{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "33c574b9-1873-486d-96cf-8a7d6c88a321",
          "code": "27253-32-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=27253-32-3",
          "code_system": "CAS",
          "references": [
            "9d6b0e9b-a74b-4fef-9a02-f507a41759f9",
            "2aecd205-9b2b-473a-86e6-134841757682"
          ]
        },
        {
          "uuid": "9ff6736c-ff40-4914-a015-180643191130",
          "code": "248-374-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.043.962",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "9d6b0e9b-a74b-4fef-9a02-f507a41759f9"
          ]
        },
        {
          "uuid": "ecf513b3-8871-9fdd-cc3b-4e24e9ca7644",
          "code": "24861462",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/24861462",
          "code_system": "PUBCHEM",
          "references": [
            "639c58c8-5f6c-ef98-4962-990772214d50"
          ]
        },
        {
          "uuid": "f02d34ff-572f-45eb-b552-fdd4a37c18d8",
          "code": "SX37H263XO",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "8c5018b0-d583-4758-a670-ff67a096a107",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "72f5e81f-8d06-4091-b85b-d18dece234d7",
            "refuuid": "8248332c-8739-4872-8639-9ac1fb9d7f19",
            "name": "MANGANOUS CATION",
            "unii": "H6EP7W5457",
            "linking_id": "H6EP7W5457",
            "ref_pname": "MANGANOUS CATION",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f0b7bb52-83ee-4431-844d-8f08c1cef628",
          "name": "MANGANESE NEODECANOATE",
          "stdName": "MANGANESE NEODECANOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8fb4a570-956a-4c83-963e-d4f3a20f5332"
          ],
          "display_name": true
        },
        {
          "uuid": "e5bff552-9908-4f63-a7c6-ebc483d13b86",
          "name": "NEO-DECANOIC ACID, MANGANESE SALT",
          "stdName": "NEO-DECANOIC ACID, MANGANESE SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b335e852-81f4-4ec8-8b34-f5c59af1f753",
            "59e9c802-aa3c-4342-ab94-8810f6213fa0"
          ],
          "display_name": false
        },
        {
          "uuid": "624b97a5-9331-48c1-ac29-949b0b9d237f",
          "name": "NEODECANOIC ACID, MANGANESE SALT",
          "stdName": "NEODECANOIC ACID, MANGANESE SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b335e852-81f4-4ec8-8b34-f5c59af1f753",
            "59e9c802-aa3c-4342-ab94-8810f6213fa0"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8fb4a570-956a-4c83-963e-d4f3a20f5332",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "59e9c802-aa3c-4342-ab94-8810f6213fa0",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b335e852-81f4-4ec8-8b34-f5c59af1f753",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9d6b0e9b-a74b-4fef-9a02-f507a41759f9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391022000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3629fb58-8738-4034-afc6-27902fae9f7b",
          "citation": "SRS import [SX37H263XO]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=SX37H263XO",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391022000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "16b3cb16-7bbd-44b8-9a52-62d3c2242c89",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0040e42e-b5e8-1fb0-533e-59c7251d6c3d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=27253-32-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "639c58c8-5f6c-ef98-4962-990772214d50",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "2aecd205-9b2b-473a-86e6-134841757682",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "463ad867-5763-49fa-b345-9ee6b5b209a8",
          "id": "463ad867-5763-49fa-b345-9ee6b5b209a8",
          "molfile": "\n  Marvin  01132103412D          \n\n  1  0  0  0  0  0            999 V2000\n    4.0319   -4.1176    0.0000 Mn  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Mn+2]",
          "formula": "Mn",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3429d6a1-5f58-46ee-8cff-be49ac0d0864"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "54.938",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "004c5942-589a-4579-b5f0-787ab778a5fb",
          "id": "004c5942-589a-4579-b5f0-787ab778a5fb",
          "molfile": "\n  Marvin  01132100202D          \n\n 12 11  0  0  0  0            999 V2000\n    9.7598   -1.7922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0456   -2.2024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0456   -3.0320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3314   -3.4422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3314   -4.2672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6173   -4.6820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6173   -5.5070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6173   -6.3320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4423   -5.5070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7923   -5.5070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3776   -6.2212    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.3776   -4.7929    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n 10  7  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  2  0  0  0  0\nM  CHG  1  11  -1\nM  END",
          "smiles": "CCCCCCC(C)(C)C(=O)[O-]",
          "formula": "C10H19O2",
          "atropisomerism": "No",
          "charge": -1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "1fbd8406-5a1c-497a-9cb8-48a45250f1f5"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "171.257",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "REPRESENTATIVE",
      "uuid": "4f50334e-4271-4288-aec7-c6d27a96196c",
      "version": "5",
      "structure": {
        "id": "879e2558-c30f-4120-99fe-e24d849fd113",
        "molfile": "\n  Marvin  01132107022D          \n\n 25 22  0  0  0  0            999 V2000\n    4.0319   -4.1176    0.0000 Mn  0  2  0  0  0  0  0  0  0  0  0  0\n    6.7923   -5.5070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6173   -5.5070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6173   -4.6820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3314   -4.2672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3314   -3.4422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0456   -3.0320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0456   -2.2024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7598   -1.7922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6173   -6.3320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4423   -5.5070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3776   -6.2212    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.3776   -4.7929    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7923   -5.5070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6173   -5.5070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6173   -4.6820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3314   -4.2672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3314   -3.4422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0456   -3.0320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0456   -2.2024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7598   -1.7922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6173   -6.3320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4423   -5.5070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3776   -6.2212    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.3776   -4.7929    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  3 10  1  0  0  0  0\n  3 11  1  0  0  0  0\n  2 12  1  0  0  0  0\n  2 13  2  0  0  0  0\n 14 15  1  0  0  0  0\n 14 24  1  0  0  0  0\n 14 25  2  0  0  0  0\n 15 16  1  0  0  0  0\n 15 22  1  0  0  0  0\n 15 23  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\nM  CHG  3   1   2  12  -1  24  -1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1 15   2   3   4   5   6   7   8   9  10  11  12  13  14  15  16\nM  SAL   1  9  17  18  19  20  21  22  23  24  25\nM  SPA   1 12   2   3   4   5   6   7   8   9  10  11  12  13\nM  SDI   1  4    5.9576   -6.7520    5.9576   -1.3722\nM  SDI   1  4   10.1798   -1.3722   10.1798   -6.7520\nM  SMT   1 2\nM  END",
        "smiles": "CCCCCCC(C)(C)C(=O)[O-].CCCCCCC(C)(C)C(=O)[O-].[Mn+2]",
        "formula": "2C10H19O2.Mn",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "397.4521",
        "optical_activity": "NONE",
        "references": [
          "16b3cb16-7bbd-44b8-9a52-62d3c2242c89",
          "3629fb58-8738-4034-afc6-27902fae9f7b"
        ],
        "stereo_centers": 0
      },
      "unii": "SX37H263XO"
    }
  ]
}