{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f071164a-438a-4503-bb1c-445426df07b0",
          "code": "10036-64-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=10036-64-3",
          "code_system": "CAS",
          "references": [
            "96b5f3ce-af31-4c8a-8f3e-142756d0a8b0",
            "ad654814-1e0f-4fba-84e2-7572b9358c59"
          ]
        },
        {
          "uuid": "b985d451-dae9-414f-8d33-7e696d6da67e",
          "code": "C77375",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C77375",
          "code_system": "NCI_THESAURUS",
          "references": [
            "96b5f3ce-af31-4c8a-8f3e-142756d0a8b0"
          ]
        },
        {
          "uuid": "c6fbef90-144b-46e9-80bc-7f0bf14d55d9",
          "code": "233-115-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.030.092",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "96b5f3ce-af31-4c8a-8f3e-142756d0a8b0"
          ]
        },
        {
          "uuid": "163bf57a-caf8-4c64-b33d-b54489b6edbf",
          "code": "82313",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/82313",
          "code_system": "PUBCHEM",
          "references": [
            "96b5f3ce-af31-4c8a-8f3e-142756d0a8b0"
          ]
        },
        {
          "uuid": "32f65af3-fb03-ce61-6a57-c51377cd7d6a",
          "code": "2280292",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2280292/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "a1ef0b74-61eb-aee5-0390-8008b1fa8e90"
          ]
        },
        {
          "uuid": "7c2137ef-1bf0-8d8b-6df1-c2a3bc5a32e9",
          "code": "DB03740",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB03740",
          "code_system": "DRUG BANK",
          "references": [
            "a1ef0b74-61eb-aee5-0390-8008b1fa8e90"
          ]
        },
        {
          "uuid": "93b4e87f-d2b5-4da8-b041-cd21fd4db756",
          "code": "T13TI5GH3D",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "65b0fdb2-e733-6352-01a8-67898f12ddd2",
          "code": "T13TI5GH3D",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=T13TI5GH3D",
          "code_system": "DAILYMED",
          "references": [
            "1ca1eff2-f23f-0ee3-8ae1-08ed0bf776da"
          ]
        },
        {
          "uuid": "da1d328e-3172-c00c-0b9a-e4feb2bf8dcd",
          "code": "DTXSID20905442",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20905442",
          "code_system": "EPA CompTox",
          "references": [
            "a1ef0b74-61eb-aee5-0390-8008b1fa8e90"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2b29add5-2be8-4f66-9f74-87de3e117b78",
          "name": ".ALPHA.-D-GLUCOPYRANOSE, 2-(ACETYLAMINO)-2-DEOXY-",
          "stdName": ".ALPHA.-D-GLUCOPYRANOSE, 2-(ACETYLAMINO)-2-DEOXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "114641e5-6a82-4c5d-b814-0745526c73bf",
            "61f1b146-8e61-4364-9d09-91306561fe95"
          ],
          "display_name": false
        },
        {
          "uuid": "b8fa7199-c213-4e4a-8407-4c6365b9473f",
          "name": "2-ACETAMIDO-2-DEOXY-.ALPHA.-D-GLUCOPYRANOSE",
          "stdName": "2-ACETAMIDO-2-DEOXY-.ALPHA.-D-GLUCOPYRANOSE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "114641e5-6a82-4c5d-b814-0745526c73bf",
            "61f1b146-8e61-4364-9d09-91306561fe95"
          ],
          "display_name": false
        },
        {
          "uuid": "e71291e7-2bf6-431a-9dfc-e53f2dbb7967",
          "name": "2-ACETAMIDO-2-DEOXY-.ALPHA.-D-GLUCOSE",
          "stdName": "2-ACETAMIDO-2-DEOXY-.ALPHA.-D-GLUCOSE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "114641e5-6a82-4c5d-b814-0745526c73bf",
            "61f1b146-8e61-4364-9d09-91306561fe95"
          ],
          "display_name": false
        },
        {
          "uuid": "be01f49d-67eb-46c1-ba2b-2075d6ce7766",
          "name": "2-DEOXY-2-ACETAMIDO-.ALPHA.-D-GLUCOPYRANOSE",
          "stdName": "2-DEOXY-2-ACETAMIDO-.ALPHA.-D-GLUCOPYRANOSE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "114641e5-6a82-4c5d-b814-0745526c73bf",
            "61f1b146-8e61-4364-9d09-91306561fe95"
          ],
          "display_name": false
        },
        {
          "uuid": "951f448a-ff5c-4fc8-a38c-e26c2c5dadd2",
          "name": "GLUCOPYRANOSE, 2-ACETAMIDO-2-DEOXY-, .ALPHA.-D",
          "stdName": "GLUCOPYRANOSE, 2-ACETAMIDO-2-DEOXY-, .ALPHA.-D",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "114641e5-6a82-4c5d-b814-0745526c73bf",
            "61f1b146-8e61-4364-9d09-91306561fe95"
          ],
          "display_name": false
        },
        {
          "uuid": "8b2a618d-6b7d-4d70-8b71-0fccd7cb2feb",
          "name": "N-ACETYL-.ALPHA.-D-GLUCOSAMINE",
          "stdName": "N-ACETYL-.ALPHA.-D-GLUCOSAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d64c4e07-0e9f-42ee-9cf0-325295bbd05a",
            "18bcc071-620e-4db9-a927-c277a6f96eef"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "18bcc071-620e-4db9-a927-c277a6f96eef",
