{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "95688c43-43d6-4b60-97b1-01e7d02238ff",
          "code": "5280656",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5280656",
          "code_system": "PUBCHEM",
          "references": [
            "0e05b958-82ca-48df-a5e1-f6b30d5bdf73"
          ]
        },
        {
          "uuid": "f1fc2cab-bb2d-49ad-ac1b-f5777b184b78",
          "code": "85026-55-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=85026-55-7",
          "code_system": "CAS",
          "references": [
            "d950a096-45fa-4273-89af-cbd27119da78",
            "ef4edb6a-34b9-466d-bc40-f6526725f04a"
          ]
        },
        {
          "uuid": "26717449-dbca-5879-05c0-9d8c6c3d42a4",
          "code": "Rosin (chemical)",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Rosin_(chemical)",
          "code_system": "WIKIPEDIA",
          "references": [
            "d950a096-45fa-4273-89af-cbd27119da78"
          ]
        },
        {
          "uuid": "274fced6-82b6-40b9-abfe-451157e99ac3",
          "code": "69306-80-5",
          "type": "NON-SPECIFIC STEREOCHEMISTRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=69306-80-5",
          "code_system": "CAS"
        },
        {
          "uuid": "6b0a793e-bf3a-4c9f-8118-66797a5c7a5f",
          "code": "SVS3GU8AY8",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "fe02ad17-7958-6c1e-75d1-a9407ec129d4",
          "code": "DTXSID60904535",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60904535",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "bf14e139-7de4-44bc-b5c1-08b15b1e4535",
          "name": "(2E)-3-PHENYL-2-PROPEN-1-YL .BETA.-D-GLUCOPYRANOSIDE",
          "stdName": "(2E)-3-PHENYL-2-PROPEN-1-YL .BETA.-D-GLUCOPYRANOSIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef4edb6a-34b9-466d-bc40-f6526725f04a"
          ],
          "display_name": false
        },
        {
          "uuid": "bffed494-326d-42db-a6ae-9c351f09fbc9",
          "name": ".BETA.-D-GLUCOPYRANOSIDE, (2E)-3-PHENYL-2-PROPEN-1-YL",
          "stdName": ".BETA.-D-GLUCOPYRANOSIDE, (2E)-3-PHENYL-2-PROPEN-1-YL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef4edb6a-34b9-466d-bc40-f6526725f04a"
          ],
          "display_name": false
        },
        {
          "uuid": "e043b101-e76a-4f82-afa4-052092d35ef1",
          "name": ".BETA.-D-GLUCOPYRANOSIDE, (2E)-3-PHENYL-2-PROPENYL",
          "stdName": ".BETA.-D-GLUCOPYRANOSIDE, (2E)-3-PHENYL-2-PROPENYL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef4edb6a-34b9-466d-bc40-f6526725f04a"
          ],
          "display_name": false
        },
        {
          "uuid": "349788fa-7c24-43a7-a174-84ad94dd43a0",
          "name": ".BETA.-D-GLUCOPYRANOSIDE, 3-PHENYL-2-PROPENYL, (E)-",
          "stdName": ".BETA.-D-GLUCOPYRANOSIDE, 3-PHENYL-2-PROPENYL, (E)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef4edb6a-34b9-466d-bc40-f6526725f04a"
          ],
          "display_name": false
        },
        {
          "uuid": "26285b71-91d3-4ab5-bed9-2212d3abf742",
          "name": "CHINESE ROSIN W",
          "stdName": "CHINESE ROSIN W",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef4edb6a-34b9-466d-bc40-f6526725f04a"
          ],
          "display_name": false
        },
        {
          "uuid": "69b9a42b-5f23-483b-ab79-ed10ec02f5a4",
          "name": "ROSIN (CHEMICAL)",
          "stdName": "ROSIN (CHEMICAL)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d950a096-45fa-4273-89af-cbd27119da78"
          ],
          "display_name": true
        },
        {
          "uuid": "d715cfe5-e955-474c-9c70-4a02a09b2b55",
          "name": "ROSIN (GLYCOSIDE)",
          "stdName": "ROSIN (GLYCOSIDE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef4edb6a-34b9-466d-bc40-f6526725f04a"
          ],
          "display_name": false
        },
        {
          "uuid": "03b6e095-5e87-4023-9ed3-4b3856d531e5",
          "name": "ROSIN X",
          "stdName": "ROSIN X",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef4edb6a-34b9-466d-bc40-f6526725f04a"
          ],
          "display_name": false
        },
        {
          "uuid": "5934a233-24c0-4e08-8a44-d3b702ab2654",
          "name": "TRANS-CINNAMYL .BETA.-D-GLUCOPYRANOSIDE",
          "stdName": "TRANS-CINNAMYL .BETA.-D-GLUCOPYRANOSIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef4edb6a-34b9-466d-bc40-f6526725f04a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0e05b958-82ca-48df-a5e1-f6b30d5bdf73",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d950a096-45fa-4273-89af-cbd27119da78",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ef4edb6a-34b9-466d-bc40-f6526725f04a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "af300bb4-e1bd-40d3-bfa8-aee33f959b2e",
