{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "a8354d47-d0a3-d220-be3a-390a88dbe8e0", "code": "20055804", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/20055804", "code_system": "PUBCHEM", "references": [ "593e678b-9d67-ef7c-4755-aab38a53010e" ] }, { "uuid": "464a3ecf-fed1-4250-8819-6898d3767826", "code": "77228-71-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=77228-71-8", "code_system": "CAS", "references": [ "d5e50e59-34e9-4b04-b63c-fe1d7270f28c", "997962e5-fbfa-41e0-9deb-ae4523e8feb1" ] }, { "uuid": "eca77672-319c-4f7d-a6fe-3c529f4dc38e", "code": "251-444-9", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.046.753", "code_system": "ECHA (EC/EINECS)", "references": [ "d5e50e59-34e9-4b04-b63c-fe1d7270f28c" ] }, { "uuid": "30ebf672-4a48-1d00-2504-0609c6350660", "code": "DB02426", "type": "PRIMARY", "url": "http://www.drugbank.ca/drugs/DB02426", "code_system": "DRUG BANK", "references": [ "723ac1f4-580d-f3a4-124e-406a20dc3857" ] }, { "uuid": "360ab612-50c2-4ef7-bb0c-d0984b117c21", "code": "SNP1XL23E6", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "eab500cc-cc63-c13a-00ee-62a762c3ad52", "code": "Carboxyatractyloside", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Carboxyatractyloside", "code_system": "WIKIPEDIA", "references": [ "97083972-0940-5426-054f-0cfc1a9cc7b0" ] }, { "uuid": "c952d192-ac7a-955e-cf56-e304abbd5797", "code": "DTXSID801336442", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID801336442", "code_system": "EPA CompTox", "references": [ "5976123e-0aa0-873a-f6e4-cdd1d577ddd4" ] } ], "relationships": [ { "uuid": "0acebcc6-fa1c-481d-9e37-a4988e383118", "amount": { "uuid": "74d9ac69-3c94-4dad-8e7c-ea61488e586a" }, "type": "SALT/SOLVATE->PARENT", "references": [ "4f3e0ea2-d53d-4144-bdc7-c655c1d9eba4" ], "related_substance": { "uuid": "d885eb2d-e778-4f4b-9eaf-49eeb58d4898", "refuuid": "b83218e0-01e0-486c-9bdc-eed92c106ebe", "name": "Carboxyatractyloside dipotassium", "unii": "PH9ATM6F5U", "linking_id": "PH9ATM6F5U", "ref_pname": "Carboxyatractyloside dipotassium", "substance_class": "reference" } }, { "uuid": "b21b3593-853f-4235-90f1-a28292fe83e2", "amount": { "uuid": "9d271f02-bcca-4bfc-85f8-71ed046b9725" }, "type": "PARENT->CONSTITUENT ALWAYS PRESENT", "references": [ "4f3e0ea2-d53d-4144-bdc7-c655c1d9eba4" ], "related_substance": { "uuid": "70063d0f-3c9a-4551-ae9a-c3533b9bf1c9", "refuuid": "f8ca2596-30c8-4dad-8ebb-51d46c83d0d7", "name": "CARLINA GUMMIFERA WHOLE", "unii": "P4XPE706EK", "linking_id": "P4XPE706EK", "ref_pname": "CARLINA GUMMIFERA WHOLE", "substance_class": "reference" } }, { "uuid": "b83de6f2-9bac-4f99-b598-ef1ebd8e7a1d", "amount": { "uuid": "ebb01fcc-03f0-4c58-893f-4a76aa0212c3" }, "type": "ORIGIN->TOXIN", "references": [ "4f3e0ea2-d53d-4144-bdc7-c655c1d9eba4" ], "related_substance": { "uuid": "fc33a24c-bb9b-4877-ba03-3f125e52d90b", "refuuid": "f8ca2596-30c8-4dad-8ebb-51d46c83d0d7", "name": "CARLINA GUMMIFERA WHOLE", "unii": "P4XPE706EK", "linking_id": "P4XPE706EK", "ref_pname": "CARLINA GUMMIFERA WHOLE", "substance_class": "reference" } }, { "uuid": "c5247299-e2ea-4209-a01b-8fe37a0f7d8d", "amount": { "uuid": "07f9297f-080c-4aaa-a0d5-3c82ce8684e7" }, "type": "TARGET->INHIBITOR", "references": [ "4f3e0ea2-d53d-4144-bdc7-c655c1d9eba4" ], "related_substance": { "uuid": "51effc24-85b7-444e-a0b9-cbee50e4fe5d", "refuuid": "32b62eab-5b1d-4377-b234-42370e2e9ba7", "name": "ADP/ATP translocase 1", "unii": "BM3JP6JD3D", "linking_id": "BM3JP6JD3D", "ref_pname": "ADP/ATP translocase 1", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "48ecdaaa-09d1-415b-b8c7-790f84a24a77", "name": "C-4992", "stdName": "C-4992", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "19798f38-e2fd-492d-abc2-fa180b670f55" ], "display_name": false }, { "uuid": "40fc4f25-1a55-483d-b0db-091a5d1ab91d", "name": "CARBOXYATRACTYLOSIDE", "stdName": "CARBOXYATRACTYLOSIDE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "1e5e43c2-181d-4467-b6db-93413e6d90d4", "dac48d37-b1ac-43c4-8b11-c3eca528fe4f" ], "display_name": true }, { "uuid": "cde4b15f-7b0b-4fc5-8669-a565b8e98214", "name": "GUMMIFERIN", "stdName": "GUMMIFERIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "1e5e43c2-181d-4467-b6db-93413e6d90d4", "dac48d37-b1ac-43c4-8b11-c3eca528fe4f" ], "display_name": false }, { "uuid": "3f1f5425-3340-4c5d-acee-5ec61fa10e2b", "name": "Kaur-16-ene-18,19-dioic acid, 15-hydroxy-2-[[2-O-(3-methyl-1-oxobutyl)-3,4-di-O-sulfo-β-D-glucopyranosyl]oxy]-, (2β,15α)-", "stdName": "KAUR-16-ENE-18,19-DIOIC ACID, 15-HYDROXY-2-((2-O-(3-METHYL-1-OXOBUTYL)-3,4-DI-O-SULFO-.BETA.