{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b6a333c1-78b9-4279-ae47-8382c18c8dfc",
          "code": "79983-71-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=79983-71-4",
          "code_system": "CAS",
          "references": [
            "27677825-c870-4b83-b2b3-cf1eceb95d93",
            "d31b5725-12e6-4fcd-bf17-27324073d79b"
          ]
        },
        {
          "uuid": "83bb22b2-d9c4-4f44-800b-f2988ac2d07d",
          "code": "m5987",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5987?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "27677825-c870-4b83-b2b3-cf1eceb95d93"
          ]
        },
        {
          "uuid": "315f264c-84ea-4ec3-8e91-09e052a60577",
          "code": "66461",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/66461",
          "code_system": "PUBCHEM",
          "references": [
            "27677825-c870-4b83-b2b3-cf1eceb95d93"
          ]
        },
        {
          "uuid": "af9d37ec-ad71-d50e-cc29-12ae689b4553",
          "code": "DTXSID4034653",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4034653",
          "code_system": "EPA CompTox",
          "references": [
            "9d2de521-cbee-c370-c9a1-5aeac468eab1"
          ]
        },
        {
          "uuid": "304735ff-5ed0-4de1-865c-32ab05d77170",
          "code": "SX9R3X1FQV",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "1d69a543-c99a-2c9b-5ddb-d9660cbae1a4",
          "code": "Hexaconazole",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Hexaconazole",
          "code_system": "WIKIPEDIA",
          "references": [
            "f27a7f2f-7aed-5124-1b08-ab407d205ce5"
          ]
        },
        {
          "uuid": "cc62f6ff-922d-aa39-71e5-67d26f8ebaab",
          "code": "hexaconazole",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/hexaconazole.html",
          "code_system": "ALANWOOD",
          "references": [
            "73037c31-a70a-c264-87f3-5a3c34153b55"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "14d0621e-d552-4403-8784-eb2914482d50",
          "name": "(±)-HEXACONAZOLE",
          "stdName": "(+/-)-HEXACONAZOLE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "918862ad-c80f-474c-8222-1226dd549671",
            "d4677871-a038-4ac6-8bdf-09f3e42d002f"
          ],
          "display_name": false
        },
        {
          "uuid": "faab0889-61cd-4ef7-848b-ff9687bd43c4",
          "name": "1H-1,2,4-TRIAZOLE-1-ETHANOL, .ALPHA.-BUTYL-.ALPHA.-(2,4-DICHLOROPHENYL)-",
          "stdName": "1H-1,2,4-TRIAZOLE-1-ETHANOL, .ALPHA.-BUTYL-.ALPHA.-(2,4-DICHLOROPHENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "918862ad-c80f-474c-8222-1226dd549671",
            "d4677871-a038-4ac6-8bdf-09f3e42d002f"
          ],
          "display_name": false
        },
        {
          "uuid": "847252ad-9a21-4006-9722-eaa19d8429a8",
          "name": "ANVIL",
          "stdName": "ANVIL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "918862ad-c80f-474c-8222-1226dd549671",
            "d4677871-a038-4ac6-8bdf-09f3e42d002f"
          ],
          "display_name": false
        },
        {
          "uuid": "c5148819-0f10-4d34-afb0-4ee393aa05c3",
          "name": "HEXACONAZOLE",
          "stdName": "HEXACONAZOLE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b2795bb8-86a2-472f-8dba-d098889f116b",
            "26c9fc6b-4cbf-4052-b397-8acfa50765f8",
            "918862ad-c80f-474c-8222-1226dd549671",
            "8712323f-0960-4b36-b130-60a57c3b4612",
            "ebe3f1e6-0bfc-43f2-b847-88e0ec50e34e",
            "48602040-90e1-4b4f-beef-557d3cba4863"
          ],
          "display_name": true
        },
        {
          "uuid": "277078d0-f5b5-4864-9ffc-a3118065729e",
          "name": "HEXACONAZOLE [ISO]",
          "stdName": "HEXACONAZOLE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b2795bb8-86a2-472f-8dba-d098889f116b",
            "918862ad-c80f-474c-8222-1226dd549671"
          ],
          "display_name": false
        },
        {
          "uuid": "0ac95d36-ea6d-4f88-9399-7e76bfd5fa4f",
          "name": "HEXACONAZOLE [MI]",
          "stdName": "HEXACONAZOLE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "918862ad-c80f-474c-8222-1226dd549671",
            "48602040-90e1-4b4f-beef-557d3cba4863"
          ],
          "display_name": false
        },
        {
          "uuid": "9e2ed472-adbf-4486-8021-546750fc1802",
          "name": "HEXACONAZOLE, (±)-",
          "stdName": "HEXACONAZOLE, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "918862ad-c80f-474c-8222-1226dd549671",
            "d4677871-a038-4ac6-8bdf-09f3e42d002f"
          ],
          "display_name": false
        },
        {
          "uuid": "4fe7ef65-b21c-430e-9262-742feddfbc81",
          "name": "PC-1002",
          "stdName": "PC-1002",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "918862ad-c80f-474c-8222-1226dd549671",
            "d4677871-a038-4ac6-8bdf-09f3e42d002f"
          ],
          "display_name": false
        },
        {
          "uuid": "308a7b76-992d-43e7-89f5-ad91a80dacc8",
          "name": "PLANETE",
          "stdName": "PLANETE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "918862ad-c80f-474c-8222-1226dd549671",
            "48602040-90e1-4b4f-beef-557d3cba4863"
          ],
          "display_name": false
        },
        {
          "uuid": "66802b4a-9775-4088-90a2-146005c8686b",
          "name": "PP-523",
          "stdName": "PP-523",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "918862ad-c80f-474c-8222-1226dd549671",
            "d4677871-a038-4ac6-8bdf-09f3e42d002f"
          ],
          "display_name": false
        },
        {
          "uuid": "aae0b64d-f91b-45c8-ae1b-83b93dd89ac7",
          "name": "R-154523",
          "stdName": "R-154523",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "918862ad-c80f-474c-8222-1226dd549671",
            "d4677871-a038-4ac6-8bdf-09f3e42d002f"
          ],
          "display_name": false
        },
        {
          "uuid": "80412f5f-49f5-4ed4-bb86-4897d04db44f",
          "name": "RS-2-(2,4-DICHLOROPHENYL)-1-(1H-1,2,4-TRIAZOL-1-YL)HEXAN-2-OL",
          "stdName": "RS-2-(2,4-DICHLOROPHENYL)-1-(1H-1,2,4-TRIAZOL-1-YL)HEXAN-2-OL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "918862ad-c80f-474c-8222-1226dd549671",
