{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "74384934-31c7-442f-91a9-55f22e03a3d7", "code": "T6T74PN7VH", "type": "PRIMARY", "code_system": "FDA UNII", "references": [ "8b6193e8-5df6-4bb2-8649-4c7e4be05401" ] }, { "uuid": "b38955a9-486f-4082-8d90-887534107b7a", "code": "2323070-48-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=2323070-48-8", "code_system": "CAS", "references": [ "8b6193e8-5df6-4bb2-8649-4c7e4be05401" ] }, { "uuid": "99e946f9-cc95-0700-3cce-e38afa833985", "code": "6325610", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6325610", "code_system": "PUBCHEM", "references": [ "5b3f4f22-e80d-3271-6ea4-a7646d5cbf86" ] } ], "substance_class": "chemical", "names": [ { "uuid": "641a3cdf-49e1-4bd7-acb8-b5a28e3a3b7a", "name": "2,7-Dihydro-3,8-dimethylanthra[1,9-bc:5,10-b'c′]dipyrrole-4,5,9,10-tetrone", "stdName": "2,7-DIHYDRO-3,8-DIMETHYLANTHRA(1,9-BC:5,10-B'C')DIPYRROLE-4,5,9,10-TETRONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "8b6193e8-5df6-4bb2-8649-4c7e4be05401" ], "display_name": true }, { "uuid": "448990c6-6627-9fc6-18c2-2f3d234b8609", "name": "6,14-DIMETHYL-4,12-DIAZAPENTACYCLO(8.6.1.12,5.013,17.09,18)OCTADECA-1(17),2,5,9(18),10,13-HEXAENE-7,8,15,16-TETRONE", "stdName": "6,14-DIMETHYL-4,12-DIAZAPENTACYCLO(8.6.1.12,5.013,17.09,18)OCTADECA-1(17),2,5,9(18),10,13-HEXAENE-7,8,15,16-TETRONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "719c3af9-fd36-1cbb-27bf-4d95cc9088d7" ], "display_name": false }, { "uuid": "6fa10766-d3c1-471e-9bdc-51947a3b889d", "name": "6,14-Dimethyl-4,12-diazapentacyclo[8.6.1.1^{2,5}.0^{13,17}.0^{9,18}]octadeca-1(17),2,5,9(18),10,13-hexaene-7,8,15,16-tetrone", "stdName": "6,14-DIMETHYL-4,12-DIAZAPENTACYCLO(8.6.1.1^(2,5).0^(13,17).0^(9,18))OCTADECA-1(17),2,5,9(18),10,13-HEXAENE-7,8,15,16-TETRONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "8b6193e8-5df6-4bb2-8649-4c7e4be05401" ], "display_name": false }, { "uuid": "0313a6db-767b-44aa-a9d7-8dce984e8edb", "name": "Anthra[1,9-bc:5,10-b'c′]dipyrrole-4,5,9,10-tetrone, 2,7-dihydro-3,8-dimethyl-", "stdName": "ANTHRA(1,9-BC:5,10-B'C')DIPYRROLE-4,5,9,10-TETRONE, 2,7-DIHYDRO-3,8-DIMETHYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "8b6193e8-5df6-4bb2-8649-4c7e4be05401" ], "display_name": false } ], "references": [ { "uuid": "719c3af9-fd36-1cbb-27bf-4d95cc9088d7", "citation": "ZINC", "url": "http://zinc.docking.org/substances/subsets/in-vivo/", "doc_type": "WEBSITE", "public_domain": true }, { "uuid": "8b6193e8-5df6-4bb2-8649-4c7e4be05401", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "5b3f4f22-e80d-3271-6ea4-a7646d5cbf86", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "6f228031-d741-4c6e-24f5-475015a232d1", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "fdf0d206-dcb7-44de-8056-d168d0df5da0", "id": "fdf0d206-dcb7-44de-8056-d168d0df5da0", "molfile": "\n Marvin 01132113092D \n\n 24 28 0 0 0 0 999 V2000\n -1.2822 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2822 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.9967 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7112 -0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.9967 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7112 0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2822 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1960 1.6455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7480 2.2586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3355 2.9730 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5286 2.8015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2251 3.1461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2251 3.9711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9396 2.7336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6541 3.1461 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9396 1.9086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6541 1.4961 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2251 1.4961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2169 0.6674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7018 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2169 -0.6674 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5678 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5678 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4423 1.9810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 22 2 2 0 0 0 0\n 3 4 2 0 0 0 0\n 3 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 5 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 23 7 2 0 0 0 0\n 8 9 2 0 0 0 0\n 24 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 24 11 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 14 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 16 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 24 2 0 0 0 0\n 19 20 2 0 0 0 0\n 23 19 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\nM END", "smiles": "Cc1c2c3c(c[nH]2)c4c5c(c[nH]c5c(C)c(=O)c4=O)c3c(=O)c1=O", "formula": "C18H10N2O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "abb1ee5b-1958-49e4-aac8-6db5f58030c0" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "318.2837", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "cb548a1e-3d92-4cb5-95ae-54a7bc220d66", "version": "7", "structure": { "id": "4ca15b36-90a4-4de1-85ff-cc15b2e7acd9", "molfile": "ZINC000012496246\n Marvin 01132104002D \n\n 24 28 0 0 0 0 999 V2000\n -1.2822 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2822 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.9967 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7112 -0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.9967 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7112 0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2822 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1960 1.6455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7480 2.2586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3355 2.9730 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5286 2.8015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2251 3.1461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2251 3.9711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9396 2.7336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6541 3.1461 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9396 1.9086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6541 1.4961 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2251 1.4961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2169 0.6674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7018 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2169 -0.6674 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5678 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5678 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4423 1.9810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 3 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 5 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 12 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 14 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 16 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 18 24 2 0 0 0 0\n 22 2 2 0 0 0 0\n 23 7 2 0 0 0 0\n 24 8 1 0 0 0 0\n 24 11 1 0 0 0 0\n 23 19 1 0 0 0 0\nM END", "smiles": "Cc1c2c3c(c[nH]2)c4c5c(c[nH]c5c(C)c(=O)c4=O)c3c(=O)c1=O", "formula": "C18H10N2O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "318.2837", "optical_activity": "NONE", "references": [ "719c3af9-fd36-1cbb-27bf-4d95cc9088d7", "8b6193e8-5df6-4bb2-8649-4c7e4be05401" ], "stereo_centers": 0 }, "unii": "T6T74PN7VH" } ] }