{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "449b6da9-0228-4633-8dc4-17df6a98a9ee",
          "code": "5793-88-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5793-88-4",
          "code_system": "CAS",
          "references": [
            "b98119e4-ff8c-4705-ac62-45e8919ce9eb",
            "0b412538-7deb-4abd-b795-f147ac43133a"
          ]
        },
        {
          "uuid": "4cb8d0ac-583f-4b1d-8453-5ede6c61a9fa",
          "code": "439",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=439",
          "code_system": "INN",
          "references": [
            "b98119e4-ff8c-4705-ac62-45e8919ce9eb"
          ]
        },
        {
          "uuid": "47fc5608-161b-4606-b64c-9c50bba93dd1",
          "code": "227-334-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.024.850",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "b98119e4-ff8c-4705-ac62-45e8919ce9eb"
          ]
        },
        {
          "uuid": "6ff6bcba-faf6-4937-bfce-c050a2bc48fd",
          "code": "C84483",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C84483",
          "code_system": "NCI_THESAURUS",
          "references": [
            "b98119e4-ff8c-4705-ac62-45e8919ce9eb"
          ]
        },
        {
          "uuid": "b93958f2-cc66-4853-bd8e-bc567854b5cf",
          "code": "1907",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1907/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "b98119e4-ff8c-4705-ac62-45e8919ce9eb"
          ]
        },
        {
          "uuid": "a3c512b3-2de5-4b40-b987-fdecf33ddc41",
          "code": "m2972",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2972?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "b98119e4-ff8c-4705-ac62-45e8919ce9eb"
          ]
        },
        {
          "uuid": "942574cf-67b7-4e9b-9f43-cfe1ddbad7bd",
          "code": "SUB06056MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "b98119e4-ff8c-4705-ac62-45e8919ce9eb"
          ]
        },
        {
          "uuid": "9fac5dc4-f2ea-353e-5082-e9ff6a50beef",
          "code": "C1017",
          "comments": "Pharmacologic Substance[C1909]|Enzyme Inhibitor[C471]|Glucuronidase Inhibitor",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1017",
          "code_system": "NCI_THESAURUS",
          "references": [
            "cdbfc397-2bbd-f8c9-a4ce-cd55c295c30c"
          ]
        },
        {
          "uuid": "bc6e9dd1-be93-691f-5d10-50cf2b7c35bc",
          "code": "1681 (Number of products:125)",
          "comments": "Dietary Supplement Label Database|Chemical|Calcium d-Glucarate",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=1681&item=Calcium d-Glucarate",
          "code_system": "DSLD",
          "references": [
            "cdbfc397-2bbd-f8c9-a4ce-cd55c295c30c"
          ]
        },
        {
          "uuid": "2496fa4e-69f9-4f30-8a3c-6c4af9c6fdd7",
          "code": "154911",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/154911",
          "code_system": "PUBCHEM",
          "references": [
            "51e2ad87-7818-7c26-130e-c4cdf77da33d"
          ]
        },
        {
          "uuid": "e6b436fe-55ee-4ef6-a219-9b1b8ae52b7d",
          "code": "SST07NLK7J",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b8c7c6a3-770a-9729-2bf9-d7bc5ed6ed42",
          "code": "2385 (Number of products:29)",
          "comments": "Dietary Supplement Label Database|chemical|Calcium Glucarate",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=2385&item=Calcium Glucarate",
          "code_system": "DSLD",
          "references": [
            "cdbfc397-2bbd-f8c9-a4ce-cd55c295c30c"
          ]
        },
        {
          "uuid": "06f12e11-236f-b08e-38ab-4e4555eebaa8",
          "code": "1108 (Number of products:5)",
          "comments": "Dietary Supplement Label Database|Other|gluconate / gluconic acid",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=1108&item=gluconate / gluconic acid",
          "code_system": "DSLD",
          "references": [
            "cdbfc397-2bbd-f8c9-a4ce-cd55c295c30c"
          ]
        },
        {
          "uuid": "ca53d1ea-6728-509f-f43f-1f0a1114c32f",
          "code": "DTXSID70227186",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70227186",
          "code_system": "EPA CompTox",
          "references": [
            "cdbfc397-2bbd-f8c9-a4ce-cd55c295c30c"
          ]
        },
        {
          "uuid": "b4674ee0-ab03-b12b-66b9-03bfab6482bd",
