{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6607b30c-afd4-408a-8c6f-16eb936b36d0",
          "code": "1072957-71-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1072957-71-1",
          "code_system": "CAS",
          "references": [
            "08cf170d-8c93-4c4e-b584-dee141cf298a",
            "662561f7-b829-4da6-a91e-9c45b0a3e18d"
          ]
        },
        {
          "uuid": "4c35c7fc-8693-4c05-872f-3d23b344493e",
          "code": "122305",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:29230",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "08cf170d-8c93-4c4e-b584-dee141cf298a"
          ]
        },
        {
          "uuid": "cd1c7681-776f-4349-8a09-aadce94a3187",
          "code": "51347655",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/51347655",
          "code_system": "PUBCHEM",
          "references": [
            "08cf170d-8c93-4c4e-b584-dee141cf298a"
          ]
        },
        {
          "uuid": "a8c1dee3-d9c1-b4d7-b40f-40d9e2431f9f",
          "code": "DTXSID8057930",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8057930",
          "code_system": "EPA CompTox",
          "references": [
            "ef9c1af3-7eb1-e8ef-3a86-29c7b9fcd863"
          ]
        },
        {
          "uuid": "ebb6026b-9482-494b-97ba-9025f8f45847",
          "code": "S98L0WK1W7",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f5d22265-0981-8c4c-f067-70ca2d313ace",
          "code": "83092",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:83092",
          "code_system": "CHEBI",
          "references": [
            "959696ef-29d4-8e39-653d-ff6070e2ef79"
          ]
        },
        {
          "uuid": "44a65f05-0004-5d9a-2fc3-1a404e10d3e9",
          "code": "benzovindiflupyr",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/benzovindiflupyr.html",
          "code_system": "ALANWOOD",
          "references": [
            "b8531464-275f-21ec-f461-e24f282d0741"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "80d8fb0f-7a09-4bb5-8466-8c55c2b4204b",
          "name": "BENZOVINDIFLUPYR",
          "stdName": "BENZOVINDIFLUPYR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "76f5c45e-dc62-4add-a2d4-8a1379aafa22",
            "0bb7ce46-0c73-44cb-8615-f8595cfd0a5b"
          ],
          "display_name": true
        },
        {
          "uuid": "74b1bcf8-c7d0-49a1-a64e-2310cb1dc83d",
          "name": "N-(9-(DICHLOROMETHYLENE)-1,2,3,4-TETRAHYDRO-1,4-METHANONAPHTHALEN-5-YL)-3-(DIFLUOROMETHYL)-1-METHYL-1H-PYRAZOL-4-CARBOXAMIDE",
          "stdName": "N-(9-(DICHLOROMETHYLENE)-1,2,3,4-TETRAHYDRO-1,4-METHANONAPHTHALEN-5-YL)-3-(DIFLUOROMETHYL)-1-METHYL-1H-PYRAZOL-4-CARBOXAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "76f5c45e-dc62-4add-a2d4-8a1379aafa22",
            "a10dd826-660f-46f3-9968-42efb2967096"
          ],
          "display_name": false
        },
        {
          "uuid": "8e8971a5-b686-46b7-b56f-9e7c24cd339c",
          "name": "SOLATENOL",
          "stdName": "SOLATENOL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "76f5c45e-dc62-4add-a2d4-8a1379aafa22",
            "a10dd826-660f-46f3-9968-42efb2967096"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0bb7ce46-0c73-44cb-8615-f8595cfd0a5b",
          "citation": "EPA PESTICIDE",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "76f5c45e-dc62-4add-a2d4-8a1379aafa22",
          "citation": "EPA",
          "doc_type": "EPA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a10dd826-660f-46f3-9968-42efb2967096",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "08cf170d-8c93-4c4e-b584-dee141cf298a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392611000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b25b5ca4-7ab8-46e7-ad26-f391664b757e",
          "citation": "SRS import [S98L0WK1W7]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=S98L0WK1W7",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392611000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ef9c1af3-7eb1-e8ef-3a86-29c7b9fcd863",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1072957-71-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b8531464-275f-21ec-f461-e24f282d0741",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "662561f7-b829-4da6-a91e-9c45b0a3e18d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "959696ef-29d4-8e39-653d-ff6070e2ef79",
          "doc_type": "SYSTEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b2e5d156-c0b3-4090-a0cc-de111c6da4be",
          "id": "b2e5d156-c0b3-4090-a0cc-de111c6da4be",
          "molfile": "\n  Marvin  01132109162D          \n\n 26 29  0  0  1  0            999 V2000\n    8.9986   -7.2885    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    9.7135   -6.8765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7135   -6.0483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9986   -5.6365    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    9.3344   -6.4605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1580   -6.4605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5699   -7.1754    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   10.5699   -5.7504    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    8.2839   -6.0483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2839   -6.8765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5691   -7.2885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8542   -6.8765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8542   -6.0483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5691   -5.6365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5691   -4.8128    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8542   -4.4010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8542   -3.5773    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1441   -4.8128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0575   -5.6315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2492   -5.8035    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9136   -6.5571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8374   -5.0886    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3904   -4.4772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2185   -3.6689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8014   -3.0858    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4213   -3.4595    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  5  1  1  0  0  0\n  1 10  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  1  0  0  0\n  4  9  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 14  2  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  2  0  0  0  0\n 18 16  1  0  0  0  0\n 18 19  2  0  0  0  0\n 23 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  1  0  0  0  0\nM  END",
          "smiles": "Cn1cc(c(C(F)F)n1)C(=O)Nc2cccc3[C@H]4CC[C@@H](c32)C4=C(Cl)Cl",
          "formula": "C18H15Cl2F2N3O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9834d5c6-e8a0-405f-b3fa-be0e8e691cf2"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "398.2346",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ea4b7aeb-a88a-40da-a5f4-e25811bb116b",
      "version": "5",
      "structure": {
        "id": "8f15fdcc-9d82-4a06-a6b4-9f0b56167b29",
        "molfile": "\n  Marvin  01132107252D          \n\n 26 29  0  0  0  0            999 V2000\n    5.2492   -5.8035    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8374   -5.0886    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3904   -4.4772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1441   -4.8128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0575   -5.6315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8542   -4.4010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8542   -3.5773    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5691   -4.8128    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5691   -5.6365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2839   -6.0483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9986   -5.6365    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.7135   -6.0483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7135   -6.8765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9986   -7.2885    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.2839   -6.8765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5691   -7.2885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8542   -6.8765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8542   -6.0483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3344   -6.4605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1580   -6.4605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5699   -7.1754    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   10.5699   -5.7504    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.2185   -3.6689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8014   -3.0858    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4213   -3.4595    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9136   -6.5571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  1  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n  9 18  2  0  0  0  0\n 10 15  2  0  0  0  0\n 14 19  1  1  0  0  0\n 11 19  1  1  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  1  0  0  0  0\n  3 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 23 25  1  0  0  0  0\n  1 26  1  0  0  0  0\nM  END",
        "smiles": "Cn1cc(c(C(F)F)n1)C(=O)Nc2cccc3[C@H]4CC[C@@H](c32)C4=C(Cl)Cl",
        "formula": "C18H15Cl2F2N3O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "398.2346",
        "optical_activity": "( + / - )",
        "references": [
          "b25b5ca4-7ab8-46e7-ad26-f391664b757e",
          "a10dd826-660f-46f3-9968-42efb2967096"
        ],
        "stereo_centers": 2
      },
      "unii": "S98L0WK1W7"
    }
  ]
}