{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "d182a3a1-fb20-4140-ad58-69d50afc4a5c", "code": "51415-02-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=51415-02-2", "code_system": "CAS", "references": [ "d8ffad54-03e8-4272-976d-860fc7fa3072", "da16ece0-bd4b-46b8-a651-0b4368366e4c" ] }, { "uuid": "7f9ae553-2fbb-4cf1-861c-286f71d844c2", "code": "13909684", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/13909684", "code_system": "PUBCHEM", "references": [ "d8ffad54-03e8-4272-976d-860fc7fa3072" ] }, { "uuid": "b8a0eed4-77e9-49e0-a864-bd40c8bbfc92", "code": "T3FU6ZPR5V", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "fd7fe7d7-b53d-9e49-8fdc-282a668ccf57", "code": "DTXSID10965732", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10965732", "code_system": "EPA CompTox" } ], "relationships": [ { "uuid": "a9b0e3e1-9614-444f-882a-e0b7156123be", "comments": "CALENDULA OFFICINALIS FLOWER terpenoid", "type": "PARENT->CONSTITUENT ALWAYS PRESENT", "references": [ "30a14c0a-2a71-40ad-a857-2ae63b3a5539" ], "related_substance": { "uuid": "1353efc9-8b66-4bd0-9073-e0b4937f7497", "refuuid": "e2dbbdeb-f16f-4daa-8570-a3f703139cb9", "name": "CALENDULA OFFICINALIS FLOWER", "unii": "P0M7O4Y7YD", "linking_id": "P0M7O4Y7YD", "ref_pname": "CALENDULA OFFICINALIS FLOWER", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "e45a2ecb-45b6-4761-9816-efd6d1120102", "name": ".BETA.-D-GLUCOPYRANOSIDURONIC ACID, (3.BETA.)-28-(.BETA.-D-GLUCOPYRANOSYLOXY)-28-OXOOLEAN-12-EN-3-YL", "stdName": ".BETA.-D-GLUCOPYRANOSIDURONIC ACID, (3.BETA.)-28-(.BETA.-D-GLUCOPYRANOSYLOXY)-28-OXOOLEAN-12-EN-3-YL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ab8decb1-ede6-4841-a1f8-acd97fc485fb", "7fa8ec3e-bd0d-425f-a2f2-bf7e0e463c95" ], "display_name": false }, { "uuid": "9c033767-b1a9-4dd0-bb34-ef3336ad91d5", "name": "3-O-.BETA.-D-GLUCURONOPYRANOSYL)OLEANOLIC ACID 28-O-.BETA.-D-GLUCOPYRANOSIDE", "stdName": "3-O-.BETA.-D-GLUCURONOPYRANOSYL)OLEANOLIC ACID 28-O-.BETA.-D-GLUCOPYRANOSIDE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ab8decb1-ede6-4841-a1f8-acd97fc485fb", "7fa8ec3e-bd0d-425f-a2f2-bf7e0e463c95" ], "display_name": false }, { "uuid": "fdef008f-7394-454c-bb51-96ccf80277e4", "name": "CALENDULOSIDE F", "stdName": "CALENDULOSIDE F", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ab8decb1-ede6-4841-a1f8-acd97fc485fb", "7fa8ec3e-bd0d-425f-a2f2-bf7e0e463c95" ], "display_name": true }, { "uuid": "ed7eabdb-8a1e-4ebd-a422-8bc063556b93", "name": "CHIKUSETSUSAPONIN IVA", "stdName": "CHIKUSETSUSAPONIN IVA", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ab8decb1-ede6-4841-a1f8-acd97fc485fb", "7fa8ec3e-bd0d-425f-a2f2-bf7e0e463c95" ], "display_name": false }, { "uuid": "18a4c07d-8602-4930-bab6-7a9a2d54c86d", "name": "MOMORDIN IIB", "stdName": "MOMORDIN IIB", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ab8decb1-ede6-4841-a1f8-acd97fc485fb", "7fa8ec3e-bd0d-425f-a2f2-bf7e0e463c95" ], "display_name": false }, { "uuid": "22838502-3f6a-4592-b14f-724b8b1968ea", "name": "OLEANOLIC ACID 3-O-(.BETA.-D-GLUCURONOPYRANOSYL)-28-O-.BETA.-D-GLUCOPYRANOSIDE", "stdName": "OLEANOLIC ACID 3-O-(.BETA.-D-GLUCURONOPYRANOSYL)-28-O-.BETA.-D-GLUCOPYRANOSIDE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ab8decb1-ede6-4841-a1f8-acd97fc485fb", "7fa8ec3e-bd0d-425f-a2f2-bf7e0e463c95" ], "display_name": false }, { "uuid": "45b836bf-be56-4a00-b975-bd68341200ae", "name": "SILPHIOSIDE G", "stdName": "SILPHIOSIDE G", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ab8decb1-ede6-4841-a1f8-acd97fc485fb", "7fa8ec3e-bd0d-425f-a2f2-bf7e0e463c95" ], "display_name": false } ], "references": [ { "uuid": "ab8decb1-ede6-4841-a1f8-acd97fc485fb", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "7fa8ec3e-bd0d-425f-a2f2-bf7e0e463c95", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d8ffad54-03e8-4272-976d-860fc7fa3072", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391344000, "tags": [ "NOMEN" ] }, { "uuid": "30a14c0a-2a71-40ad-a857-2ae63b3a5539", "citation": "HERBAL MEDICINES 4TH ED 2103", "doc_type": "BOOK", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4c14f944-042c-4293-a1e7-0d168e4c81d2", "citation": "SRS import [T3FU6ZPR5V]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=T3FU6ZPR5V", "doc_type": "SRS", "public_domain": true, "document_date": 1493391344000, "tags": [ "NOMEN" ] }, { "uuid": "da16ece0-bd4b-46b8-a651-0b4368366e4c", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "b542237b-4628-4ced-973f-b4292e70f837", "id": "b542237b-4628-4ced-973f-b4292e70f837", "molfile": "\n Marvin 01132109232D \n\n 56 62 0 0 1 0 999 V2000\n 13.7734 -6.0545 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 13.7734 -6.8795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4879 -7.2921 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0590 -5.6421 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0590 -4.8171 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 12.3445 -4.4045 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6300 -4.8171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6300 -5.6421 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9156 -4.4046 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 11.6300 -3.9921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6300 -3.1671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9156 -2.7545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3852 -2.1226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4458 -2.1226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2011 -3.1671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2011 -3.9921 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 9.4866 -4.4046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7721 -3.9921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0576 -4.4046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0576 -5.2296 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 7.3431 -5.6421 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 7.3431 -4.8171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6287 -5.2296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9142 -5.6421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9142 -6.4671 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 5.1997 -6.8796 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4853 -6.4671 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 5.0156 -5.8351 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7334 -5.0599 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 5.2637 -4.4279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0762 -4.5711 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9815 -3.6526 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9209 -4.9166 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 3.6388 -4.1413 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3906 -5.5485 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 2.5782 -5.4054 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6728 -6.3238 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 3.1425 -6.9558 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6287 -6.8796 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.0412 -7.5940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0984 -7.5115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3431 -6.4671 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 8.0576 -6.8796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7721 -6.4671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7721 -5.6421 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 8.7721 -4.8171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4866 -5.2296 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 9.4866 -6.0546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2011 -5.6421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9156 -5.2296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7734 -4.4045 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 13.7734 -3.5795 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4879 -4.8171 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 15.2023 -4.4045 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4879 -5.6421 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 15.2024 -6.0545 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 1 4 1 0 0 0 0\n 55 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 1 1 0 0 0\n 51 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 2 0 0 0 0\n 9 7 1 1 0 0 0\n 9 10 1 0 0 0 0\n 9 16 1 0 0 0 0\n 9 50 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 14 1 0 0 0 0\n 15 12 1 0 0 0 0\n 16 15 1 0 0 0 0\n 16 17 1 6 0 0 0\n 17 18 2 0 0 0 0\n 17 47 1 0 0 0 0\n 18 19 1 0 0 0 0\n 20 19 1 1 0 0 0\n 20 21 1 0 0 0 0\n 45 20 1 0 0 0 0\n 21 22 1 1 0 0 0\n 21 23 1 0 0 0 0\n 21 42 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 1 0 0 0\n 39 25 1 0 0 0 0\n 27 26 1 1 0 0 0\n 27 28 1 0 0 0 0\n 37 27 1 0 0 0 0\n 29 28 1 0 0 0 0\n 29 30 1 1 0 0 0\n 33 29 1 0 0 0 0\n 30 31 1 0 0 0 0\n 30 32 2 0 0 0 0\n 33 34 1 6 0 0 0\n 33 35 1 0 0 0 0\n 35 36 1 1 0 0 0\n 35 37 1 0 0 0 0\n 37 38 1 6 0 0 0\n 39 40 1 0 0 0 0\n 39 41 1 0 0 0 0\n 42 39 1 1 0 0 0\n 43 42 1 0 0 0 0\n 44 43 1 0 0 0 0\n 45 44 1 0 0 0 0\n 45 46 1 1 0 0 0\n 47 45 1 0 0 0 0\n 47 48 1 6 0 0 0\n 49 47 1 0 0 0 0\n 50 49 1 0 0 0 0\n 51 52 1 6 0 0 0\n 53 51 1 0 0 0 0\n 53 54 1 1 0 0 0\n 55 53 1 0 0 0 0\n 55 56 1 6 0 0 0\nM END", "smiles": "CC1(C)CC[C@@]2(CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@@H](C(C)(C)[C@@H]5CC[C@]43C)O[C@H]6[C@@H]([C@H]([C@@H]([C@@H](C(=O)O)O6)O)O)O)[C@@H]2C1)C(=O)O[C@H]7[C@@H]([C@H]([C@@H]([C@@H](CO)O7)O)O)O", "formula": "C42H66O14", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "e05d3bfb-1607-48a5-bd55-e72798f5f463" }, "defined_stereo": 18, "ez_centers": 0, "molecular_weight": "794.9667", "optical_activity": "UNSPECIFIED", "stereo_centers": 18 } ], "definition_level": "COMPLETE", "uuid": "7c89c184-c5a0-431b-90cd-442591560724", "version": "3", "structure": { "id": "e5c1f684-5568-42d4-99ee-43dbd12660e1", "molfile": "\n Marvin 01132111542D \n\n 60 66 0 0 1 0 999 V2000\n 11.6300 -4.8171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9156 -4.4046 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 11.6300 -3.9921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6300 -3.1671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9156 -2.7545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3852 -2.1226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4458 -2.1226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2011 -3.1671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2011 -3.9921 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 10.2011 -4.8171 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4866 -4.4046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7721 -3.9921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0576 -4.4046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0576 -5.2296 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 8.0576 -6.0546 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3431 -5.6421 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 6.6287 -5.2296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9142 -5.6421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9142 -6.4671 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 5.1997 -6.8796 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4853 -6.4671 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 4.2031 -7.2423 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6728 -6.3238 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 3.1425 -6.9558 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3906 -5.5485 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 2.5782 -5.4054 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9209 -4.9166 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 3.6388 -4.1413 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7334 -5.0599 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 5.2637 -4.4279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0762 -4.5711 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9815 -3.6526 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0156 -5.8351 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6287 -6.8796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0412 -7.5940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0984 -7.5115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3431 -6.4671 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.3431 -7.2921 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0576 -6.8796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7721 -6.4671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7721 -5.6421 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 8.7721 -4.8171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4866 -5.2296 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 9.4866 -6.0546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2011 -5.6421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9156 -5.2296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3431 -4.8171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6300 -5.6421 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3445 -4.4045 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0590 -4.8171 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 13.7734 -4.4045 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 13.7734 -3.5795 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4879 -4.8171 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 15.2023 -4.4045 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4879 -5.6421 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 15.2024 -6.0545 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7734 -6.0545 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 13.7734 -6.8795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4879 -7.2921 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0590 -5.6421 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 1 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 7 1 0 0 0 0\n 8 5 1 0 0 0 0\n 9 8 1 0 0 0 0\n 2 9 1 0 0 0 0\n 9 10 1 1 0 0 0\n 9 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 6 0 0 0\n 14 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 1 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 6 0 0 0\n 21 23 1 0 0 0 0\n 23 24 1 6 0 0 0\n 23 25 1 0 0 0 0\n 25 26 1 1 0 0 0\n 25 27 1 0 0 0 0\n 27 28 1 6 0 0 0\n 29 27 1 0 0 0 0\n 29 30 1 1 0 0 0\n 30 31 2 0 0 0 0\n 30 32 1 0 0 0 0\n 33 29 1 0 0 0 0\n 21 33 1 0 0 0 0\n 34 19 1 0 0 0 0\n 34 35 1 0 0 0 0\n 34 36 1 0 0 0 0\n 37 34 1 0 0 0 0\n 16 37 1 0 0 0 0\n 37 38 1 6 0 0 0\n 39 37 1 0 0 0 0\n 40 39 1 0 0 0 0\n 41 40 1 0 0 0 0\n 41 14 1 0 0 0 0\n 41 42 1 1 0 0 0\n 43 41 1 0 0 0 0\n 11 43 1 0 0 0 0\n 43 44 1 6 0 0 0\n 45 43 1 0 0 0 0\n 2 46 1 0 0 0 0\n 46 45 1 0 0 0 0\n 16 47 1 1 0 0 0\n 1 48 2 0 0 0 0\n 1 49 1 0 0 0 0\n 50 49 1 1 0 0 0\n 50 51 1 0 0 0 0\n 51 52 1 6 0 0 0\n 51 53 1 0 0 0 0\n 53 54 1 1 0 0 0\n 53 55 1 0 0 0 0\n 55 56 1 6 0 0 0\n 57 55 1 0 0 0 0\n 57 58 1 1 0 0 0\n 58 59 1 0 0 0 0\n 60 57 1 0 0 0 0\n 50 60 1 0 0 0 0\nM END", "smiles": "CC1(C)CC[C@@]2(CC[C@]3(C)C(=CC[C@]4([H])[C@@]5(C)CC[C@@H](C(C)(C)[C@]5([H])CC[C@]43C)O[C@@]6([H])[C@@H]([C@H]([C@@H]([C@@H](C(=O)O)O6)O)O)O)[C@]2([H])C1)C(=O)O[C@H]7[C@@H]([C@H]([C@@H]([C@@H](CO)O7)O)O)O", "formula": "C42H66O14", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 18, "ez_centers": 0, "molecular_weight": "794.9667", "optical_activity": "UNSPECIFIED", "references": [ "4c14f944-042c-4293-a1e7-0d168e4c81d2", "ab8decb1-ede6-4841-a1f8-acd97fc485fb" ], "stereo_centers": 18 }, "unii": "T3FU6ZPR5V" } ] }