-D-GLUCOPYRANOSYL)OXY)-, (2.BETA.,15.ALPHA.)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "19798f38-e2fd-492d-abc2-fa180b670f55" ], "display_name": false } ], "references": [ { "uuid": "1e5e43c2-181d-4467-b6db-93413e6d90d4", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "dac48d37-b1ac-43c4-8b11-c3eca528fe4f", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d5e50e59-34e9-4b04-b63c-fe1d7270f28c", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393130000, "tags": [ "NOMEN" ] }, { "uuid": "e86e0aaf-363b-4ad6-9fc0-2b59d472fd5e", "citation": "SRS import [SNP1XL23E6]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=SNP1XL23E6", "doc_type": "SRS", "public_domain": true, "document_date": 1493393130000, "tags": [ "NOMEN" ] }, { "uuid": "97083972-0940-5426-054f-0cfc1a9cc7b0", "citation": "WIKI", "doc_type": "WIKI", "public_domain": true }, { "uuid": "723ac1f4-580d-f3a4-124e-406a20dc3857", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "997962e5-fbfa-41e0-9deb-ae4523e8feb1", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "19798f38-e2fd-492d-abc2-fa180b670f55", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "5976123e-0aa0-873a-f6e4-cdd1d577ddd4", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true }, { "uuid": "4f3e0ea2-d53d-4144-bdc7-c655c1d9eba4", "citation": "WIKI", "doc_type": "WIKI", "public_domain": true }, { "uuid": "593e678b-9d67-ef7c-4755-aab38a53010e", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "1fa5cf9b-5793-4cdf-a750-cb17054d0d7c", "id": "1fa5cf9b-5793-4cdf-a750-cb17054d0d7c", "molfile": "\n Marvin 06022313482D \n\n 54 58 0 0 1 0 999 V2000\n 18.1477 -2.6095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3231 -2.7195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0757 -3.5165 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 16.3336 -3.8189 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 16.3336 -4.6433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6190 -5.0557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9044 -4.6433 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 14.1898 -5.0557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4752 -4.6433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4752 -3.8189 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 14.1898 -3.4066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9044 -3.8189 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 15.6190 -3.4066 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 15.6190 -4.2311 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4816 -2.5820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0588 -1.9774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.8559 -2.0598 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 16.0863 -2.7744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9044 -2.9943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7605 -3.4066 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0459 -3.8189 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 11.3312 -3.4066 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 11.3312 -2.5820 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6167 -2.1697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9021 -2.5820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1875 -2.1697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4728 -2.5820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1875 -1.3451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6167 -1.3451 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6167 -3.8189 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 9.9021 -3.4066 