-EN-3-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8e0dfeab-6a8b-42b2-becc-166e41bd9b8e"
          ],
          "display_name": false
        },
        {
          "uuid": "a0fd5e31-d164-48d8-b7cb-b2f76c05f617",
          "name": "7.ALPHA.,17-DIMETHYLTESTOSTERONE",
          "stdName": "7.ALPHA.,17-DIMETHYLTESTOSTERONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8e0dfeab-6a8b-42b2-becc-166e41bd9b8e"
          ],
          "display_name": false
        },
        {
          "uuid": "eb025ccb-0528-44f3-8135-9314f0751d30",
          "name": "ANDROST-4-EN-3-ONE, 17-HYDROXY-7,17-DIMETHYL-, (7.ALPHA.,17.BETA.)-",
          "stdName": "ANDROST-4-EN-3-ONE, 17-HYDROXY-7,17-DIMETHYL-, (7.ALPHA.,17.BETA.)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8e0dfeab-6a8b-42b2-becc-166e41bd9b8e"
          ],
          "display_name": false
        },
        {
          "uuid": "ef031d9b-4d0e-411a-bdd0-223199059aba",
          "name": "BOLASTERONE",
          "stdName": "BOLASTERONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fa5d2271-f59b-4a85-9048-3c8bfe1e5d66",
            "2c8730ed-27b0-45cb-b483-d6a7a9b23f92",
            "bee63c53-6362-42c2-b87c-53368c872fff",
            "157aca76-91ce-4856-95da-8055bd364042",
            "a833d767-a282-49ab-8c61-3324dd8609b3",
            "4d3a0584-8e60-4bc1-857b-6bee84492b2a",
            "c26049cb-ed2d-4a94-8877-6eb079b13ec1",
            "73d44ebe-2905-47c8-a112-42ad9121146c",
            "8e0dfeab-6a8b-42b2-becc-166e41bd9b8e",
            "3a7e35ce-8b54-4b45-806e-58715482e2cc"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "de087084-0e09-42eb-990b-97e66b3eb990",
              "name_org": "INN"
            },
            {
              "uuid": "5857b532-d44a-4341-892c-f1965010a6e0",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "4897dc57-944b-4a9c-a509-68b1954b25c4",
          "name": "BOLASTERONE [MART.]",
          "stdName": "BOLASTERONE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fa5d2271-f59b-4a85-9048-3c8bfe1e5d66"
          ],
          "display_name": false
        },
        {
          "uuid": "691f585f-8a3a-4cec-a393-c9d77fbe0fdb",
          "name": "BOLASTERONE [MI]",
          "stdName": "BOLASTERONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a833d767-a282-49ab-8c61-3324dd8609b3",
            "73d44ebe-2905-47c8-a112-42ad9121146c"
          ],
          "display_name": false
        },
        {
          "uuid": "13dbf4c2-ddaa-4045-84bc-78e31f47a444",
          "name": "BOLASTERONE [USAN]",
          "stdName": "BOLASTERONE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bee63c53-6362-42c2-b87c-53368c872fff"
          ],
          "display_name": false
        },
        {
          "uuid": "f3381842-15d5-44b8-9176-5460c7927f7e",
          "name": "NSC-66233",
          "stdName": "NSC-66233",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8e0dfeab-6a8b-42b2-becc-166e41bd9b8e"
          ],
          "display_name": false
        },
        {
          "uuid": "a3a6bad2-74d6-4cf9-ada7-3a7c6dad6fcf",
          "name": "U-19763",
          "stdName": "U-19763",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8e0dfeab-6a8b-42b2-becc-166e41bd9b8e"
          ],
          "display_name": false
        },
        {
          "uuid": "435758be-cc0d-4438-baf0-8e7b6703fa2c",
          "name": "bolasterone [INN]",
          "stdName": "BOLASTERONE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "157aca76-91ce-4856-95da-8055bd364042"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8e0dfeab-6a8b-42b2-becc-166e41bd9b8e",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "157aca76-91ce-4856-95da-8055bd364042",
          "citation": "INN Proposed List 13",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL13.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "bee63c53-6362-42c2-b87c-53368c872fff",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fa5d2271-f59b-4a85-9048-3c8bfe1e5d66",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a833d767-a282-49ab-8c61-3324dd8609b3",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "73d44ebe-2905-47c8-a112-42ad9121146c",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "435a1382-c9be-4ff9-8dc3-881bfa7fbb69",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389669000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "95051923-5bb5-4727-945b-59daaf5b2110",
          "citation": "SRS import [T7ZM08F7FU]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=T7ZM08F7FU",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389669000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3a7e35ce-8b54-4b45-806e-58715482e2cc",
          "citation": "BOLASTERONE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c26049cb-ed2d-4a94-8877-6eb079b13ec1",
          "citation": "BOLASTERONE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2c8730ed-27b0-45cb-b483-d6a7a9b23f92",
          "citation": "BOLASTERONE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4d3a0584-8e60-4bc1-857b-6bee84492b2a",
          "citation": "BOLASTERONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "40d84e10-9fba-184c-33e0-ef820dbade58",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1605-89-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8e335ff8-4062-1b93-8b92-4df9c4282786",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "42ab7b9c-a20d-494a-a1e3-216a1d9f835b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "223c28c5-8e68-c42c-6781-2e05dd5267c3",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "b0e66d68-1d14-7fd3-08e8-9721f2607e97",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1411fdd5-fad0-46d0-9022-0115d2e33e92",
          "id": "1411fdd5-fad0-46d0-9022-0115d2e33e92",
