{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9f57cc88-860a-4a5c-8c4a-26f2d34db425",
          "code": "P03BA01",
          "comments": "ATC|ANTIPARASITIC PRODUCTS, INSECTICIDES AND REPELLENTS|ECTOPARASITICIDES, INCL. SCABICIDES, INSECTICIDES AND REPELLENTS|INSECTICIDES AND REPELLENTS|Pyrethrines|cyfluthrin",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=P03BA01&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "5c011e4b-f32e-413a-87b5-1f97064e9081"
          ]
        },
        {
          "uuid": "bc58ee6d-846d-43ee-bb88-0b9d77cd7102",
          "code": "QP53AC12",
          "comments": "VATC|ECTOPARACITICIDES,  INSECTICIDES AND REPELLENTS|ECTOPARASITICIDES FOR TOPICAL USE, INCL. INSECTICIDES|Pyrethrins and pyrethroids|cyfluthrin",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QP53AC12&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "5c011e4b-f32e-413a-87b5-1f97064e9081"
          ]
        },
        {
          "uuid": "a287d43b-7f18-444d-821d-3c3cc8a7b3a9",
          "code": "68359-37-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=68359-37-5",
          "code_system": "CAS",
          "references": [
            "5c011e4b-f32e-413a-87b5-1f97064e9081",
            "f562a288-6974-4c55-a885-fa31b6898559"
          ]
        },
        {
          "uuid": "00187486-f2c0-4c72-ac61-82558bb827bc",
          "code": "C052570",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67052570",
          "code_system": "MESH",
          "references": [
            "5c011e4b-f32e-413a-87b5-1f97064e9081"
          ]
        },
        {
          "uuid": "44567c66-7a6f-4770-a10d-0ce7ffac6f03",
          "code": "CYFLUTHRIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Cyfluthrin",
          "code_system": "WIKIPEDIA",
          "references": [
            "5c011e4b-f32e-413a-87b5-1f97064e9081"
          ]
        },
        {
          "uuid": "e2c44d76-39b8-4f65-82b8-fa6f3e3364ca",
          "code": "269-855-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.063.485",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "5c011e4b-f32e-413a-87b5-1f97064e9081"
          ]
        },
        {
          "uuid": "df21a3b1-6130-4fb5-8fa5-6be6e068abdc",
          "code": "C80599",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C80599",
          "code_system": "NCI_THESAURUS",
          "references": [
            "5c011e4b-f32e-413a-87b5-1f97064e9081"
          ]
        },
        {
          "uuid": "f7e25048-94e7-4e7f-8b0c-921c375e806a",
          "code": "m4024",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4024?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "5c011e4b-f32e-413a-87b5-1f97064e9081"
          ]
        },
        {
          "uuid": "223d019d-59fd-4b23-ad78-8dec379b191d",
          "code": "CHEMBL2104608",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2104608",
          "code_system": "ChEMBL",
          "references": [
            "5c011e4b-f32e-413a-87b5-1f97064e9081"
          ]
        },
        {
          "uuid": "fcc3889a-a636-4329-9bb3-635a92e0b2ed",
          "code": "104926",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/104926",
          "code_system": "PUBCHEM",
          "references": [
            "5c011e4b-f32e-413a-87b5-1f97064e9081"
          ]
        },
        {
          "uuid": "22cd1620-f89f-3d12-c7cb-df266429c894",
          "code": "6599",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6599",
          "code_system": "HSDB",
          "references": [
            "5f4d1d94-deac-6e3e-10e8-ae88b781a2ef"
          ]
        },
        {
          "uuid": "474369fb-9fd7-429e-0a61-59ac1558e9c7",
          "code": "DTXSID5035957",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5035957",
          "code_system": "EPA CompTox",
          "references": [
            "0564cb36-ad49-c78f-b02e-fe63ecb00e90"
          ]
        },
        {
          "uuid": "7472c759-a348-b3ce-4954-faf0500a0475",
          "code": "C737",
          "comments": "Industrial Aid[C45678]|Pesticide",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C737",
          "code_system": "NCI_THESAURUS",
          "references": [
            "ba5b3ee9-4104-f316-fbde-b4e2d0149a2b"
          ]
        },
        {
          "uuid": "2b866dbd-a610-7fdd-9048-9b1fb22f8b3e",
          "code": "4407",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/4407",
          "code_system": "DRUG CENTRAL",
          "references": [
            "ba5b3ee9-4104-f316-fbde-b4e2d0149a2b"
          ]
        },
        {
          "uuid": "99aa5df6-69ee-5154-3117-9fa9ebd7473a",
          "code": "DB13828",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB13828",
          "code_system": "DRUG BANK",
          "references": [
            "ba5b3ee9-4104-f316-fbde-b4e2d0149a2b"
          ]
        },
        {
          "uuid": "1955390d-c27a-4dc4-adcf-10a1925cc353",