          "citation": "ChemIDplus 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d64c4e07-0e9f-42ee-9cf0-325295bbd05a",
          "citation": "CHEMID (STN)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "61f1b146-8e61-4364-9d09-91306561fe95",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "114641e5-6a82-4c5d-b814-0745526c73bf",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "96b5f3ce-af31-4c8a-8f3e-142756d0a8b0",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390695000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e8fff143-2d79-42db-8bff-2d7d9e1806f4",
          "citation": "SRS import [T13TI5GH3D]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=T13TI5GH3D",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390695000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a1ef0b74-61eb-aee5-0390-8008b1fa8e90",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "ad654814-1e0f-4fba-84e2-7572b9358c59",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "1ca1eff2-f23f-0ee3-8ae1-08ed0bf776da",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "19acf2b2-5b8f-4140-a1cf-646d72d23a48",
          "id": "19acf2b2-5b8f-4140-a1cf-646d72d23a48",
          "molfile": "\n  Marvin  01132101312D          \n\n 15 15  0  0  1  0            999 V2000\n    6.2167   -4.2917    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.9334   -3.8750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4917   -3.8750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7792   -4.2917    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.0667   -3.8750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4334   -4.4083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7792   -5.1167    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    4.0667   -5.5292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4917   -5.5292    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.5000   -6.3583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2167   -5.1167    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.9334   -5.5292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6459   -5.1083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3584   -5.5208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6375   -4.2833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n 11  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  1  0  0  0\n  7  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  8  1  6  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  1  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  6  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 13  2  0  0  0  0\nM  END",
          "smiles": "CC(=O)N[C@@H]1[C@H]([C@@H]([C@@H](CO)O[C@@H]1O)O)O",
          "formula": "C8H15NO6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "881d9196-5980-4138-a414-5d31fb4a42c5"
          },
          "defined_stereo": 5,
          "ez_centers": 0,
          "molecular_weight": "221.2081",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1f9cbd85-8b41-4d9b-8e8c-d578802c9ac7",
      "version": "7",
      "structure": {
        "id": "c3f272dc-29b7-4ffb-9c64-0cab55ec9692",
        "molfile": "\n  Marvin  01132110082D          \n\n 15 15  0  0  1  0            999 V2000\n    6.2167   -5.1167    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.4917   -5.5292    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.2167   -4.2917    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.4917   -3.8750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7792   -5.1167    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.7792   -4.2917    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.9334   -5.5292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6459   -5.1083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6375   -4.2833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5000   -6.3583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0667   -5.5292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9334   -3.8750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0667   -3.8750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4334   -4.4083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3584   -5.5208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n  1  7  1  6  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n  2 10  1  1  0  0  0\n  5 11  1  6  0  0  0\n  3 12  1  6  0  0  0\n  6 13  1  1  0  0  0\n 14 13  1  0  0  0  0\n 15  8  1  0  0  0  0\n  4  6  1  0  0  0  0\nM  END",
        "smiles": "CC(=O)N[C@@H]1[C@H]([C@@H]([C@@H](CO)O[C@@H]1O)O)O",
        "formula": "C8H15NO6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 5,
        "ez_centers": 0,
        "molecular_weight": "221.2081",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "e8fff143-2d79-42db-8bff-2d7d9e1806f4",
          "18bcc071-620e-4db9-a927-c277a6f96eef"
        ],
        "stereo_centers": 5
      },
      "unii": "T13TI5GH3D"
    }
  ]
}