{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "aba4115a-c882-462c-ab9a-6944339d9d28",
          "code": "2050-34-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2050-34-2",
          "code_system": "CAS",
          "references": [
            "fe2dcb52-f755-4dcd-86a8-5ba7b0716a23",
            "3b4a052b-e976-4ffe-9bca-5f1aefd5eacc"
          ]
        },
        {
          "uuid": "7241c929-9fdd-420f-9ff6-25a887944371",
          "code": "218-087-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.016.444",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "fe2dcb52-f755-4dcd-86a8-5ba7b0716a23"
          ]
        },
        {
          "uuid": "813c2650-8e21-4039-bed6-d57ca905b49d",
          "code": "SW441JGO0K",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ef186c80-0c49-03d9-cdaa-e930a1311da5",
          "code": "DTXSID00862165",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00862165",
          "code_system": "EPA CompTox"
        }
      ],
      "relationships": [
        {
          "uuid": "6e135a02-db24-478f-9aa0-ad58f3128adf",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "17cbc346-4e9f-4340-9f61-9de194b82b0e",
            "refuuid": "b3473c02-558e-45bb-b447-ce305636fe61",
            "name": "ACID ORANGE 6 FREE ACID",
            "unii": "SW441JGO0K",
            "linking_id": "SW441JGO0K",
            "ref_pname": "ACID ORANGE 6 FREE ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1ba098b2-e8bb-4cf6-b488-d63bfc5f7cf3",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "8ae79688-fad2-459a-ad38-5f3c5d3c36ad",
            "refuuid": "a2f1c73b-d82c-4966-ae07-674b0dc428fa",
            "name": "ACID ORANGE 6",
            "unii": "NF91VMI73L",
            "linking_id": "NF91VMI73L",
            "ref_pname": "ACID ORANGE 6",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ed489abf-5e20-421e-a473-451ae749582d",
          "name": "2,4-DIHYDROXYAZOBENZENE-4'-SULFONIC ACID",
          "stdName": "2,4-DIHYDROXYAZOBENZENE-4'-SULFONIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6cf92f4e-4c82-462e-9f30-82837930cc26"
          ],
          "display_name": false
        },
        {
          "uuid": "e33b2f09-c0b0-451f-af2d-52348c38ac9b",
          "name": "4-((2,4-DIHYDROXYPHENYL)AZO)BENZENESULPHONIC ACID",
          "stdName": "4-((2,4-DIHYDROXYPHENYL)AZO)BENZENESULPHONIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "234c36c1-eeb5-4348-ab7e-b5a386d24f8e",
            "dadf0e14-3512-4e83-8f53-1d89f784b54c"
          ],
          "display_name": false
        },
        {
          "uuid": "c37a86e8-9561-4bfe-9aa7-2c4454beecfa",
          "name": "4-(2,4-DIHYDROXYPHENYLAZO)BENZENESULFONIC ACID",
          "stdName": "4-(2,4-DIHYDROXYPHENYLAZO)BENZENESULFONIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6cf92f4e-4c82-462e-9f30-82837930cc26"
          ],
          "display_name": false
        },
        {
          "uuid": "463c9398-fe60-457a-a0e4-3bd8d6651170",
          "name": "ACID ORANGE 6 FREE ACID",
          "stdName": "ACID ORANGE 6 FREE ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a7dc21f-7790-4339-bf28-34283242a021",
            "234c36c1-eeb5-4348-ab7e-b5a386d24f8e"
          ],
          "display_name": true
        },
        {
          "uuid": "7d36dbf5-c1c6-40d8-99b3-1b0492a3171d",
          "name": "BENZENESULFONIC ACID, 4-((2,4-DIHYDROXYPHENYL)AZO)-",
          "stdName": "BENZENESULFONIC ACID, 4-((2,4-DIHYDROXYPHENYL)AZO)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6cf92f4e-4c82-462e-9f30-82837930cc26"
          ],
          "display_name": false
        },
        {
          "uuid": "1c60ddd7-66f5-402d-ad60-89fd714f137c",
          "name": "BENZENESULFONIC ACID, P-((2,4-DIHYDROXYPHENYL)AZO)-",
          "stdName": "BENZENESULFONIC ACID, P-((2,4-DIHYDROXYPHENYL)AZO)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6cf92f4e-4c82-462e-9f30-82837930cc26"
          ],
          "display_name": false
        },
        {
          "uuid": "dc4d3b0d-3618-47ca-8e9d-f96a6f1d7a12",
          "name": "BENZENESULFONIC ACID, P-((DIHYDROXYPHENYL)AZO)-",
          "stdName": "BENZENESULFONIC ACID, P-((DIHYDROXYPHENYL)AZO)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6cf92f4e-4c82-462e-9f30-82837930cc26"
          ],
          "display_name": false
        },
        {
          "uuid": "09cd8f1d-4d94-48d4-bd22-65285a9b5147",
          "name": "C.I. ACID ORANGE 6 (FREE ACID)",
          "stdName": "C.I. ACID ORANGE 6 (FREE ACID)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6cf92f4e-4c82-462e-9f30-82837930cc26"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "dadf0e14-3512-4e83-8f53-1d89f784b54c",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "234c36c1-eeb5-4348-ab7e-b5a386d24f8e",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6a7dc21f-7790-4339-bf28-34283242a021",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6cf92f4e-4c82-462e-9f30-82837930cc26",