          "id": "af300bb4-e1bd-40d3-bfa8-aee33f959b2e",
          "molfile": "\n  Marvin  06172210512D          \n\n 21 22  0  0  1  0            999 V2000\n    4.2868    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5723    1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8578    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1434    1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2868    2.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1446    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8591    1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7157    3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1446    2.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0013    1.6500    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.7157    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0013    2.4750    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.4302    1.6500    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.7157    2.8875    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.4302    2.4750    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    1.4289    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4289    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145    1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n 10  1  1  1  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4 16  1  0  0  0  0\n 12  5  1  6  0  0  0\n  6  7  1  0  0  0  0\n 13  6  1  1  0  0  0\n 14  8  1  1  0  0  0\n 15  9  1  6  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 17  2  0  0  0  0\n 16 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 18 20  2  0  0  0  0\n 19 21  2  0  0  0  0\n 20 21  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)/C=C/CO[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O",
          "formula": "C15H20O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "40495190-a845-4abd-8c52-a946280e7ab3"
          },
          "defined_stereo": 5,
          "ez_centers": 1,
          "molecular_weight": "296.3163",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "226ea666-e92d-4720-abec-48802a77a7d1",
      "version": "8",
      "structure": {
        "id": "9e964566-e2ac-4a15-8937-164d4429e912",
        "molfile": "Rosin X\n   JSDraw206172210512D\n\n 21 22  0  0  1  0              0 V2000\n   25.2195   -8.8660    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8685   -8.0860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.5175   -8.8660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1665   -8.0860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.2195   -5.7460    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   30.6234   -8.8660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   31.9744   -8.0860    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   27.9214   -4.1860    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   30.6234   -5.7460    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   26.5705   -8.0860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.9214   -8.8660    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   26.5705   -6.5260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.2724   -8.0860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.9214   -5.7460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.2724   -6.5260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.8156   -8.8660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.8156  -10.4260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4646   -8.0860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4646  -11.2060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1136   -8.8660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1136  -10.4260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n 10  1  1  1  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4 16  1  0  0  0  0\n 12  5  1  6  0  0  0\n  6  7  1  0  0  0  0\n 13  6  1  1  0  0  0\n 14  8  1  1  0  0  0\n 15  9  1  6  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 17  2  0  0  0  0\n 16 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 18 20  2  0  0  0  0\n 19 21  2  0  0  0  0\n 20 21  1  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)/C=C/CO[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O",
        "formula": "C15H20O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 5,
        "ez_centers": 1,
        "molecular_weight": "296.3163",
        "optical_activity": "( - )",
        "references": [
          "d950a096-45fa-4273-89af-cbd27119da78"
        ],
        "stereo_centers": 5
      },
      "unii": "SVS3GU8AY8"
    }
  ]
}