{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "d6d5669d-297f-4947-8d22-338189318ea8", "code": "199986-75-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=199986-75-9", "code_system": "CAS", "references": [ "b1469e57-b5c1-45ee-8579-da95539b92c6", "24c64f5f-4e78-44fd-afb0-920aaeec10f3" ] }, { "uuid": "49956936-48ab-43d7-bacb-ba153d98cdcd", "code": "6918386", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6918386", "code_system": "PUBCHEM", "references": [ "b1469e57-b5c1-45ee-8579-da95539b92c6" ] }, { "uuid": "9a0c1e18-383e-77d5-f177-e46868aef6c7", "code": "DTXSID30173812", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30173812", "code_system": "EPA CompTox", "references": [ "8d96fc45-b7e9-6984-eb13-9b762f7e2485" ] }, { "uuid": "a677cf14-c2f3-40d1-bd49-951e2f500e2e", "code": "T5490K8I7S", "type": "PRIMARY", "code_system": "FDA UNII" } ], "relationships": [ { "uuid": "ad61f563-344d-47c1-a9fe-318a431a7403", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "4335570a-b483-4083-8991-ec67f32f1ce0", "refuuid": "67c38bbb-f5e3-448d-ad5f-38da60829bac", "name": "CVT-313", "unii": "T5490K8I7S", "linking_id": "T5490K8I7S", "ref_pname": "CVT-313", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "c7e4de9b-0a9a-43a7-8172-3c03bd193293", "name": "CVT-313", "stdName": "CVT-313", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "1412dc32-2e70-405d-aec5-ed3fbabeb86e", "97a5ed34-ced4-48b0-a447-76d805385b14" ], "display_name": true }, { "uuid": "a888c9df-ff28-428e-a4ca-32e858b09cb0", "name": "ETHANOL, 2,2'-((6-(((4-METHOXYPHENYL)METHYL)AMINO)-9-(1-METHYLETHYL)-9H-PURIN-2-YL)IMINO)BIS-", "stdName": "ETHANOL, 2,2'-((6-(((4-METHOXYPHENYL)METHYL)AMINO)-9-(1-METHYLETHYL)-9H-PURIN-2-YL)IMINO)BIS-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "1412dc32-2e70-405d-aec5-ed3fbabeb86e", "97a5ed34-ced4-48b0-a447-76d805385b14" ], "display_name": false }, { "uuid": "95404fac-a5c0-4926-850c-9420f09fac1b", "name": "NG-36", "stdName": "NG-36", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "1412dc32-2e70-405d-aec5-ed3fbabeb86e", "97a5ed34-ced4-48b0-a447-76d805385b14" ], "display_name": false } ], "references": [ { "uuid": "1412dc32-2e70-405d-aec5-ed3fbabeb86e", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "97a5ed34-ced4-48b0-a447-76d805385b14", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b1469e57-b5c1-45ee-8579-da95539b92c6", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392519000, "tags": [ "NOMEN" ] }, { "uuid": "f62074f5-4418-40c4-ba7b-bca9bc1635a7", "citation": "SRS import [T5490K8I7S]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=T5490K8I7S", "doc_type": "SRS", "public_domain": true, "document_date": 1493392519000, "tags": [ "NOMEN" ] }, { "uuid": "8d96fc45-b7e9-6984-eb13-9b762f7e2485", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=199986-75-9", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "24c64f5f-4e78-44fd-afb0-920aaeec10f3", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "a154f4fd-9d29-4e1b-87c3-5d1e1a9b157d", "id": "a154f4fd-9d29-4e1b-87c3-5d1e1a9b157d", "molfile": "\n Marvin 01132108232D \n\n 29 31 0 0 0 0 999 V2000\n 4.2012 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4867 -2.0625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7722 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7722 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0578 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3433 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6288 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0857 -0.8250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8001 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8001 0.4125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5146 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2291 0.4125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2291 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8422 -0.9645 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5066 -1.7182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6861 -1.6320 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5146 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6491 -0.7930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9041 -0.0084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2012 -1.4061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5146 1.6500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8001 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0857 1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6288 2.0625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2291 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9435 1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6580 2.0625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3433 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0578 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 3 29 2 0 0 0 0\n 5 4 2 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 6 28 2 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 2 0 0 0 0\n 9 17 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 2 0 0 0 0\n 21 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 13 17 2 0 0 0 0\n 15 14 1 0 0 0 0\n 14 18 1 0 0 0 0\n 16 15 2 0 0 0 0\n 16 17 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 20 1 0 0 0 0\n 21 22 1 0 0 0 0\n 21 25 1 0 0 0 0\n 23 22 1 0 0 0 0\n 23 24 1 0 0 0 0\n 26 25 1 0 0 0 0\n 26 27 1 0 0 0 0\n 29 28 1 0 0 0 0\nM END", "smiles": "CC(C)n1cnc2c(NCc3ccc(cc3)OC)nc(nc21)N(CCO)CCO", "formula": "C20H28N6O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "3c1349be-6460-4b16-98d5-e1b22b60e6e3" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "400.4755", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "67c38bbb-f5e3-448d-ad5f-38da60829bac", "version": "3", "structure": { "id": "cb3f7380-4028-4e50-b19f-3b6bd77a4a0e", "molfile": "\n Marvin 01132110302D \n\n 29 31 0 0 0 0 999 V2000\n -1.5146 1.6500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6861 -1.6320 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5066 -1.7182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8422 -0.9645 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2291 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2291 0.4125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5146 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8001 0.4125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8001 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5146 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6491 -0.7930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9041 -0.0084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2012 -1.4061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0857 -0.8250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6288 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3433 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0578 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7722 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7722 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0578 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3433 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4867 -2.0625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2012 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0857 1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8001 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6288 2.0625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9435 1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2291 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6580 2.0625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 2 10 1 0 0 0 0\n 5 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 1 0 0 0 0\n 4 11 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 2 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 16 21 2 0 0 0 0\n 22 23 1 0 0 0 0\n 19 22 1 0 0 0 0\n 15 16 1 0 0 0 0\n 14 15 1 0 0 0 0\n 9 14 1 0 0 0 0\n 1 7 1 0 0 0 0\n 24 25 1 0 0 0 0\n 24 26 1 0 0 0 0\n 1 25 1 0 0 0 0\n 27 28 1 0 0 0 0\n 27 29 1 0 0 0 0\n 1 28 1 0 0 0 0\nM END", "smiles": "CC(C)n1cnc2c(NCc3ccc(cc3)OC)nc(nc21)N(CCO)CCO", "formula": "C20H28N6O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "400.4755", "optical_activity": "NONE", "references": [ "1412dc32-2e70-405d-aec5-ed3fbabeb86e", "f62074f5-4418-40c4-ba7b-bca9bc1635a7" ], "stereo_centers": 0 }, "unii": "T5490K8I7S" } ] }