{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d9850f86-5683-4500-892d-f2c65ec2a986",
          "code": "98092-92-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=98092-92-3",
          "code_system": "CAS",
          "references": [
            "4bc20c98-6cc6-4ca8-8e23-14efbbc51c97",
            "4f833cc6-ee24-4dd2-9703-0b7626111a97"
          ]
        },
        {
          "uuid": "dd11dca6-3cdb-44d9-a175-60e27813a609",
          "code": "m4154",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4154?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "4bc20c98-6cc6-4ca8-8e23-14efbbc51c97"
          ]
        },
        {
          "uuid": "c0489eb6-f8b0-4857-bdf0-2a4b99b7884f",
          "code": "6917873",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6917873",
          "code_system": "PUBCHEM",
          "references": [
            "4bc20c98-6cc6-4ca8-8e23-14efbbc51c97"
          ]
        },
        {
          "uuid": "4d1ac4e1-99c5-4a25-b4cc-a99663c81364",
          "code": "SRE423V9Z9",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a5dabd8d-4951-98f1-12d6-a73620bb9cc0",
          "code": "DTXSID001335757",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID001335757",
          "code_system": "EPA CompTox",
          "references": [
            "6f9edd68-9402-61cb-a222-52398d3271fc"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "a9fbc664-9533-443b-8a55-e277036d0145",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "b0a790f4-7aaa-4a65-a8f3-3dadd68d19af",
            "refuuid": "4244709c-1854-410f-8710-b4f7d1badcec",
            "name": "DELMOPINOL",
            "unii": "DT67WL708F",
            "linking_id": "DT67WL708F",
            "ref_pname": "DELMOPINOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "17d566d1-c40f-47f7-ad74-736315e840a1",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "94065e8a-1a4a-42eb-b0ca-f980db89cf1d",
            "refuuid": "4244709c-1854-410f-8710-b4f7d1badcec",
            "name": "DELMOPINOL",
            "unii": "DT67WL708F",
            "linking_id": "DT67WL708F",
            "ref_pname": "DELMOPINOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0ddfd0f7-e917-45b1-81dc-c1749854d592",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "ad1aa98c-d25c-40a3-a06f-bec4ad8518e2",
            "refuuid": "f36fd5ec-14ef-4b07-a53c-2c6c94d011d8",
            "name": "DELMOPINOL HYDROCHLORIDE, (R)-",
            "unii": "4YE8BQ5PWF",
            "linking_id": "4YE8BQ5PWF",
            "ref_pname": "DELMOPINOL HYDROCHLORIDE, (R)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d207d611-a5f6-4ef7-b51d-e9c0ef7e0afd",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "a70bbc7c-cf4f-4436-816a-8ecbea762fa2",
            "refuuid": "766cd10e-9600-4742-a125-12ffe920945e",
            "name": "DELMOPINOL HYDROCHLORIDE, (S)-",
            "unii": "1G7L497Y7Y",
            "linking_id": "1G7L497Y7Y",
            "ref_pname": "DELMOPINOL HYDROCHLORIDE, (S)-",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3b8e5644-2e74-4c65-943b-47d0a2b36274",
          "name": "4-MORPHOLINEETHANOL, 3-(4-PROPYLHEPTYL)-, HYDROCHLORIDE",
          "stdName": "4-MORPHOLINEETHANOL, 3-(4-PROPYLHEPTYL)-, HYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8dde300d-8c8e-4657-838f-5c357cc8e9f7",
            "20e0c0f8-83a4-41d2-ae8c-a7456e38b94c"
          ],
          "display_name": false
        },
        {
          "uuid": "fb12e1e4-96c1-440d-a67a-57f8bcc2ecf4",
          "name": "4-MORPHOLINEETHANOL, 3-(4-PROPYLHEPTYL)-, HYDROCHLORIDE (1:1)",
          "stdName": "4-MORPHOLINEETHANOL, 3-(4-PROPYLHEPTYL)-, HYDROCHLORIDE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8dde300d-8c8e-4657-838f-5c357cc8e9f7",
            "20e0c0f8-83a4-41d2-ae8c-a7456e38b94c"
          ],
          "display_name": false
        },
        {
          "uuid": "0d467bcb-dc28-400a-ab8f-ccacbcc2c09e",
          "name": "DECAPINOL",
          "stdName": "DECAPINOL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8dde300d-8c8e-4657-838f-5c357cc8e9f7",
            "e0fe0191-1873-4dde-a807-5608da64bf3f"
          ],
          "display_name": false
        },
        {
          "uuid": "2d742c72-51f5-4ece-8040-ca8230f96547",
          "name": "DELMOPINOL HCL",
          "stdName": "DELMOPINOL HCL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "8dde300d-8c8e-4657-838f-5c357cc8e9f7",
            "50cf330a-2fbe-4a65-a731-a5ed19bfc9be",
            "2059a37f-7b5f-4d15-b964-a78be4371355"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "351c9fd6-f0ef-443b-a9b0-a755f1620c0e",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "d78140fc-b454-46c5-b3c1-160c5dd4bd3c",
          "name": "DELMOPINOL HYDROCHLORIDE",
          "stdName": "DELMOPINOL HYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8dde300d-8c8e-4657-838f-5c357cc8e9f7",
            "1adfac74-2c1e-46fc-a5e4-99f86725f312",
            "e0fe0191-1873-4dde-a807-5608da64bf3f"
          ],
          "display_name": true
        },
        {
          "uuid": "c769aed0-0935-4fb2-8c1e-558378051f3f",
          "name": "DELMOPINOL HYDROCHLORIDE [MI]",
          "stdName": "DELMOPINOL HYDROCHLORIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8dde300d-8c8e-4657-838f-5c357cc8e9f7",
            "e0fe0191-1873-4dde-a807-5608da64bf3f"
          ],
          "display_name": false
        },
        {
          "uuid": "b58a4af0-e5be-48e7-a9e0-fdc6dca34e59",
          "name": "M-1650",
          "stdName": "M-1650",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8dde300d-8c8e-4657-838f-5c357cc8e9f7",
