{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7ccbb821-ee19-4c62-937e-053293323754",
          "code": "475-38-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=475-38-7",
          "code_system": "CAS",
          "references": [
            "9e8d265b-395d-4014-8373-35cf290b416c",
            "6042366d-c901-444f-92de-10f4fb909d6e"
          ]
        },
        {
          "uuid": "e1457143-77a2-4668-b983-0618c13c1246",
          "code": "207-495-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.006.816",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "9e8d265b-395d-4014-8373-35cf290b416c"
          ]
        },
        {
          "uuid": "d160f87c-3009-4f9d-9231-25e69ae0f697",
          "code": "10141",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10141",
          "code_system": "PUBCHEM",
          "references": [
            "9e8d265b-395d-4014-8373-35cf290b416c"
          ]
        },
        {
          "uuid": "c37e9c23-1440-0394-11e1-a41d77bb82c8",
          "code": "DTXSID00197161",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00197161",
          "code_system": "EPA CompTox",
          "references": [
            "a0b4027f-7612-dd99-2803-4189c72e3078"
          ]
        },
        {
          "uuid": "9cff8532-36f3-4586-9793-af473169fae6",
          "code": "S9IX5I5C0K",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "affcbf53-a7bc-b215-42af-86fa3be86c6f",
          "code": "28849",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:28849",
          "code_system": "CHEBI",
          "references": [
            "70c5ffb8-e209-1faf-ed63-b20afe51922c"
          ]
        },
        {
          "uuid": "947bb933-6ab8-82bb-2bc7-44623370c081",
          "code": "Naphthazarin",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Naphthazarin",
          "code_system": "WIKIPEDIA",
          "references": [
            "dff88b11-097c-584c-bce7-0ea9f59c71e0"
          ]
        },
        {
          "uuid": "f4637f86-ecf9-8985-76fc-40beef283e9a",
          "code": "26647",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=26647",
          "code_system": "NSC",
          "references": [
            "219b28f2-7be1-1bfb-6518-152fde3b459a"
          ]
        },
        {
          "uuid": "b6b68cea-cbc7-3c90-1210-6027b0ca151d",
          "code": "344555",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=344555",
          "code_system": "NSC",
          "references": [
            "219b28f2-7be1-1bfb-6518-152fde3b459a"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "7a7743a5-aaec-4e67-afda-27bff690605c",
          "name": "1,4-NAPHTHALENEDIONE, 5,8-DIHYDROXY-",
          "stdName": "1,4-NAPHTHALENEDIONE, 5,8-DIHYDROXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a03367fc-a12a-42f5-93c6-a97f31a4fca1",
            "b43807b9-9809-40fa-b8a1-aa6b3c12d3ff"
          ],
          "display_name": false
        },
        {
          "uuid": "f3fde649-2719-48a5-b0e0-cd2d2407a05e",
          "name": "1,4-NAPHTHOQUINONE, 5,8-DIHYDROXY-",
          "stdName": "1,4-NAPHTHOQUINONE, 5,8-DIHYDROXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a03367fc-a12a-42f5-93c6-a97f31a4fca1",
            "b43807b9-9809-40fa-b8a1-aa6b3c12d3ff"
          ],
          "display_name": false
        },
        {
          "uuid": "377ce3f1-2248-4280-99d3-94af6a374d1c",
          "name": "5,8-DIHYDROXY-1,4-NAPHTHALENEDIONE",
          "stdName": "5,8-DIHYDROXY-1,4-NAPHTHALENEDIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a03367fc-a12a-42f5-93c6-a97f31a4fca1",
            "b43807b9-9809-40fa-b8a1-aa6b3c12d3ff"
          ],
          "display_name": false
        },
        {
          "uuid": "6b06c20b-63f9-4846-8cb0-4ede43b20465",
          "name": "5,8-DIHYDROXY-1,4-NAPHTHOQUINONE",
          "stdName": "5,8-DIHYDROXY-1,4-NAPHTHOQUINONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a03367fc-a12a-42f5-93c6-a97f31a4fca1",
            "b43807b9-9809-40fa-b8a1-aa6b3c12d3ff"
          ],
          "display_name": false
        },
        {
          "uuid": "e5566dd1-e0a7-4a80-b68f-ac84525b71b8",
          "name": "5,8-DIHYDROXY-1,4-NAPHTHOSEMIQUINONE",
          "stdName": "5,8-DIHYDROXY-1,4-NAPHTHOSEMIQUINONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a03367fc-a12a-42f5-93c6-a97f31a4fca1",
            "b43807b9-9809-40fa-b8a1-aa6b3c12d3ff"
          ],
          "display_name": false
        },
        {
          "uuid": "33139bcf-dbfb-47cd-9cbb-8948f14f22bc",
          "name": "5,8-DIHYDROXYNAPHTHOQUINONE",
          "stdName": "5,8-DIHYDROXYNAPHTHOQUINONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a03367fc-a12a-42f5-93c6-a97f31a4fca1",
            "b43807b9-9809-40fa-b8a1-aa6b3c12d3ff"
          ],
          "display_name": false
        },
        {
          "uuid": "4a4ec87a-b1f9-4a38-a05e-8c36d164f0a2",
          "name": "DIHYDROXY-1,4-NAPHTHALENEDIONE, 5,8-",
          "stdName": "DIHYDROXY-1,4-NAPHTHALENEDIONE, 5,8-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "91d29b87-0f02-4ab9-af3c-bfdf652318b2"
          ],
          "display_name": false
        },
        {
          "uuid": "5ba82d43-90e5-430d-b5b7-36f5daf07c01",
          "name": "NAPHTHAZARIN",
          "stdName": "NAPHTHAZARIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a03367fc-a12a-42f5-93c6-a97f31a4fca1",
            "b43807b9-9809-40fa-b8a1-aa6b3c12d3ff"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "5804c610-bfff-4c9f-a0e0-c3b24937aed2",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "7cdbd0f2-1925-4133-80ae-93208e7858ef",
          "name": "NAPHTHAZARINE",
