{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "026af4fa-b6f3-4c34-a66e-06e7c039cbb2",
          "code": "29022-11-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=29022-11-5",
          "code_system": "CAS",
          "references": [
            "ae28006a-5aa7-42ec-ad65-f1f516ac4d50",
            "1be42783-ba76-451e-a092-85bf85317247"
          ]
        },
        {
          "uuid": "6df8b1a7-884e-4b3a-b765-7c09d6757f32",
          "code": "249-373-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.044.871",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "ae28006a-5aa7-42ec-ad65-f1f516ac4d50"
          ]
        },
        {
          "uuid": "04df9871-d408-4aa1-81c0-dc8c5d291660",
          "code": "93124",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/93124",
          "code_system": "PUBCHEM",
          "references": [
            "ae28006a-5aa7-42ec-ad65-f1f516ac4d50"
          ]
        },
        {
          "uuid": "7242b2f0-f4b3-d706-e462-bf462fabd1fd",
          "code": "DTXSID60183262",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60183262",
          "code_system": "EPA CompTox",
          "references": [
            "f17f12fb-fb26-4107-321d-61e434fd5448"
          ]
        },
        {
          "uuid": "ee256a06-954c-4ece-87c1-2a26593287c2",
          "code": "T5AMN9BP5V",
          "type": "PRIMARY",
          "code_system": "FDA UNII",
          "references": [
            "1be42783-ba76-451e-a092-85bf85317247"
          ]
        },
        {
          "uuid": "9e3fc58b-8075-e477-96a6-a899d6257530",
          "code": "334288",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=334288",
          "code_system": "NSC",
          "references": [
            "da64bc7b-62b7-2217-544f-3ef3796ba978"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2a26be73-c001-425a-9f5d-3f8af2af87ad",
          "name": "2-[[[(9H-Fluoren-9-yl)methoxy]carbonyl]amino]acetic acid",
          "stdName": "2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)ACETIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1be42783-ba76-451e-a092-85bf85317247"
          ],
          "display_name": false
        },
        {
          "uuid": "4f7e2b8d-1198-4eab-988e-fd65dd6b436d",
          "name": "2-[[[(9H-Fluoren-9-yl)methoxy]carbonyl]amino]ethanoic acid",
          "stdName": "2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)ETHANOIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1be42783-ba76-451e-a092-85bf85317247"
          ],
          "display_name": false
        },
        {
          "uuid": "bb27eae3-4737-4c0d-9a42-6b7062d53071",
          "name": "Fmoc glycine",
          "stdName": "FMOC GLYCINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1be42783-ba76-451e-a092-85bf85317247"
          ],
          "display_name": false
        },
        {
          "uuid": "5cd56deb-b142-4069-af9b-6f9adfb5b05e",
          "name": "Fmoc-Gly-OH",
          "stdName": "FMOC-GLY-OH",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1be42783-ba76-451e-a092-85bf85317247"
          ],
          "display_name": true
        },
        {
          "uuid": "244f57ad-e7ff-49b1-92dd-0cb0897064f7",
          "name": "Glycine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-",
          "stdName": "GLYCINE, N-((9H-FLUOREN-9-YLMETHOXY)CARBONYL)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1be42783-ba76-451e-a092-85bf85317247"
          ],
          "display_name": false
        },
        {
          "uuid": "bb845298-201c-44ea-8f3a-1c5bb46b9787",
          "name": "Glycine, N-carboxy-, N-(fluoren-9-ylmethyl) ester",
          "stdName": "GLYCINE, N-CARBOXY-, N-(FLUOREN-9-YLMETHYL) ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1be42783-ba76-451e-a092-85bf85317247"
          ],
          "display_name": false
        },
        {
          "uuid": "063ce0bb-ade9-4668-81e4-8142a8979b1e",
          "name": "N-(9-Fluorenylmethoxycarbonyl)glycine",
          "stdName": "N-(9-FLUORENYLMETHOXYCARBONYL)GLYCINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1be42783-ba76-451e-a092-85bf85317247"
          ],
          "display_name": false
        },
        {
          "uuid": "b65458e8-cc3c-43f7-8295-5d87535bbf77",
          "name": "N-(9H-(FLUOREN-9-YLMETHOXY)CARBONYL)GLYCINE",
          "stdName": "N-(9H-(FLUOREN-9-YLMETHOXY)CARBONYL)GLYCINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1674bc7c-64c1-4fb0-8065-603faf2f5947",
            "685b089e-bed0-46db-a5e4-24d898638ad8"
          ],
          "display_name": false
        },
        {
          "uuid": "a652634e-1710-4080-b242-d678943d9095",
          "name": "N-Fluorenylmethoxycarbonylglycine",
          "stdName": "N-FLUORENYLMETHOXYCARBONYLGLYCINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1be42783-ba76-451e-a092-85bf85317247"
          ],
          "display_name": false
        },
        {
          "uuid": "7917a7b4-925d-4c17-84e9-747662c89da4",
          "name": "NPC-14692",
          "stdName": "NPC-14692",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1be42783-ba76-451e-a092-85bf85317247"
          ],
          "display_name": false
        },
        {
          "uuid": "1fed882e-304d-eb8f-cf59-36fdb6117421",
          "name": "NSC-334288",
          "stdName": "NSC-334288",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "da64bc7b-62b7-2217-544f-3ef3796ba978"
          ],
          "display_name": false
        },
        {
          "uuid": "abc763a7-4222-4a84-bb45-ca6436f296d5",
          "name": "[[[(9H-Fluoren-9-yl)methoxy]carbonyl]amino]acetic acid",