          "code": "SCM2QLZ6S0",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "87ea7a7f-51c5-047a-ac0e-11aeaf5f9611",
          "code": "4034",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:4034",
          "code_system": "CHEBI",
          "references": [
            "ba5b3ee9-4104-f316-fbde-b4e2d0149a2b"
          ]
        },
        {
          "uuid": "e773c266-c131-68bc-f11e-3458585f545c",
          "code": "300000029135",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "280f8b47-d6e0-1d9f-6508-deeafa7c57da"
          ]
        },
        {
          "uuid": "6a557c31-76a3-84e8-a5f7-cd7e35410079",
          "code": "cyfluthrin",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/cyfluthrin.html",
          "code_system": "ALANWOOD",
          "references": [
            "9587da19-a0a7-3922-1fc4-689c06337913"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f69a5f7a-4e2a-47b5-9d6a-db4b7d39b698",
          "name": "(R,S)-.ALPHA.-CYANO-4-FLUORO-3-PHENOXYBENZYL-(1R,S)-CIS,TRANS-3-(2,2-DICHLOROVINYL)-2,2-DIMETHYLCYCLOPROPANECARBOXYLATE",
          "stdName": "(R,S)-.ALPHA.-CYANO-4-FLUORO-3-PHENOXYBENZYL-(1R,S)-CIS,TRANS-3-(2,2-DICHLOROVINYL)-2,2-DIMETHYLCYCLOPROPANECARBOXYLATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "94a64ee6-cdf6-4f91-b1fe-7298a6801a94"
          ],
          "display_name": false
        },
        {
          "uuid": "65785b7f-0d39-456c-aea1-f4511ab020ae",
          "name": "(RS)-.ALPHA.-CYANO-4-FLUORO-3-PHENOXYBENZYL (1RS,3RS; 1RS,3SR)-3-(2,2-DICHLOROVINYL)-2,2-DIMETHYLCYCLOPROPANECARBOXYLATE",
          "stdName": "(RS)-.ALPHA.-CYANO-4-FLUORO-3-PHENOXYBENZYL (1RS,3RS; 1RS,3SR)-3-(2,2-DICHLOROVINYL)-2,2-DIMETHYLCYCLOPROPANECARBOXYLATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8cdd82fc-6b8a-47ed-99ac-004cb2f55f51"
          ],
          "display_name": false
        },
        {
          "uuid": "0a8d80e5-0cf1-4fed-aad3-cc96aa215879",
          "name": "3-(2,2-DICHLOROETHENYL)-2,2-DIMETHYLCYCLOPROPANECARBOXYLIC ACID CYANO(4-FLUORO-3-PHENOXYPHENYL)METHYL ESTER",
          "stdName": "3-(2,2-DICHLOROETHENYL)-2,2-DIMETHYLCYCLOPROPANECARBOXYLIC ACID CYANO(4-FLUORO-3-PHENOXYPHENYL)METHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "94a64ee6-cdf6-4f91-b1fe-7298a6801a94"
          ],
          "display_name": false
        },
        {
          "uuid": "6cc6bc6e-e8c9-4f9f-b5c5-67ffdede1969",
          "name": "BAY VL 1704",
          "stdName": "BAY VL 1704",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8cdd82fc-6b8a-47ed-99ac-004cb2f55f51"
          ],
          "display_name": false
        },
        {
          "uuid": "cb62bb79-7754-4ed2-b264-1cd7eede3bdf",
          "name": "BAY-VL-1704",
          "stdName": "BAY-VL-1704",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "061c3ae7-dcbf-44b9-8f88-f1ed637cac32"
          ],
          "display_name": false
        },
        {
          "uuid": "7cd5da46-e393-44bc-bdfc-252e51ab6a33",
          "name": "CYANO(4-FLUORO-3-PHENOXYPHENYL)METHYL 3-(2,2-DICHLOROETHENYL)-2,2-DIMETHYLCYCLOPROPANECARBOXYLATE",
          "stdName": "CYANO(4-FLUORO-3-PHENOXYPHENYL)METHYL 3-(2,2-DICHLOROETHENYL)-2,2-DIMETHYLCYCLOPROPANECARBOXYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7bb5979d-06f8-4e2b-ae6c-e1098bb302d7",
            "24ee65b6-8582-497e-a5b6-8b64d7e878fe"
          ],
          "display_name": false
        },
        {
          "uuid": "909f5ab2-49c8-4f76-a1e4-328e8570638c",
          "name": "CYFLUTHRIN",
          "stdName": "CYFLUTHRIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0bf4b554-3c26-4bc6-9972-5da23f6beccd",
            "c2b3300b-3ade-4d2b-82ea-d5233563a8fc",
            "c1b3cd11-3b6a-4a49-8430-d9488a76041d",
            "cce6f344-dce9-4f07-b8f6-f388861f5d91",
            "ae82a930-e8c8-422b-bd81-00523622b52e",
            "c68360f4-59b5-4e7a-831b-37ea69a7ebbf",
            "8cdd82fc-6b8a-47ed-99ac-004cb2f55f51",
            "99ea98ca-45d2-4e20-b15f-493cd32ed398",
            "e9f4c507-3f52-4d73-b868-dfff40b35544"
          ],
          "display_name": true
        },
        {
          "uuid": "d83e9ddc-add3-4faf-b598-91a10a1d4dd3",
          "name": "CYFLUTHRIN [HSDB]",
          "stdName": "CYFLUTHRIN [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0bf4b554-3c26-4bc6-9972-5da23f6beccd"
          ],
          "display_name": false
        },
        {
          "uuid": "85ce0e00-7201-4175-8f73-bc752b8f2890",
          "name": "CYFLUTHRIN [ISO]",
          "stdName": "CYFLUTHRIN [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c68360f4-59b5-4e7a-831b-37ea69a7ebbf"
          ],
          "display_name": false
        },
        {
          "uuid": "7b15012d-6652-4e42-a8c6-18e48dfd16ba",
          "name": "CYFLUTHRIN [JAN]",
          "stdName": "CYFLUTHRIN [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6bcd0a45-f82d-487c-ec30-956fc14a4d5e"
          ],
          "display_name": false
        },
        {
          "uuid": "35087fb6-3451-4ce1-b9e3-0f09cd9f58e6",