          "stdName": "NAPHTHAZARINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a03367fc-a12a-42f5-93c6-a97f31a4fca1",
            "b43807b9-9809-40fa-b8a1-aa6b3c12d3ff"
          ],
          "display_name": false
        },
        {
          "uuid": "548e3d61-9535-4132-af7a-a638d1b2ca94",
          "name": "NAPHTHAZARONE",
          "stdName": "NAPHTHAZARONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a03367fc-a12a-42f5-93c6-a97f31a4fca1",
            "b43807b9-9809-40fa-b8a1-aa6b3c12d3ff"
          ],
          "display_name": false
        },
        {
          "uuid": "3982d459-6b27-498f-82df-f211121e5055",
          "name": "NSC-26647",
          "stdName": "NSC-26647",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a03367fc-a12a-42f5-93c6-a97f31a4fca1",
            "b43807b9-9809-40fa-b8a1-aa6b3c12d3ff"
          ],
          "display_name": false
        },
        {
          "uuid": "0f3840d0-01c9-4926-8be2-a609a74b2985",
          "name": "NSC-344555",
          "stdName": "NSC-344555",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a03367fc-a12a-42f5-93c6-a97f31a4fca1",
            "b43807b9-9809-40fa-b8a1-aa6b3c12d3ff"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "91d29b87-0f02-4ab9-af3c-bfdf652318b2",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b43807b9-9809-40fa-b8a1-aa6b3c12d3ff",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a03367fc-a12a-42f5-93c6-a97f31a4fca1",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9e8d265b-395d-4014-8373-35cf290b416c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390925000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "966a2067-2a30-4dda-8dc5-7ae47f8101d8",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a0b4027f-7612-dd99-2803-4189c72e3078",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=475-38-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b5701695-654c-2ae7-6fb0-28ea2bd9b22d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "dff88b11-097c-584c-bce7-0ea9f59c71e0",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "70c5ffb8-e209-1faf-ed63-b20afe51922c",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "6042366d-c901-444f-92de-10f4fb909d6e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "219b28f2-7be1-1bfb-6518-152fde3b459a",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a5d697db-bc1e-42a4-8be2-5bae7edeacc6",
          "id": "a5d697db-bc1e-42a4-8be2-5bae7edeacc6",
          "molfile": "\n  Marvin  01132108372D          \n\n 14 15  0  0  0  0            999 V2000\n    6.2123   -6.4935    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2123   -5.6589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4642   -5.2478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4642   -4.4228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2123   -4.0069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2123   -3.1746    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9183   -4.4228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6193   -4.0069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6193   -3.1746    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3697   -4.4228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3697   -5.2478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6193   -5.6589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6193   -6.4935    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9183   -5.2478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n 14  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  5  2  0  0  0  0\n  7  8  1  0  0  0  0\n 14  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 14 12  1  0  0  0  0\nM  END",
          "smiles": "c1cc(c2C(=O)C=CC(=O)c2c1O)O",
          "formula": "C10H6O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2e21dabc-e826-40ab-8bd2-d02cf227a0bf"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "190.1526",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ca2b9f09-acf8-4d1b-93ba-a66af60f76e9",
      "version": "12",
      "structure": {
        "id": "35f5a128-1838-449b-9b51-15f22b771835",
        "molfile": "\n  Marvin  01132102522D          \n\n 14 15  0  0  0  0            999 V2000\n    6.9183   -5.2478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9183   -4.4228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2123   -4.0069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4642   -4.4228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4642   -5.2478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2123   -5.6589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2123   -6.4935    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2123   -3.1746    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6193   -4.0069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3697   -4.4228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3697   -5.2478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6193   -5.6589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6193   -6.4935    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6193   -3.1746    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  1  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  3  8  1  0  0  0  0\n  2  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n  1 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n  9 14  2  0  0  0  0\nM  END",
        "smiles": "c1cc(c2C(=O)C=CC(=O)c2c1O)O",
        "formula": "C10H6O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "190.1526",
        "optical_activity": "NONE",
        "references": [
          "b5701695-654c-2ae7-6fb0-28ea2bd9b22d"
        ],
        "stereo_centers": 0
      },
      "unii": "S9IX5I5C0K"
    }
  ]
}