          "molfile": "\n  Marvin  01132101152D          \n\n 23 26  0  0  1  0            999 V2000\n    6.0362   -1.8513    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.8295   -2.1128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3090   -1.4415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8295   -0.7789    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    7.6520   -0.7789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8209    0.0436    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0362   -1.0375    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.8327   -0.2151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3241   -0.6162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6092   -1.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6092   -1.8513    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.3241   -2.2726    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.3241   -3.0951    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.0362   -3.5136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6092   -3.5049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8972   -3.0951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1852   -3.5049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4674   -3.0951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7554   -3.5078    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4674   -2.2726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1852   -1.8513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8972   -2.2726    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    3.8972   -1.4502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  7  1  0  0  0  0\n 12  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  1  0  0  0\n  7  4  1  0  0  0  0\n  7  8  1  1  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  6  0  0  0\n 11 22  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  6  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  2  0  0  0  0\n 22 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  2  0  0  0  0\n 20 18  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 21  1  0  0  0  0\n 22 23  1  1  0  0  0\nM  END",
          "smiles": "C[C@@H]1CC2=CC(=O)CC[C@]2(C)C3CC[C@@]4(C)[C@@H](CC[C@]4(C)O)[C@H]13",
          "formula": "C21H32O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "282eaf1e-1b89-45df-bae7-91acd6029110"
          },
          "defined_stereo": 6,
          "ez_centers": 0,
          "molecular_weight": "316.4784",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 7
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "7db8c0ff-2f99-428a-9691-fdd0e7bf57d4",
      "version": "8",
      "structure": {
        "id": "7b992a73-34a4-428b-89a4-503b7924332d",
        "molfile": "\n  Marvin  01132106252D          \n\n 26 29  0  0  1  0            999 V2000\n    3.8972   -2.2726    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.8972   -3.0951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6092   -1.8513    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.0362   -1.8513    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.0362   -1.0375    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.3241   -2.2726    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.3241   -3.0951    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.1852   -3.5049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8295   -0.7789    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.6092   -3.5049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3241   -0.6162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6092   -1.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8295   -2.1128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1852   -1.8513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4674   -3.0951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3090   -1.4415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7554   -3.5078    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4674   -2.2726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8209    0.0436    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8972   -1.4502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8327   -0.2151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0362   -3.5136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6520   -0.7789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3212   -1.4502    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0274   -2.6737    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6092   -2.6737    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  6  1  0  0  0  0\n  5 11  1  0  0  0  0\n  6  3  1  0  0  0  0\n  7 10  1  0  0  0  0\n  8  2  2  0  0  0  0\n  9  5  1  0  0  0  0\n 10  2  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12  3  1  0  0  0  0\n 13  4  1  0  0  0  0\n 14  1  1  0  0  0  0\n 15  8  1  0  0  0  0\n 16 13  1  0  0  0  0\n 17 15  2  0  0  0  0\n 18 14  1  0  0  0  0\n  9 19  1  1  0  0  0\n  1 20  1  1  0  0  0\n  5 21  1  1  0  0  0\n  7 22  1  6  0  0  0\n  9 23  1  6  0  0  0\n  6 24  1  1  0  0  0\n  4 25  1  6  0  0  0\n  3 26  1  6  0  0  0\n 18 15  1  0  0  0  0\n  6  7  1  0  0  0  0\n  5  4  1  0  0  0  0\n  9 16  1  0  0  0  0\nM  END",
        "smiles": "C[C@@H]1CC2=CC(=O)CC[C@]2(C)[C@@]3([H])CC[C@@]4(C)[C@@]([H])(CC[C@]4(C)O)[C@]13[H]",
        "formula": "C21H32O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 7,
        "ez_centers": 0,
        "molecular_weight": "316.4784",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "8e0dfeab-6a8b-42b2-becc-166e41bd9b8e",
          "95051923-5bb5-4727-945b-59daaf5b2110",
          "157aca76-91ce-4856-95da-8055bd364042"
        ],
        "stereo_centers": 7
      },
      "unii": "T7ZM08F7FU"
    }
  ]
}