{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "cbd8d0b5-097b-408f-b78d-ce2fa12b4653",
          "code": "87-81-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=87-81-0",
          "code_system": "CAS",
          "references": [
            "8091ffab-c126-446f-bac5-88001669531f",
            "34c117fa-a3fe-4969-a53d-e0586045d991"
          ]
        },
        {
          "uuid": "5ae4ad59-b477-4c08-afff-1b77dfe68704",
          "code": "C030192",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67030192",
          "code_system": "MESH",
          "references": [
            "8091ffab-c126-446f-bac5-88001669531f"
          ]
        },
        {
          "uuid": "a5bb5b3b-cb3b-41ac-b07e-e1ca37c62dfd",
          "code": "201-772-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.612",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "8091ffab-c126-446f-bac5-88001669531f"
          ]
        },
        {
          "uuid": "3e266d50-fff0-488e-8451-9ccd56e3fb9d",
          "code": "m10431",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10431?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "8091ffab-c126-446f-bac5-88001669531f"
          ]
        },
        {
          "uuid": "87a09c49-6344-4c51-965d-a11cebdc5fe2",
          "code": "SUB26542",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "8091ffab-c126-446f-bac5-88001669531f"
          ]
        },
        {
          "uuid": "a30202bd-90b7-4d76-9072-95f9bc880ac9",
          "code": "SUB129913",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "8091ffab-c126-446f-bac5-88001669531f"
          ]
        },
        {
          "uuid": "79c65d2e-d2a8-4b6d-82d2-09c8cde6934d",
          "code": "92092",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/92092",
          "code_system": "PUBCHEM",
          "references": [
            "8091ffab-c126-446f-bac5-88001669531f"
          ]
        },
        {
          "uuid": "037d01cc-b624-e460-c91c-9b6f5dd34c5f",
          "code": "Tagatose",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Tagatose",
          "code_system": "WIKIPEDIA",
          "references": [
            "b8f0e033-d4b1-5fdd-0a4c-69b00c45664f"
          ]
        },
        {
          "uuid": "56ea2887-cb41-ae93-1ba8-93338609ca85",
          "code": "DTXSID3047897",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3047897",
          "code_system": "EPA CompTox",
          "references": [
            "a53c7a93-a1ce-daa2-413f-bba27e92cd67"
          ]
        },
        {
          "uuid": "80b36e1d-f3c8-ad21-a0ec-370eb6bcd75b",
          "code": "459614",
          "comments": "ORPHAN DRUG|Designated|Treatment of Prader-Willi Syndrome",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=459614",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "a8221f67-06df-40cb-8c90-03e85c8efd70",
          "code": "41847-01-2",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=41847-01-2",
          "code_system": "CAS",
          "references": [
            "064df07d-e2eb-1bc0-30c7-8bb807bcef90"
          ]
        },
        {
          "uuid": "95ed95f3-a3e6-4b4f-9cd0-c543808ccf70",
          "code": "41847-61-4",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=41847-61-4",
          "code_system": "CAS",
          "references": [
            "064df07d-e2eb-1bc0-30c7-8bb807bcef90"
          ]
        },
        {
          "uuid": "bb778e58-3a63-6b2a-cfd4-485ee6bec142",
          "code": "DB04936",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB04936",
          "code_system": "DRUG BANK",
          "references": [
            "5eb4a063-cfc4-9a46-0030-9e1dd133748c"
          ]
        },
        {
          "uuid": "7ec33388-75e3-4a2b-aa48-f2e25cf7abed",
          "code": "T7A20Y888Y",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0bd6ca8a-949b-14d9-1935-0053532d028a",
          "code": "4249",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:4249",
          "code_system": "CHEBI",
          "references": [
            "5eb4a063-cfc4-9a46-0030-9e1dd133748c"
          ]
        },
        {
          "uuid": "94722056-5f54-66d3-e9f0-b155e46000fb",
          "code": "16443",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:16443",
          "code_system": "CHEBI",
          "references": [
            "5eb4a063-cfc4-9a46-0030-9e1dd133748c"
          ]
        },
        {
          "uuid": "0b9cd67b-dd46-5f10-a783-ea7efeac72f9",
