{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "62ae765a-0c95-4458-81f6-c550f76cbbee",
          "code": "1968-05-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1968-05-4",
          "code_system": "CAS",
          "references": [
            "b174038e-6fe3-495a-8a0c-1956864c78db",
            "34beca5d-c3e2-493f-baf7-f79c80c15802"
          ]
        },
        {
          "uuid": "e164666f-0390-4dca-b429-85e6052d7898",
          "code": "C016392",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67016392",
          "code_system": "MESH",
          "references": [
            "b174038e-6fe3-495a-8a0c-1956864c78db"
          ]
        },
        {
          "uuid": "808cd9fd-4603-489d-a5c0-000e85957fa3",
          "code": "1603521",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1603521/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "b174038e-6fe3-495a-8a0c-1956864c78db"
          ]
        },
        {
          "uuid": "f0129832-4aa9-42a5-b022-0db3452437b7",
          "code": "SUB32854",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "b174038e-6fe3-495a-8a0c-1956864c78db"
          ]
        },
        {
          "uuid": "e88bba33-1f4c-45d3-8fc4-6f8e9a4c8967",
          "code": "3071",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3071",
          "code_system": "PUBCHEM",
          "references": [
            "b174038e-6fe3-495a-8a0c-1956864c78db"
          ]
        },
        {
          "uuid": "27c6794c-8af6-a194-b4b5-6be8a072e658",
          "code": "3,3'-Diindolylmethane",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/3,3'-Diindolylmethane",
          "code_system": "WIKIPEDIA",
          "references": [
            "5061f886-ae31-ed54-93d0-5d46a5f338da"
          ]
        },
        {
          "uuid": "14316390-ec0f-9db7-5638-e78a7c5ae482",
          "code": "DTXSID8037047",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8037047",
          "code_system": "EPA CompTox",
          "references": [
            "8fd402c7-3115-c856-4de6-5bcee36bcbac"
          ]
        },
        {
          "uuid": "20a24769-761e-faf3-5155-7fad69c9c0d4",
          "code": "C54630",
          "comments": "Pharmacologic Substance[C1909]|Chemopreventive Agent[C1892]|Phase II Enzymes Inducer",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C54630",
          "code_system": "NCI_THESAURUS",
          "references": [
            "2a97ca36-e7d6-ad89-8826-2fabd7560f2e"
          ]
        },
        {
          "uuid": "b7a81d46-842a-9441-3583-bec1e4ad193a",
          "code": "C54677",
          "comments": "Drug or Chemical by Structure[C1913]|Organic Chemical[C718]|Ring Compound[C1933]|Aromatic Compounds[C1915]|Indole Compound",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C54677",
          "code_system": "NCI_THESAURUS",
          "references": [
            "2a97ca36-e7d6-ad89-8826-2fabd7560f2e"
          ]
        },
        {
          "uuid": "4b0b30c4-f8ca-4637-b2f3-10f624bc02cb",
          "code": "SSZ9HQT61Z",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "bbacacea-6549-4950-a3ff-983d996f2298",
          "code": "1346 (Number of products:303)",
          "comments": "Dietary Supplement Label Database|Chemical|Diindolylmethane",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=1346&item=Diindolylmethane",
          "code_system": "DSLD",
          "references": [
            "2a97ca36-e7d6-ad89-8826-2fabd7560f2e"
          ]
        },
        {
          "uuid": "3de14fb8-570a-31fb-92e7-24974587fc2c",
          "code": "DB11875",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB11875",
          "code_system": "DRUG BANK",
          "references": [
            "2a97ca36-e7d6-ad89-8826-2fabd7560f2e"
          ]
        },
        {
          "uuid": "8715eddb-57b3-38ce-cb51-75c5a16237fb",
          "code": "C53434",
          "comments": "NCIT",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C53434",
          "code_system": "NCI_THESAURUS",
          "references": [
            "8bb249dc-5896-c160-2faa-58571043ae15"
          ]
        },
        {
          "uuid": "eb1fcb45-c622-9053-9b41-8da0a54c5a5a",
          "code": "100000126223",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "7465c9d6-a083-cb9a-222b-132a18fbe2ed"
          ]
        },
        {
          "uuid": "7929ceaf-22c8-f508-ce28-f437fe6eee97",
          "code": "SSZ9HQT61Z",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=SSZ9HQT61Z",
          "code_system": "DAILYMED",
          "references": [
            "4c53d7a5-56b8-64e6-a50f-7b6f0f41fef2"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "c1f4b452-b3b6-42b6-9daf-01e8a2dc134b",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "61226de3-7bdc-4ac3-995a-d1e9e4b0ba35",
