{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "46cc8288-d9f2-494b-9f07-aa5ad53975d2",
          "code": "17418-58-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=17418-58-5",
          "code_system": "CAS",
          "references": [
            "a9070bfd-ad18-4297-b243-bfc03c01bc48",
            "a0d31007-e579-40f2-98d6-327f3a35bbfb"
          ]
        },
        {
          "uuid": "b3430e94-02f7-4004-b4c5-eaa615652b8f",
          "code": "241-442-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.037.659",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a9070bfd-ad18-4297-b243-bfc03c01bc48"
          ]
        },
        {
          "uuid": "49521e36-6e4d-4b3e-a04d-937c20e6788b",
          "code": "28531",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/28531",
          "code_system": "PUBCHEM",
          "references": [
            "a9070bfd-ad18-4297-b243-bfc03c01bc48"
          ]
        },
        {
          "uuid": "78014954-9e6c-a1db-4090-2076344309fd",
          "code": "DTXSID2025210",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2025210",
          "code_system": "EPA CompTox",
          "references": [
            "4f3185fb-d2a0-18be-b1d6-67683905956b"
          ]
        },
        {
          "uuid": "77c287ac-5377-42cc-9fd0-21e3cacbe552",
          "code": "T4431S01IG",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5012baed-f5aa-26a6-5a05-4714b692b0c5",
          "code": "Disperse Red 60",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Disperse_Red_60",
          "code_system": "WIKIPEDIA",
          "references": [
            "c6e0f60b-ead7-5694-1672-f7cffa1d427e"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5d0d54c1-70cf-4ccf-8a4b-6e5833cd4055",
          "name": "9,10-ANTHRACENEDIONE, 1-AMINO-4-HYDROXY-2-PHENOXY-",
          "stdName": "9,10-ANTHRACENEDIONE, 1-AMINO-4-HYDROXY-2-PHENOXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3b18608-9853-4073-91ab-d60bb0557ccc",
            "d07dccf1-98d3-47db-b4e2-c25435f0fe61"
          ],
          "display_name": false
        },
        {
          "uuid": "7112cfca-3f59-492e-bf1d-6ec64ea529b0",
          "name": "ANTHRAQUINONE MAGENTA",
          "stdName": "ANTHRAQUINONE MAGENTA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3b18608-9853-4073-91ab-d60bb0557ccc",
            "d07dccf1-98d3-47db-b4e2-c25435f0fe61"
          ],
          "display_name": false
        },
        {
          "uuid": "802a1ff6-66f5-41a2-9558-80db5a4995e5",
          "name": "C.I. 60756",
          "stdName": "C.I. 60756",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3b18608-9853-4073-91ab-d60bb0557ccc",
            "d07dccf1-98d3-47db-b4e2-c25435f0fe61"
          ],
          "display_name": false
        },
        {
          "uuid": "a2a38edd-bba5-4b49-98e3-b332b0174b02",
          "name": "C.I. DISPERSE RED 60",
          "stdName": "C.I. DISPERSE RED 60",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3b18608-9853-4073-91ab-d60bb0557ccc",
            "d07dccf1-98d3-47db-b4e2-c25435f0fe61"
          ],
          "display_name": false
        },
        {
          "uuid": "a9bb74ff-9b22-407f-9240-ef05b1ac8206",
          "name": "C.I. DISPERSE RED 71",
          "stdName": "C.I. DISPERSE RED 71",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3b18608-9853-4073-91ab-d60bb0557ccc",
            "d07dccf1-98d3-47db-b4e2-c25435f0fe61"
          ],
          "display_name": false
        },
        {
          "uuid": "68de5477-ad2e-4fe5-979a-d7523bcc8709",
          "name": "C.I. DISPERSE RED 83",
          "stdName": "C.I. DISPERSE RED 83",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3b18608-9853-4073-91ab-d60bb0557ccc",
            "d07dccf1-98d3-47db-b4e2-c25435f0fe61"
          ],
          "display_name": false
        },
        {
          "uuid": "de0ab2cb-1351-4f90-98f6-068fb85227bf",
          "name": "C.I. SOLVENT RED 146",
          "stdName": "C.I. SOLVENT RED 146",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3b18608-9853-4073-91ab-d60bb0557ccc",
            "d07dccf1-98d3-47db-b4e2-c25435f0fe61"
          ],
          "display_name": false
        },
        {
          "uuid": "371a2a23-73af-4480-859d-0d25856999e9",
          "name": "CI 60756",
          "stdName": "CI 60756",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d07dccf1-98d3-47db-b4e2-c25435f0fe61",
            "fd2ce375-ed80-4ae4-89b9-24fa492d8250"
          ],
          "display_name": false
        },
        {
          "uuid": "cb066cce-01fc-4851-894f-94791c7e3dd2",
          "name": "CI DISPERSE RED 60",
          "stdName": "CI DISPERSE RED 60",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6eb2ad57-9190-4494-a84e-2daf0a2aff2f"
          ],
          "display_name": false
        },
        {
          "uuid": "e0079714-f4f0-4d93-9c43-85751760236e",
          "name": "DISPERSE RED 3B",
          "stdName": "DISPERSE RED 3B",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3b18608-9853-4073-91ab-d60bb0557ccc",
            "d07dccf1-98d3-47db-b4e2-c25435f0fe61"
          ],
          "display_name": false
        },
        {
          "uuid": "2e782673-9d57-40fb-9b28-99e42c1657df",
          "name": "DISPERSE RED 60",
          "stdName": "DISPERSE RED 60",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3b18608-9853-4073-91ab-d60bb0557ccc",
            "d07dccf1-98d3-47db-b4e2-c25435f0fe61"
          ],
          "display_name": true
        },
        {
          "uuid": "159d7eee-527f-4743-95a0-9129faeea754",
          "name": "DISPERSE RED FB",
          "stdName": "DISPERSE RED FB",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3b18608-9853-4073-91ab-d60bb0557ccc",
            "d07dccf1-98d3-47db-b4e2-c25435f0fe61"
          ],
          "display_name": false
        },
        {
          "uuid": "373ca151-2131-436c-9e42-4ed4bedaf699",
          "name": "RESIREN RED TB",
          "stdName": "RESIREN RED TB",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3b18608-9853-4073-91ab-d60bb0557ccc",
            "d07dccf1-98d3-47db-b4e2-c25435f0fe61"
          ],
          "display_name": false
        },
        {
          "uuid": "13f3ffd8-2dd1-4543-8466-cae1ac9ee864",
          "name": "SOLVENT RED 146",
          "stdName": "SOLVENT RED 146",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3b18608-9853-4073-91ab-d60bb0557ccc",
