{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "75dd174e-a03a-4812-9f48-71c10caa9c87",
          "code": "P02DX02",
          "comments": "ATC|ANTIPARASITIC PRODUCTS, INSECTICIDES AND REPELLENTS|ANTHELMINTICS|ANTICESTODALS|Other anticestodals|dichlorophen",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=P02DX02&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "d66b4fc1-e2e8-4302-aed5-99d6cb22a580"
          ]
        },
        {
          "uuid": "7ea1c757-be09-4a40-87ac-9c6f6ebd3bc7",
          "code": "QP52AG01",
          "comments": "VATC|ANTHELMINTICS|ANTHELMINTICS|Phenol derivatives, incl. salicylanilides|dichlorophene",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QP52AG01&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "d66b4fc1-e2e8-4302-aed5-99d6cb22a580"
          ]
        },
        {
          "uuid": "9fcb213c-7d76-4130-93d8-60c5a715ccbf",
          "code": "97-23-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=97-23-4",
          "code_system": "CAS",
          "references": [
            "d66b4fc1-e2e8-4302-aed5-99d6cb22a580",
            "ee9f4137-02a9-4059-be5e-141975aebe29"
          ]
        },
        {
          "uuid": "9adc01d1-d436-4e22-ab35-53062d1f4c38",
          "code": "C47485",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47485",
          "code_system": "NCI_THESAURUS",
          "references": [
            "d66b4fc1-e2e8-4302-aed5-99d6cb22a580"
          ]
        },
        {
          "uuid": "c0224ff5-cc6b-4644-9d3d-f6362d90ba10",
          "code": "D004003",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68004003",
          "code_system": "MESH",
          "references": [
            "d66b4fc1-e2e8-4302-aed5-99d6cb22a580"
          ]
        },
        {
          "uuid": "b8ea28f9-967a-4421-9e7f-909398325b6f",
          "code": "DICHLOROPHEN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Dichlorophen",
          "code_system": "WIKIPEDIA",
          "references": [
            "d66b4fc1-e2e8-4302-aed5-99d6cb22a580"
          ]
        },
        {
          "uuid": "64e79f94-934a-4ce8-a24a-0d7fa00f8a10",
          "code": "21 CFR 176.170",
          "comments": "PART 176 -- INDIRECT FOOD ADDITIVES: PAPER AND PAPERBOARD COMPONENTS|Subpart B--Substances for Use Only as Components of Paper and Paperboard|Sec. 176.170 Components of paper and paperboard in contact with aqueous and fatty foods.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=176.170",
          "code_system": "CFR",
          "references": [
            "d66b4fc1-e2e8-4302-aed5-99d6cb22a580"
          ]
        },
        {
          "uuid": "21199605-38e7-45db-969a-78a4a4453629",
          "code": "55001",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:342",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "d66b4fc1-e2e8-4302-aed5-99d6cb22a580"
          ]
        },
        {
          "uuid": "2524e362-442d-445d-9595-8101d8755db7",
          "code": "674",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=674",
          "code_system": "INN",
          "references": [
            "d66b4fc1-e2e8-4302-aed5-99d6cb22a580"
          ]
        },
        {
          "uuid": "93c17cd0-dd86-4795-8d56-b02c5a8dcd6b",
          "code": "202-567-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.002.335",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "d66b4fc1-e2e8-4302-aed5-99d6cb22a580"
          ]
        },
        {
          "uuid": "a460fc32-c8b3-485f-9504-9be31323af00",
          "code": "3351",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/3351/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "d66b4fc1-e2e8-4302-aed5-99d6cb22a580"
          ]
        },
        {
          "uuid": "7ce5d066-5663-44d6-b00c-584ea5542442",
          "code": "m4351",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4351?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "d66b4fc1-e2e8-4302-aed5-99d6cb22a580"
          ]
        },
        {
          "uuid": "cc7a2d33-c2cc-4b32-84dd-a57ef401ee3e",
          "code": "SUB07085MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "d66b4fc1-e2e8-4302-aed5-99d6cb22a580"
          ]
        },
        {
          "uuid": "90ad8c5f-12f3-41ba-b1b2-dbfdf8ad1700",
          "code": "21 CFR 520.580",
          "comments": "SUBCHAPTER E--ANIMAL DRUGS, FEEDS, AND RELATED PRODUCTS|PART 520 ORAL DOSAGE FORM NEW ANIMAL DRUGS|Sec. 520.580 Dichlorophene and toluene.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=520.580",
          "code_system": "CFR",
          "references": [
            "d66b4fc1-e2e8-4302-aed5-99d6cb22a580"
          ]
        },
        {
          "uuid": "e0be59f9-0cdf-4f64-afd1-464606ee5892",
          "code": "21 CFR 520.581",
