{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "897da419-28c0-477d-823b-9bb985b48027",
          "code": "219-484-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.017.713",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "fdb4aef0-5c5d-4550-a51d-86e5078b2a37"
          ]
        },
        {
          "uuid": "fddb211b-aabf-409b-b859-5a80c8a86ca0",
          "code": "2998",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2998",
          "code_system": "PUBCHEM",
          "references": [
            "fdb4aef0-5c5d-4550-a51d-86e5078b2a37"
          ]
        },
        {
          "uuid": "df4114c4-d5fc-47ae-876d-13d05eec44fb",
          "code": "2444-46-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2444-46-4",
          "code_system": "CAS",
          "references": [
            "fdb4aef0-5c5d-4550-a51d-86e5078b2a37",
            "65984893-d7ba-4dd7-b516-dc8b16e1213e"
          ]
        },
        {
          "uuid": "4573cfdc-e9d7-4ef8-b452-fca0d9b4e4d0",
          "code": "C005871",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67005871",
          "code_system": "MESH",
          "references": [
            "fdb4aef0-5c5d-4550-a51d-86e5078b2a37"
          ]
        },
        {
          "uuid": "321d1f57-afb3-4eac-9874-19abf45e802c",
          "code": "NONIVAMIDE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Nonivamide",
          "code_system": "WIKIPEDIA",
          "references": [
            "fdb4aef0-5c5d-4550-a51d-86e5078b2a37"
          ]
        },
        {
          "uuid": "4c6d39d7-3edd-4a81-9214-750e73a1d481",
          "code": "70709",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3061",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "fdb4aef0-5c5d-4550-a51d-86e5078b2a37"
          ]
        },
        {
          "uuid": "cd2c9a42-2a29-4743-8289-d5d6ce876214",
          "code": "4758",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=4758",
          "code_system": "INN",
          "references": [
            "fdb4aef0-5c5d-4550-a51d-86e5078b2a37"
          ]
        },
        {
          "uuid": "c8f0efd1-2a76-43fb-aafd-b98ced0e9704",
          "code": "31945",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/31945/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "fdb4aef0-5c5d-4550-a51d-86e5078b2a37"
          ]
        },
        {
          "uuid": "00c8c73f-20d9-4448-847b-0951e82a05f8",
          "code": "SUB09352MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "fdb4aef0-5c5d-4550-a51d-86e5078b2a37"
          ]
        },
        {
          "uuid": "214c1476-ea0a-4435-8ba3-a09ba4e7d7a8",
          "code": "CHEMBL75124",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL75124",
          "code_system": "ChEMBL",
          "references": [
            "fdb4aef0-5c5d-4550-a51d-86e5078b2a37"
          ]
        },
        {
          "uuid": "8a95715b-2e0e-2afb-3dcc-af21837d325e",
          "code": "DTXSID1034769",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1034769",
          "code_system": "EPA CompTox",
          "references": [
            "0f20c217-bc6b-c9a5-0ac0-dfa44639818a"
          ]
        },
        {
          "uuid": "de55f68d-d722-1046-4180-c04d8fc00cfb",
          "code": "C170227",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C170227",
          "code_system": "NCI_THESAURUS",
          "references": [
            "790fb1d2-54e6-3478-c8d9-ba3849307a4b"
          ]
        },
        {
          "uuid": "aa1005aa-c1c0-47b2-9b7f-cb963bc42ca2",
          "code": "S846B891OR",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0b7013f3-975c-f4bf-98da-1dcba532754d",
          "code": "DB11324",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB11324",
          "code_system": "DRUG BANK",
          "references": [
            "790fb1d2-54e6-3478-c8d9-ba3849307a4b"
          ]
        },
        {
          "uuid": "8ef49ae0-bf56-f7a2-2863-f889a23ee2b3",
          "code": "46936",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:46936",
          "code_system": "CHEBI",
          "references": [
            "790fb1d2-54e6-3478-c8d9-ba3849307a4b"
          ]
        },
        {
          "uuid": "27b76916-3449-b579-2957-0eaf04189e9b",
          "code": "S846B891OR",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=S846B891OR",
          "code_system": "DAILYMED",
          "references": [
            "e38e492d-71c6-a3e4-5cde-866c62d40158"
          ]
        },
        {
          "uuid": "0298b16b-c65f-17a9-44b3-39b3a1055464",
          "code": "100000083590",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "ba247d6d-34f4-1958-7e06-73153a6354b7"
          ]
        },
        {
          "uuid": "23ffb5b2-3d22-7d10-b5e8-baef34e30152",
          "code": "172795",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=172795",
          "code_system": "NSC",
          "references": [
            "7a443fdc-44bd-55cc-4325-89e1225f0d17"
          ]
        },
        {
          "uuid": "c168eb2c-5158-abda-b579-a78bc24c4d27",
          "code": "1588",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/1588/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "e027e5c4-25b3-03b4-c4c1-3058b58d8426"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "121d5794-c4df-4f8f-8c34-ac1146d1921f",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "e70bd709-40d1-4660-a62b-14b2683f5fb3",