            "d07dccf1-98d3-47db-b4e2-c25435f0fe61"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6eb2ad57-9190-4494-a84e-2daf0a2aff2f",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a3b18608-9853-4073-91ab-d60bb0557ccc",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d07dccf1-98d3-47db-b4e2-c25435f0fe61",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fd2ce375-ed80-4ae4-89b9-24fa492d8250",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a9070bfd-ad18-4297-b243-bfc03c01bc48",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390879000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b42975cc-df76-4d33-9ec1-6b6e2e327def",
          "citation": "SRS import [T4431S01IG]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=T4431S01IG",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390879000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c2d04de1-81a2-4cb2-9b97-286f4c3bfcc4",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4f3185fb-d2a0-18be-b1d6-67683905956b",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=17418-58-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c6e0f60b-ead7-5694-1672-f7cffa1d427e",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "a0d31007-e579-40f2-98d6-327f3a35bbfb",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c526fbaa-2861-41b2-bef0-0a0bbf021d78",
          "id": "c526fbaa-2861-41b2-bef0-0a0bbf021d78",
          "molfile": "\n  Marvin  01132110112D          \n\n 25 28  0  0  0  0            999 V2000\n    7.1137   -3.5742    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1137   -4.4098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8324   -4.8148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5557   -4.3960    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2905   -4.7987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9954   -4.3799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7278   -4.7873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7278   -5.5908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0092   -6.0257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2905   -5.6068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8324   -5.6366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1137   -6.0532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1137   -6.8771    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3995   -5.6366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6739   -6.0532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6739   -6.8771    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9552   -5.6366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2433   -6.0532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5154   -5.6366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5154   -4.8148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2433   -4.4098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9552   -4.8148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6739   -4.4098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6739   -3.5742    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3995   -4.8148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n 25  2  2  0  0  0  0\n  3  4  1  0  0  0  0\n  3 11  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 10  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 12  2  0  0  0  0\n 14 15  1  0  0  0  0\n 25 14  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 22 17  2  0  0  0  0\n 18 19  2  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 23 24  2  0  0  0  0\n 25 23  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)Oc2cc(c3c(c2N)C(=O)c4ccccc4C3=O)O",
          "formula": "C20H13NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3c35433d-d16a-4767-9931-1128177899a5"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "331.3223",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1227973e-15e1-4adc-91e6-da119fd7de63",
      "version": "4",
      "structure": {
        "id": "a7633275-d17c-4a0a-b5fc-64ceaf1cea0c",
        "molfile": "\n  Marvin  01132108412D          \n\n 25 28  0  0  0  0            999 V2000\n    6.3995   -4.8148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3995   -5.6366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6739   -6.0532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9552   -5.6366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2433   -6.0532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5154   -5.6366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5154   -4.8148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2433   -4.4098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9552   -4.8148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6739   -4.4098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6739   -3.5742    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6739   -6.8771    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1137   -6.0532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8324   -5.6366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8324   -4.8148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1137   -4.4098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1137   -3.5742    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5557   -4.3960    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2905   -4.7987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9954   -4.3799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7278   -4.7873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7278   -5.5908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0092   -6.0257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2905   -5.6068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1137   -6.8771    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n  1 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n  9  4  2  0  0  0  0\n  3 12  2  0  0  0  0\n  2 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n  1 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 15 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  2  0  0  0  0\n 19 24  1  0  0  0  0\n 13 25  1  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)Oc2cc(c3c(c2N)C(=O)c4ccccc4C3=O)O",
        "formula": "C20H13NO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "331.3223",
        "optical_activity": "NONE",
        "references": [
          "b42975cc-df76-4d33-9ec1-6b6e2e327def",
          "c2d04de1-81a2-4cb2-9b97-286f4c3bfcc4"
        ],
        "stereo_centers": 0
      },
      "unii": "T4431S01IG"
    }
  ]
}