          "comments": "SUBCHAPTER E--ANIMAL DRUGS, FEEDS, AND RELATED PRODUCTS|PART 520 ORAL DOSAGE FORM NEW ANIMAL DRUGS|Sec. 520.581 Dichlorophene tablets.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=520.581",
          "code_system": "CFR",
          "references": [
            "d66b4fc1-e2e8-4302-aed5-99d6cb22a580"
          ]
        },
        {
          "uuid": "36a834c1-fac5-49ce-b45f-ed2877a75de9",
          "code": "CHEMBL33845",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL33845",
          "code_system": "ChEMBL",
          "references": [
            "d66b4fc1-e2e8-4302-aed5-99d6cb22a580"
          ]
        },
        {
          "uuid": "dc39311b-57d0-4817-8ce0-33cebeb4e757",
          "code": "3037",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3037",
          "code_system": "PUBCHEM",
          "references": [
            "d66b4fc1-e2e8-4302-aed5-99d6cb22a580"
          ]
        },
        {
          "uuid": "90336724-31b6-6282-c2b9-21ceb7b1582c",
          "code": "6033",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6033",
          "code_system": "HSDB",
          "references": [
            "4f18fcc4-b49e-d932-b892-4f923fe8406f"
          ]
        },
        {
          "uuid": "f17eb5b4-2170-4e09-891f-cff7ab5acfbf",
          "code": "DTXSID6021824",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6021824",
          "code_system": "EPA CompTox",
          "references": [
            "7f31a729-ca3e-fdc2-3d61-90708f9a27c2"
          ]
        },
        {
          "uuid": "680d1f30-e942-d2ae-20e8-84a2b6ab1584",
          "code": "C250",
          "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Antiparasitic Agent[C276]|Antihelminthic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C250",
          "code_system": "NCI_THESAURUS",
          "references": [
            "6927ea4f-8eba-9322-83a6-4a5173781848"
          ]
        },
        {
          "uuid": "a13c9913-b7bd-43a9-9db3-19874c10c384",
          "code": "T1J0JOU64O",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "74666c98-2830-c2d5-1479-58203814526f",
          "code": "863",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/863",
          "code_system": "DRUG CENTRAL",
          "references": [
            "6927ea4f-8eba-9322-83a6-4a5173781848"
          ]
        },
        {
          "uuid": "01c02c60-1c80-284e-3ff8-a82865095114",
          "code": "DB11396",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB11396",
          "code_system": "DRUG BANK",
          "references": [
            "6927ea4f-8eba-9322-83a6-4a5173781848"
          ]
        },
        {
          "uuid": "69980a04-2cc1-5984-dc83-c33c3cc1ba1a",
          "code": "100000082933",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "6775b0f4-e1d7-556b-6c38-13334314ae8a"
          ]
        },
        {
          "uuid": "704a11f7-b9f6-88c6-7c8c-e746f336d7e6",
          "code": "38642",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=38642",
          "code_system": "NSC",
          "references": [
            "97a20939-203e-a3b5-9747-d3599669dded"
          ]
        },
        {
          "uuid": "2d9bfb68-f224-3e7c-c4d7-d9ba9a70c885",
          "code": "dichlorophen",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/dichlorophen.html",
          "code_system": "ALANWOOD",
          "references": [
            "f0f50024-60cf-1771-5233-f4daf4ac7012"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "794134f5-ee07-499c-842e-dd7cbf7f2f1c",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "1d25985b-54c6-44e5-9d6c-275c70627afa",
            "refuuid": "49ab4525-6ca3-4062-ba9b-685527b7f4f3",
            "name": "DICHLOROPHEN",
            "unii": "T1J0JOU64O",
            "linking_id": "T1J0JOU64O",
            "ref_pname": "DICHLOROPHEN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7a6c7c9a-8e64-4e41-8706-e86de658a701",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "18b8e2e6-fd61-4994-8bb1-65721443828b",
            "refuuid": "88becb1f-09fc-4749-8316-40788bb77e63",
            "name": "DICHLOROPHEN DISODIUM",
            "unii": "6Y5TLW5O7J",
            "linking_id": "6Y5TLW5O7J",
            "ref_pname": "DICHLOROPHEN DISODIUM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "8f62816e-88fd-4bfe-9951-c689f1afd4ec",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "e5a379bc-bed4-41ec-9e52-6f8451709824",
            "refuuid": "2038b001-d419-45a4-9157-6e437df70139",
            "name": "DICHLOROPHEN MONOSODIUM",
            "unii": "S75BB68Q3X",
            "linking_id": "S75BB68Q3X",
            "ref_pname": "DICHLOROPHEN MONOSODIUM",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "95fbe521-1639-4a02-a864-a8960551af86",
          "name": "2,2'-METHYLENEBIS(4-CHLOROPHENOL)",
