{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "d0a462d9-7d9a-4477-95e4-72ed5e6b1377", "code": "T78SEL6WEF", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "e63e2f5b-b036-4f0b-aaa6-2a7ff9d56c70", "code": "25485-88-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=25485-88-5", "code_system": "CAS", "references": [ "13f5fd8a-9acb-4c3f-808c-45f4246d13d7", "e54d7d5a-db18-4bbd-94e9-4359010255c4" ] }, { "uuid": "50ee4b0d-3845-4c1b-b11b-4d98cf8bf5c3", "code": "101330", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/101330", "code_system": "PUBCHEM", "references": [ "13f5fd8a-9acb-4c3f-808c-45f4246d13d7" ] }, { "uuid": "084ff3e5-7720-6806-cc12-9c3bb326b911", "code": "DTXSID2051928", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2051928", "code_system": "EPA CompTox", "references": [ "dfb878fa-abfc-154b-321a-8b7d9bfdd6e6" ] }, { "uuid": "b4eb9b3b-700e-e884-bec1-a50ecf5a8f26", "code": "406675", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=406675", "code_system": "NSC", "references": [ "36a38006-2a0f-989c-0013-a77a622db429" ] } ], "substance_class": "chemical", "names": [ { "uuid": "ca6b79f3-416f-43e4-9412-6e5957476438", "name": "CYCLOHEXYL SALICYLATE", "stdName": "CYCLOHEXYL SALICYLATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "140a11e1-0651-466b-a8d7-7022c0e3504b" ], "display_name": true }, { "uuid": "f5cb7f16-0806-423a-9694-7845e6355477", "name": "Cyclohexyl 2-hydroxybenzoate", "stdName": "CYCLOHEXYL 2-HYDROXYBENZOATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "e54d7d5a-db18-4bbd-94e9-4359010255c4" ], "display_name": false }, { "uuid": "b6e4644a-ed6d-4202-b3ce-c8c5cf3ac353", "name": "NSC-406675", "stdName": "NSC-406675", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "25b80b2f-4f6a-48bb-a061-1aaa904da68e", "7e27ec00-f2f9-4efa-9de0-c81a6272c7d3" ], "display_name": false } ], "references": [ { "uuid": "140a11e1-0651-466b-a8d7-7022c0e3504b", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "25b80b2f-4f6a-48bb-a061-1aaa904da68e", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "7e27ec00-f2f9-4efa-9de0-c81a6272c7d3", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "13f5fd8a-9acb-4c3f-808c-45f4246d13d7", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391081000, "tags": [ "NOMEN" ] }, { "uuid": "229a3b95-fb72-4cda-ad02-db1f58d046c8", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "dfb878fa-abfc-154b-321a-8b7d9bfdd6e6", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=25485-88-5", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "36a38006-2a0f-989c-0013-a77a622db429", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "e54d7d5a-db18-4bbd-94e9-4359010255c4", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "2e278d39-13b6-4ebc-b5a5-fd62e9860728", "id": "2e278d39-13b6-4ebc-b5a5-fd62e9860728", "molfile": "\n Marvin 01132102292D \n\n 16 17 0 0 0 0 999 V2000\n 8.3962 -5.6185 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3962 -4.7936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1065 -4.3811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1065 -3.5561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3915 -3.1483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6811 -3.5561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6811 -4.3857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9662 -4.7982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2558 -4.3902 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9662 -5.6277 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2513 -6.0402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2513 -6.8652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5362 -7.2776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8259 -6.8652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8259 -6.0402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5362 -5.6277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 1 0 0 0 0\n 2 7 2 0 0 0 0\n 4 3 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 9 8 2 0 0 0 0\n 10 8 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 16 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\nM END", "smiles": "C1CCC(CC1)OC(=O)c2ccccc2O", "formula": "C13H16O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "4d73b4ea-9e64-4212-a2a8-26eeadaf2f8b" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "220.2648", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "ee3f4fed-f82f-45f0-b2de-725ac6fb7674", "version": "6", "structure": { "id": "969deff0-6ae9-4648-8993-decbc0dcab57", "molfile": "\n Marvin 01132107492D \n\n 16 17 0 0 0 0 999 V2000\n 6.9662 -4.7982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6811 -4.3857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3962 -4.7936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3962 -5.6185 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1065 -4.3811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1065 -3.5561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3915 -3.1483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6811 -3.5561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9662 -5.6277 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2513 -6.0402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2513 -6.8652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5362 -7.2776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8259 -6.8652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8259 -6.0402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5362 -5.6277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2558 -4.3902 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 3 2 0 0 0 0\n 6 5 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 2 2 0 0 0 0\n 9 1 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 10 1 0 0 0 0\n 16 1 2 0 0 0 0\nM END", "smiles": "C1CCC(CC1)OC(=O)c2ccccc2O", "formula": "C13H16O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "220.2648", "optical_activity": "NONE", "references": [ "229a3b95-fb72-4cda-ad02-db1f58d046c8", "e54d7d5a-db18-4bbd-94e9-4359010255c4" ], "stereo_centers": 0 }, "unii": "T78SEL6WEF" } ] }