          "code": "122011",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=122011",
          "code_system": "NSC",
          "references": [
            "6e9c3d07-93ae-b269-009e-53a87564a218"
          ]
        },
        {
          "uuid": "70ea869c-1346-7f8f-5756-da417091912d",
          "code": "100000081613",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "e63362cb-6cd6-2362-369b-bbd9111acc71"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "494e3119-c6ad-4bda-9379-a8f55232135d",
          "amount": {
            "uuid": "bb948f4b-8b83-400a-8dfd-7402d0250ce7"
          },
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "d6969235-d1dd-4a98-908c-52de92cfa4ac",
            "refuuid": "143b0731-8592-4c89-8d54-ac86d722fa10",
            "name": "GLUCARIC ACID",
            "unii": "QLZ991V4A2",
            "linking_id": "QLZ991V4A2",
            "ref_pname": "GLUCARIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "95e06054-2b44-4943-9764-58e99bc2c495",
          "amount": {
            "uuid": "040b96ad-9059-4b6a-a630-d0d77a1ec43e"
          },
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "0b412538-7deb-4abd-b795-f147ac43133a"
          ],
          "related_substance": {
            "uuid": "be9b3c33-c100-426b-9907-84d8f5b302b2",
            "refuuid": "bf3b915f-1cc4-426c-9f46-f46484c7dfb3",
            "name": "CALCIUM SACCHARATE",
            "unii": "6AP9J91K4V",
            "linking_id": "6AP9J91K4V",
            "ref_pname": "CALCIUM SACCHARATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1957364a-cd59-48d2-c2bc-a41cada1ccf2",
          "name": "CALCIUM D-GLUCARATE",
          "stdName": "CALCIUM D-GLUCARATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0da3099c-0f1d-451d-b29a-b06b66fb3157"
          ],
          "display_name": false
        },
        {
          "uuid": "43c20cd3-679c-4dad-b74e-1722e953f6f3",
          "name": "CALCIUM D-GLUCARATE (1:1)",
          "stdName": "CALCIUM D-GLUCARATE (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fca9373a-197d-4a89-bb1c-633e4507034d"
          ],
          "display_name": false
        },
        {
          "uuid": "ffd0dfb1-76b3-457a-8e98-81e95281af62",
          "name": "CALCIUM D-SACCHARATE",
          "stdName": "CALCIUM D-SACCHARATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1adb45db-73e9-459c-befd-f23e6d3b8563",
            "073021cd-9311-4522-9f78-ae55534e5c6f",
            "66f943fb-9c82-4253-ad0c-598cf58793c0",
            "b725ad0d-4b69-4b26-89ed-aab4b1054d76",
            "30f364bc-597c-4398-8465-53596364d081"
          ],
          "display_name": false
        },
        {
          "uuid": "9e811a53-c881-453a-af82-8d12aa2f2931",
          "name": "CALCIUM D-SACCHARATE [MI]",
          "stdName": "CALCIUM D-SACCHARATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "073021cd-9311-4522-9f78-ae55534e5c6f"
          ],
          "display_name": false
        },
        {
          "uuid": "49c7c3cb-b15d-47e3-906a-83ed545fe378",
          "name": "CALCIUM D-SACCHARATE [VANDF]",
          "stdName": "CALCIUM D-SACCHARATE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30f364bc-597c-4398-8465-53596364d081"
          ],
          "display_name": false
        },
        {
          "uuid": "405d5e28-182e-4e08-aec3-50e426b43ae7",
          "name": "CALCIUM GLUCARATE",
          "stdName": "CALCIUM GLUCARATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "626c4557-7f1f-4808-a194-0795b9b5ad2c"
          ],
          "display_name": false
        },
        {
          "uuid": "1dd6131b-a678-47e4-8a6e-15c624b46cfb",
          "name": "CALCIUM SACCHARATE ANHYDROUS",
          "stdName": "CALCIUM SACCHARATE ANHYDROUS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8671a1a0-adba-4ba2-923d-09e12ed5a774"
          ],
          "display_name": true
        },
        {
          "uuid": "6cc98b20-16ef-bb43-5e0e-3d52d068410f",
          "name": "Calcium glucarate [WHO-DD]",
          "stdName": "CALCIUM GLUCARATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "43f0b0f0-ffc8-e281-e496-fe8a38f6e71b"
          ],
          "display_name": false
        },
        {
          "uuid": "3121e34b-fbb3-5735-b6d9-256c55ae1c05",
          "name": "Calcium saccharate [WHO-DD]",
          "stdName": "CALCIUM SACCHARATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "43f0b0f0-ffc8-e281-e496-fe8a38f6e71b"
          ],
          "display_name": false
        },
        {
