{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2e18646b-4047-4d53-9b4e-74145dfc60f9",
          "code": "173994-77-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=173994-77-9",
          "code_system": "CAS",
          "references": [
            "214e827a-8c0d-4ba0-a656-b725667a9d3d",
            "808bba69-bac0-4bb6-aa99-3a4105addd8a"
          ]
        },
        {
          "uuid": "86d536f9-a4d3-441a-9066-54b58ae650ff",
          "code": "22715265",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/22715265",
          "code_system": "PUBCHEM",
          "references": [
            "214e827a-8c0d-4ba0-a656-b725667a9d3d"
          ]
        },
        {
          "uuid": "26ed7145-0d9a-42ec-aea6-6e9907719acd",
          "code": "T60KLL74PP",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "396fce18-bad2-513a-57b9-806efe9f2284",
          "code": "DTXSID30938448",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30938448",
          "code_system": "EPA CompTox",
          "references": [
            "b13d3960-1663-74f3-1d44-183eab1e8ef7"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5a3b8146-512e-454a-ba8d-a1b647765e91",
          "name": "1H-PYRAZOLE-4,5-DIAMINE, 1-((4-METHYLPHENYL)METHYL)-, SULFATE (2:1)",
          "stdName": "1H-PYRAZOLE-4,5-DIAMINE, 1-((4-METHYLPHENYL)METHYL)-, SULFATE (2:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8fd7fede-d2df-4432-a941-5f04521a8a0b",
            "75c42d1b-0fe2-441c-a76e-696483c2927b"
          ],
          "display_name": false
        },
        {
          "uuid": "3cdb42d5-a156-4cfe-81f8-8ddff79c8c13",
          "name": "4-METHYLBENZYL 4,5-DIAMINO PYRAZOLE SULFATE",
          "stdName": "4-METHYLBENZYL 4,5-DIAMINO PYRAZOLE SULFATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "83b4801f-725c-4775-8836-d429dd64a07d",
            "7fcc1b97-1c94-4931-bbbc-edc34163add3",
            "75c42d1b-0fe2-441c-a76e-696483c2927b"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "dbb5dc1a-5a76-4c34-a7e8-0284f5668cae",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "8fd7fede-d2df-4432-a941-5f04521a8a0b",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "75c42d1b-0fe2-441c-a76e-696483c2927b",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7fcc1b97-1c94-4931-bbbc-edc34163add3",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "214e827a-8c0d-4ba0-a656-b725667a9d3d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391408000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "69b81216-d674-4acf-84e5-02587466b38a",
          "citation": "SRS import [T60KLL74PP]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=T60KLL74PP",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391408000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "83b4801f-725c-4775-8836-d429dd64a07d",
          "citation": "4-METHYLBENZYL 4,5-DIAMINO PYRAZOLE SULFATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "808bba69-bac0-4bb6-aa99-3a4105addd8a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b13d3960-1663-74f3-1d44-183eab1e8ef7",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "30ec9f9d-d78c-4422-9693-64be44c859d1",
          "id": "30ec9f9d-d78c-4422-9693-64be44c859d1",
          "molfile": "\n  Marvin  01132102372D          \n\n  5  4  0  0  0  0            999 V2000\n    8.2741   -1.5176    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8610   -2.0999    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2741   -2.6820    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4432   -1.5176    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4432   -2.6820    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  2  0  0  0  0\n  2  5  2  0  0  0  0\nM  END",
          "smiles": "OS(=O)(=O)O",
          "formula": "H2O4S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "fb508d46-6d00-4e56-8c7d-52e5c2363ccb"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "98.0796",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "115c5cd6-7d07-441b-8022-9b341a746c5b",
          "id": "115c5cd6-7d07-441b-8022-9b341a746c5b",
          "molfile": "\n  Marvin  01132101072D          \n\n 15 16  0  0  0  0            999 V2000\n    3.6820   -0.7053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6820   -1.5300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9674   -1.9424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9674   -2.7672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6820   -3.1796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6820   -3.9997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3965   -4.4122    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4795   -5.2319    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2886   -5.4060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7010   -4.6915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5161   -4.6039    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1458   -4.0769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3199   -3.2725    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3965   -2.7672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3965   -1.9424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n 15  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 14  2  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n 12  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 14 15  1  0  0  0  0\nM  END",
          "smiles": "Cc1ccc(cc1)Cn2c(c(cn2)N)N",
          "formula": "C11H14N4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "41f1a211-c201-4b5c-99e6-e0048cf7a047"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "202.2561",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "820110c4-69b7-4f2f-bb79-53059cc9578d",
      "version": "7",
      "structure": {
        "id": "08b70718-d314-4a7a-a6e8-3cf9d1a4c610",
        "molfile": "\n  Marvin  01132100432D          \n\n 20 20  0  0  0  0            999 V2000\n    8.8445   -2.0960    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4256   -1.5148    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4256   -2.6770    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2587   -1.5148    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2587   -2.6770    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3965   -1.9424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3965   -2.7672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6820   -3.1796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9674   -2.7672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9674   -1.9424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6820   -1.5300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6820   -0.7053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6820   -3.9997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3965   -4.4122    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4795   -5.2319    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2886   -5.4060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7010   -4.6915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1458   -4.0769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3199   -3.2725    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5161   -4.6039    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  3  2  0  0  0  0\n  1  4  1  0  0  0  0\n  1  5  1  0  0  0  0\n  1  2  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n  6 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n  8 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 14  1  0  0  0  0\n 18 19  1  0  0  0  0\n 17 20  1  0  0  0  0\nM  END",
        "smiles": "Cc1ccc(cc1)Cn2c(c(cn2)N)N.OS(=O)(=O)O",
        "formula": "C11H14N4.H2O4S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "300.3357",
        "optical_activity": "NONE",
        "references": [
          "7fcc1b97-1c94-4931-bbbc-edc34163add3",
          "69b81216-d674-4acf-84e5-02587466b38a"
        ],
        "stereo_centers": 0
      },
      "unii": "T60KLL74PP"
    }
  ]
}