          "name": "CYFLUTHRIN [MART.]",
          "stdName": "CYFLUTHRIN [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cce6f344-dce9-4f07-b8f6-f388861f5d91"
          ],
          "display_name": false
        },
        {
          "uuid": "034e1407-c266-46ba-b507-03bc474a0feb",
          "name": "CYFLUTHRIN [MI]",
          "stdName": "CYFLUTHRIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "99ea98ca-45d2-4e20-b15f-493cd32ed398"
          ],
          "display_name": false
        },
        {
          "uuid": "ab9a2669-be67-46b2-94c7-97e5964c0f5c",
          "name": "CYFOXYLATE",
          "stdName": "CYFOXYLATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "94a64ee6-cdf6-4f91-b1fe-7298a6801a94"
          ],
          "display_name": false
        },
        {
          "uuid": "e0cee19b-8d4c-4720-bacb-53984f1a09c3",
          "name": "FCR-1272",
          "stdName": "FCR-1272",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "94a64ee6-cdf6-4f91-b1fe-7298a6801a94"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8cdd82fc-6b8a-47ed-99ac-004cb2f55f51",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "94a64ee6-cdf6-4f91-b1fe-7298a6801a94",
          "citation": "MERCK 14TH",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "061c3ae7-dcbf-44b9-8f88-f1ed637cac32",
          "citation": "usp dictionary 2013",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7bb5979d-06f8-4e2b-ae6c-e1098bb302d7",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "24ee65b6-8582-497e-a5b6-8b64d7e878fe",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cce6f344-dce9-4f07-b8f6-f388861f5d91",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "99ea98ca-45d2-4e20-b15f-493cd32ed398",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0bf4b554-3c26-4bc6-9972-5da23f6beccd",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c68360f4-59b5-4e7a-831b-37ea69a7ebbf",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5c011e4b-f32e-413a-87b5-1f97064e9081",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390768000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c4f9d501-8e3d-40ff-8454-83dc6126c9e9",
          "citation": "SRS import [SCM2QLZ6S0]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=SCM2QLZ6S0",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390768000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c1b3cd11-3b6a-4a49-8430-d9488a76041d",
          "citation": "CYFLUTHRIN [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e9f4c507-3f52-4d73-b868-dfff40b35544",
          "citation": "CYFLUTHRIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ae82a930-e8c8-422b-bd81-00523622b52e",
          "citation": "CYFLUTHRIN [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c2b3300b-3ade-4d2b-82ea-d5233563a8fc",
          "citation": "CYFLUTHRIN [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6bcd0a45-f82d-487c-ec30-956fc14a4d5e",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5f4d1d94-deac-6e3e-10e8-ae88b781a2ef",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+68359-37-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0564cb36-ad49-c78f-b02e-fe63ecb00e90",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=68359-37-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ba5b3ee9-4104-f316-fbde-b4e2d0149a2b",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "9587da19-a0a7-3922-1fc4-689c06337913",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "f562a288-6974-4c55-a885-fa31b6898559",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "280f8b47-d6e0-1d9f-6508-deeafa7c57da",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d82a8f0d-d524-4bff-bf5f-041065af3f50",
          "id": "d82a8f0d-d524-4bff-bf5f-041065af3f50",
          "molfile": "\n  Marvin  01132111122D          \n\n 29 31  0  0  0  0            999 V2000\n   -3.3290    1.2165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7432    0.6272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1608    1.2165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.1533   -0.0828    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   -3.8667   -0.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.7041   -0.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.1177   -1.2062    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -5.1177    0.2171    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3296   -0.0828    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   -1.6197   -0.