{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "91bb2cf8-6402-41ef-816f-399564fbb36f", "code": "206659-84-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=206659-84-9", "code_system": "CAS", "references": [ "61a5fa41-4e5c-4eba-893a-9b7e593e8030", "b338fdbb-00b0-4c09-88f8-6f41cdd21412" ] }, { "uuid": "439118e7-197c-4a2a-9b98-d636ade19219", "code": "71587635", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71587635", "code_system": "PUBCHEM", "references": [ "61a5fa41-4e5c-4eba-893a-9b7e593e8030" ] }, { "uuid": "b3a6b9b7-1a35-4e2d-9668-8cf076311037", "code": "T55ULQ060E", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "00dcf9ac-b2f0-7fa6-7570-83eec86b809d", "code": "DTXSID50174705", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50174705", "code_system": "EPA CompTox", "references": [ "001ce971-c826-163a-0268-a5ef58df16d1" ] } ], "substance_class": "chemical", "names": [ { "uuid": "3239fdab-6e35-45c7-8ed0-f8c97f2f5705", "name": "DIHYDROPHYTOSTERYL OCTYLDECANOATE", "stdName": "DIHYDROPHYTOSTERYL OCTYLDECANOATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "e43d176e-d632-47f7-b27e-53872a009f42", "55028fbe-4af1-40fc-8920-562d4914a6fe", "bcc1eaf4-211d-4e98-b045-41917e37a3e0" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "25ca8e59-1ab6-4020-bee4-211c33cfced9", "name_org": "INCI" } ] }, { "uuid": "5820c6cf-99dc-443d-9620-e49f6ba53daf", "name": "NIKKOL DPIS", "stdName": "NIKKOL DPIS", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "e43d176e-d632-47f7-b27e-53872a009f42", "e48d0260-cc37-4839-adbe-ceb471e1c8bc" ], "display_name": false }, { "uuid": "4746a664-2adb-4519-b16f-ad35c8d513c5", "name": "STIGMASTAN-3-OL, 2-OCTYLDECANOATE, (3.BETA.,5.BETA.)-", "stdName": "STIGMASTAN-3-OL, 2-OCTYLDECANOATE, (3.BETA.,5.BETA.)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e43d176e-d632-47f7-b27e-53872a009f42", "e48d0260-cc37-4839-adbe-ceb471e1c8bc" ], "display_name": false } ], "references": [ { "uuid": "55028fbe-4af1-40fc-8920-562d4914a6fe", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "e43d176e-d632-47f7-b27e-53872a009f42", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e48d0260-cc37-4839-adbe-ceb471e1c8bc", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "61a5fa41-4e5c-4eba-893a-9b7e593e8030", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391490000, "tags": [ "NOMEN" ] }, { "uuid": "3bd499fa-9cca-4b2d-bba1-6b29b75dcf51", "citation": "SRS import [T55ULQ060E]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=T55ULQ060E", "doc_type": "SRS", "public_domain": true, "document_date": 1493391490000, "tags": [ "NOMEN" ] }, { "uuid": "bcc1eaf4-211d-4e98-b045-41917e37a3e0", "citation": "DIHYDROPHYTOSTERYL OCTYLDECANOATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "dc1a9ea2-9d1c-45c9-524d-e525ee938b4f", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=206659-84-9", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "b338fdbb-00b0-4c09-88f8-6f41cdd21412", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "001ce971-c826-163a-0268-a5ef58df16d1", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "27f7193d-9a42-45ad-be89-f45c6ca6e3ae", "id": "27f7193d-9a42-45ad-be89-f45c6ca6e3ae", "molfile": "\n Marvin 01132102112D \n\n 49 52 0 0 1 0 999 V2000\n 10.7228 -1.6791 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 10.6653 -0.8561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9238 -0.4944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0389 -2.1404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0965 -2.9634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4125 -3.4247 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 8.6710 -3.0631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4700 -4.2477 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 9.9549 -4.9151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4700 -5.5826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6854 -5.3277 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 7.9709 -5.7401 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 7.9709 -6.5651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2564 -6.9777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5420 -6.5651 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 5.8275 -6.9777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1131 -6.5651 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 5.1130 -5.7401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8275 -5.3277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5420 -5.7401 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 6.5420 -4.9151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2564 -5.3277 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 7.2564 -4.5027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9709 -4.0901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6854 -4.5027 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 8.7716 -3.6821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3986 -6.9777 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3986 -7.8027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6841 -8.2151 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1131 -8.2151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8275 -7.8027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5420 -8.2151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2564 -7.8027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9709 -8.2151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6854 -7.8027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3998 -8.2151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1143 -7.8026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8288 -8.2151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1131 -9.0401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8275 -9.4527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8275 -10.2776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5420 -10.6901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5420 -11.5151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2564 -11.9276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2564 -12.7526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9709 -13.1651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4643 -2.0407 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 12.1483 -1.5794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5219 -2.8637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 4 1 0 0 0 0\n 1 47 1 1 0 0 0\n 2 3 