          "citation": "SCIFINDER 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fe2dcb52-f755-4dcd-86a8-5ba7b0716a23",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391502000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b414371a-8583-4061-b67c-b372046eb468",
          "citation": "SRS import [SW441JGO0K]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=SW441JGO0K",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391502000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ef01f996-7b5a-4ff1-b19f-9ff4c6de37a0",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3b4a052b-e976-4ffe-9bca-5f1aefd5eacc",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "35ff1898-0316-407f-899b-00ac4b95de20",
          "id": "35ff1898-0316-407f-899b-00ac4b95de20",
          "molfile": "\n  Marvin  01132102532D          \n\n 20 21  0  0  0  0            999 V2000\n    0.0000   -1.7918    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7161   -1.3822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7182   -0.5572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4287   -0.1464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1454   -0.5608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8605   -0.1493    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5744   -0.5629    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2895   -0.1516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2895    0.6734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9990    1.0859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7168    0.6734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7168   -0.1516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9990   -0.5641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4308    1.0867    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1448    1.4999    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0175    1.8007    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8440    0.3727    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1433   -1.3858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8564   -1.8007    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4246   -1.7964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 20  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n 18  5  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 13  2  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 14 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 14  2  0  0  0  0\n 14 17  2  0  0  0  0\n 18 19  1  0  0  0  0\n 20 18  1  0  0  0  0\nM  END",
          "smiles": "c1cc(ccc1/N=N/c2ccc(cc2O)O)S(=O)(=O)O",
          "formula": "C12H10N2O5S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2ea72ec2-f1ea-4494-b198-9bd8263386c9"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "294.2848",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b3473c02-558e-45bb-b447-ce305636fe61",
      "version": "3",
      "structure": {
        "id": "f089e149-cb17-455a-8bed-6f71e6ead2ed",
        "molfile": "\n  Marvin  01132112292D          \n\n 20 21  0  0  0  0            999 V2000\n    6.0175    1.8007    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4308    1.0867    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8440    0.3727    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7168    0.6734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9990    1.0859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2895    0.6734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2895   -0.1516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9990   -0.5641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7168   -0.1516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5744   -0.5629    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8605   -0.1493    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1454   -0.5608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4287   -0.1464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7182   -0.5572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7161   -1.3822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4246   -1.7964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1433   -1.3858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8564   -1.8007    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.7918    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1448    1.4999    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9  4  2  0  0  0  0\n  7 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 12  2  0  0  0  0\n 17 18  1  0  0  0  0\n 15 19  1  0  0  0  0\n  2 20  1  0  0  0  0\nM  END",
        "smiles": "c1cc(ccc1/N=N/c2ccc(cc2O)O)S(=O)(=O)O",
        "formula": "C12H10N2O5S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "294.2848",
        "optical_activity": "NONE",
        "references": [
          "b414371a-8583-4061-b67c-b372046eb468",
          "ef01f996-7b5a-4ff1-b19f-9ff4c6de37a0"
        ],
        "stereo_centers": 0
      },
      "unii": "SW441JGO0K"
    }
  ]
}