{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "af116b4e-ea76-4bb3-ad9b-5a418ba46611", "code": "81065-76-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=81065-76-1", "code_system": "CAS", "references": [ "905c42f9-58a9-441d-a933-7e7dca84e066", "97414214-54df-4be0-b56a-b2f9f5ff8498" ] }, { "uuid": "f417a389-5de0-4b04-bd06-5fcd46464cc0", "code": "1373152", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1373152/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "905c42f9-58a9-441d-a933-7e7dca84e066" ] }, { "uuid": "531ecd60-4c96-4227-99da-5452d3fb2a6d", "code": "SM5YJ88LTU", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "6d334664-cefb-375a-63f3-42464fac5a41", "code": "DTXSID801021732", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID801021732", "code_system": "EPA CompTox" }, { "uuid": "e6cb1b65-9755-e526-8071-07cb19860bb9", "code": "SM5YJ88LTU", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=SM5YJ88LTU", "code_system": "DAILYMED", "references": [ "d686faf7-0524-efdb-43e3-1ed231179672" ] } ], "substance_class": "chemical", "names": [ { "uuid": "d607a221-fd00-4d16-9321-e8308a91f32a", "name": "ETHYLBISIMINOMETHYLGUAIACOL MANGANESE CHLORIDE", "stdName": "ETHYLBISIMINOMETHYLGUAIACOL MANGANESE CHLORIDE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "443187fd-3481-46f6-9ded-be6853ab62ce", "e2d10dc6-4260-48cf-92da-4eb5c1092534", "886a9d02-882e-4787-8b8b-ca3cd8cbefae" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "89d5756f-c539-4e71-9c5e-9a4c2ffb0423", "name_org": "INCI" } ] }, { "uuid": "4bdccca2-d390-4689-a91b-c87918e2716e", "name": "EUK-134", "stdName": "EUK-134", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "443187fd-3481-46f6-9ded-be6853ab62ce", "e2d10dc6-4260-48cf-92da-4eb5c1092534" ], "display_name": false }, { "uuid": "215b5bbb-4bf6-435d-8a92-e1c702c7dc13", "name": "MANGANESE, CHLORO((2,2'-(1,2-ETHANEDIYLBIS((NITRILO-.KAPPA.N)METHYLIDYNE))BIS(6-METHOXYPHENOLATO-.KAPPA.O))(2-))-, (SP-5-13)-", "stdName": "MANGANESE, CHLORO((2,2'-(1,2-ETHANEDIYLBIS((NITRILO-.KAPPA.N)METHYLIDYNE))BIS(6-METHOXYPHENOLATO-.KAPPA.O))(2-))-, (SP-5-13)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "3d8f5cfc-e732-453b-8837-ef37c1e45595", "e2d10dc6-4260-48cf-92da-4eb5c1092534" ], "display_name": false }, { "uuid": "32bb6948-f126-48fe-bda4-cf4220bec8ec", "name": "MANGANESE, CHLORO((2,2'-(1,2-ETHANEDIYLBIS(NITRILOMETHYLIDYNE))BIS(6-METHOXYPHENOLATO))(2-)-N2,N2',O1,O1')-", "stdName": "MANGANESE, CHLORO((2,2'-(1,2-ETHANEDIYLBIS(NITRILOMETHYLIDYNE))BIS(6-METHOXYPHENOLATO))(2-)-N2,N2',O1,O1')-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "3d8f5cfc-e732-453b-8837-ef37c1e45595", "e2d10dc6-4260-48cf-92da-4eb5c1092534" ], "display_name": false }, { "uuid": "9ae80818-a035-48c0-95e0-d4c4954202cb", "name": "PHENOL, 2,2'-(1,2-ETHANEDIYLBIS(NITRILOMETHYLIDYNE))BIS(6-METHOXY-, MANGANESE COMPLEX", "stdName": "PHENOL, 2,2'-(1,2-ETHANEDIYLBIS(NITRILOMETHYLIDYNE))BIS(6-METHOXY-, MANGANESE COMPLEX", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "3d8f5cfc-e732-453b-8837-ef37c1e45595", "e2d10dc6-4260-48cf-92da-4eb5c1092534" ], "display_name": false } ], "references": [ { "uuid": "443187fd-3481-46f6-9ded-be6853ab62ce", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "e2d10dc6-4260-48cf-92da-4eb5c1092534", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3d8f5cfc-e732-453b-8837-ef37c1e45595", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "905c42f9-58a9-441d-a933-7e7dca84e066", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391523000, "tags": [ "NOMEN" ] }, { "uuid": "4038fb01-932b-4df9-8601-f89e264c0b88", "citation": "SRS import [SM5YJ88LTU]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=SM5YJ88LTU", "doc_type": "SRS", "public_domain": true, "document_date": 1493391523000, "tags": [ "NOMEN" ] }, { "uuid": "886a9d02-882e-4787-8b8b-ca3cd8cbefae", "citation": "ETHYLBISIMINOMETHYLGUAIACOL MANGANESE CHLORIDE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "97414214-54df-4be0-b56a-b2f9f5ff8498", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "d686faf7-0524-efdb-43e3-1ed231179672", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "df568c34-18e6-4bc5-87e0-e59ec2c4b953", "id": "df568c34-18e6-4bc5-87e0-e59ec2c4b953", "molfile": "\n Marvin 01132111342D \n\n 1 0 0 0 0 0 999 V2000\n 8.0099 -6.1984 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\nM END", "smiles": "Cl", "formula": "ClH", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "96160a52-d87b-4a90-88c5-0c3876bd2c32" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "36.4609", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "81f96881-3fc8-4554-bdee-b1d570a53125", "id": "81f96881-3fc8-4554-bdee-b1d570a53125", "molfile": "\n Marvin 01132106452D \n\n 1 0 0 0 0 0 999 V2000\n 8.0535 -5.3472 0.0000 Mn 0 1 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 3\nM END", "smiles": "[Mn+3]", "formula": "Mn", "atropisomerism": "No", "charge": 3, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "bc535a70-16cb-4589-91e5-2e3b5494ea5d" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "54.938", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "702f83de-69e1-48b2-95eb-9a34ebc0a5bb", "id": "702f83de-69e1-48b2-95eb-9a34ebc0a5bb", "molfile": "\n Marvin 01132105492D \n\n 24 25 0 0 0 0 999 V2000\n 6.1332 -6.9220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5544 -6.2126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1332 -5.4811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3351 -5.4811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9139 -4.7717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3351 -4.