{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9c2a8335-0d2e-4429-bc5c-726f199ccbcb",
          "code": "M01AA02",
          "comments": "ATC|MUSCULO-SKELETAL SYSTEM|ANTIINFLAMMATORY AND ANTIRHEUMATIC PRODUCTS|ANTIINFLAMMATORY AND ANTIRHEUMATIC PRODUCTS, NON-STEROIDS|Butylpyrazolidines|mofebutazone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=M01AA02&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "575f02c5-ea5f-45b1-a0dd-2ec6189cf1a3"
          ]
        },
        {
          "uuid": "7fd6cae1-2d52-42a5-849c-b50cc5af360d",
          "code": "M02AA02",
          "comments": "ATC|MUSCULO-SKELETAL SYSTEM|TOPICAL PRODUCTS FOR JOINT AND MUSCULAR PAIN|TOPICAL PRODUCTS FOR JOINT AND MUSCULAR PAIN|Antiinflammatory preparations, non-steroids for topical use|mofebutazone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=M02AA02&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "575f02c5-ea5f-45b1-a0dd-2ec6189cf1a3"
          ]
        },
        {
          "uuid": "37d833ce-10a4-4bd9-b3d3-cc0bf929061f",
          "code": "QM02AA02",
          "comments": "VATC|TOPICAL PRODUCTS FOR JOINT AND MUSCULAR PAIN|TOPICAL PRODUCTS FOR JOINT AND MUSCULAR PAIN|Antiinflammatory preparations, non-steroids for topical use|mofebutazone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QM02AA02&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "575f02c5-ea5f-45b1-a0dd-2ec6189cf1a3"
          ]
        },
        {
          "uuid": "b683026e-d273-4a0a-b90c-c6eb13ca7a4b",
          "code": "QM01AA02",
          "comments": "VATC|ANTIINFLAMMATORY AND ANTIRHEUMATIC PRODUCTS|ANTIINFLAMMATORY AND ANTIRHEUMATIC PRODUCTS, NON-STEROIDS|Butylpyrazolidines|mofebutazone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QM01AA02&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "575f02c5-ea5f-45b1-a0dd-2ec6189cf1a3"
          ]
        },
        {
          "uuid": "9d80df9e-380c-45b8-8b61-d02948d46e9b",
          "code": "2210-63-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2210-63-1",
          "code_system": "CAS",
          "references": [
            "575f02c5-ea5f-45b1-a0dd-2ec6189cf1a3",
            "feb48354-7fd6-44ae-9ac4-c7e85b16563d"
          ]
        },
        {
          "uuid": "c2b47659-09ad-446f-a5e3-dfbbec3f5614",
          "code": "C73089",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C73089",
          "code_system": "NCI_THESAURUS",
          "references": [
            "575f02c5-ea5f-45b1-a0dd-2ec6189cf1a3"
          ]
        },
        {
          "uuid": "2e0c7f2e-b96b-4502-ba06-1c667d90f30b",
          "code": "C002374",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67002374",
          "code_system": "MESH",
          "references": [
            "575f02c5-ea5f-45b1-a0dd-2ec6189cf1a3"
          ]
        },
        {
          "uuid": "46409c40-46a0-4cf6-a0b5-ea0a66d3a31e",
          "code": "1773",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1773",
          "code_system": "INN",
          "references": [
            "575f02c5-ea5f-45b1-a0dd-2ec6189cf1a3"
          ]
        },
        {
          "uuid": "ebff586b-7678-44f7-a084-85ef82675109",
          "code": "218-641-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.016.947",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "575f02c5-ea5f-45b1-a0dd-2ec6189cf1a3"
          ]
        },
        {
          "uuid": "fc58c64f-ea25-4ccf-b2f9-378075be0b00",
          "code": "30202",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/30202/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "575f02c5-ea5f-45b1-a0dd-2ec6189cf1a3"
          ]
        },
        {
          "uuid": "03a5313e-925d-41cc-97c9-f65711ea7e1b",
          "code": "m7587",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7587?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "575f02c5-ea5f-45b1-a0dd-2ec6189cf1a3"
          ]
        },
        {
          "uuid": "b4d86722-4f1c-4283-a62a-db3e46b96e07",
          "code": "SUB09033MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "575f02c5-ea5f-45b1-a0dd-2ec6189cf1a3"
          ]
        },
        {
          "uuid": "65cd3300-604a-41a6-b35d-c89a46d4b15d",
          "code": "CHEMBL1892201",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1892201",
          "code_system": "ChEMBL",
          "references": [
            "575f02c5-ea5f-45b1-a0dd-2ec6189cf1a3"
          ]
        },
        {
          "uuid": "80a5fb0f-98e0-4aca-a06b-bafad33de2d2",
          "code": "16639",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/16639",