          "stdName": "((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)ACETIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1be42783-ba76-451e-a092-85bf85317247"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "685b089e-bed0-46db-a5e4-24d898638ad8",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1674bc7c-64c1-4fb0-8065-603faf2f5947",
          "citation": "EPA",
          "doc_type": "EPA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ae28006a-5aa7-42ec-ad65-f1f516ac4d50",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393986000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f17f12fb-fb26-4107-321d-61e434fd5448",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=29022-11-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "da64bc7b-62b7-2217-544f-3ef3796ba978",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "1be42783-ba76-451e-a092-85bf85317247",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "104979b1-1b2e-4fe8-a743-59ce9bbf26be",
          "id": "104979b1-1b2e-4fe8-a743-59ce9bbf26be",
          "molfile": "\n  CDK     07102419112D\n\n 22 24  0  0  0  0  0  0  0  0999 V2000\n   28.0520  -13.4420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.5408  -11.9548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.4904  -10.8004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.9616  -11.1228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.4832  -12.6100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.5232  -13.7644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.9232  -12.6100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.8832  -13.7644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.3544  -13.4420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.8760  -11.9548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.9160  -10.8004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.4448  -11.1228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.7032  -10.2076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.7032   -8.6476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.3523   -7.8676    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.3523   -6.3076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.7032   -5.5276    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   22.0012   -5.5276    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   22.0012   -3.9676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.6502   -3.1876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.2992   -3.9676    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.6502   -1.6276    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  1  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n  7 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n  4 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 20 22  1  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)-c3ccccc3C2COC(=O)NCC(=O)O",
          "formula": "C17H15NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e938d8e9-e8e5-4ecf-8f63-f562e563f41e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "297.3059",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "039e8f6d-f06c-4071-b12b-ecbc5080d5b5",
      "version": "12",
      "structure": {
        "id": "05cec74d-1d9d-4b85-b379-4365ff841fb5",
        "molfile": "\n   JSDraw207102419112D\n\n 22 24  0  0  0  0              0 V2000\n   28.0520  -13.4420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.5408  -11.9548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.4904  -10.8004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.9616  -11.1228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.4832  -12.6100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.5232  -13.7644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.9232  -12.6100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.8832  -13.7644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.3544  -13.4420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.8760  -11.9548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.9160  -10.8004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.4448  -11.1228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.7032  -10.2076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.7032   -8.6476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.3523   -7.8676    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.3523   -6.3076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.7032   -5.5276    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   22.0012   -5.5276    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   22.0012   -3.9676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.6502   -3.1876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.2992   -3.9676    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.6502   -1.6276    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  1  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n  7 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n  4 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 20 22  1  0  0  0  0\nM  END",
        "smiles": "c1ccc2c(c1)-c3ccccc3C2COC(=O)NCC(=O)O",
        "formula": "C17H15NO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "297.3059",
        "optical_activity": "NONE",
        "references": [
          "685b089e-bed0-46db-a5e4-24d898638ad8",
          "1be42783-ba76-451e-a092-85bf85317247"
        ],
        "stereo_centers": 0
      },
      "unii": "T5AMN9BP5V"
    }
  ]
}