          "code": "47693",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:47693",
          "code_system": "CHEBI",
          "references": [
            "5eb4a063-cfc4-9a46-0030-9e1dd133748c"
          ]
        },
        {
          "uuid": "26c7a5df-0b3e-6bbf-dfce-1b30b7068457",
          "code": "1642904",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1642904",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "5eb4a063-cfc4-9a46-0030-9e1dd133748c"
          ]
        },
        {
          "uuid": "ad707846-5ac0-b3dd-9500-0c9105940f5a",
          "code": "100000091290",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "65b7d1af-b2b4-944f-b00e-d79634b650a6"
          ]
        },
        {
          "uuid": "5819a35a-1fae-11eb-2344-14c030c2f49c",
          "code": "977",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=977",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "5eb4a063-cfc4-9a46-0030-9e1dd133748c"
          ]
        },
        {
          "uuid": "16de7dfa-03b3-7646-b9ba-f89325e4e1d0",
          "code": "78",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=78",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "5eb4a063-cfc4-9a46-0030-9e1dd133748c"
          ]
        },
        {
          "uuid": "e9ec6252-62f7-1efd-f8a0-56f728a139d9",
          "code": "352",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=352",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "5eb4a063-cfc4-9a46-0030-9e1dd133748c"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "7de3c71c-379b-437c-9862-f73e04b482a8",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ff74a593-1719-49bc-b28e-7cf67d32d4f9",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b83c9c53-7874-4166-b2e0-ddb4f8ad1378",
          "citation": "USP FOOD CHEMICALS CODEX",
          "doc_type": "USP FOOD CHEMICALS CODEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6afa218a-9069-41ab-8978-e496ee8f2d05",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d18e3441-74be-459a-bf7b-3ff9cacd8cd2",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "47a59fa1-d558-420d-8e85-4f814771991b",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9795318d-348b-4109-a439-2475a3e51439",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e15bbb3a-4ae5-4020-bfe1-0e6e0a0fa1b3",
          "citation": "CLINICAL TRIALS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8091ffab-c126-446f-bac5-88001669531f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389710000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8292d533-31de-480a-8eff-66e81653a837",
          "citation": "SRS import [T7A20Y888Y]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=T7A20Y888Y",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389710000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b25b6d7d-b1c8-499f-9be2-84ac6ade7327",
          "citation": "TAGATOSE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "abb95fce-ab01-477c-acc2-5641320d6919",
          "citation": "D-TAGATOSE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c918590f-ff3f-499d-80c2-b1862e7b8679",
          "citation": "D-TAGATOSE [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "eb0c3b3e-3b38-4360-af85-30198fb49316",
          "citation": "TAGATOSE, D- [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "45383cbd-3871-4361-a29b-08e3b3333f81",
          "citation": "TAGATOSE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b8f0e033-d4b1-5fdd-0a4c-69b00c45664f",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Tagatose",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a53c7a93-a1ce-daa2-413f-bba27e92cd67",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=87-81-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "064df07d-e2eb-1bc0-30c7-8bb807bcef90",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "34c117fa-a3fe-4969-a53d-e0586045d991",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "efb2aac6-4d7c-7c79-efb8-6922ddfaf8a8",
          "citation": "WIKIPEDIA",
          "url": "https://en.wikipedia.org/wiki/Tagatose#Antihyperglycemic_effect",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5eb4a063-cfc4-9a46-0030-9e1dd133748c",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "65b7d1af-b2b4-944f-b00e-d79634b650a6",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "220ab0bf-5400-4eba-97ad-d421a7cf3be2",
          "id": "220ab0bf-5400-4eba-97ad-d421a7cf3be2",
