{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9e771b1d-5b80-4812-915f-081c4cd8a397",
          "code": "226940-14-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=226940-14-3",
          "code_system": "CAS",
          "references": [
            "d744a5e0-5d8f-4aa3-8c5d-0b03a0307cd0",
            "591a8a14-8363-4ce1-a1bd-1d45429e11af"
          ]
        },
        {
          "uuid": "41e5b073-1ad9-17d2-b1f5-fa0e5ed43bdb",
          "code": "DTXSID20879811",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20879811",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "56b8b481-c840-4533-a95a-49170e1cf5c1",
          "code": "T2X8Y3QKX8",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "e625fec9-00cd-4c68-a1fe-c4e987346625",
          "amount": {
            "uuid": "a5c1a173-242f-45d0-af8a-4efa9e0c8195"
          },
          "type": "PARENT->SALT/SOLVATE",
          "references": [
            "24a67d4f-ac83-46d6-8cf0-c9a7b7801a67"
          ],
          "related_substance": {
            "uuid": "b9b7a39d-5fab-4f66-940a-2f4a6f020e7c",
            "refuuid": "a4dab83d-2857-4cce-a94c-ec7511128ba1",
            "name": "Basic Orange 69 Base",
            "unii": "9R8Y7Y6Z3J",
            "linking_id": "9R8Y7Y6Z3J",
            "ref_pname": "Basic Orange 69 Base",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "cdb2281b-2839-46fe-85ae-d20b5f2c9c5f",
          "name": "Basic Orange 69",
          "stdName": "BASIC ORANGE 69",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "591a8a14-8363-4ce1-a1bd-1d45429e11af"
          ],
          "display_name": true
        },
        {
          "uuid": "633f3ac8-3f0e-4a24-b2da-de21a85bbe4d",
          "name": "Benzenaminium, 3-[2-(4-amino-2,5-dimethoxyphenyl)diazenyl]-N,N,N-trimethyl-, chloride",
          "stdName": "BENZENAMINIUM, 3-(2-(4-AMINO-2,5-DIMETHOXYPHENYL)DIAZENYL)-N,N,N-TRIMETHYL-, CHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "591a8a14-8363-4ce1-a1bd-1d45429e11af"
          ],
          "display_name": false
        },
        {
          "uuid": "054341e1-aab5-47fb-a54c-7bcf6f15097b",
          "name": "Benzenaminium, 3-[2-(4-amino-2,5-dimethoxyphenyl)diazenyl]-N,N,N-trimethyl-, chloride (1:1)",
          "stdName": "BENZENAMINIUM, 3-(2-(4-AMINO-2,5-DIMETHOXYPHENYL)DIAZENYL)-N,N,N-TRIMETHYL-, CHLORIDE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3d4e22c3-06b6-42ff-bbca-ec8a085d4f62"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3d4e22c3-06b6-42ff-bbca-ec8a085d4f62",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d744a5e0-5d8f-4aa3-8c5d-0b03a0307cd0",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392181000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "591a8a14-8363-4ce1-a1bd-1d45429e11af",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "24a67d4f-ac83-46d6-8cf0-c9a7b7801a67",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9b716448-057b-41cf-a4b7-04643f15655a",
          "id": "9b716448-057b-41cf-a4b7-04643f15655a",
          "molfile": "\n  Marvin  01132108052D          \n\n  1  0  0  0  0  0            999 V2000\n    4.6091   -3.9363    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5eedb75e-9734-40ff-a639-d290bb7874c4"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "ba4e2ffa-9501-417b-95f4-ac6427aa9827",
          "id": "ba4e2ffa-9501-417b-95f4-ac6427aa9827",
          "molfile": "\n  Marvin  01132109382D          \n\n 23 24  0  0  0  0            999 V2000\n    2.1344   -4.2997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4229   -3.8899    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4307   -3.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1421   -2.6526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1421   -1.8251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9619   -1.8251    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5496   -1.2374    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5627   -1.2296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5627   -2.0570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2741   -2.4592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9856   -2.0570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9856   -1.2296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2741   -0.8120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6971   -0.8120    0.0000 N   0  3  0  0  0  0  0  0  0  3  0  0\n    6.1403   -0.1083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3235   -1.4539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7334   -0.1392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4307   -1.4152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4229   -0.5877    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0107    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7192   -1.8251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7192   -2.6526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -3.0624    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n 22  3  2  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  5 18  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 13  2  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 14 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 21 18  2  0  0  0  0\n 19 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\nM  CHG  1  14   1\nM  END",
          "smiles": "C[N+](C)(C)c1cccc(c1)/N=N/c2cc(c(cc2OC)N)OC",
          "formula": "C17H23N4O2",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "cf66a9cf-e204-44ba-a629-24da64ce9a75"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "315.3908",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "82bdd4b4-144a-4b94-b680-1a8514458498",
      "version": "7",
      "structure": {
        "id": "eef7d6b8-d42f-4510-8dc3-9edb1f352ea7",
        "molfile": "\n   JSDraw212052319532D\n\n 24 24  0  0  0  0              0 V2000\n   20.2596   -1.5600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.4794   -2.9109    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   18.1286   -2.1306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.6992   -4.2617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.8303   -3.6911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.1823   -2.9111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.5343   -3.6911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.5343   -5.2511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.1823   -6.0311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.8303   -5.2511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.1823   -7.5911    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   23.5332   -8.3711    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   23.5332   -9.9311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.8849  -10.7117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.8857  -12.2726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.5348  -13.0528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.1831  -12.2721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.1824  -10.7113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.8311   -9.9317    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   19.4804  -10.7121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.5348  -14.6128    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   26.2369  -13.0521    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   26.2374  -14.6121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4999   -7.1483    0.0000 Cl  0  5  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n  5 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 13 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 16 21  1  0  0  0  0\n 15 22  1  0  0  0  0\n 22 23  1  0  0  0  0\nM  CHG  2   2   1  24  -1\nM  END",
        "smiles": "C[N+](C)(C)c1cccc(c1)/N=N/c2cc(c(cc2OC)N)OC.[Cl-]",
        "formula": "C17H23N4O2.Cl",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "350.8437",
        "optical_activity": "NONE",
        "references": [
          "3d4e22c3-06b6-42ff-bbca-ec8a085d4f62"
        ],
        "stereo_centers": 0
      },
      "unii": "T2X8Y3QKX8"
    }
  ]
}