{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d0339c79-faa9-47d1-bad2-614e3c248ce2",
          "code": "4740-79-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=4740-79-8",
          "code_system": "CAS",
          "references": [
            "b6b1e3b1-9806-4b14-bb8f-a0ec0d3636e5",
            "17850a2d-b464-435d-969a-b4e994488a77"
          ]
        },
        {
          "uuid": "9995cfc8-c090-4de3-a6c1-19ea02c7b4bf",
          "code": "225-249-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.022.954",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "b6b1e3b1-9806-4b14-bb8f-a0ec0d3636e5"
          ]
        },
        {
          "uuid": "218b576f-736e-6b67-63db-7c3f1082278a",
          "code": "DTXSID4063589",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4063589",
          "code_system": "EPA CompTox",
          "references": [
            "90d7e221-dcad-eb4b-53bf-c35708e851d9"
          ]
        },
        {
          "uuid": "29c6a237-6acb-4a91-b164-03fee6f7bebb",
          "code": "SC0BU1F8LI",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "19fd349c-dd6d-493a-8422-bc80ea912f73",
          "name": "1,3-DIOXAN-5-OL, 2-(PHENYLMETHYL)-",
          "stdName": "1,3-DIOXAN-5-OL, 2-(PHENYLMETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd1d88e4-54fc-4d4e-83db-e248f856f188",
            "8fc1dfb6-4abc-4f33-b0c5-c76dbbc8e088"
          ],
          "display_name": false
        },
        {
          "uuid": "45706734-be23-42fe-abbc-7fb7cda5ef10",
          "name": "1,3-HYACINTH ACETAL",
          "stdName": "1,3-HYACINTH ACETAL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd1d88e4-54fc-4d4e-83db-e248f856f188",
            "d5d68cb6-bf35-4a92-b2dd-c2f0e176bba2"
          ],
          "display_name": false
        },
        {
          "uuid": "e296b90f-7c6f-460f-a0f7-6127be073092",
          "name": "2-BENZYL-1,3-DIOXAN-5-OL",
          "stdName": "2-BENZYL-1,3-DIOXAN-5-OL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd1d88e4-54fc-4d4e-83db-e248f856f188",
            "b9cd2db5-66ea-40f6-a532-3d2e6ea060ef"
          ],
          "display_name": false
        },
        {
          "uuid": "dbb35df8-dc03-4036-b7bb-9277cb0c3f29",
          "name": "5-HYDROXY-2-BENZYL-1,3-DIOXANE",
          "stdName": "5-HYDROXY-2-BENZYL-1,3-DIOXANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd1d88e4-54fc-4d4e-83db-e248f856f188",
            "58ccf937-aa83-44c1-9479-37b966c1708a"
          ],
          "display_name": true
        },
        {
          "uuid": "968f3c69-9425-4ee7-bb7b-010969c26412",
          "name": "FEMA NO. 2877, 1,3-DIOXANE-",
          "stdName": "FEMA NO. 2877, 1,3-DIOXANE-",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b12fc3ea-3d27-4e43-9a04-480cfe434fcb",
            "cd1d88e4-54fc-4d4e-83db-e248f856f188"
          ],
          "display_name": false
        },
        {
          "uuid": "da53c744-11f6-4870-af4a-cc01fa9ba455",
          "name": "M-DIOXAN-5-OL, 2-BENZYL-",
          "stdName": "M-DIOXAN-5-OL, 2-BENZYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd1d88e4-54fc-4d4e-83db-e248f856f188",
            "8fc1dfb6-4abc-4f33-b0c5-c76dbbc8e088"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "58ccf937-aa83-44c1-9479-37b966c1708a",
          "citation": "JECFA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "cd1d88e4-54fc-4d4e-83db-e248f856f188",
          "citation": "JECFA: JOINT FAO/WHO COMMITTEE FOOD ADD",
          "doc_type": "JECFA: JOINT FAO/WHO COMMITTEE FOOD ADD",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8fc1dfb6-4abc-4f33-b0c5-c76dbbc8e088",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b9cd2db5-66ea-40f6-a532-3d2e6ea060ef",
          "citation": "CHEMDRAW",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b12fc3ea-3d27-4e43-9a04-480cfe434fcb",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d5d68cb6-bf35-4a92-b2dd-c2f0e176bba2",
          "citation": "http://www.thegoodscentscompany.com/data/rw1548491.html",
          "url": "http://www.thegoodscentscompany.com/data/rw1548491.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b6b1e3b1-9806-4b14-bb8f-a0ec0d3636e5",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391391000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d6e4e176-ea8c-4e11-87af-1c5fc0e8fdc3",
          "citation": "SRS import [SC0BU1F8LI]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=SC0BU1F8LI",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391391000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "82bf37ac-5ebb-e301-afee-2e685b41c207",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=4740-79-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "17850a2d-b464-435d-969a-b4e994488a77",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "90d7e221-dcad-eb4b-53bf-c35708e851d9",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "30817515-ce6d-4b97-8e0e-893ea4a2769f",
          "id": "30817515-ce6d-4b97-8e0e-893ea4a2769f",
          "molfile": "\n  Marvin  01132102362D          \n\n 14 15  0  0  0  0            999 V2000\n    5.3269   -4.4434    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0360   -4.0295    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.7524   -4.4385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4644   -4.0295    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4644   -3.2024    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.1808   -2.7935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8935   -3.2091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8935   -4.0359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6053   -4.4451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3219   -4.0292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3219   -3.2090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6092   -2.7934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7524   -2.7847    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0360   -3.2024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  6  0  0  0\n  2  3  1  0  0  0  0\n 14  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  1  0  0  0\n  5 13  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 12  2  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 14  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)C[C@H]2OC[C@@H](CO2)O",
          "formula": "C11H14O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "26c73d6e-64e4-46d5-995e-2c96dbde2a27"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "194.2275",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f69e9045-5542-464d-9eb8-f2e87a54fd94",
      "version": "5",
      "structure": {
        "id": "864d5c3a-02a8-4e41-88ca-3631e7e0b3eb",
        "molfile": "\n  Marvin  01132106582D          \n\n 14 15  0  0  1  0            999 V2000\n    5.3269   -4.4434    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0360   -4.0295    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.7524   -4.4385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4644   -4.0295    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4644   -3.2024    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.1808   -2.7935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8935   -3.2091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8935   -4.0359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6053   -4.4451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3219   -4.0292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3219   -3.2090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6092   -2.7934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7524   -2.7847    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0360   -3.2024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  6  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  1  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n  7 12  2  0  0  0  0\n  5 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14  2  1  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)C[C@H]2OC[C@@H](CO2)O",
        "formula": "C11H14O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "194.2275",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "d6e4e176-ea8c-4e11-87af-1c5fc0e8fdc3",
          "8fc1dfb6-4abc-4f33-b0c5-c76dbbc8e088"
        ],
        "stereo_centers": 0
      },
      "unii": "SC0BU1F8LI"
    }
  ]
}