{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5e08a07e-cf88-49e1-8756-6bc25518dc40",
          "code": "20069-09-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=20069-09-4",
          "code_system": "CAS",
          "references": [
            "b9dbd614-665d-450f-9733-4c26c1eb4962",
            "cd5d2c9e-dce6-483b-9e64-6ba4a383d373"
          ]
        },
        {
          "uuid": "4be71ce1-b9fd-43da-9e6d-8cfb0e36cb6c",
          "code": "PIPERLONGUMINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Piperlongumine",
          "code_system": "WIKIPEDIA",
          "references": [
            "b9dbd614-665d-450f-9733-4c26c1eb4962"
          ]
        },
        {
          "uuid": "5f1a6249-b763-4958-a3fe-b2c9d7bedb9c",
          "code": "m8856",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8856?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "b9dbd614-665d-450f-9733-4c26c1eb4962"
          ]
        },
        {
          "uuid": "7b4b08ac-2754-435e-9353-8b7e5a36a202",
          "code": "637858",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/637858",
          "code_system": "PUBCHEM",
          "references": [
            "b9dbd614-665d-450f-9733-4c26c1eb4962"
          ]
        },
        {
          "uuid": "d09b8543-99e8-4eb5-9307-0ed6e3abc4e6",
          "code": "SGD66V4SVJ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "6f5983a8-498e-08f7-d796-d1b7f7f00dc4",
          "code": "DTXSID801029762",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID801029762",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "22da2594-371a-4a8c-8787-7c1f42558fd8",
          "name": "2(1H)-PYRIDINONE, 5,6-DIHYDRO-1-(1-OXO-3-(3,4,5-TRIMETHOXYPHENYL)-2- PROPENYL)-, (E)-",
          "stdName": "2(1H)-PYRIDINONE, 5,6-DIHYDRO-1-(1-OXO-3-(3,4,5-TRIMETHOXYPHENYL)-2- PROPENYL)-, (E)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a2e76dfa-14d1-4566-9150-1bde26b895f2",
            "68213075-834d-44ad-84ab-db14cea5b384"
          ],
          "display_name": false
        },
        {
          "uuid": "b15224d6-0f08-470a-a047-93b00341bcad",
          "name": "PIPERLONGUMINE",
          "stdName": "PIPERLONGUMINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e94cb4b8-1c97-482d-9607-de6fd377fb94",
            "a2e76dfa-14d1-4566-9150-1bde26b895f2",
            "252535a6-3dd4-47c7-9271-651f8ae3af02",
            "730ef260-80b8-4426-a604-d8819ba3d3f7",
            "afe4c929-17e6-44d3-a9e5-044d3d706f72",
            "eb3f7d25-0be1-445f-8720-09675d91db63"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "4b43b7bc-b286-4f72-9950-c8c2a882c405",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "04aeaf43-5b9c-4844-9204-02d3cd873440",
          "name": "PIPERLONGUMINE [MI]",
          "stdName": "PIPERLONGUMINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a2e76dfa-14d1-4566-9150-1bde26b895f2",
            "730ef260-80b8-4426-a604-d8819ba3d3f7"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e94cb4b8-1c97-482d-9607-de6fd377fb94",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "68213075-834d-44ad-84ab-db14cea5b384",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a2e76dfa-14d1-4566-9150-1bde26b895f2",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "afe4c929-17e6-44d3-a9e5-044d3d706f72",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "730ef260-80b8-4426-a604-d8819ba3d3f7",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b9dbd614-665d-450f-9733-4c26c1eb4962",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391034000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "514c383c-88e9-4355-94ef-b5b9d1e500cc",
          "citation": "SRS import [SGD66V4SVJ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=SGD66V4SVJ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391034000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d4f68a19-31dd-4c51-8d81-a871b68e7aab",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eb3f7d25-0be1-445f-8720-09675d91db63",
          "citation": "PIPERLONGUMINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "252535a6-3dd4-47c7-9271-651f8ae3af02",
          "citation": "PIPERLONGUMINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cd5d2c9e-dce6-483b-9e64-6ba4a383d373",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "14f49c96-0d8d-0e97-7254-619d59c7b8f0",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b1e7d96a-df7e-4130-98f1-7a445534cc28",
          "id": "b1e7d96a-df7e-4130-98f1-7a445534cc28",
          "molfile": "\n  Marvin  01132109132D          \n\n 23 24  0  0  0  0            999 V2000\n    9.0533   -6.6535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3388   -7.0661    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6244   -6.6535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6244   -5.8283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9100   -5.4157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9100   -4.5905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6244   -4.1780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6244   -3.3528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9100   -2.9402    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3388   -2.9402    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3388   -2.1150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0533   -1.7024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7677   -2.1150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7677   -2.9402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0533   -3.3528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0533   -4.1780    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1956   -5.8283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1956   -6.6535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4811   -7.0661    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7666   -6.6535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9100   -7.0661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9100   -7.8912    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1956   -8.3038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3 21  2  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  5 17  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 15  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 18 21  1  0  0  0  0\n 19 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\nM  END",
          "smiles": "COc1cc(/C=C/C(=O)N2CCC=CC2=O)cc(c1OC)OC",
          "formula": "C17H19NO5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "065b193f-39bf-429d-8ef3-4cd749df26c4"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "317.3371",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "11cb5a7e-3e7a-423c-aeb0-6727f113dbd2",
      "version": "6",
      "structure": {
        "id": "44dc8592-169e-404b-a2ee-6d0f6f32081d",
        "molfile": "\n  Marvin  01132103372D          \n\n 23 24  0  0  0  0            999 V2000\n    9.0533   -6.6535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3388   -7.0661    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6244   -6.6535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6244   -5.8283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9100   -5.4157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1956   -5.8283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1956   -6.6535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9100   -7.0661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9100   -7.8912    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1956   -8.3038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4811   -7.0661    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7666   -6.6535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9100   -4.5905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6244   -4.1780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6244   -3.3528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9100   -2.9402    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3388   -2.9402    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3388   -2.1150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0533   -1.7024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7677   -2.1150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7677   -2.9402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0533   -3.3528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0533   -4.1780    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  3  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  7 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n  5 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 17 22  1  0  0  0  0\n 22 23  2  0  0  0  0\nM  END",
        "smiles": "COc1cc(/C=C/C(=O)N2CCC=CC2=O)cc(c1OC)OC",
        "formula": "C17H19NO5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "317.3371",
        "optical_activity": "NONE",
        "references": [
          "d4f68a19-31dd-4c51-8d81-a871b68e7aab",
          "514c383c-88e9-4355-94ef-b5b9d1e500cc"
        ],
        "stereo_centers": 0
      },
      "unii": "SGD66V4SVJ"
    }
  ]
}