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1875 -3.8189 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7752 -3.1043 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5997 -4.5335 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4728 -4.2311 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6167 -4.6433 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 9.9021 -5.0557 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9021 -5.8803 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0775 -5.8803 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7266 -5.8803 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9021 -6.7048 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3312 -5.0557 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 12.0459 -4.6433 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3312 -5.8803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0459 -6.2925 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8769 -5.8803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5745 -6.6499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6740 -5.7429 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6401 -5.6879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9424 -6.4574 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8430 -5.5504 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9044 -5.2481 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6804 -4.0662 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0459 -2.9938 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 3 2 1 0 0 0 0\n 2 17 1 0 0 0 0\n 4 3 1 0 0 0 0\n 3 53 1 6 0 0 0\n 5 4 1 0 0 0 0\n 4 13 1 0 0 0 0\n 4 18 1 6 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 7 12 1 0 0 0 0\n 7 52 1 1 0 0 0\n 9 8 1 0 0 0 0\n 8 46 1 0 0 0 0\n 8 49 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 20 1 1 0 0 0\n 11 12 1 0 0 0 0\n 13 12 1 0 0 0 0\n 12 19 1 6 0 0 0\n 13 14 1 1 0 0 0\n 13 15 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 17 18 1 6 0 0 0\n 21 20 1 6 0 0 0\n 21 22 1 0 0 0 0\n 21 43 1 0 0 0 0\n 21 54 1 1 0 0 0\n 22 23 1 1 0 0 0\n 22 30 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 24 29 2 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 26 28 1 0 0 0 0\n 30 31 1 6 0 0 0\n 30 36 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 2 0 0 0 0\n 32 34 2 0 0 0 0\n 32 35 1 0 0 0 0\n 36 37 1 1 0 0 0\n 36 42 1 0 0 0 0\n 37 38 1 0 0 0 0\n 38 39 2 0 0 0 0\n 38 40 2 0 0 0 0\n 38 41 1 0 0 0 0\n 42 43 1 0 0 0 0\n 42 44 1 6 0 0 0\n 44 45 1 0 0 0 0\n 46 47 2 0 0 0 0\n 46 48 1 0 0 0 0\n 49 50 2 0 0 0 0\n 49 51 1 0 0 0 0\nM END", "smiles": "CC(C)CC(=O)O[C@@H]1[C@H]([C@@H]([C@@H](CO)O[C@@]1([H])O[C@H]2C[C@@]3(C)[C@]4([H])CC[C@@H]5C[C@@]4(CC[C@]3([H])C(C2)(C(=O)O)C(=O)O)[C@H](C5=C)O)OS(=O)(=O)O)OS(=O)(=O)O", "formula": "C31H46O18S2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "79ec9680-4c33-49bc-862e-9265faa2a2fb" }, "defined_stereo": 12, "ez_centers": 0, "molecular_weight": "770.8195", "optical_activity": "UNSPECIFIED", "stereo_centers": 12 } ], "definition_level": "COMPLETE", "uuid": "6a11e08b-66b1-4b0e-8532-de545a02e20f", "version": "13", "structure": { "id": "a6137be3-4c66-4c3d-b527-5395b9f17595", "molfile": "\n JSDraw206022313482D\n\n 54 58 0 0 1 0 0 V2000\n 34.3150 -4.9342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.7558 -5.1422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.2880 -6.6492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.8848 -7.2210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.8848 -8.7800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5336 -9.5597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1823 -8.7800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.8311 -9.5597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.4799 -8.7800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.4799 -7.2210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.8311 -6.4414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1823 -7.2210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5336 -6.4414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5336 -8.0004 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2738 -4.8822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.3652 -3.7390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.8724 -3.8948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.4172 -5.2460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1823 -5.6618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.1285 -6.4414 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 22.7773 -7.2210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.4260 -6.4414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.4260 -4.8822 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 20.0748 -4.1026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.7236 -4.8822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3724 -4.1026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0210 -4.8822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3724 -2.5435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.0748 -2.5435 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 20.0748 -7.2210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.7236 -6.4414 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3724 -7.2210 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5928 -5.8698 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1518 -8.5722 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0210 -8.0004 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 20.0748 -8.7800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.7236 -9.5597 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.7236 -11.1189 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1644 -11.1189 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 20.2826 -11.1189 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.7236 -12.6779 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.4260 -9.5597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.7773 -8.7800 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.4260 -11.1189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.7773 -11.8983 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1304 -11.1189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.5585 -12.5741 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6376 -10.8591 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.7917 -10.7551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.3633 -12.2101 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 24.2845 -10.4951 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1823 -9.9235 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 33.4314 -7.6886 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 22.7773 -5.6610 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 7 12 1 0 0 0 0\n 4 13 1 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 1 1 0 0 0\n 13 15 1 0 0 0 0\n 16 15 1 0 0 0 0\n 2 17 1 0 0 0 0\n 17 16 1 0 0 0 0\n 17 18 1 6 0 0 0\n 4 18 1 6 0 0 0\n 12 19 1 6 0 0 0\n 10 20 1 1 0 0 0\n 21 20 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 1 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 26 28 1 0 0 0 0\n 24 29 2 0 0 0 0\n 22 30 1 0 0 0 0\n 30 31 1 6 0 0 0\n 31 32 1 0 0 0 0\n 32 33 2 0 0 0 0\n 32 34 2 0 0 0 0\n 32 35 1 0 0 0 0\n 30 36 1 0 0 0 0\n 36 37 1 1 0 0 0\n 37 38 1 0 0 0 0\n 38 39 2 0 0 0 0\n 38 40 2 0 0 0 0\n 38 41 1 0 0 0 0\n 36 42 1 0 0 0 0\n 42 43 1 0 0 0 0\n 21 43 1 0 0 0 0\n 42 44 1 6 0 0 0\n 44 45 1 0 0 0 0\n 8 46 1 0 0 0 0\n 46 47 2 0 0 0 0\n 46 48 1 0 0 0 0\n 8 49 1 0 0 0 0\n 49 50 2 0 0 0 0\n 49 51 1 0 0 0 0\n 7 52 1 1 0 0 0\n 3 53 1 6 0 0 0\n 21 54 1 1 0 0 0\nM END", "smiles": "CC(C)CC(=O)O[C@@H]1[C@H]([C@@H]([C@@H](CO)O[C@@]1([H])O[C@H]2C[C@@]3(C)[C@]4([H])CC[C@@H]5C[C@@]4(CC[C@]3([H])C(C2)(C(=O)O)C(=O)O)[C@H](C5=C)O)OS(=O)(=O)O)OS(=O)(=O)O", "formula": "C31H46O18S2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 12, "ez_centers": 0, "molecular_weight": "770.8195", "optical_activity": "UNSPECIFIED", "references": [ "1e5e43c2-181d-4467-b6db-93413e6d90d4", "e86e0aaf-363b-4ad6-9fc0-2b59d472fd5e" ], "stereo_centers": 12 }, "unii": "SNP1XL23E6" } ] }