            "refuuid": "53611c64-123e-4aad-9ee8-c8680c181ac2",
            "name": "3,3'-DIINDOLYLMETHANE",
            "unii": "SSZ9HQT61Z",
            "linking_id": "SSZ9HQT61Z",
            "ref_pname": "3,3'-DIINDOLYLMETHANE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b505d946-0403-4996-a98b-5baf757ef3a4",
          "type": "PARENT->POSSIBLE ACTIVE CONSTITUENT ALWAYS PRESENT",
          "references": [
            "cc62f138-fce9-4629-a328-87a0aac88bff"
          ],
          "related_substance": {
            "uuid": "da87b703-6f1b-4890-b98a-96c2211a27b1",
            "refuuid": "055c52cb-f6f5-4459-ba24-5e3fd45ba3fe",
            "name": "BROCCOLI",
            "unii": "UOI4FT57BZ",
            "linking_id": "UOI4FT57BZ",
            "ref_pname": "BROCCOLI",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3b19d487-189b-4fa5-9de1-a4bc0b625e6e",
          "name": "3,3'-DIINDOLYLMETHANE",
          "stdName": "3,3'-DIINDOLYLMETHANE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e7bebd6-44f9-4d13-ac98-b0ec221d938b",
            "0ad0b371-d2a1-4c50-b54c-fe6d7a63ff47",
            "7598a9cb-6932-4d4a-91f4-1536ec6d46bc",
            "fd08b686-3a7f-4be6-9c16-6db42a98e234"
          ],
          "display_name": true
        },
        {
          "uuid": "99a2ddf2-c65c-57ae-3ec5-2863ae00b721",
          "name": "3,3'-Diindolylmethane [WHO-DD]",
          "stdName": "3,3'-DIINDOLYLMETHANE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9c3361c3-158e-87b2-9cec-86cec146bafa"
          ],
          "display_name": false
        },
        {
          "uuid": "0af3f7f2-e0de-4b6b-9dcd-0eb90aaed248",
          "name": "DIINDOLYLMETHANE",
          "stdName": "DIINDOLYLMETHANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ce1e5280-a42f-47e8-84b2-b53670ed2778",
            "320dbc24-c31a-4f3a-b80d-307a34c88c33",
            "1e7bebd6-44f9-4d13-ac98-b0ec221d938b",
            "a9d949ae-fb32-4100-af59-c5572433bbbe"
          ],
          "display_name": false
        },
        {
          "uuid": "83261307-f8ec-4d7a-b3c5-76304b2b26fb",
          "name": "DIINDOLYLMETHANE [VANDF]",
          "stdName": "DIINDOLYLMETHANE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ce1e5280-a42f-47e8-84b2-b53670ed2778",
            "1e7bebd6-44f9-4d13-ac98-b0ec221d938b"
          ],
          "display_name": false
        },
        {
          "uuid": "6f69845e-dc55-4561-9436-ee8193e7254a",
          "name": "DIINDOLYLMETHANE, 3,3'-",
          "stdName": "DIINDOLYLMETHANE, 3,3'-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b6214e0b-5d1e-48c1-88d9-9e0484c6aa30"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b6214e0b-5d1e-48c1-88d9-9e0484c6aa30",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7598a9cb-6932-4d4a-91f4-1536ec6d46bc",
          "citation": "http://www.chemblink.com/products/1968-05-4.htm",
          "url": "http://www.chemblink.com/products/1968-05-4.htm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1e7bebd6-44f9-4d13-ac98-b0ec221d938b",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fd08b686-3a7f-4be6-9c16-6db42a98e234",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "320dbc24-c31a-4f3a-b80d-307a34c88c33",
          "citation": "CLINICAL TRIALS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ce1e5280-a42f-47e8-84b2-b53670ed2778",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b174038e-6fe3-495a-8a0c-1956864c78db",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390938000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cc62f138-fce9-4629-a328-87a0aac88bff",
          "citation": "3,3'-DIINDOLYLMETHANE",
          "url": "http://en.wikipedia.org/wiki/3,3%27-Diindolylmethane",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e2ae893f-a30f-4e10-960c-f8b580ea9bd9",
          "citation": "SRS import [SSZ9HQT61Z]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=SSZ9HQT61Z",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390938000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "900fd797-d184-421a-a2ae-4041fdabc444",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0ad0b371-d2a1-4c50-b54c-fe6d7a63ff47",
          "citation": "3,3'-DIINDOLYLMETHANE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a9d949ae-fb32-4100-af59-c5572433bbbe",
          "citation": "DIINDOLYLMETHANE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5061f886-ae31-ed54-93d0-5d46a5f338da",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/3,3'-Diindolylmethane",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8fd402c7-3115-c856-4de6-5bcee36bcbac",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1968-05-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2a97ca36-e7d6-ad89-8826-2fabd7560f2e",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "34beca5d-c3e2-493f-baf7-f79c80c15802",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "8bb249dc-5896-c160-2faa-58571043ae15",