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1332 -4.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5544 -3.3528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3746 -3.3528 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7737 -2.6435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5939 -2.6435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0151 -3.3750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8132 -3.3750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2344 -4.0844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0324 -4.0844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4537 -4.7939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0324 -5.5032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2344 -5.5032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8575 -6.2126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3120 -6.8777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8132 -4.7939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0041 -4.7939 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 6.5544 -4.7717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3746 -4.7717 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 3 1 0 0 0 0\n 3 23 2 0 0 0 0\n 5 4 2 0 0 0 0\n 6 5 1 0 0 0 0\n 6 7 2 0 0 0 0\n 8 7 1 0 0 0 0\n 7 23 1 0 0 0 0\n 9 8 2 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 15 14 1 0 0 0 0\n 14 21 2 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 2 0 0 0 0\n 19 18 1 0 0 0 0\n 18 21 1 0 0 0 0\n 20 19 1 0 0 0 0\n 21 22 1 0 0 0 0\n 23 24 1 0 0 0 0\nM CHG 2 22 -1 24 -1\nM END", "smiles": "COc1cccc(/C=N/CC/N=C/c2cccc(c2[O-])OC)c1[O-]", "formula": "C18H18N2O4", "atropisomerism": "No", "charge": -2, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "025bc6b5-67ab-4408-9325-c22a43215601" }, "defined_stereo": 0, "ez_centers": 2, "molecular_weight": "326.3472", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "6c9ec09a-e59b-423f-a56d-51ff1a9b3b86", "version": "5", "structure": { "id": "97e57988-200b-4fb6-b47c-45570fa68ce0", "molfile": "\n Marvin 01132107532D \n\n 26 25 0 0 0 0 999 V2000\n 6.1332 -6.9220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3120 -6.8777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3351 -5.4811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0324 -5.5032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9139 -4.7717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4537 -4.7939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3351 -4.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0324 -4.0844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5939 -2.6435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7737 -2.6435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5544 -6.2126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8575 -6.2126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8132 -3.3750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5544 -3.3528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2344 -5.5032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1332 -5.4811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2344 -4.0844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1332 -4.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0151 -3.3750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3746 -3.3528 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3746 -4.7717 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 9.0041 -4.7939 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 6.5544 -4.7717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8132 -4.7939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0535 -5.3472 0.0000 Mn 0 1 0 0 0 0 0 0 0 0 0 0\n 8.0099 -6.1984 0.0000 Cl 0 5 0 0 0 0 0 0 0 0 0 0\n 10 9 1 0 0 0 0\n 8 6 2 0 0 0 0\n 7 5 2 0 0 0 0\n 1 11 1 0 0 0 0\n 2 12 1 0 0 0 0\n 3 16 2 0 0 0 0\n 4 15 2 0 0 0 0\n 5 3 1 0 0 0 0\n 6 4 1 0 0 0 0\n 7 18 1 0 0 0 0\n 8 17 1 0 0 0 0\n 9 19 1 0 0 0 0\n 10 20 1 0 0 0 0\n 11 16 1 0 0 0 0\n 12 15 1 0 0 0 0\n 13 17 1 0 0 0 0\n 14 18 1 0 0 0 0\n 15 24 1 0 0 0 0\n 16 23 1 0 0 0 0\n 17 24 2 0 0 0 0\n 18 23 2 0 0 0 0\n 19 13 2 0 0 0 0\n 20 14 2 0 0 0 0\n 23 21 1 0 0 0 0\n 24 22 1 0 0 0 0\nM CHG 4 21 -1 22 -1 25 3 26 -1\nM END", "smiles": "COc1cccc(/C=N/CC/N=C/c2cccc(c2[O-])OC)c1[O-].[Cl-].[Mn+3]", "formula": "C18H18N2O4.Cl.Mn", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 2, "molecular_weight": "416.7382", "optical_activity": "NONE", "references": [ "4038fb01-932b-4df9-8601-f89e264c0b88", "3d8f5cfc-e732-453b-8837-ef37c1e45595" ], "stereo_centers": 0 }, "unii": "SM5YJ88LTU" } ] }