{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b85e4027-57c1-4cd0-9b47-672e33eacb00",
          "code": "25103-12-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=25103-12-2",
          "code_system": "CAS",
          "references": [
            "cea76a15-9f11-4e70-9dcb-626a7b06b92c",
            "2078b695-8ce8-4865-a068-0bdb4e2a1f30"
          ]
        },
        {
          "uuid": "12688887-53b2-4941-8daa-14f6de749b9f",
          "code": "246-614-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.042.362",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "cea76a15-9f11-4e70-9dcb-626a7b06b92c"
          ]
        },
        {
          "uuid": "783110b6-8a55-4774-b825-d6d8c30aa2f5",
          "code": "90714",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/90714",
          "code_system": "PUBCHEM",
          "references": [
            "cea76a15-9f11-4e70-9dcb-626a7b06b92c"
          ]
        },
        {
          "uuid": "a798f852-ce7f-4a98-9357-6a501654f617",
          "code": "SN4X38MJ1X",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "fddfe8f3-a02a-4d3b-81f5-52320a448058",
          "name": "ISOOCTYL PHOSPHITE",
          "stdName": "ISOOCTYL PHOSPHITE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f1e315ce-786f-4a94-84f9-913c8a56de67",
            "91ef22ed-c190-4bc6-8ef5-fa6ba4d18e38"
          ],
          "display_name": false
        },
        {
          "uuid": "65f9fe06-5299-4c3a-8c29-676aed7d73ba",
          "name": "PHOSPHOROUS ACID, TRIISOOCTYL ESTER",
          "stdName": "PHOSPHOROUS ACID, TRIISOOCTYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f1e315ce-786f-4a94-84f9-913c8a56de67",
            "91ef22ed-c190-4bc6-8ef5-fa6ba4d18e38"
          ],
          "display_name": false
        },
        {
          "uuid": "ca007a1f-fa8f-4867-881c-cca8b46bed71",
          "name": "TRIISOOCTYLPHOSPHITE",
          "stdName": "TRIISOOCTYLPHOSPHITE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "40d2aaad-b814-4a96-8279-824b1fa14bbf"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "40d2aaad-b814-4a96-8279-824b1fa14bbf",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "91ef22ed-c190-4bc6-8ef5-fa6ba4d18e38",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f1e315ce-786f-4a94-84f9-913c8a56de67",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cea76a15-9f11-4e70-9dcb-626a7b06b92c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391769000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "880dd13a-617a-4c66-ab82-3e2c68ebc3ea",
          "citation": "SRS import [SN4X38MJ1X]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=SN4X38MJ1X",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391769000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3dea0b30-55d8-495b-a410-a27eb1020046",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "397968f3-2ddd-8b0a-6d00-f300b17e72a9",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=25103-12-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2078b695-8ce8-4865-a068-0bdb4e2a1f30",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "027173a7-9ad8-4b7d-86b8-bb9d4eee4bb7",
          "id": "027173a7-9ad8-4b7d-86b8-bb9d4eee4bb7",
          "molfile": "\n  Marvin  01132100262D          \n\n 28 27  0  0  0  0            999 V2000\n   10.8735   -9.6894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8735   -8.8576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5846   -8.4393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1624   -8.4393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1624   -7.6027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4514   -7.1845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4514   -6.3480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7403   -5.9296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7403   -5.0931    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0292   -4.6749    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3228   -5.0931    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6117   -4.6749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9007   -5.0931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1896   -4.6749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4786   -5.0931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7676   -4.6749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0565   -5.0931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0565   -5.9296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3501   -4.6749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0292   -3.8429    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4492   -3.1396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2859   -3.1396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7058   -2.4316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5423   -2.4316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9623   -1.7237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7989   -1.7237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2189   -1.0136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2154   -2.4357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 20 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 17  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  1  0  0  0  0\n 27 26  1  0  0  0  0\n 28 26  1  0  0  0  0\nM  END",
          "smiles": "CC(C)CCCCCOP(OCCCCCC(C)C)OCCCCCC(C)C",
          "formula": "C24H51O3P",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b3592eeb-6040-42df-8d0e-a877a1f632d1"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "418.6346",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "REPRESENTATIVE",
      "uuid": "f1f4f4b7-be13-4d6f-9306-c0b2533ae55a",
      "version": "5",
      "structure": {
        "id": "f67de1b0-b165-42f8-af88-dd76dbb112ff",
        "molfile": "\n  Marvin  01132112472D          \n\n 28 27  0  0  0  0            999 V2000\n    8.0292   -4.6749    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7403   -5.0931    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7403   -5.9296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4514   -6.3480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4514   -7.1845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1624   -7.6027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1624   -8.4393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8735   -8.8576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8735   -9.6894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5846   -8.4393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3228   -5.0931    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6117   -4.6749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9007   -5.0931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1896   -4.6749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4786   -5.0931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7676   -4.6749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0565   -5.0931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0565   -5.9296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3501   -4.6749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0292   -3.8429    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4492   -3.1396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2859   -3.1396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7058   -2.4316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5423   -2.4316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9623   -1.7237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7989   -1.7237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2189   -1.0136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2154   -2.4357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  1  0  0  0  0\n 11  1  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 17  1  0  0  0  0\n 20  1  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  1  0  0  0  0\n 27 26  1  0  0  0  0\n 28 26  1  0  0  0  0\nM  END",
        "smiles": "CC(C)CCCCCOP(OCCCCCC(C)C)OCCCCCC(C)C",
        "formula": "C24H51O3P",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "418.6346",
        "optical_activity": "NONE",
        "references": [
          "880dd13a-617a-4c66-ab82-3e2c68ebc3ea",
          "3dea0b30-55d8-495b-a410-a27eb1020046"
        ],
        "stereo_centers": 0
      },
      "unii": "SN4X38MJ1X"
    }
  ]
}