1 0 0 0 0\n 4 5 1 0 0 0 0\n 6 5 1 0 0 0 0\n 6 7 1 6 0 0 0\n 6 8 1 0 0 0 0\n 8 9 1 1 0 0 0\n 8 25 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 1 0 0 0\n 11 12 1 0 0 0 0\n 25 11 1 0 0 0 0\n 12 13 1 6 0 0 0\n 12 22 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 1 0 0 0 0\n 15 16 1 6 0 0 0\n 20 15 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 27 1 1 0 0 0\n 18 19 1 0 0 0 0\n 20 19 1 0 0 0 0\n 20 21 1 1 0 0 0\n 22 20 1 0 0 0 0\n 22 23 1 1 0 0 0\n 23 24 1 0 0 0 0\n 25 24 1 0 0 0 0\n 25 26 1 1 0 0 0\n 27 28 1 0 0 0 0\n 28 29 2 0 0 0 0\n 28 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 30 39 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 34 35 1 0 0 0 0\n 35 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 37 38 1 0 0 0 0\n 39 40 1 0 0 0 0\n 40 41 1 0 0 0 0\n 41 42 1 0 0 0 0\n 42 43 1 0 0 0 0\n 43 44 1 0 0 0 0\n 44 45 1 0 0 0 0\n 45 46 1 0 0 0 0\n 48 47 1 0 0 0 0\n 49 47 1 0 0 0 0\nM END", "smiles": "CCCCCCCCC(CCCCCCCC)C(=O)O[C@H]1CC[C@@]2(C)[C@H](CC[C@H]3[C@@H]4CC[C@H]([C@H](C)CC[C@@H](CC)C(C)C)[C@@]4(C)CC[C@@H]32)C1", "formula": "C47H86O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "63052476-0137-4f81-ab63-ffc7bad73bb1" }, "defined_stereo": 10, "ez_centers": 0, "molecular_weight": "683.1863", "optical_activity": "UNSPECIFIED", "stereo_centers": 10 } ], "definition_level": "COMPLETE", "uuid": "5b29e5fd-e6aa-47ac-970c-643a321003a9", "version": "6", "structure": { "id": "a1896c35-1a24-4c8b-8acb-c32297b1e5d5", "molfile": "\n Marvin 01132108232D \n\n 54 57 0 0 1 0 999 V2000\n 8.6710 -3.0631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1483 -1.5794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5219 -2.8637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4643 -2.0407 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 9.9238 -0.4944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6653 -0.8561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7228 -1.6791 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 10.0389 -2.1404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0965 -2.9634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4125 -3.4247 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 8.7716 -6.1481 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2564 -6.1527 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9709 -4.9151 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5420 -7.3901 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5420 -4.9151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6841 -8.2151 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8288 -8.2151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1143 -7.8026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3998 -8.2151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6854 -7.8027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9709 -8.2151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2564 -7.8027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5420 -8.2151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8275 -7.8027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9709 -13.1651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2564 -12.7526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2564 -11.9276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5420 -11.5151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5420 -10.6901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8275 -10.2776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8275 -9.4527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1131 -9.0401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1131 -8.2151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3986 -7.8027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3986 -6.9777 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8275 -6.9777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1131 -6.5651 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 5.1130 -5.7401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8275 -5.3277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5420 -5.7401 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 6.5420 -6.5651 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.2564 -6.9777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9709 -6.5651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9709 -5.7401 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.2564 -5.3277 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.2564 -4.5027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9709 -4.0901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7716 -3.6821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6854 -4.5027 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.6854 -5.3277 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 9.4700 -5.5826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9549 -4.9151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4700 -4.2477 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 10.1845 -3.8352 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 10 1 1 6 0 0 0\n 2 4 1 0 0 0 0\n 3 4 1 0 0 0 0\n 7 4 1 1 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 53 1 0 0 0 0\n 50 11 1 6 0 0 0\n 53 49 1 0 0 0 0\n 45 12 1 6 0 0 0\n 44 13 1 1 0 0 0\n 41 14 1 1 0 0 0\n 40 15 1 1 0 0 0\n 34 16 2 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 20 19 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 1 0 0 0 0\n 33 24 1 0 0 0 0\n 26 25 1 0 0 0 0\n 27 26 1 0 0 0 0\n 28 27 1 0 0 0 0\n 29 28 1 0 0 0 0\n 30 29 1 0 0 0 0\n 31 30 1 0 0 0 0\n 32 31 1 0 0 0 0\n 33 32 1 0 0 0 0\n 34 33 1 0 0 0 0\n 35 34 1 0 0 0 0\n 37 35 1 1 0 0 0\n 36 41 1 0 0 0 0\n 36 37 1 0 0 0 0\n 37 38 1 0 0 0 0\n 38 39 1 0 0 0 0\n 39 40 1 0 0 0 0\n 40 45 1 0 0 0 0\n 41 40 1 0 0 0 0\n 41 42 1 0 0 0 0\n 42 43 1 0 0 0 0\n 43 44 1 0 0 0 0\n 44 50 1 0 0 0 0\n 45 44 1 0 0 0 0\n 46 45 1 0 0 0 0\n 46 47 1 0 0 0 0\n 47 49 1 0 0 0 0\n 49 48 1 1 0 0 0\n 50 49 1 0 0 0 0\n 51 50 1 0 0 0 0\n 51 52 1 0 0 0 0\n 52 53 1 0 0 0 0\n 53 54 1 6 0 0 0\nM END", "smiles": "CCCCCCCCC(CCCCCCCC)C(=O)O[C@H]1CC[C@@]2(C)[C@]([H])(CC[C@@]3([H])[C@]4([H])CC[C@]([H])([C@H](C)CC[C@@H](CC)C(C)C)[C@@]4(C)CC[C@@]32[H])C1", "formula": "C47H86O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 10, "ez_centers": 0, "molecular_weight": "683.1863", "optical_activity": "UNSPECIFIED", "references": [ "3bd499fa-9cca-4b2d-bba1-6b29b75dcf51", "e48d0260-cc37-4839-adbe-ceb471e1c8bc" ], "stereo_centers": 10 }, "unii": "T55ULQ060E" } ] }