          "code_system": "PUBCHEM",
          "references": [
            "575f02c5-ea5f-45b1-a0dd-2ec6189cf1a3"
          ]
        },
        {
          "uuid": "5444c94a-2430-4656-5019-a80675063045",
          "code": "DTXSID4023331",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4023331",
          "code_system": "EPA CompTox",
          "references": [
            "da372779-30e6-7dd8-c57c-3b5622c26a61"
          ]
        },
        {
          "uuid": "dda3d493-a701-ac0e-d1f4-2572747f6c6e",
          "code": "C257",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Analgesic Agent[C241]|Nonnarcotic Analgesic[C2198]|Analgesic and Antipyretic[C2356]|Nonsteroidal Antiinflammatory Drug",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C257",
          "code_system": "NCI_THESAURUS",
          "references": [
            "17244fa8-c931-9915-dfcb-1c2858ba384b"
          ]
        },
        {
          "uuid": "1c222955-6c2d-4c49-8499-f6305a5980ae",
          "code": "SPW36WUI5Z",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "4d2637ad-bd3b-c5de-c88f-c85dbe346613",
          "code": "1828",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1828",
          "code_system": "DRUG CENTRAL",
          "references": [
            "17244fa8-c931-9915-dfcb-1c2858ba384b"
          ]
        },
        {
          "uuid": "16138a79-bc26-54b8-a3b4-30f5deba58c2",
          "code": "DB13629",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB13629",
          "code_system": "DRUG BANK",
          "references": [
            "17244fa8-c931-9915-dfcb-1c2858ba384b"
          ]
        },
        {
          "uuid": "e3f95de7-5862-18de-637a-7a17998180a9",
          "code": "76252",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:76252",
          "code_system": "CHEBI",
          "references": [
            "17244fa8-c931-9915-dfcb-1c2858ba384b"
          ]
        },
        {
          "uuid": "16062ae5-346a-c2f5-8826-884a3d8370f5",
          "code": "Mofebutazone",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Mofebutazone",
          "code_system": "WIKIPEDIA",
          "references": [
            "bb3c4cfa-c67b-348f-31f6-6eb61c542589"
          ]
        },
        {
          "uuid": "f723d9cf-02fc-27b6-a40d-a11d6f8d09bc",
          "code": "73725",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=73725",
          "code_system": "NSC",
          "references": [
            "962c6254-fbcb-a618-d872-3d970ebb16fc"
          ]
        },
        {
          "uuid": "f639a145-2b48-fd8f-09be-2707c10a8e87",
          "code": "100000080352",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "9eb9ff2a-580b-b713-bfe2-10b88f8eefed"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "9bf76a80-5f48-4e25-8935-295d61986875",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "9cd03c21-3279-4987-be83-0ad5b68e3e2f",
            "refuuid": "91277c6f-42aa-4d48-ae0d-efbc1156de91",
            "name": "MOFEBUTAZONE",
            "unii": "SPW36WUI5Z",
            "linking_id": "SPW36WUI5Z",
            "ref_pname": "MOFEBUTAZONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b859f44d-71ab-475a-89eb-f4be97772891",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "eb0e4acc-91b5-438a-b2a1-39d3c2cace55",
            "refuuid": "01c9aa7a-6885-4dd9-999f-dd49fbc75749",
            "name": "MOFEBUTAZONE SODIUM",
            "unii": "73X92I1U1W",
            "linking_id": "73X92I1U1W",
            "ref_pname": "MOFEBUTAZONE SODIUM",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "94366406-eaa7-4acd-b2a2-a0e5e71a0936",
          "name": "4-BUTYL-1-PHENYL-3,5-PYRAZOLIDINEDIONE",
          "stdName": "4-BUTYL-1-PHENYL-3,5-PYRAZOLIDINEDIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e6c89df4-8626-4bd3-af64-77419543605c"
          ],
          "display_name": false
        },
        {
          "uuid": "d861f14f-674b-4802-bcb2-70c4ad24842a",
          "name": "MOFEBUTAZONE",
          "stdName": "MOFEBUTAZONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fa2661fc-f328-4ff8-acc9-376b95551d30",
            "70c5238e-f6e9-48d3-afd4-5e188809130a",
            "029f0f84-7c06-4bde-a16a-80f29d9481ad",
            "7737f128-cf8a-4bec-8fb1-8973281325c0",
            "ce3b4487-f1c7-4ddf-8373-a9d7493077a2",
            "9b2e0eb7-ec8e-4773-ad66-86d9b8dd9121",
            "9c7aabbd-dad7-475b-b9d2-5980bfffbc5c",
            "e6c89df4-8626-4bd3-af64-77419543605c",
            "b8809ca7-cd28-41f6-a447-cbd9c4b07b08",