            "refuuid": "0591c4bf-594a-4e3c-852f-ed2be5e78586",
            "name": "NONIVAMIDE",
            "unii": "S846B891OR",
            "linking_id": "S846B891OR",
            "ref_pname": "NONIVAMIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b2ea813e-91d0-4838-8c4e-94b74e7b70e3",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "d2d88545-b259-4b0b-8556-a71f25d2e473"
          ],
          "related_substance": {
            "uuid": "62e163e5-f862-4284-b8c2-1bed2e2565f9",
            "refuuid": "d08f68dd-195b-4366-8dcd-af9218f72f9d",
            "name": "PAPRIKA",
            "unii": "X72Z47861V",
            "linking_id": "X72Z47861V",
            "ref_pname": "PAPRIKA",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "80c06c49-1bde-41ae-8b2f-2dee65b657fe",
          "name": "AH-23491X",
          "stdName": "AH-23491X",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8091311d-32db-4174-9bf7-54e15a6a4023"
          ],
          "display_name": false
        },
        {
          "uuid": "ee7a6da6-97d7-4040-a920-a0c1675076f5",
          "name": "FEMA NO. 2787",
          "stdName": "FEMA NO. 2787",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de536037-0bfc-436c-a622-8ea3bbf12820"
          ],
          "display_name": false
        },
        {
          "uuid": "d7213124-f3c5-4273-b652-35a247f23aa9",
          "name": "HANSAPLAST",
          "stdName": "HANSAPLAST",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d660a42f-1a87-43d8-882d-87313db9ebc3",
            "847f3d9c-b29b-4c54-99d7-fc03143de4b8"
          ],
          "display_name": false
        },
        {
          "uuid": "5986a119-b818-4e65-b472-dd1f5e1696f2",
          "name": "HYDROXYMETHOXYBENZYL PELARGONAMIDE",
          "stdName": "HYDROXYMETHOXYBENZYL PELARGONAMIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "a4eb00de-0336-450c-a0e2-e36fdd19e391",
            "d8b5cda6-60f4-48a0-a2d7-4e5886d191a4"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "ac527506-83b1-4585-ac53-04023b200f7f",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "97c0406e-97e5-497c-a7f4-8195accaecb8",
          "name": "N-NONANOYL-4-HYDROXY-3-METHOXYBENZYL-AMIDE [FHFI]",
          "stdName": "N-NONANOYL-4-HYDROXY-3-METHOXYBENZYL-AMIDE [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "841d0d66-9e1d-4b4f-8f6a-cf169d0012dd"
          ],
          "display_name": false
        },
        {
          "uuid": "4e2bfeab-36f2-4995-a1cf-8f5cf0995455",
          "name": "N-VANILLYLNONAMIDE",
          "stdName": "N-VANILLYLNONAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2d26eb39-26a2-4f8b-986d-ff1bec732234"
          ],
          "display_name": false
        },
        {
          "uuid": "25d1f841-e828-4f51-be9d-03f9a84e8984",
          "name": "N-VANILLYLNONANAMIDE",
          "stdName": "N-VANILLYLNONANAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a50a436b-d118-4606-abe6-706d517828f6"
          ],
          "display_name": false
        },
        {
          "uuid": "4f9772d4-8628-4aaf-888c-a1950e6e1baa",
          "name": "NONANOYL 4-HYDROXY-3-METHOXYBENZYLAMIDE",
          "stdName": "NONANOYL 4-HYDROXY-3-METHOXYBENZYLAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3905b002-93dd-44c2-b6a8-10da1ab13b9e"
          ],
          "display_name": false
        },
        {
          "uuid": "3a7cc282-edc8-46bd-b3c7-e70f2905626f",
          "name": "NONIVAMIDE",
          "stdName": "NONIVAMIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c1ffb1c-48ec-47f3-83de-2fb6c5dcc683",
            "638f4d1f-5610-4f93-a7ea-a11cbeb72938",
            "f5a9b49f-95c0-49ac-9987-747d3407d564",
            "ae20ef1d-6b64-4759-86d0-50cb28f89a51",
            "e0a31770-cc35-4d1d-b070-49e7e4eb0566",
            "a7944725-bf7b-42f2-abee-a36b493ab602",
            "087516bb-d518-4c85-a322-f2ff7518ca5c"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "48120909-11df-4862-814c-c1e923696b4c",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "c9d655ca-75ae-4a7e-bf16-d1d233c768f2",
          "name": "NONIVAMIDE (CONSTITUENT OF CAPSICUM) [DSC]",
          "stdName": "NONIVAMIDE (CONSTITUENT OF CAPSICUM) [DSC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e761596-6940-4eb5-b9ff-c525c799d6cd"
          ],
          "display_name": false
        },
        {
          "uuid": "3ecd45a0-ebeb-4a61-adfd-b0cf87b0cdb5",
          "name": "NONIVAMIDE [MART.]",
          "stdName": "NONIVAMIDE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ae20ef1d-6b64-4759-86d0-50cb28f89a51"
          ],
          "display_name": false
        },
        {
          "uuid": "7f297fb8-dcd5-4373-a4f2-b59bc8144a76",
          "name": "NONYLIC ACID VANILLYAMIDE",
          "stdName": "NONYLIC ACID VANILLYAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2d26eb39-26a2-4f8b-986d-ff1bec732234"
          ],
          "display_name": false
        },
        {
          "uuid": "2d15159b-a18e-4815-853f-2d56cd0406f2",
          "name": "NSC-172795",
          "stdName": "NSC-172795",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8091311d-32db-4174-9bf7-54e15a6a4023"