            "d4677871-a038-4ac6-8bdf-09f3e42d002f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b2795bb8-86a2-472f-8dba-d098889f116b",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "918862ad-c80f-474c-8222-1226dd549671",
          "citation": "ISO",
          "doc_type": "ISO",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d4677871-a038-4ac6-8bdf-09f3e42d002f",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "48602040-90e1-4b4f-beef-557d3cba4863",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ebe3f1e6-0bfc-43f2-b847-88e0ec50e34e",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "27677825-c870-4b83-b2b3-cf1eceb95d93",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392017000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "518d7123-2c4d-4c4b-b949-2a53aaaf027b",
          "citation": "SRS import [SX9R3X1FQV]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=SX9R3X1FQV",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392017000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "26c9fc6b-4cbf-4052-b397-8acfa50765f8",
          "citation": "HEXACONAZOLE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8712323f-0960-4b36-b130-60a57c3b4612",
          "citation": "HEXACONAZOLE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9d2de521-cbee-c370-c9a1-5aeac468eab1",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=79983-71-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f27a7f2f-7aed-5124-1b08-ab407d205ce5",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "73037c31-a70a-c264-87f3-5a3c34153b55",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "d31b5725-12e6-4fcd-bf17-27324073d79b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d2b4cefe-8795-47d5-a7c3-1e3e847e6b74",
          "id": "d2b4cefe-8795-47d5-a7c3-1e3e847e6b74",
          "molfile": "\n  Marvin  01132110532D          \n\n 20 21  0  0  0  0            999 V2000\n    4.1362    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4283   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4283   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7091   -1.6612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7091   -2.4862    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    2.2855   -3.1997    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9956   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2710   -2.4862    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2710   -1.6612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4905   -1.3992    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.0681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4905   -2.7370    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4283   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4283   -3.7181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1362   -4.1362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8553   -3.7181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5744   -4.1362    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.8553   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1362   -2.4862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1362   -1.6612    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  5  1  0  0  0  0\n  5 13  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 12  1  0  0  0  0\n 10  9  2  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  2  0  0  0  0\n 14 13  1  0  0  0  0\n 13 19  2  0  0  0  0\n 14 15  2  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 16  2  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
          "smiles": "CCCCC(Cn1cncn1)(c2ccc(cc2Cl)Cl)O",
          "formula": "C14H17Cl2N3O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6d3d6904-f0ce-4605-9944-86f95e479a72"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "314.2107",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "aab21e9a-bcdd-4169-9491-cdbaf79c9c1f",
      "version": "5",
      "structure": {
        "id": "372bb0f6-4ab3-4f6f-b8e0-1ad7e0805739",
        "molfile": "\n  Marvin  01132102562D          \n\n 20 21  0  0  0  0            999 V2000\n    0.4905   -1.3992    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2710   -1.6612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2710   -2.4862    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4905   -2.7370    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.0681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9956   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7091   -2.4862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4283   -3.7181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4283   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1362   -2.4862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8553   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8553   -3.7181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1362   -4.1362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1362   -1.6612    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.5744   -4.1362    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    2.7091   -1.6612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4283   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4283   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1362    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2855   -3.1997    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  5  1  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  6  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  9  1  0  0  0  0\n  7 16  1  0  0  0  0\n  7 20  1  0  0  0  0\n  8 13  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 14  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\nM  END",
        "smiles": "CCCCC(Cn1cncn1)(c2ccc(cc2Cl)Cl)O",
        "formula": "C14H17Cl2N3O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "314.2107",
        "optical_activity": "( + / - )",
        "references": [
          "518d7123-2c4d-4c4b-b949-2a53aaaf027b",
          "ebe3f1e6-0bfc-43f2-b847-88e0ec50e34e"
        ],
        "stereo_centers": 1
      },
      "unii": "SX9R3X1FQV"
    }
  ]
}