{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "16fc2585-14e4-4fc6-ae66-8566cb5ab272", "code": "1563-66-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1563-66-2", "code_system": "CAS", "references": [ "6cd7448d-e04c-473c-a628-90b75c6c5370", "b7414cb4-3c2f-43c3-b160-bc865ee586f2" ] }, { "uuid": "c22efdf5-29de-40f3-92af-9a8de0cd9bf3", "code": "D002235", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/68002235", "code_system": "MESH", "references": [ "6cd7448d-e04c-473c-a628-90b75c6c5370" ] }, { "uuid": "3afd3d77-3407-496d-92d1-33c582ae2a29", "code": "90601", "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL", "type": "PRIMARY", "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:1739", "code_system": "EPA PESTICIDE CODE", "references": [ "6cd7448d-e04c-473c-a628-90b75c6c5370" ] }, { "uuid": "21e3eed4-fae5-4755-b905-7f3e55e444e1", "code": "216-353-0", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.014.867", "code_system": "ECHA (EC/EINECS)", "references": [ "6cd7448d-e04c-473c-a628-90b75c6c5370" ] }, { "uuid": "d46ea4df-c9aa-4926-82c0-d369521ef39c", "code": "m3073", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m3073?q=authorize", "code_system": "MERCK INDEX", "references": [ "6cd7448d-e04c-473c-a628-90b75c6c5370" ] }, { "uuid": "babf97c6-c2b7-4bcc-9563-391f49fe40eb", "code": "2566", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2566", "code_system": "PUBCHEM", "references": [ "6cd7448d-e04c-473c-a628-90b75c6c5370" ] }, { "uuid": "5d138406-060f-58d5-02d7-389f4c3299b6", "code": "C163636", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C163636", "code_system": "NCI_THESAURUS", "references": [ "e7758db6-15b8-a5a6-c426-fd54bb348982" ] }, { "uuid": "3c3ff144-4d8e-3257-365b-750aa915111d", "code": "Carbofuran", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Carbofuran", "code_system": "WIKIPEDIA", "references": [ "4455bbcd-c66f-535a-ebb1-b4a5f3f2b82e" ] }, { "uuid": "f1c9be43-658e-07c4-fb3e-00679625e3b9", "code": "1530", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/1530", "code_system": "HSDB", "references": [ "5e59561d-d926-6609-53ae-48bc7d2959d8" ] }, { "uuid": "41e23858-624b-b5bc-e766-ac42b504d9a7", "code": "DTXSID9020249", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9020249", "code_system": "EPA CompTox", "references": [ "16891cf8-8575-c83f-ab5f-bacbae504cf0" ] }, { "uuid": "44d2a649-eb5d-4e14-bdcf-01cf7cc07f69", "code": "SKF77S6Y67", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "cff43cfd-838f-cf1f-5f25-893262f587ce", "code": "34611", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:34611", "code_system": "CHEBI", "references": [ "3e17418c-223e-9847-95f9-5bdda27c1dd4" ] }, { "uuid": "58a4b0da-6d17-1cc9-5b22-7aa47bc7cfea", "code": "carbofuran", "type": "PRIMARY", "url": "https://pesticidecompendium.bcpc.org/carbofuran.html", "code_system": "ALANWOOD", "references": [ "1c475bc9-21ab-f9a6-1f08-c3bc5e24ac73" ] }, { "uuid": "ea7399e1-0ec0-b343-e9a8-d48e48ff070f", "code": "167822", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=167822", "code_system": "NSC", "references": [ "265e7d39-81e2-4a5c-86d5-e87c686fbca2" ] } ], "relationships": [ { "uuid": "6e70c2c0-3b0d-4342-a1fc-f623c3696157", "amount": { "uuid": "dd12429d-81e7-476d-9997-8298461c9f48" }, "type": "METABOLITE->PARENT", "references": [ "2fe275e3-37b9-45ba-b880-c253163f8a1d" ], "related_substance": { "uuid": "807ac54a-6ac4-47d1-9d6a-7e45386b9891", "refuuid": "988161d3-917e-4571-9395-f0ab03d065b0", "name": "3-HYDROXYCARBOFURAN", "unii": "7J7N7A61BJ", "linking_id": "7J7N7A61BJ", "ref_pname": "3-HYDROXYCARBOFURAN" } } ], "substance_class": "chemical", "names": [ { "uuid": "d8873861-46cd-4add-8449-8749fa324710", "name": "2,3-DIHYDRO-2,2-DIMETHYL-7-BENZOFURANYL N-METHYLCARBAMATE", "stdName": "2,3-DIHYDRO-2,2-DIMETHYL-7-BENZOFURANYL N-METHYLCARBAMATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "76c85bca-119e-44cb-9106-52ad1a45f86a", "b1004796-0e29-41a0-8b58-c7c5edcad51b" ], "display_name": false }, { "uuid": "4d6de4d9-837f-4fb2-9963-e9aebae7beb3", "name": "2,3-DIHYDRO-2,2-DIMETHYLBENZOFURAN-7-YL METHYLCARBAMATE", "stdName": "2,3-DIHYDRO-2,2-DIMETHYLBENZOFURAN-7-YL METHYLCARBAMATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "2309235e-d427-4016-be8b-a1ebb1473505", "76c85bca-119e-44cb-9106-52ad1a45f86a" ], "display_name": false }, { "uuid": "31af0665-3f71-4649-9617-f636e020d029", "name": "CARBOFURAN", "stdName": "CARBOFURAN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9c87db53-4ca9-45b0-a022-c799f4ebbf38", "9e25bbe4-bd73-454a-94e1-c8c6d36f0b94", "c8709be9-d46a-49cd-85f4-9efa47c592df", "7703b7d5-065d-44f2-befd-7b9dbfc04dff", "a0b92467-f596-48ab-b4cb-6908a16d00fd", "de48a10f-044a-4378-a7e3-0c2650f83794", "8796b7ce-262a-48e1-ae6c-e24fcdea78a4" ], "display_name": true }, { "uuid": "ec14b44d-65a8-4009-823d-76a03bda9144", "name": "CARBOFURAN [HSDB]", "stdName": "CARBOFURAN [HSDB]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c8709be9-d46a-49cd-85f4-9efa47c592df" ], "display_name": false }, { "uuid": "e673d918-7860-47aa-a6f8-9785416bd2e5", "name": "CARBOFURAN [ISO]", "stdName": "CARBOFURAN [ISO]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9e25bbe4-bd73-454a-94e1-c8c6d36f0b94" ], "display_name": false }, { "uuid": "d4d26f7d-a1d8-4f2e-be85-3e7544fdf354", "name": "CARBOFURAN [MI]", "stdName": "CARBOFURAN [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9c87db53-4ca9-45b0-a022-c799f4ebbf38" ], "display_name": false }, { "uuid": "4e51a946-58f0-4d0d-bd8e-a2bbba02d646", "name": "NSC-167822", "stdName": "NSC-167822", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "05747c78-2561-44e2-9690-9ec3f57011b0" ], "display_name": false } ], "references": [ { "uuid": "8796b7ce-262a-48e1-ae6c-e24fcdea78a4", "citation": "WIKIPEDIA", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "76c85bca-119e-44cb-9106-52ad1a45f86a", "citation": "ALANWOOD.NET", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "2309235e-d427-4016-be8b-a1ebb1473505", "citation": "ALANWOOD IUPAC", "doc_type": "WEB PAGE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b1004796-0e29-41a0-8b58-c7c5edcad51b", "citation": "ALANWOOD CAS", "doc_type": "WEB PAGE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9c87db53-4ca9-45b0-a022-c799f4ebbf38", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c8709be9-d46a-49cd-85f4-9efa47c592df", "citation": "HSDB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9e25bbe4-bd73-454a-94e1-c8c6d36f0b94", "citation": "ISO", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "05747c78-2561-44e2-9690-9ec3f57011b0", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6cd7448d-e04c-473c-a628-90b75c6c5370", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391076000, "tags": [ "NOMEN" ] }, { "uuid": "05690dc5-5db0-421a-8f84-c43d6d0a3372", "citation": "SRS import [SKF77S6Y67]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=SKF77S6Y67", "doc_type": "SRS", "public_domain": true, "document_date": 1493391076000, "tags": [ "NOMEN" ] }, { "uuid": "de48a10f-044a-4378-a7e3-0c2650f83794", "citation": "CARBOFURAN [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "7703b7d5-065d-44f2-befd-7b9dbfc04dff", "citation": "CARBOFURAN [HSDB]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "a0b92467-f596-48ab-b4cb-6908a16d00fd", "citation": "CARBOFURAN [ISO]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "4455bbcd-c66f-535a-ebb1-b4a5f3f2b82e", "citation": "WIKI", "url": "https://en.wikipedia.org/wiki/Larotaxel", "doc_type": "WIKI", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "5e59561d-d926-6609-53ae-48bc7d2959d8", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+1563-66-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "16891cf8-8575-c83f-ab5f-bacbae504cf0", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1563-66-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "e7758db6-15b8-a5a6-c426-fd54bb348982", "citation": "NCIT", "doc_type": "NCI THESAURUS", "public_domain": true }, { "uuid": "1c475bc9-21ab-f9a6-1f08-c3bc5e24ac73", "citation": "AW", "doc_type": "ALANWOOD", "public_domain": true }, { "uuid": "2fe275e3-37b9-45ba-b880-c253163f8a1d", "citation": "J Agric Food Chem 1980;28(4):719", "doc_type": "JA", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "b7414cb4-3c2f-43c3-b160-bc865ee586f2", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "3e17418c-223e-9847-95f9-5bdda27c1dd4", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "265e7d39-81e2-4a5c-86d5-e87c686fbca2", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "af945666-f4bb-4b89-8074-a91134f3058e", "id": "af945666-f4bb-4b89-8074-a91134f3058e", "molfile": "\n Marvin 01132109062D \n\n 16 17 0 0 0 0 999 V2000\n 4.3040 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5205 -0.3062 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3882 -1.1156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0238 -1.6267 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6073 -1.4113 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6073 -2.2363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3182 -2.6488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3182 -3.4738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5995 -3.8993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8939 -3.4738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1000 -3.7436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6149 -3.0587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.5087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -3.6113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1000 -2.3920 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8939 -2.6462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 3 2 0 0 0 0\n 3 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 7 6 1 0 0 0 0\n 6 16 2 0 0 0 0\n 8 7 2 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 11 10 1 0 0 0 0\n 10 16 1 0 0 0 0\n 11 12 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 12 1 0 0 0 0\n 12 15 1 0 0 0 0\n 15 16 1 0 0 0 0\nM END", "smiles": "CC1(C)Cc2cccc(c2O1)OC(=O)NC", "formula": "C12H15NO3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "c47deaf1-2a76-44f0-a601-cb84b93f8378" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "221.2529", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "f400fd57-7a89-4640-a76a-824334e6bc5d", "version": "12", "structure": { "id": "ddeb162b-b113-4cde-b622-f236d0af2167", "molfile": "\n Marvin 01132111302D \n\n 16 17 0 0 0 0 999 V2000\n 1.8939 -2.6462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1000 -2.3920 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3882 -1.1156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6073 -2.2363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8939 -3.4738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6149 -3.0587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6073 -1.4113 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1000 -3.7436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0238 -1.6267 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5205 -0.3062 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5995 -3.8993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3182 -2.6488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.5087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -3.6113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3182 -3.4738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3040 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 7 1 0 0 0 0\n 4 1 2 0 0 0 0\n 5 1 1 0 0 0 0\n 6 2 1 0 0 0 0\n 7 4 1 0 0 0 0\n 8 5 1 0 0 0 0\n 9 3 2 0 0 0 0\n 10 3 1 0 0 0 0\n 11 5 2 0 0 0 0\n 12 4 1 0 0 0 0\n 13 6 1 0 0 0 0\n 14 6 1 0 0 0 0\n 15 11 1 0 0 0 0\n 16 10 1 0 0 0 0\n 8 6 1 0 0 0 0\n 15 12 2 0 0 0 0\nM END", "smiles": "CC1(C)Cc2cccc(c2O1)OC(=O)NC", "formula": "C12H15NO3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "221.2529", "optical_activity": "NONE", "references": [ "05690dc5-5db0-421a-8f84-c43d6d0a3372", "8796b7ce-262a-48e1-ae6c-e24fcdea78a4" ], "stereo_centers": 0 }, "unii": "SKF77S6Y67" } ] }