{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ea0607a8-ba75-416b-bf6a-490a93ebcfcd",
          "code": "5306-85-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5306-85-4",
          "code_system": "CAS",
          "references": [
            "abdcc723-b6ba-4595-ae44-c1656645a79c",
            "0cad036c-526e-422b-a864-3d14cb4e234e"
          ]
        },
        {
          "uuid": "cf51200a-4970-44b9-bb00-dfcbdd888752",
          "code": "C80925",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C80925",
          "code_system": "NCI_THESAURUS",
          "references": [
            "abdcc723-b6ba-4595-ae44-c1656645a79c"
          ]
        },
        {
          "uuid": "0a3aaf6d-d3e4-445a-bb38-3d93b3d3f8be",
          "code": "1426599",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1426599/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "abdcc723-b6ba-4595-ae44-c1656645a79c"
          ]
        },
        {
          "uuid": "ecfb17c9-5065-431e-8ea2-e606a5c03d70",
          "code": "SUB76096",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "abdcc723-b6ba-4595-ae44-c1656645a79c"
          ]
        },
        {
          "uuid": "93cd0b0a-29cb-4fbc-a37e-e27e1e6a979a",
          "code": "226-159-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.023.782",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "abdcc723-b6ba-4595-ae44-c1656645a79c"
          ]
        },
        {
          "uuid": "53dff4bd-9cab-4c18-b7c2-e0b07a8ea77a",
          "code": "62990",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/62990",
          "code_system": "PUBCHEM",
          "references": [
            "abdcc723-b6ba-4595-ae44-c1656645a79c"
          ]
        },
        {
          "uuid": "b602675f-d1b8-5499-5e05-8ecd2feb7f1f",
          "code": "C45678",
          "comments": "Industrial Aid",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C45678",
          "code_system": "NCI_THESAURUS",
          "references": [
            "218e04a2-6c01-14c2-7f2b-ef7c83858c72"
          ]
        },
        {
          "uuid": "ce8717ff-171b-41ff-a4be-bc7cf28e10ba",
          "code": "SA6A6V432S",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "676b9133-94c1-e05f-a9e9-37eb23abeb47",
          "code": "100000137613",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "f41782aa-439e-bc57-b603-435a4bdbe03a"
          ]
        },
        {
          "uuid": "491856ce-f239-e6aa-97f0-efc825fc01b9",
          "code": "DTXSID201019399",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID201019399",
          "code_system": "EPA CompTox",
          "references": [
            "218e04a2-6c01-14c2-7f2b-ef7c83858c72"
          ]
        },
        {
          "uuid": "a451ae86-4880-598f-be03-56bb70ce614c",
          "code": "44695",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=44695",
          "code_system": "NSC",
          "references": [
            "42b81ada-d7f3-f1b4-03ec-294ba659f10a"
          ]
        },
        {
          "uuid": "4c37dc51-a6d3-d30e-9376-899dced22232",
          "code": "40727",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=40727",
          "code_system": "NSC",
          "references": [
            "42b81ada-d7f3-f1b4-03ec-294ba659f10a"
          ]
        },
        {
          "uuid": "ca79358e-4ca5-8a2a-3449-26659b78e0f1",
          "code": "SA6A6V432S",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=SA6A6V432S",
          "code_system": "DAILYMED",
          "references": [
            "944fcee5-5c87-70e4-f3f0-b7e35e493ca0"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "bc63a68b-36a9-466f-8998-aa6913908071",
          "name": "2,5-DIMETHYLISOSORBIDE",
          "stdName": "2,5-DIMETHYLISOSORBIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5bff8333-53a9-472f-bfab-97d20da92985",
            "cc087d1a-b93b-46b1-b8f1-0384d131ce83"
          ],
          "display_name": false
        },
        {
          "uuid": "7b4bdaea-8b1f-4e8e-b0eb-fc27533ced22",
          "name": "DIMETHYL ISOSORBIDE",
          "stdName": "DIMETHYL ISOSORBIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c135b9c0-737a-4177-90a9-809f0ca80be7",
            "3792c608-aed7-428b-8d8e-2afa5f6cad29",
            "5bff8333-53a9-472f-bfab-97d20da92985",
            "cc087d1a-b93b-46b1-b8f1-0384d131ce83",
            "e9be4e4a-b157-46c5-b128-e3beb51d7c06"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "74bb32fa-5dc1-460b-9701-858c1a9c5bba",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "2554372d-6329-41fb-bec3-dc79468d54b8",
          "name": "DIMETHYL ISOSORBIDE [II]",
          "stdName": "DIMETHYL ISOSORBIDE [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc087d1a-b93b-46b1-b8f1-0384d131ce83"
          ],
          "display_name": false
        },
        {
          "uuid": "b3b6a1c7-879e-4fea-ad53-b2750d7f82a5",
          "name": "NSC-40727",
          "stdName": "NSC-40727",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5bff8333-53a9-472f-bfab-97d20da92985",
            "81a8bec7-00ab-4aa9-9d71-d02be02b6486"
          ],
          "display_name": false
        },
        {
          "uuid": "91ce6bde-8891-46b2-866f-292aec4adefb",
          "name": "NSC-44695",
