{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "da124883-dc98-4c98-b3cf-5e4125f6b4f3", "code": "52199-86-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=52199-86-7", "code_system": "CAS", "references": [ "5e241f55-c1e1-4c62-9840-e30b15f295cd", "96d26927-f1b3-4088-99df-273cba614df1" ] }, { "uuid": "75a9d32a-2b47-475c-8bac-87e85e4d7910", "code": "10994120", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10994120", "code_system": "PUBCHEM", "references": [ "5e241f55-c1e1-4c62-9840-e30b15f295cd" ] }, { "uuid": "0758d3e1-2328-4022-1a13-741c09774330", "code": "DTXSID80200228", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80200228", "code_system": "EPA CompTox", "references": [ "2e071bb9-2a20-341f-5fd4-5b160c538e1f" ] }, { "uuid": "f330c99e-e7b4-4cfe-b36b-84acb7e40b0a", "code": "SDJ3QWL8HN", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "dc655052-7e05-4fac-84d0-929064a6b453", "name": "3,5-HEPTANEDIONE, 1,7-BIS(4-(ACETYLOXY)-3-METHOXYPHENYL)-", "stdName": "3,5-HEPTANEDIONE, 1,7-BIS(4-(ACETYLOXY)-3-METHOXYPHENYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "cda71b44-b4e4-4fe2-89a1-0ca2982606b9", "d99bca55-96a3-41a0-b696-499f39000ffa" ], "display_name": false }, { "uuid": "fec96fa2-01a9-407d-837f-579ef50948a4", "name": "TETRAHYDROCURCUMIN DIACETATE", "stdName": "TETRAHYDROCURCUMIN DIACETATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "9f0fc97f-796b-4084-9262-1545c4e9605d", "5d4d3964-d3e6-461f-84c8-a5b855da592f", "d99bca55-96a3-41a0-b696-499f39000ffa" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "30def756-569a-49f1-a6d4-e2db3299808a", "name_org": "INCI" } ] } ], "references": [ { "uuid": "9f0fc97f-796b-4084-9262-1545c4e9605d", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "d99bca55-96a3-41a0-b696-499f39000ffa", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "cda71b44-b4e4-4fe2-89a1-0ca2982606b9", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "5e241f55-c1e1-4c62-9840-e30b15f295cd", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391466000, "tags": [ "NOMEN" ] }, { "uuid": "7d3a6ed4-795b-4705-a8ce-e08ac7f258ad", "citation": "SRS import [SDJ3QWL8HN]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=SDJ3QWL8HN", "doc_type": "SRS", "public_domain": true, "document_date": 1493391466000, "tags": [ "NOMEN" ] }, { "uuid": "5d4d3964-d3e6-461f-84c8-a5b855da592f", "citation": "TETRAHYDROCURCUMIN DIACETATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "2e071bb9-2a20-341f-5fd4-5b160c538e1f", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=52199-86-7", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "96d26927-f1b3-4088-99df-273cba614df1", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "34cc994b-cc3d-42e8-b720-c20153dfd8b0", "id": "34cc994b-cc3d-42e8-b720-c20153dfd8b0", "molfile": "\n Marvin 01132102492D \n\n 33 34 0 0 0 0 999 V2000\n 13.5377 -9.1418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2943 -8.7094 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9969 -9.1418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6995 -8.7094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4021 -9.1418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1587 -8.7094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.8613 -9.1418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.5640 -8.7094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.5640 -7.8988 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.3206 -9.1418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.0232 -8.7094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.0232 -7.8988 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 20.7257 -9.1418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.4284 -8.7094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.1849 -9.1418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.1849 -9.9525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.8876 -10.3848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.5902 -9.9525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.2928 -10.3848 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 24.2928 -11.1956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.0495 -11.6279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.5902 -11.6279 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 23.5902 -9.1418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.2928 -8.7094 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.0495 -9.1418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.8876 -8.7094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4021 -9.9525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6995 -10.3848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9969 -9.9525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2943 -10.3848 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2943 -11.1956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5377 -11.6279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9969 -11.6279 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 3 29 2 0 0 0 0\n 5 4 2 0 0 0 0\n 6 5 1 0 0 0 0\n 5 27 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 8 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 11 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 15 26 2 0 0 0 0\n 17 16 2 0 0 0 0\n 18 17 1 0 0 0 0\n 18 19 1 0 0 0 0\n 23 18 2 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 20 22 2 0 0 0 0\n 23 24 1 0 0 0 0\n 26 23 1 0 0 0 0\n 24 25 1 0 0 0 0\n 28 27 2 0 0 0 0\n 29 28 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 31 33 2 0 0 0 0\nM END", "smiles": "CC(=O)Oc1ccc(CCC(=O)CC(=O)CCc2ccc(c(c2)OC)OC(=O)C)cc1OC", "formula": "C25H28O8", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "591f6200-200a-42b5-b459-79840da2df44" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "456.486", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "e0e96d7b-2d8b-42b2-9a6a-211fcde1985e", "version": "4", "structure": { "id": "b9c2e8a3-d067-4c6a-ace8-c8a12c79e53f", "molfile": "\n Marvin 01132109372D \n\n 33 34 0 0 0 0 999 V2000\n 13.5377 -11.6279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9969 -11.6279 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2943 -11.1956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2943 -10.3848 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5377 -9.1418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2943 -8.7094 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4021 -9.9525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6995 -10.3848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9969 -9.9525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9969 -9.1418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6995 -8.7094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4021 -9.1418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.0495 -11.6279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.5902 -11.6279 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 24.2928 -11.1956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.2928 -10.3848 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.0495 -9.1418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.2928 -8.7094 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 22.1849 -9.9525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.8876 -10.3848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.5902 -9.9525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.5902 -9.1418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.8876 -8.7094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.1849 -9.1418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.0232 -7.8988 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.5640 -7.8988 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.4284 -8.7094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.7257 -9.1418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.0232 -8.7094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.3206 -9.1418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.5640 -8.7094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.8613 -9.1418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1587 -8.7094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33 12 1 0 0 0 0\n 9 4 1 0 0 0 0\n 4 3 1 0 0 0 0\n 3 1 1 0 0 0 0\n 3 2 2 0 0 0 0\n 10 6 1 0 0 0 0\n 6 5 1 0 0 0 0\n 12 7 2 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 2 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 2 0 0 0 0\n 12 11 1 0 0 0 0\n 27 24 1 0 0 0 0\n 21 16 1 0 0 0 0\n 16 15 1 0 0 0 0\n 15 13 1 0 0 0 0\n 15 14 2 0 0 0 0\n 22 18 1 0 0 0 0\n 18 17 1 0 0 0 0\n 24 19 2 0 0 0 0\n 20 19 1 0 0 0 0\n 21 20 2 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 2 0 0 0 0\n 24 23 1 0 0 0 0\n 29 25 2 0 0 0 0\n 31 26 2 0 0 0 0\n 28 27 1 0 0 0 0\n 29 28 1 0 0 0 0\n 30 29 1 0 0 0 0\n 31 30 1 0 0 0 0\n 32 31 1 0 0 0 0\n 33 32 1 0 0 0 0\nM END", "smiles": "CC(=O)Oc1ccc(CCC(=O)CC(=O)CCc2ccc(c(c2)OC)OC(=O)C)cc1OC", "formula": "C25H28O8", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "456.486", "optical_activity": "NONE", "references": [ "cda71b44-b4e4-4fe2-89a1-0ca2982606b9", "7d3a6ed4-795b-4705-a8ce-e08ac7f258ad" ], "stereo_centers": 0 }, "unii": "SDJ3QWL8HN" } ] }