          ],
          "display_name": false
        },
        {
          "uuid": "62548ca8-8dad-94b3-8c87-5c3cc3ca045a",
          "name": "Nonivamide [WHO-DD]",
          "stdName": "NONIVAMIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dc19ac43-9d86-d102-ce81-849afdc220d3"
          ],
          "display_name": false
        },
        {
          "uuid": "ad3ded0c-2137-440a-8251-f0ba3d51af41",
          "name": "PELARGONIC ACID VANILLYLAMIDE",
          "stdName": "PELARGONIC ACID VANILLYLAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "693b9f17-b0b9-4531-a150-958b877b4b5d"
          ],
          "display_name": false
        },
        {
          "uuid": "2776be40-a446-4bc1-b6b5-b60530a5fc1e",
          "name": "PSEUDOCAPSAICIN",
          "stdName": "PSEUDOCAPSAICIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "693b9f17-b0b9-4531-a150-958b877b4b5d"
          ],
          "display_name": false
        },
        {
          "uuid": "f31353b8-e86e-405b-9546-c135c4deec21",
          "name": "VANILLYL N-NONYLAMIDE",
          "stdName": "VANILLYL N-NONYLAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "693b9f17-b0b9-4531-a150-958b877b4b5d"
          ],
          "display_name": false
        },
        {
          "uuid": "1e4a227b-e7e4-4463-8e16-593915a56130",
          "name": "VANILLYL PELARGONIC AMIDE",
          "stdName": "VANILLYL PELARGONIC AMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "693b9f17-b0b9-4531-a150-958b877b4b5d"
          ],
          "display_name": false
        },
        {
          "uuid": "f5a7311e-64b8-48b9-bb6c-a57dacb2864b",
          "name": "VANILLYL-N-NONYLAMIDE",
          "stdName": "VANILLYL-N-NONYLAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7152ab81-a842-4420-9c5a-6e658a4dcfb0"
          ],
          "display_name": false
        },
        {
          "uuid": "f040a583-aea7-4d84-8358-48a55c68ed4f",
          "name": "nonivamide [INN]",
          "stdName": "NONIVAMIDE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "638f4d1f-5610-4f93-a7ea-a11cbeb72938"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5e761596-6940-4eb5-b9ff-c525c799d6cd",
          "citation": "DSC, VOL.2, 2015",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8091311d-32db-4174-9bf7-54e15a6a4023",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fdb4aef0-5c5d-4550-a51d-86e5078b2a37",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390978000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d2d88545-b259-4b0b-8556-a71f25d2e473",
          "citation": "2015 USP DIETARY SUPPLEMENTS COMPENDIUM",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "293f09b2-b102-4a56-9c50-10977996a861",
          "citation": "SRS import [S846B891OR]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=S846B891OR",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390978000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "afc2c14a-6a30-4464-be53-e61a883063e1",
          "citation": "INN 2010; USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e0a31770-cc35-4d1d-b070-49e7e4eb0566",
          "citation": "NONIVAMIDE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a7944725-bf7b-42f2-abee-a36b493ab602",
          "citation": "NONIVAMIDE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a4eb00de-0336-450c-a0e2-e36fdd19e391",
          "citation": "HYDROXYMETHOXYBENZYL PELARGONAMIDE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "087516bb-d518-4c85-a322-f2ff7518ca5c",
          "citation": "NONIVAMIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4c1ffb1c-48ec-47f3-83de-2fb6c5dcc683",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "638f4d1f-5610-4f93-a7ea-a11cbeb72938",
          "citation": "INN Proposed List 43",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL43.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2d26eb39-26a2-4f8b-986d-ff1bec732234",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "de536037-0bfc-436c-a622-8ea3bbf12820",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ae20ef1d-6b64-4759-86d0-50cb28f89a51",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d660a42f-1a87-43d8-882d-87313db9ebc3",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "847f3d9c-b29b-4c54-99d7-fc03143de4b8",
          "citation": "D08282",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "841d0d66-9e1d-4b4f-8f6a-cf169d0012dd",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7152ab81-a842-4420-9c5a-6e658a4dcfb0",
          "citation": "RXNORM",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d8b5cda6-60f4-48a0-a2d7-4e5886d191a4",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "693b9f17-b0b9-4531-a150-958b877b4b5d",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f5a9b49f-95c0-49ac-9987-747d3407d564",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a50a436b-d118-4606-abe6-706d517828f6",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3905b002-93dd-44c2-b6a8-10da1ab13b9e",