          "molfile": "\n  Marvin  01132101552D          \n\n 12 11  0  0  1  0            999 V2000\n    3.3035   -2.7050    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    3.3247   -3.5297    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5787   -2.3110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8751   -2.7416    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0072   -2.2743    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    3.9859   -1.4496    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7320   -2.6684    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    4.7531   -3.4930    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4356   -2.2376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4144   -1.4129    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1604   -2.6316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8640   -2.2009    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  5  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  6  1  6  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  1  0  0  0\n  7  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 11  9  1  0  0  0  0\n 12 11  1  0  0  0  0\nM  END",
          "smiles": "C([C@H]([C@@H]([C@@H](C(=O)CO)O)O)O)O",
          "formula": "C6H12O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "eb77ce4e-7af8-40c7-a450-5d9e7ac17417"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "180.1561",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "7f9dd819-750f-43f7-8f78-727af106aac7",
      "version": "30",
      "structure": {
        "id": "bad8266b-83f5-42b9-80ff-5be03c816d1a",
        "molfile": "\n  Marvin  01132109402D          \n\n 12 11  0  0  1  0            999 V2000\n   12.8748   -4.2670    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   13.5784   -3.8363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5572   -3.0115    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3032   -4.2303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0068   -3.7996    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1500   -3.8730    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   11.4464   -4.3037    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   11.4675   -5.1284    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7215   -3.9097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0180   -4.3403    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1288   -3.0482    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8960   -5.0916    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  6  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  6 11  1  6  0  0  0\n  1 12  1  1  0  0  0\nM  END",
        "smiles": "C([C@H]([C@@H]([C@@H](C(=O)CO)O)O)O)O",
        "formula": "C6H12O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "180.1561",
        "optical_activity": "( - )",
        "references": [
          "ff74a593-1719-49bc-b28e-7cf67d32d4f9",
          "8292d533-31de-480a-8eff-66e81653a837"
        ],
        "stereo_centers": 3
      },
      "unii": "T7A20Y888Y",
      "relationships": [
        {
          "uuid": "b88cec77-5600-4a3b-a695-d84b8480ac10",
          "type": "SUBSTANCE->SUB_ALTERNATE",
          "related_substance": {
            "uuid": "d664a9cf-df4b-4c25-a48d-e82099dfe14f",
            "refuuid": "c9bf9626-a37a-4929-b4cb-ae265b57b9bf",
            "name": "ALTERNATIVE DEFINITION for [TAGATOSE]",
            "linking_id": "c9bf9626-a37a-4929-b4cb-ae265b57b9bf",
            "ref_pname": "NO NAME"
          }
        },
        {
          "uuid": "5390ea90-75e3-4bf3-b0df-fe06b7caf1f7",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "757acaf4-8171-4a62-8194-0ddd2248a556",
            "refuuid": "7f9dd819-750f-43f7-8f78-727af106aac7",
            "name": "TAGATOSE",
            "unii": "T7A20Y888Y",
            "linking_id": "T7A20Y888Y",
            "ref_pname": "TAGATOSE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "fcf29e87-fad5-4c34-991d-37d595b82991",
          "type": "SUBSTANCE->SUB_ALTERNATE",
          "related_substance": {
            "uuid": "73c50c7f-8922-45a9-88fa-377e05d0854f",
            "refuuid": "671238a5-6823-46bb-bd71-43d4d95897e9",
            "name": "ALTERNATIVE DEFINITION for [TAGATOSE]",
            "linking_id": "671238a5-6823-46bb-bd71-43d4d95897e9",
            "ref_pname": "NO NAME"
          }
        },
        {
          "uuid": "9a6d4296-4c99-43f5-8e9b-ac0668f045ca",