          "stdName": "2,2'-METHYLENEBIS(4-CHLOROPHENOL)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "09de8d7c-66ee-4396-933f-947046b791aa",
            "b90a7d95-f3e9-4082-980a-3182f0513cd5"
          ],
          "display_name": false
        },
        {
          "uuid": "5e64d9f3-40cf-4f68-898d-463e0af4a5fa",
          "name": "4,4'-DICHLORO-2,2'-METHYLENEDIPHENOL",
          "stdName": "4,4'-DICHLORO-2,2'-METHYLENEDIPHENOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e8a9b78d-3a29-4d21-a714-f890b9ed8789",
            "f6abc13b-8352-4e83-9aef-bc8c602d6952"
          ],
          "display_name": false
        },
        {
          "uuid": "ad65092b-7e70-4d48-80ab-c58b0ffb44f8",
          "name": "5,5'-DICHLORO-2,2'-DIHYDROXYDIPHENYLMETHANE",
          "stdName": "5,5'-DICHLORO-2,2'-DIHYDROXYDIPHENYLMETHANE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "09de8d7c-66ee-4396-933f-947046b791aa",
            "b90a7d95-f3e9-4082-980a-3182f0513cd5"
          ],
          "display_name": false
        },
        {
          "uuid": "c136e305-7d7f-4cba-bd28-c4f86deb8231",
          "name": "ANTHIPHEN",
          "stdName": "ANTHIPHEN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "09de8d7c-66ee-4396-933f-947046b791aa",
            "b90a7d95-f3e9-4082-980a-3182f0513cd5"
          ],
          "display_name": false
        },
        {
          "uuid": "52ffffa4-81d4-4722-92f6-35f8ff9b6f61",
          "name": "DICHLOROPHEN",
          "stdName": "DICHLOROPHEN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7b86c829-3ea1-4c46-8270-3f11701f5c74",
            "a44f7928-387a-4765-a2e7-efa4ba9eae85",
            "900b944c-115a-4d82-bea2-d72616298ded",
            "09de8d7c-66ee-4396-933f-947046b791aa",
            "41882744-c020-40bd-b74d-9c1b4cad5d26",
            "1cc7dcf5-c0a1-4c04-97c7-22c87dd8a0c4",
            "2c03e2d1-190e-460c-92e2-64613d7b10c4",
            "17f3756f-746e-40f3-8e81-e3450ddce690",
            "6f411210-d31f-4d15-bf0d-5798a08ad029",
            "1df77f8e-d274-46d8-b361-047a39cf87b2",
            "7bcabf93-e5f2-474d-b078-e9559379d82c",
            "1a36376d-0d0e-454d-9aa1-001ef8915211",
            "e3050370-406a-400d-b0d1-8cec7332baaf",
            "b6c91817-b151-4477-bc5d-697955aa6c22"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "ff580e5b-e7b4-49f5-9923-80262274cd96",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "cbd5f09c-6d95-4650-beaf-13b23696ef78",
          "name": "DICHLOROPHEN [HSDB]",
          "stdName": "DICHLOROPHEN [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1df77f8e-d274-46d8-b361-047a39cf87b2",
            "09de8d7c-66ee-4396-933f-947046b791aa"
          ],
          "display_name": false
        },
        {
          "uuid": "7c89a861-6748-4ff5-9bb7-669199d49aa1",
          "name": "DICHLOROPHEN [ISO]",
          "stdName": "DICHLOROPHEN [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c03e2d1-190e-460c-92e2-64613d7b10c4",
            "09de8d7c-66ee-4396-933f-947046b791aa"
          ],
          "display_name": false
        },
        {
          "uuid": "1f1e024b-8fbd-4c38-9d6e-f505937f8998",
          "name": "DICHLOROPHEN [MART.]",
          "stdName": "DICHLOROPHEN [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a44f7928-387a-4765-a2e7-efa4ba9eae85"
          ],
          "display_name": false
        },
        {
          "uuid": "d851a4d2-d0d3-48f9-ada9-d6ccb20fc666",
          "name": "DICHLOROPHEN [MI]",
          "stdName": "DICHLOROPHEN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6f411210-d31f-4d15-bf0d-5798a08ad029",
            "09de8d7c-66ee-4396-933f-947046b791aa"
          ],
          "display_name": false
        },
        {
          "uuid": "94c43915-b949-4ac6-8140-7156dcb50b56",
          "name": "DICHLOROPHENE",
          "stdName": "DICHLOROPHENE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "9a836c00-0b99-4480-9630-9dca0eec1290",
            "bf5956e0-0726-43aa-8365-a5040ff9d408",
            "b3cea0c1-66cd-4458-8e90-b020c8ee91a2",
            "09de8d7c-66ee-4396-933f-947046b791aa",
            "9299c6a4-6c92-4d32-acc9-5261e038c1ee",
            "dcf11087-a18e-4caf-b574-8d06df209c98"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "85a9c6eb-c3b7-41e1-9ae8-b0e1155b99dd",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "aa3df597-017a-435d-8fa4-5365eabdb6e6",
          "name": "DICHLOROPHENE [GREEN BOOK]",
          "stdName": "DICHLOROPHENE [GREEN BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b3cea0c1-66cd-4458-8e90-b020c8ee91a2",
            "09de8d7c-66ee-4396-933f-947046b791aa"
          ],
          "display_name": false
        },
        {
          "uuid": "015ddf1a-6127-427c-9ca3-ad7f1da9f7d2",
          "name": "DIDROXANE",
          "stdName": "DIDROXANE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "09de8d7c-66ee-4396-933f-947046b791aa",