            "e0fe0191-1873-4dde-a807-5608da64bf3f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e0fe0191-1873-4dde-a807-5608da64bf3f",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "50cf330a-2fbe-4a65-a731-a5ed19bfc9be",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8dde300d-8c8e-4657-838f-5c357cc8e9f7",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "20e0c0f8-83a4-41d2-ae8c-a7456e38b94c",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4bc20c98-6cc6-4ca8-8e23-14efbbc51c97",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390500000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "072c4f0b-df5c-4ca8-bc9c-1ac084caea49",
          "citation": "SRS import [SRE423V9Z9]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=SRE423V9Z9",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390500000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2059a37f-7b5f-4d15-b964-a78be4371355",
          "citation": "DELMOPINOL HCL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1adfac74-2c1e-46fc-a5e4-99f86725f312",
          "citation": "DELMOPINOL HYDROCHLORIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4f833cc6-ee24-4dd2-9703-0b7626111a97",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6f9edd68-9402-61cb-a222-52398d3271fc",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "77ed984e-369e-413e-984d-d6ac147c7b51",
          "id": "77ed984e-369e-413e-984d-d6ac147c7b51",
          "molfile": "\n  Marvin  01132106142D          \n\n  1  0  0  0  0  0            999 V2000\n   -1.1084   -3.9709    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "129f6bf5-b074-4257-895d-61b1f62215fb"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "e7e19b5e-f88c-4ef8-9cbd-2af86c3df16e",
          "id": "e7e19b5e-f88c-4ef8-9cbd-2af86c3df16e",
          "molfile": "\n  Marvin  01132112002D          \n\n 19 19  0  0  0  0            999 V2000\n    5.1978   -0.4856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1978   -1.3107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4834   -1.7231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4834   -2.5481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1978   -2.9606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9962   -2.6950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6267   -2.9606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7689   -2.9606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0544   -2.5481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3400   -2.9606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6256   -2.5481    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    1.6256   -1.7231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9111   -1.3107    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1966   -1.7231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1966   -2.5481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9111   -2.9606    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9111   -3.7856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6256   -4.1981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6256   -5.0230    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4  8  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 11 16  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\nM  END",
          "smiles": "CCCC(CCC)CCCC1COCCN1CCO",
          "formula": "C16H33NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "29013396-1de7-44db-be83-ac17f4b9551e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "271.4393",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e6e8a7c9-df61-4070-a4c7-3dfec73e678c",
      "version": "5",
      "structure": {
        "id": "d5c83eba-0db7-4379-8764-34920b796da8",
        "molfile": "\n  Marvin  01132111052D          \n\n 20 19  0  0  0  0            999 V2000\n   -1.1084   -3.9709    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.9111   -2.9606    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6256   -2.5481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6256   -1.7231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9111   -1.3107    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1966   -1.7231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1966   -2.5481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3400   -2.9606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0544   -2.5481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7689   -2.9606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4834   -2.5481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4834   -1.7231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1978   -1.3107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1978   -0.4856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1978   -2.9606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9962   -2.6950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6267   -2.9606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9111   -3.7856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6256   -4.1981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6256   -5.0230    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  2  1  0  0  0  0\n  3  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 11  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18  2  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\nM  END",
        "smiles": "CCCC(CCC)CCCC1COCCN1CCO.Cl",
        "formula": "C16H33NO2.ClH",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "307.9002",
        "optical_activity": "( + / - )",
        "references": [
          "072c4f0b-df5c-4ca8-bc9c-1ac084caea49",
          "20e0c0f8-83a4-41d2-ae8c-a7456e38b94c"
        ],
        "stereo_centers": 1
      },
      "unii": "SRE423V9Z9"
    }
  ]
}