          "uuid": "98c5373e-6991-44d7-bf04-1f2529fae8cc",
          "name": "D-GLUCARIC ACID CALCIUM SALT",
          "stdName": "D-GLUCARIC ACID CALCIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1adb45db-73e9-459c-befd-f23e6d3b8563"
          ],
          "display_name": false
        },
        {
          "uuid": "6b08caf9-cf5c-4d73-ac37-f9575a601918",
          "name": "D-GLUCARIC ACID, CALCIUM SALT (1:1)",
          "stdName": "D-GLUCARIC ACID, CALCIUM SALT (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fca9373a-197d-4a89-bb1c-633e4507034d"
          ],
          "display_name": false
        },
        {
          "uuid": "9323c42a-e6c8-4530-bab0-ec034abdf4f7",
          "name": "NSC-122011",
          "stdName": "NSC-122011",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0da3099c-0f1d-451d-b29a-b06b66fb3157"
          ],
          "display_name": false
        },
        {
          "uuid": "94b0c685-9fe4-421c-93ff-36fe95e32a43",
          "name": "SACCHARATED LIME",
          "stdName": "SACCHARATED LIME",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "672ce0e6-db32-48a4-a032-e5601d4e564c",
            "9a46d2e0-c0fd-4eb3-b007-e08c02750cb8",
            "04af11bd-b260-4a47-82f6-309bb64b39a6"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "34d528ea-8740-4b28-a777-6448ed8159ac",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "502e3294-7125-4836-b5a2-c5f22ee51079",
          "name": "calcium saccharate [INN]",
          "stdName": "CALCIUM SACCHARATE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "350adcb9-338b-4492-9956-dcbd5a0f9161"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8671a1a0-adba-4ba2-923d-09e12ed5a774",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1adb45db-73e9-459c-befd-f23e6d3b8563",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "626c4557-7f1f-4808-a194-0795b9b5ad2c",
          "citation": "RXNORM",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fca9373a-197d-4a89-bb1c-633e4507034d",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "350adcb9-338b-4492-9956-dcbd5a0f9161",
          "citation": "INN 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "073021cd-9311-4522-9f78-ae55534e5c6f",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "672ce0e6-db32-48a4-a032-e5601d4e564c",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "30f364bc-597c-4398-8465-53596364d081",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "04af11bd-b260-4a47-82f6-309bb64b39a6",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cfbc2994-d8ea-46c2-b8b4-3fce6f08c061",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0da3099c-0f1d-451d-b29a-b06b66fb3157",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b98119e4-ff8c-4705-ac62-45e8919ce9eb",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390715000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f719074d-250b-4582-a507-e7d14944e688",
          "citation": "SRS import [SST07NLK7J]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=SST07NLK7J",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390715000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "65a4351c-fdb4-43df-9d37-5e32f6537d17",
          "citation": "Merck 14.3",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "66f943fb-9c82-4253-ad0c-598cf58793c0",
          "citation": "CALCIUM D-SACCHARATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9a46d2e0-c0fd-4eb3-b007-e08c02750cb8",
          "citation": "SACCHARATED LIME [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b725ad0d-4b69-4b26-89ed-aab4b1054d76",
          "citation": "CALCIUM D-SACCHARATE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cdbfc397-2bbd-f8c9-a4ce-cd55c295c30c",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "622c6d7b-a48e-1c5c-65a7-c20fbd632498",
          "citation": "WHO DRUG DICTIONARY 2019",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "0b412538-7deb-4abd-b795-f147ac43133a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "51e2ad87-7818-7c26-130e-c4cdf77da33d",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "6e9c3d07-93ae-b269-009e-53a87564a218",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "cd06322b-81ae-caa6-4938-5aa37102cca0",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "43f0b0f0-ffc8-e281-e496-fe8a38f6e71b",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "e63362cb-6cd6-2362-369b-bbd9111acc71",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5c3d7671-e40c-44a3-a3b4-bb61c5fcc9f7",