            "b90a7d95-f3e9-4082-980a-3182f0513cd5"
          ],
          "display_name": false
        },
        {
          "uuid": "58d7fe0f-80ef-75a9-9ac1-20b661a9549f",
          "name": "Dichlorophen [WHO-DD]",
          "stdName": "DICHLOROPHEN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "621fa987-7b43-7704-08ee-e7309fda26de"
          ],
          "display_name": false
        },
        {
          "uuid": "6dd6a5fa-7d7b-45b7-9017-90a5f3e16cb3",
          "name": "G-4",
          "stdName": "G-4",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9817bc90-f47c-4325-b8aa-ea4def96827d",
            "09de8d7c-66ee-4396-933f-947046b791aa"
          ],
          "display_name": false
        },
        {
          "uuid": "d61c4ea9-5746-4bdc-a9d2-52f9c7148b05",
          "name": "NSC-38642",
          "stdName": "NSC-38642",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5db21243-4381-4a35-8fb9-9cf8674fb22c",
            "09de8d7c-66ee-4396-933f-947046b791aa"
          ],
          "display_name": false
        },
        {
          "uuid": "72a43857-877d-454f-9cc3-94465450e13a",
          "name": "PARABIS",
          "stdName": "PARABIS",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "09de8d7c-66ee-4396-933f-947046b791aa",
            "b90a7d95-f3e9-4082-980a-3182f0513cd5"
          ],
          "display_name": false
        },
        {
          "uuid": "24411471-2165-4359-b7db-355ad6bac689",
          "name": "dichlorophen [INN]",
          "stdName": "DICHLOROPHEN [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7b86c829-3ea1-4c46-8270-3f11701f5c74"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "41882744-c020-40bd-b74d-9c1b4cad5d26",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b90a7d95-f3e9-4082-980a-3182f0513cd5",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "09de8d7c-66ee-4396-933f-947046b791aa",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f6abc13b-8352-4e83-9aef-bc8c602d6952",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e8a9b78d-3a29-4d21-a714-f890b9ed8789",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7b86c829-3ea1-4c46-8270-3f11701f5c74",
          "citation": "INN Proposed List 6",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL06.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a44f7928-387a-4765-a2e7-efa4ba9eae85",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6f411210-d31f-4d15-bf0d-5798a08ad029",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9299c6a4-6c92-4d32-acc9-5261e038c1ee",
          "citation": "DOSE",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b3cea0c1-66cd-4458-8e90-b020c8ee91a2",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9a836c00-0b99-4480-9630-9dca0eec1290",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1df77f8e-d274-46d8-b361-047a39cf87b2",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "900b944c-115a-4d82-bea2-d72616298ded",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2c03e2d1-190e-460c-92e2-64613d7b10c4",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5db21243-4381-4a35-8fb9-9cf8674fb22c",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9817bc90-f47c-4325-b8aa-ea4def96827d",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d66b4fc1-e2e8-4302-aed5-99d6cb22a580",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389652000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0960ba92-a2ca-45df-84e8-d354b771cd41",
          "citation": "SRS import [T1J0JOU64O]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=T1J0JOU64O",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389652000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "47c1d2e8-7e6a-409e-ba1b-aa9e150330e9",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b6c91817-b151-4477-bc5d-697955aa6c22",
          "citation": "DICHLOROPHEN [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "17f3756f-746e-40f3-8e81-e3450ddce690",
          "citation": "DICHLOROPHEN [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1a36376d-0d0e-454d-9aa1-001ef8915211",
          "citation": "DICHLOROPHEN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bf5956e0-0726-43aa-8365-a5040ff9d408",
          "citation": "DICHLOROPHENE [GREEN BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "dcf11087-a18e-4caf-b574-8d06df209c98",
          "citation": "DICHLOROPHENE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1cc7dcf5-c0a1-4c04-97c7-22c87dd8a0c4",
          "citation": "DICHLOROPHEN [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7bcabf93-e5f2-474d-b078-e9559379d82c",
          "citation": "DICHLOROPHEN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e3050370-406a-400d-b0d1-8cec7332baaf",