          "citation": "JECFA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0f20c217-bc6b-c9a5-0ac0-dfa44639818a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2444-46-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "65984893-d7ba-4dd7-b516-dc8b16e1213e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "790fb1d2-54e6-3478-c8d9-ba3849307a4b",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "7a443fdc-44bd-55cc-4325-89e1225f0d17",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "e38e492d-71c6-a3e4-5cde-866c62d40158",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "dc19ac43-9d86-d102-ce81-849afdc220d3",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "ba247d6d-34f4-1958-7e06-73153a6354b7",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "e027e5c4-25b3-03b4-c4c1-3058b58d8426",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "69a7f4fd-9a00-47c5-a63a-77c97559c2e3",
          "id": "69a7f4fd-9a00-47c5-a63a-77c97559c2e3",
          "molfile": "\n  Marvin  01132105292D          \n\n 21 21  0  0  0  0            999 V2000\n   10.0223   -1.7421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3007   -1.3324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5688   -1.7318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8730   -1.3092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1437   -1.7112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4273   -1.3015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7083   -1.7035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9970   -1.2783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2857   -1.6803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2780   -2.5049    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5873   -1.2705    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8554   -1.6622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1442   -1.2525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1338   -0.4098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4483    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7113   -0.4098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0258    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7113   -1.2319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.6416    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.4611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4329   -1.6416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 13 21  2  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  1  0  0  0  0\n 16 18  2  0  0  0  0\n 19 18  1  0  0  0  0\n 21 18  1  0  0  0  0\n 20 19  1  0  0  0  0\nM  END",
          "smiles": "CCCCCCCCC(=O)NCc1ccc(c(c1)OC)O",
          "formula": "C17H27NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "fcd52df0-9950-40e7-a48c-e357fa0274be"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "293.4018",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0591c4bf-594a-4e3c-852f-ed2be5e78586",
      "version": "17",
      "structure": {
        "id": "3d53149d-64a9-47c4-a4de-fd5c10ac1ee3",
        "molfile": "\n  Marvin  01132103152D          \n\n 21 21  0  0  0  0            999 V2000\n    0.7113   -1.2319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2857   -1.6803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7113   -0.4098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5873   -1.2705    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4329   -1.6416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2780   -2.5049    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4483    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1442   -1.2525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8554   -1.6622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1338   -0.4098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.6416    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0258    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9970   -1.2783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.4611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7083   -1.7035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3007   -1.3324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5688   -1.7318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1437   -1.7112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8730   -1.3092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4273   -1.3015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0223   -1.7421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  4  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  9  1  0  0  0  0\n  5  1  2  0  0  0  0\n  6  2  2  0  0  0  0\n  7  3  2  0  0  0  0\n  8  5  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  2  0  0  0  0\n 11  1  1  0  0  0  0\n 12  3  1  0  0  0  0\n 13  2  1  0  0  0  0\n 14 11  1  0  0  0  0\n 15 13  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 15  1  0  0  0  0\n 21 16  1  0  0  0  0\n 10  7  1  0  0  0  0\nM  END",
        "smiles": "CCCCCCCCC(=O)NCc1ccc(c(c1)OC)O",
        "formula": "C17H27NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "293.4018",
        "optical_activity": "NONE",
        "references": [
          "afc2c14a-6a30-4464-be53-e61a883063e1",
          "293f09b2-b102-4a56-9c50-10977996a861",
          "638f4d1f-5610-4f93-a7ea-a11cbeb72938"
        ],
        "stereo_centers": 0
      },
      "unii": "S846B891OR"
    }
  ]
}