            "b82f94a7-6ee0-4e2c-a2f8-a7485b320273"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "42f9d995-98d5-45d5-854e-eecbbeb5f6fa",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "e2a8d130-2b30-4369-ace7-e045fd064bdf",
          "name": "MOFEBUTAZONE [MART.]",
          "stdName": "MOFEBUTAZONE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b8809ca7-cd28-41f6-a447-cbd9c4b07b08"
          ],
          "display_name": false
        },
        {
          "uuid": "5752ded7-283c-426e-863d-45046574d470",
          "name": "MOFEBUTAZONE [MI]",
          "stdName": "MOFEBUTAZONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7737f128-cf8a-4bec-8fb1-8973281325c0",
            "9b2e0eb7-ec8e-4773-ad66-86d9b8dd9121"
          ],
          "display_name": false
        },
        {
          "uuid": "85f0854d-44f8-45b8-a715-30f53be285a6",
          "name": "MONAZONE",
          "stdName": "MONAZONE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9220903e-6007-4223-b849-7b0bad93ded4",
            "3b83736d-a66a-4df3-be29-5ca4ae186ea1"
          ],
          "display_name": false
        },
        {
          "uuid": "ccba872b-ae72-44d2-a22f-858709dfb3e4",
          "name": "MONOPHENYLBUTAZONE",
          "stdName": "MONOPHENYLBUTAZONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "717c5fd6-9636-471a-8e52-1d74ce4e6b82",
            "7737f128-cf8a-4bec-8fb1-8973281325c0"
          ],
          "display_name": false
        },
        {
          "uuid": "485e6661-26ef-aff7-a871-612b32f10b07",
          "name": "Mofebutazone [WHO-DD]",
          "stdName": "MOFEBUTAZONE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dc409a53-180b-7df7-37ad-a1a630570b37"
          ],
          "display_name": false
        },
        {
          "uuid": "145ced58-db5d-42b4-8757-cc3ed7b9a3bc",
          "name": "NSC-73725",
          "stdName": "NSC-73725",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7737f128-cf8a-4bec-8fb1-8973281325c0",
            "9737acaf-7683-431f-842d-26bd7053f3f4"
          ],
          "display_name": false
        },
        {
          "uuid": "190028da-a5d6-40fb-abd0-a4a9354c3fcf",
          "name": "mofebutazone [INN]",
          "stdName": "MOFEBUTAZONE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fa2661fc-f328-4ff8-acc9-376b95551d30"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e6c89df4-8626-4bd3-af64-77419543605c",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "fa2661fc-f328-4ff8-acc9-376b95551d30",
          "citation": "INN Proposed List 15",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL15.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b8809ca7-cd28-41f6-a447-cbd9c4b07b08",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9b2e0eb7-ec8e-4773-ad66-86d9b8dd9121",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7737f128-cf8a-4bec-8fb1-8973281325c0",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9220903e-6007-4223-b849-7b0bad93ded4",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3b83736d-a66a-4df3-be29-5ca4ae186ea1",
          "citation": "D07262",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "717c5fd6-9636-471a-8e52-1d74ce4e6b82",
          "citation": "RXNORM",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "029f0f84-7c06-4bde-a16a-80f29d9481ad",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9737acaf-7683-431f-842d-26bd7053f3f4",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "575f02c5-ea5f-45b1-a0dd-2ec6189cf1a3",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390742000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0a1592ce-89ce-4174-ae66-c4ae760fbce8",
          "citation": "SRS import [SPW36WUI5Z]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=SPW36WUI5Z",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390742000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bd262634-db9f-468b-9664-26537da8e7f6",
          "citation": "USP Dictionary 2010; INN 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ce3b4487-f1c7-4ddf-8373-a9d7493077a2",
          "citation": "MOFEBUTAZONE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "70c5238e-f6e9-48d3-afd4-5e188809130a",
          "citation": "MOFEBUTAZONE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b82f94a7-6ee0-4e2c-a2f8-a7485b320273",
          "citation": "MOFEBUTAZONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9c7aabbd-dad7-475b-b9d2-5980bfffbc5c",