          "citation": "NCIT",
          "doc_type": "NCI THESAURUS",
          "public_domain": true
        },
        {
          "uuid": "9c3361c3-158e-87b2-9cec-86cec146bafa",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "4c53d7a5-56b8-64e6-a50f-7b6f0f41fef2",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "7465c9d6-a083-cb9a-222b-132a18fbe2ed",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8056b2d2-4c17-4cab-80a0-a3c1945baded",
          "id": "8056b2d2-4c17-4cab-80a0-a3c1945baded",
          "molfile": "\n  Marvin  01132106402D          \n\n 19 22  0  0  0  0            999 V2000\n    7.3429   -5.3517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0535   -4.9449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0535   -5.7633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7642   -6.1823    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4786   -5.7660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1780   -6.1803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8967   -5.7749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8967   -4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1869   -4.5352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4786   -4.9449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6278   -4.9402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6278   -4.1099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9088   -3.6867    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1923   -4.1074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4784   -3.6997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7636   -4.1117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7636   -4.9377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4805   -5.3499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1923   -4.9402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n 11  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n 10  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n 10  5  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 19 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 19  2  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)c(Cc3c[nH]c4ccccc34)c[nH]2",
          "formula": "C17H14N2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "873dcfc4-8550-4b44-9e1e-5dd8650a8eeb"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "246.3071",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "53611c64-123e-4aad-9ee8-c8680c181ac2",
      "version": "18",
      "structure": {
        "id": "a49a11eb-fce4-4fff-8e8f-edf7f98d52f4",
        "molfile": "\n  Marvin  01132108332D          \n\n 19 22  0  0  0  0            999 V2000\n    8.0535   -4.9449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0535   -5.7633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7642   -6.1823    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4786   -5.7660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4786   -4.9449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1869   -4.5352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8967   -4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8967   -5.7749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1780   -6.1803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3429   -5.3517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6278   -4.9402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6278   -4.1099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9088   -3.6867    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1923   -4.1074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4784   -3.6997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7636   -4.1117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7636   -4.9377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4805   -5.3499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1923   -4.9402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  5  1  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n  4  9  1  0  0  0  0\n 10  1  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 11  1  0  0  0  0\n 14 19  1  0  0  0  0\nM  END",
        "smiles": "c1ccc2c(c1)c(Cc3c[nH]c4ccccc34)c[nH]2",
        "formula": "C17H14N2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "246.3071",
        "optical_activity": "NONE",
        "references": [
          "900fd797-d184-421a-a2ae-4041fdabc444",
          "e2ae893f-a30f-4e10-960c-f8b580ea9bd9"
        ],
        "stereo_centers": 0
      },
      "unii": "SSZ9HQT61Z"
    }
  ]
}