{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a530ea9c-823e-4835-a2fa-26b2bcca417f",
          "code": "42630676",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/42630676",
          "code_system": "PUBCHEM",
          "references": [
            "85a1d24f-5054-4f5b-bbf5-9d0707957797"
          ]
        },
        {
          "uuid": "dbf302fb-790e-4019-90fe-7f82c1b6e3a7",
          "code": "1998745",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1998745/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "e7afb22f-0db5-5610-2cc3-4b5ecfa37640"
          ]
        },
        {
          "uuid": "e53397ba-889f-4943-85db-22fba5152650",
          "code": "SUB194735",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "f2c4acbb-12dd-e1a0-8a6e-7cb3b3b7bbca"
          ]
        },
        {
          "uuid": "44cceb2c-14bd-4e06-89f4-cd8f1b3cbf94",
          "code": "S9N5X165MO",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f1e26185-f274-0aed-3eb8-148043da64fc",
          "code": "S9N5X165MO",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=S9N5X165MO",
          "code_system": "DAILYMED",
          "references": [
            "43dc06f7-2740-1409-6cd4-59267238b33d"
          ]
        },
        {
          "uuid": "7b7f6f8b-5367-f913-e70c-25beea79bd40",
          "code": "100000181219",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "7f2a2c81-7f5a-05a7-39fb-3e9dc3a29bcc"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6bc00742-4afb-4aae-ad44-74a9fac68dfe",
          "name": "COLLASYN 4 GG",
          "stdName": "COLLASYN 4 GG",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b5544a20-c02a-475c-805e-e81e4476cc9d",
            "bd82e2d2-faca-488a-8338-94c0c3046161"
          ],
          "display_name": false
        },
        {
          "uuid": "7ec1fba9-2c7d-4d01-b566-e29089376315",
          "name": "COLLASYN-4GG",
          "stdName": "COLLASYN-4GG",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b5544a20-c02a-475c-805e-e81e4476cc9d",
            "bd82e2d2-faca-488a-8338-94c0c3046161"
          ],
          "display_name": false
        },
        {
          "uuid": "a0258da9-7687-4e0d-bb92-e5a2cfd582ee",
          "name": "GEPG",
          "stdName": "GEPG",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bd82e2d2-faca-488a-8338-94c0c3046161",
            "3501c181-7715-4826-969a-bc2651476515"
          ],
          "display_name": false
        },
        {
          "uuid": "ecf2d801-7a48-4ca7-8261-ac2a8ff78809",
          "name": "GLY-GLU-PRO-GLY",
          "stdName": "GLY-GLU-PRO-GLY",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bd82e2d2-faca-488a-8338-94c0c3046161",
            "3501c181-7715-4826-969a-bc2651476515"
          ],
          "display_name": false
        },
        {
          "uuid": "8e21af51-9415-4c89-81f4-12ab9ca4614b",
          "name": "TETRAPEPTIDE-4",
          "stdName": "TETRAPEPTIDE-4",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b5544a20-c02a-475c-805e-e81e4476cc9d",
            "529b271f-5fac-4744-bc82-800af18beb26",
            "bd82e2d2-faca-488a-8338-94c0c3046161",
            "0ea645b5-cbe9-4007-9b0e-edbd5bf576f3"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "c1dde1c7-8891-489a-a2d3-578c936009ba",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "b5544a20-c02a-475c-805e-e81e4476cc9d",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "bd82e2d2-faca-488a-8338-94c0c3046161",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3501c181-7715-4826-969a-bc2651476515",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0ea645b5-cbe9-4007-9b0e-edbd5bf576f3",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "85a1d24f-5054-4f5b-bbf5-9d0707957797",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391315000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cc9bc7a0-9144-44ac-894b-d5ade0fd9e97",
          "citation": "SRS import [S9N5X165MO]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=S9N5X165MO",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391315000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3b19bc55-ef7e-45b3-bc5b-30d61a7e7d87",
          "citation": "http://www.faqs.org/patents/app/20100144643",
          "url": "http://www.faqs.org/patents/app/20100144643",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "529b271f-5fac-4744-bc82-800af18beb26",
          "citation": "TETRAPEPTIDE-4 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e7afb22f-0db5-5610-2cc3-4b5ecfa37640",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "f2c4acbb-12dd-e1a0-8a6e-7cb3b3b7bbca",
          "citation": "EVMPD",
          "doc_type": "EVMPD",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "43dc06f7-2740-1409-6cd4-59267238b33d",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "7f2a2c81-7f5a-05a7-39fb-3e9dc3a29bcc",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3cda30b1-98bc-4aa8-b1bf-357232fd9052",
          "id": "3cda30b1-98bc-4aa8-b1bf-357232fd9052",