          "citation": "MOFEBUTAZONE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "da372779-30e6-7dd8-c57c-3b5622c26a61",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2210-63-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "17244fa8-c931-9915-dfcb-1c2858ba384b",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "feb48354-7fd6-44ae-9ac4-c7e85b16563d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "bb3c4cfa-c67b-348f-31f6-6eb61c542589",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "962c6254-fbcb-a618-d872-3d970ebb16fc",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "dc409a53-180b-7df7-37ad-a1a630570b37",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "9eb9ff2a-580b-b713-bfe2-10b88f8eefed",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c7577937-94b1-4b25-8db3-558c2b45893a",
          "id": "c7577937-94b1-4b25-8db3-558c2b45893a",
          "molfile": "\n  Marvin  01132110182D          \n\n 17 18  0  0  0  0            999 V2000\n    2.9278   -2.8504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3242   -2.3010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5323   -2.5512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9158   -2.0017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1419   -2.2494    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   -0.1238   -3.0310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3869   -3.6785    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9415   -3.0310    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1918   -2.2494    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5236   -1.7618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5236   -0.9415    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9656   -1.9940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5899   -2.5434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3715   -2.2881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5392   -1.4807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9201   -0.9312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1410   -1.1814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 10  1  0  0  0  0\n  7  6  2  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 12  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 13 12  1  0  0  0  0\n 17 12  2  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\nM  END",
          "smiles": "CCCCC1C(=O)NN(c2ccccc2)C1=O",
          "formula": "C13H16N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4887ffc6-a606-40c9-959e-720592097a35"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "232.2788",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "91277c6f-42aa-4d48-ae0d-efbc1156de91",
      "version": "17",
      "structure": {
        "id": "4704a179-be91-4f04-a930-39dd97d30302",
        "molfile": "\n  Marvin  01132103442D          \n\n 17 18  0  0  0  0            999 V2000\n   -1.1918   -2.2494    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5236   -1.7618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9415   -3.0310    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1238   -3.0310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1419   -2.2494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9656   -1.9940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5236   -0.9415    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3869   -3.6785    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9158   -2.0017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1410   -1.1814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5899   -2.5434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5323   -2.5512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3242   -2.3010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9278   -2.8504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3715   -2.2881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9201   -0.9312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5392   -1.4807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  2  2  0  0  0  0\n  8  4  2  0  0  0  0\n  5  9  1  0  0  0  0\n 10  6  2  0  0  0  0\n 11  6  1  0  0  0  0\n 12  9  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 11  2  0  0  0  0\n 16 10  1  0  0  0  0\n 17 15  1  0  0  0  0\n  5  4  1  0  0  0  0\n 17 16  2  0  0  0  0\nM  END",
        "smiles": "CCCCC1C(=O)NN(c2ccccc2)C1=O",
        "formula": "C13H16N2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "232.2788",
        "optical_activity": "( + / - )",
        "references": [
          "0a1592ce-89ce-4174-ae66-c4ae760fbce8",
          "bd262634-db9f-468b-9664-26537da8e7f6",
          "fa2661fc-f328-4ff8-acc9-376b95551d30"
        ],
        "stereo_centers": 1
      },
      "unii": "SPW36WUI5Z"
    }
  ]
}