{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "46c36e09-2963-4f4f-b968-e5a0713bf9ed",
          "code": "78125-98-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=78125-98-1",
          "code_system": "CAS",
          "references": [
            "b4711721-98ee-4c07-a969-a19411f25caa",
            "e0e9b3cb-ccf0-43b6-961e-0fd99900b9da"
          ]
        },
        {
          "uuid": "a777318b-1059-4f70-a13b-a991c3c50036",
          "code": "115086",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/115086",
          "code_system": "PUBCHEM",
          "references": [
            "b4711721-98ee-4c07-a969-a19411f25caa"
          ]
        },
        {
          "uuid": "4e5628d2-eb17-4bd8-a279-324921a2a31d",
          "code": "SD9ROX569A",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0117156c-c276-876c-8ecb-c26ed5c1eefd",
          "code": "DTXSID30999372",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30999372",
          "code_system": "EPA CompTox"
        }
      ],
      "relationships": [
        {
          "uuid": "f477a5bb-cf2d-45d5-b54c-e9e8b6fa2ab6",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "af5b7d17-dacc-4c7f-9a10-e4c62080ab51",
            "refuuid": "32aef549-06f0-49ba-97fc-369805ef9b0a",
            "name": "NONYLACRIDINE ORANGE CATION",
            "unii": "SD9ROX569A",
            "linking_id": "SD9ROX569A",
            "ref_pname": "NONYLACRIDINE ORANGE CATION",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "bcab7741-0c60-48dc-aabb-e94fa9fd4c55",
          "name": "ACRIDINIUM, 3,6-BIS(DIMETHYLAMINO)-10-NONYL-",
          "stdName": "ACRIDINIUM, 3,6-BIS(DIMETHYLAMINO)-10-NONYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68179b8c-03e4-46a7-8f70-63cdc25151a6",
            "985004b7-a0d0-4907-b0f0-8935c44eb445"
          ],
          "display_name": false
        },
        {
          "uuid": "59f53707-5eac-4206-91de-8ca063af997b",
          "name": "NONYLACRIDINE ORANGE CATION",
          "stdName": "NONYLACRIDINE ORANGE CATION",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68179b8c-03e4-46a7-8f70-63cdc25151a6",
            "b55a3110-077f-4314-a3a6-83817ab4b44a"
          ],
          "display_name": true
        },
        {
          "uuid": "8edc8c7d-85f8-45d3-9fc5-c8fb42ff89d9",
          "name": "NONYLACRIDINE ORANGE ION",
          "stdName": "NONYLACRIDINE ORANGE ION",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68179b8c-03e4-46a7-8f70-63cdc25151a6",
            "985004b7-a0d0-4907-b0f0-8935c44eb445"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b55a3110-077f-4314-a3a6-83817ab4b44a",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "68179b8c-03e4-46a7-8f70-63cdc25151a6",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "985004b7-a0d0-4907-b0f0-8935c44eb445",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b4711721-98ee-4c07-a969-a19411f25caa",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391216000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b0f1fac4-5ca2-41b9-aaf4-726c8904780b",
          "citation": "SRS import [SD9ROX569A]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=SD9ROX569A",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391216000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8aedaf82-2e82-47a1-b35d-ba2289fbd0e3",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e0e9b3cb-ccf0-43b6-961e-0fd99900b9da",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e6920269-641a-4006-8a64-e930d6d80153",
          "id": "e6920269-641a-4006-8a64-e930d6d80153",
          "molfile": "\n  Marvin  01132111562D          \n\n 29 31  0  0  0  0            999 V2000\n    5.8917   -1.7917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8958   -2.6125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1875   -3.0250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1917   -3.8458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4833   -4.2583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4875   -5.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7792   -5.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7833   -6.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0750   -6.7250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0821   -7.5488    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7980   -7.9561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5094   -7.5381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2290   -7.9442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2367   -8.7769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5207   -9.1955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8016   -8.7857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0877   -9.2008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3724   -8.7898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6581   -9.2069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9432   -8.7940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9444   -7.9666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6563   -7.5539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3716   -7.9630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2298   -7.5543    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   -0.4845   -7.9670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2296   -6.7293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9396   -7.5249    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9317   -6.6999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6579   -7.9306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 10 23  1  0  0  0  0\n 12 11  1  0  0  0  0\n 11 16  2  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 13 27  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 23 18  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 21 24  2  3  0  0  0\n 23 22  2  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  1  0  0  0  0\n 27 28  1  0  0  0  0\n 27 29  1  0  0  0  0\nM  CHG  1  24   1\nM  END",
          "smiles": "CCCCCCCCCn1c-2cc(=[N+](C)C)ccc2cc3ccc(cc31)N(C)C",
          "formula": "C26H38N3",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6d7733b5-72f7-4a47-9ac5-bdd4ae7a2243"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "392.601",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "32aef549-06f0-49ba-97fc-369805ef9b0a",
      "version": "4",
      "structure": {
        "id": "0cdd6b3c-314a-40fb-a537-ce80659cee52",
        "molfile": "\n  Marvin  01132100552D          \n\n 29 31  0  0  0  0            999 V2000\n    0.9444   -7.9666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9432   -8.7940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6581   -9.2069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6563   -7.5539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3716   -7.9630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3724   -8.7898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0877   -9.2008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0821   -7.5488    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    3.7980   -7.9561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8016   -8.7857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5207   -9.1955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2367   -8.7769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2290   -7.9442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5094   -7.5381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0750   -6.7250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7833   -6.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7792   -5.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4875   -5.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4833   -4.2583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1917   -3.8458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1875   -3.0250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8958   -2.6125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8917   -1.7917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2298   -7.5543    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4845   -7.9670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2296   -6.7293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9396   -7.5249    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9317   -6.6999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6579   -7.9306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n 13 14  2  0  0  0  0\n 14  9  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8 15  1  0  0  0  0\n  7 10  2  0  0  0  0\n 15 16  1  0  0  0  0\n  1  2  2  0  0  0  0\n 16 17  1  0  0  0  0\n  9  8  2  0  0  0  0\n 17 18  1  0  0  0  0\n  8  5  1  0  0  0  0\n 18 19  1  0  0  0  0\n  5  4  2  0  0  0  0\n 19 20  1  0  0  0  0\n  4  1  1  0  0  0  0\n 20 21  1  0  0  0  0\n  9 10  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 10 11  1  0  0  0  0\n  1 24  1  0  0  0  0\n  2  3  1  0  0  0  0\n 24 25  1  0  0  0  0\n 11 12  2  0  0  0  0\n 24 26  1  0  0  0  0\n  5  6  1  0  0  0  0\n 13 27  1  0  0  0  0\n 12 13  1  0  0  0  0\n 27 28  1  0  0  0  0\n  3  6  2  0  0  0  0\n 27 29  1  0  0  0  0\nM  CHG  1   8   1\nM  END",
        "smiles": "CCCCCCCCC[n+]1c2cc(ccc2cc3ccc(cc31)N(C)C)N(C)C",
        "formula": "C26H38N3",
        "atropisomerism": "No",
        "charge": 1,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "392.601",
        "optical_activity": "NONE",
        "references": [
          "8aedaf82-2e82-47a1-b35d-ba2289fbd0e3",
          "b0f1fac4-5ca2-41b9-aaf4-726c8904780b"
        ],
        "stereo_centers": 0
      },
      "unii": "SD9ROX569A"
    }
  ]
}