          "id": "5c3d7671-e40c-44a3-a3b4-bb61c5fcc9f7",
          "molfile": "\n  Marvin  01132104472D          \n\n  1  0  0  0  1  0            999 V2000\n    6.1325   -1.9377    0.0000 Ca  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Ca+2]",
          "formula": "Ca",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "71f9066b-d886-4833-80d3-f8b7aceeaffa"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "40.078",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "fa34c5e8-fd34-49dd-8d5e-57de799830a3",
          "id": "fa34c5e8-fd34-49dd-8d5e-57de799830a3",
          "molfile": "\n  Marvin  01132112582D          \n\n 14 13  0  0  1  0            999 V2000\n    3.7155   -1.9464    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    3.7155   -2.7714    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4331   -1.5309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4331   -0.7059    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1448   -1.9405    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0038   -1.5368    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    3.0038   -0.7117    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.2863   -1.9522    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    2.2863   -2.7743    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    1.5745   -1.5426    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    1.5745   -0.7176    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8570   -1.9580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1453   -1.5484    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8570   -2.7830    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  6  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  3  2  0  0  0  0\n  6  7  1  6  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  6  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  1  0  0  0\n 10 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 12  2  0  0  0  0\nM  CHG  2   7  -1   9  -1\nM  END",
          "smiles": "[C@H]([C@@H]([C@H](C(=O)O)O)[O-])([C@@H](C(=O)O)O)[O-]",
          "formula": "C6H8O8",
          "atropisomerism": "No",
          "charge": -2,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e4087a27-541b-4455-b681-10875c5b97b3"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "208.1232",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4918e15c-2a41-45e2-a443-703746313e1a",
      "version": "20",
      "structure": {
        "id": "ed9ee229-70d5-4e26-b5e5-c11249fc1ae9",
        "molfile": "\n  Marvin  01132112172D          \n\n 15 13  0  0  1  0            999 V2000\n    2.2863   -1.9522    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.0038   -1.5368    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    1.5745   -1.5426    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.7155   -1.9464    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    0.8570   -1.9580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4331   -1.5309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1453   -1.5484    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.4331   -0.7059    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8570   -2.7830    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1448   -1.9405    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.7155   -2.7714    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5745   -0.7176    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0038   -0.7117    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2863   -2.7743    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1325   -1.9377    0.0000 Ca  0  2  0  0  0  0  0  0  0  0  0  0\n 10  6  1  0  0  0  0\n  4 11  1  6  0  0  0\n  3 12  1  1  0  0  0\n  2 13  1  6  0  0  0\n  1 14  1  6  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  3  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  6  2  0  0  0  0\n  9  5  2  0  0  0  0\nM  CHG  3   7  -1  10  -1  15   2\nM  END",
        "smiles": "[C@H]([C@@H]([C@H](C(=O)[O-])O)O)([C@@H](C(=O)[O-])O)O.[Ca+2]",
        "formula": "C6H8O8.Ca",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "248.2012",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "65a4351c-fdb4-43df-9d37-5e32f6537d17",
          "f719074d-250b-4582-a507-e7d14944e688"
        ],
        "stereo_centers": 4
      },
      "unii": "SST07NLK7J"
    }
  ]
}