          "citation": "DICHLOROPHEN [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4f18fcc4-b49e-d932-b892-4f923fe8406f",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+97-23-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7f31a729-ca3e-fdc2-3d61-90708f9a27c2",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=97-23-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6927ea4f-8eba-9322-83a6-4a5173781848",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "ee9f4137-02a9-4059-be5e-141975aebe29",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f0f50024-60cf-1771-5233-f4daf4ac7012",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "97a20939-203e-a3b5-9747-d3599669dded",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "621fa987-7b43-7704-08ee-e7309fda26de",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "6775b0f4-e1d7-556b-6c38-13334314ae8a",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "51438373-2c9a-4fa3-bd60-1560d38cfd1f",
          "id": "51438373-2c9a-4fa3-bd60-1560d38cfd1f",
          "molfile": "\n  Marvin  01132104142D          \n\n 17 18  0  0  0  0            999 V2000\n    0.7097    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7097   -0.8263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.0669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7097   -2.4787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7097   -3.3050    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    1.4246   -2.0669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4246   -1.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1394   -0.8263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8621   -1.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8621   -2.0669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5769   -2.4787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5769   -3.3050    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.2918   -2.0669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2918   -1.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5769   -0.8263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5769    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  8  2  0  0  0  0\n  4  3  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 16 10  2  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 12  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  1  0  0  0  0\nM  END",
          "smiles": "c1cc(c(Cc2cc(ccc2O)Cl)cc1Cl)O",
          "formula": "C13H10Cl2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4e4cae61-dbbf-4f5c-bb81-616f8275ac2e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "269.1237",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "49ab4525-6ca3-4062-ba9b-685527b7f4f3",
      "version": "15",
      "structure": {
        "id": "53f3cd57-41e3-41da-952b-afd30dfe7dcf",
        "molfile": "\n  Marvin  01132104222D          \n\n 17 18  0  0  0  0            999 V2000\n    2.8621   -1.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4246   -1.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1394   -0.8263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5769   -0.8263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7097   -0.8263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8621   -2.0669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4246   -2.0669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2918   -1.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7097   -2.4787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5769   -2.4787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2918   -2.0669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.0669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5769   -3.3050    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.7097   -3.3050    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.7097    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5769    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  2  0  0  0  0\n  5  2  2  0  0  0  0\n  6  1  1  0  0  0  0\n  7  2  1  0  0  0  0\n  8  5  1  0  0  0  0\n  9  4  1  0  0  0  0\n 10  7  2  0  0  0  0\n 11  6  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 10  1  0  0  0  0\n 14 11  1  0  0  0  0\n 15 10  1  0  0  0  0\n 16  5  1  0  0  0  0\n 17  4  1  0  0  0  0\n 12  9  2  0  0  0  0\n 13  8  2  0  0  0  0\nM  END",
        "smiles": "c1cc(c(Cc2cc(ccc2O)Cl)cc1Cl)O",
        "formula": "C13H10Cl2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "269.1237",
        "optical_activity": "NONE",
        "references": [
          "0960ba92-a2ca-45df-84e8-d354b771cd41",
          "47c1d2e8-7e6a-409e-ba1b-aa9e150330e9",
          "7b86c829-3ea1-4c46-8270-3f11701f5c74"
        ],
        "stereo_centers": 0
      },
      "unii": "T1J0JOU64O"
    }
  ]
}