          "type": "TARGET->ACTIVATOR",
          "references": [
            "efb2aac6-4d7c-7c79-efb8-6922ddfaf8a8"
          ],
          "related_substance": {
            "uuid": "01b814d1-3339-487d-a047-43d7e4f5b739",
            "refuuid": "f554def7-ec5a-406c-abe3-627a05bd1d7c",
            "name": "GLUCOKINASE",
            "unii": "CMT726YV87",
            "linking_id": "CMT726YV87",
            "ref_pname": "GLUCOKINASE",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "ffddcf70-7c5b-4fc9-acb0-c7422a48fa35",
          "name": "D-(-)-TAGATOSE",
          "stdName": "D-(-)-TAGATOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "34c117fa-a3fe-4969-a53d-e0586045d991"
          ],
          "display_name": false
        },
        {
          "uuid": "4b2d7954-fc4e-4a37-af7c-93deb88d8ffb",
          "name": "D-LYXO-HEXULOSE",
          "stdName": "D-LYXO-HEXULOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6afa218a-9069-41ab-8978-e496ee8f2d05",
            "b83c9c53-7874-4166-b2e0-ddb4f8ad1378"
          ],
          "display_name": false
        },
        {
          "uuid": "e4f1775a-d73c-44b8-aae4-046a2cf4ef6b",
          "name": "D-TAGATOSE",
          "stdName": "D-TAGATOSE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff74a593-1719-49bc-b28e-7cf67d32d4f9",
            "abb95fce-ab01-477c-acc2-5641320d6919",
            "b83c9c53-7874-4166-b2e0-ddb4f8ad1378",
            "c918590f-ff3f-499d-80c2-b1862e7b8679",
            "47a59fa1-d558-420d-8e85-4f814771991b"
          ],
          "display_name": false
        },
        {
          "uuid": "9fc50e74-de31-4c27-8c02-d3be5d04f00a",
          "name": "D-TAGATOSE [FCC]",
          "stdName": "D-TAGATOSE [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff74a593-1719-49bc-b28e-7cf67d32d4f9",
            "b83c9c53-7874-4166-b2e0-ddb4f8ad1378"
          ],
          "display_name": false
        },
        {
          "uuid": "b3145122-aec2-4536-996e-cf393d5d5108",
          "name": "D-TAGATOSE [MI]",
          "stdName": "D-TAGATOSE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b83c9c53-7874-4166-b2e0-ddb4f8ad1378",
            "47a59fa1-d558-420d-8e85-4f814771991b"
          ],
          "display_name": false
        },
        {
          "uuid": "4bc1e19a-a840-4b5f-ae54-fdf5e9227eb4",
          "name": "NATURLOSE",
          "stdName": "NATURLOSE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6afa218a-9069-41ab-8978-e496ee8f2d05",
            "b83c9c53-7874-4166-b2e0-ddb4f8ad1378"
          ],
          "display_name": false
        },
        {
          "uuid": "20edf2d2-82c8-42a1-a450-80d0071c14ac",
          "name": "TAGATOSE",
          "stdName": "TAGATOSE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b25b6d7d-b1c8-499f-9be2-84ac6ade7327",
            "45383cbd-3871-4361-a29b-08e3b3333f81",
            "9795318d-348b-4109-a439-2475a3e51439",
            "e15bbb3a-4ae5-4020-bfe1-0e6e0a0fa1b3",
            "b83c9c53-7874-4166-b2e0-ddb4f8ad1378",
            "d18e3441-74be-459a-bf7b-3ff9cacd8cd2"
          ],
          "display_name": true
        },
        {
          "uuid": "0a02ac55-9824-4919-856a-1cc9eca3a9f0",
          "name": "TAGATOSE [MART.]",
          "stdName": "TAGATOSE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d18e3441-74be-459a-bf7b-3ff9cacd8cd2"
          ],
          "display_name": false
        },
        {
          "uuid": "1ce81780-86a0-4692-8162-a863afc43647",
          "name": "TAGATOSE [USP-RS]",
          "stdName": "TAGATOSE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9795318d-348b-4109-a439-2475a3e51439",
            "b83c9c53-7874-4166-b2e0-ddb4f8ad1378"
          ],
          "display_name": false
        },
        {
          "uuid": "40ce3d50-6e11-4c4d-9bda-1f264238fab9",
          "name": "TAGATOSE, D-",
          "stdName": "TAGATOSE, D-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7de3c71c-379b-437c-9862-f73e04b482a8",
            "eb0c3b3e-3b38-4360-af85-30198fb49316"
          ],
          "display_name": false
        },
        {
          "uuid": "8107645e-2ed8-4748-ad9f-3c775b844464",
          "name": "TAGATOSE, D- [II]",
          "stdName": "TAGATOSE, D- [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7de3c71c-379b-437c-9862-f73e04b482a8"
          ],
          "display_name": false
        }
      ],
      "modifications": {
        "uuid": "6651d0f8-34d9-439b-b7f7-b4b36a922eef"
      }
    }
  ]
}