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6197   -1.3199    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9064   -0.0828    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1861   -0.4928    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   -0.1827   -1.3164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1861   -2.1332    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5169   -0.0724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5135    0.7548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2165    1.1648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9437    0.7582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6536    1.1786    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9505   -0.0586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6674   -0.4721    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3773   -0.0552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0907   -0.4583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8041   -0.0448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7972    0.7788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0735    1.1924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3670    0.7650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2372   -0.4825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  9  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  9  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 16  1  0  0  0  0\n 14 15  3  0  0  0  0\n 16 17  1  0  0  0  0\n 16 29  2  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 21 19  2  0  0  0  0\n 21 22  1  0  0  0  0\n 29 21  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 23 28  2  0  0  0  0\n 24 25  2  0  0  0  0\n 25 26  1  0  0  0  0\n 27 26  2  0  0  0  0\n 28 27  1  0  0  0  0\nM  END",
          "smiles": "CC1(C)C(C=C(Cl)Cl)C1C(=O)OC(C#N)c2ccc(c(c2)Oc3ccccc3)F",
          "formula": "C22H18Cl2FNO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5029e3b5-2af6-43e0-b6c7-bf3917ca28db"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "434.2883",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5b3a32c8-f295-4401-a9fc-17921581a8f7",
      "version": "11",
      "structure": {
        "id": "a1ac71ea-a95b-4db8-9edf-01b5b204b4a5",
        "molfile": "\n  Marvin  01132108242D          \n\n 29 31  0  0  0  0            999 V2000\n   -2.3296   -0.0828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.1533   -0.0828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7432    0.6272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6197   -0.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.8667   -0.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3290    1.2165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1608    1.2165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9064   -0.0828    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6197   -1.3199    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.7041   -0.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1861   -0.4928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.1177   -1.2062    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -5.1177    0.2171    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.5169   -0.0724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1827   -1.3164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2372   -0.4825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5135    0.7548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1861   -2.1332    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9505   -0.0586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2165    1.1648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6674   -0.4721    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9437    0.7582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3773   -0.0552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6536    1.1786    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0907   -0.4583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3670    0.7650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8041   -0.0448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0735    1.1924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7972    0.7788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  3  6  1  0  0  0  0\n  3  7  1  0  0  0  0\n  4  8  1  0  0  0  0\n  4  9  2  0  0  0  0\n  5 10  2  0  0  0  0\n  8 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 10 13  1  0  0  0  0\n 11 14  1  0  0  0  0\n 11 15  1  0  0  0  0\n 14 16  2  0  0  0  0\n 14 17  1  0  0  0  0\n 15 18  3  0  0  0  0\n 16 19  1  0  0  0  0\n 17 20  2  0  0  0  0\n 19 21  1  0  0  0  0\n 19 22  2  0  0  0  0\n 21 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 23 25  2  0  0  0  0\n 23 26  1  0  0  0  0\n 25 27  1  0  0  0  0\n 26 28  2  0  0  0  0\n 27 29  2  0  0  0  0\n  2  3  1  0  0  0  0\n 20 22  1  0  0  0  0\n 28 29  1  0  0  0  0\nM  END",
        "smiles": "CC1(C)C(C=C(Cl)Cl)C1C(=O)OC(C#N)c2ccc(c(c2)Oc3ccccc3)F",
        "formula": "C22H18Cl2FNO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "434.2883",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "c4f9d501-8e3d-40ff-8454-83dc6126c9e9",
          "8cdd82fc-6b8a-47ed-99ac-004cb2f55f51"
        ],
        "stereo_centers": 3
      },
      "unii": "SCM2QLZ6S0"
    }
  ]
}