          "stdName": "NSC-44695",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5bff8333-53a9-472f-bfab-97d20da92985",
            "81a8bec7-00ab-4aa9-9d71-d02be02b6486"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "cc087d1a-b93b-46b1-b8f1-0384d131ce83",
          "citation": "ChemIDPlus 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5bff8333-53a9-472f-bfab-97d20da92985",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c135b9c0-737a-4177-90a9-809f0ca80be7",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "81a8bec7-00ab-4aa9-9d71-d02be02b6486",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "abdcc723-b6ba-4595-ae44-c1656645a79c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389728000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1e5e75c1-9717-4eb6-bb24-a697518cd15c",
          "citation": "SRS import [SA6A6V432S]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=SA6A6V432S",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389728000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3792c608-aed7-428b-8d8e-2afa5f6cad29",
          "citation": "DIMETHYL ISOSORBIDE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e9be4e4a-b157-46c5-b128-e3beb51d7c06",
          "citation": "DIMETHYL ISOSORBIDE [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "218e04a2-6c01-14c2-7f2b-ef7c83858c72",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "0cad036c-526e-422b-a864-3d14cb4e234e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "42b81ada-d7f3-f1b4-03ec-294ba659f10a",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "944fcee5-5c87-70e4-f3f0-b7e35e493ca0",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "f41782aa-439e-bc57-b603-435a4bdbe03a",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "43910c2c-088d-4df7-b864-4d1a65cc3ff0",
          "id": "43910c2c-088d-4df7-b864-4d1a65cc3ff0",
          "molfile": "\n  Marvin  01132103342D          \n\n 12 13  0  0  1  0            999 V2000\n    0.0188   -2.9721    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   -0.4775   -2.3109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0164   -1.6299    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7989   -1.8805    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    1.5712   -1.6299    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    2.0675   -2.2960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5891   -2.9545    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7989   -2.7265    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    1.8343   -0.8514    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6436   -0.6884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2419   -3.7538    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0460   -3.9359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  8  1  1  0  0  0  0\n  1 11  1  6  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  6  0  0  0\n  4  5  1  0  0  0  0\n  4  8  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  9  1  1  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  6  0  0  0\n  9 10  1  0  0  0  0\n 11 12  1  0  0  0  0\nM  END",
          "smiles": "CO[C@@H]1CO[C@@H]2[C@H](CO[C@H]12)OC",
          "formula": "C8H14O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "81eb2398-17ce-4366-9f92-5d5de1fec668"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "174.1947",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "399b23e9-2008-4763-9a81-a6bd0743f15c",
      "version": "9",
      "structure": {
        "id": "680cdf21-1683-4195-a449-0b45f8c05583",
        "molfile": "\n  Marvin  01132105252D          \n\n 14 15  0  0  1  0            999 V2000\n    0.7997   -2.7292    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    0.7997   -1.8824    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    0.0188   -2.9751    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    1.5907   -2.9574    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5728   -1.6315    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    0.0164   -1.6315    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4780   -2.3132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2421   -3.7575    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0696   -2.2983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8361   -0.8522    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0470   -3.9398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8074   -3.5500    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8074   -1.0621    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6462   -0.6891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  2  6  1  0  0  0  0\n  3  7  1  0  0  0  0\n  3  8  1  6  0  0  0\n  4  9  1  0  0  0  0\n  5 10  1  1  0  0  0\n  8 11  1  0  0  0  0\n  5  9  1  0  0  0  0\n  6  7  1  0  0  0  0\n  1 12  1  1  0  0  0\n  2 13  1  1  0  0  0\n 10 14  1  0  0  0  0\nM  END",
        "smiles": "CO[C@@H]1CO[C@]2([H])[C@H](CO[C@]12[H])OC",
        "formula": "C8H14O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "174.1947",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "cc087d1a-b93b-46b1-b8f1-0384d131ce83",
          "1e5e75c1-9717-4eb6-bb24-a697518cd15c"
        ],
        "stereo_centers": 4
      },
      "unii": "SA6A6V432S"
    }
  ]
}