          "molfile": "\n  Marvin  01132103132D          \n\n 25 25  0  0  1  0            999 V2000\n    4.2285   -5.5832    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    4.2291   -4.8839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8318   -4.5374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8324   -3.8426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2312   -3.4945    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4346   -3.4961    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6804   -5.9833    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0987   -6.5683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5389   -7.6456    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9623   -6.3259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3653   -7.2881    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8051   -5.9737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8044   -6.6713    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3966   -6.5488    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0629   -5.7142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7457   -5.1355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5065   -5.6046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1770   -6.3685    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.6235   -7.0617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2966   -7.8196    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4484   -7.0787    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3101   -6.4735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1936   -7.0957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0186   -7.0948    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1769   -8.1777    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  7  1  1  0  0  0\n  1 12  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10  8  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  1  0  0  0  0\n 15 14  1  0  0  0  0\n 14 18  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  1  1  0  0  0\n 19 20  2  0  0  0  0\n 21 19  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 23 25  2  0  0  0  0\nM  END",
          "smiles": "C1C[C@@H](C(=O)NCC(=O)O)N(C1)C(=O)[C@H](CCC(=O)O)NC(=O)CN",
          "formula": "C14H22N4O7",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5fb304fe-00a2-4abc-9528-097c6d1ae671"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "358.3476",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "7b31cb75-d5fe-481b-a6a7-3ed59f585247",
      "version": "9",
      "structure": {
        "id": "69d48a84-84ae-4518-b64a-f107ab8b5c75",
        "molfile": "\n  Marvin  01132105302D          \n\n 26 26  0  0  1  0            999 V2000\n   11.9733   -6.5451    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9733   -5.7200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6878   -5.3077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6878   -4.4826    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4023   -4.0700    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   13.4023   -3.2450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1167   -2.8324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1167   -2.0075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4023   -1.5950    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8312   -1.5950    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1167   -4.4826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8312   -4.0700    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9174   -3.2495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7244   -3.0780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.1369   -3.7925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5849   -4.4056    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   15.7564   -5.2126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.5410   -5.4675    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1542   -4.9156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9388   -5.1704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.1103   -5.9773    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1433   -5.7645    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1167   -5.3077    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4023   -5.7200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4099   -4.4056    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   18.5520   -4.6183    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  1  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  2  0  0  0  0\n  5 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 17 22  2  0  0  0  0\n 12 16  1  0  0  0  0\n 11 23  2  0  0  0  0\n  3 24  2  0  0  0  0\n 16 25  1  6  0  0  0\n 20 26  1  0  0  0  0\nM  END",
        "smiles": "C1C[C@@]([H])(C(=O)NCC(=O)O)N(C1)C(=O)[C@H](CCC(=O)O)NC(=O)CN",
        "formula": "C14H22N4O7",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "358.3476",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "3b19bc55-ef7e-45b3-bc5b-30d61a7e7d87",
          "cc9bc7a0-9144-44ac-894b-d5ade0fd9e97"
        ],
        "stereo_centers": 2
      },
      "unii": "S9N5X165MO"
    }
  ]
}