{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5e95a539-6328-44f9-8d73-f70cffe19cde",
          "code": "S7T8YL727Z",
          "type": "PRIMARY",
          "code_system": "FDA UNII",
          "references": [
            "ce31724a-00c1-4697-9d8d-8ee726add596"
          ]
        },
        {
          "uuid": "07c263d7-c335-44a0-9716-715a3d2f9a58",
          "code": "60580-61-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=60580-61-2",
          "code_system": "CAS",
          "references": [
            "40a2f957-d007-4f71-8d2b-90b2d3aa1fe2",
            "ce31724a-00c1-4697-9d8d-8ee726add596"
          ]
        },
        {
          "uuid": "f416ea4d-009e-4a3c-a845-d4947d51ad3c",
          "code": "6454008",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6454008",
          "code_system": "PUBCHEM",
          "references": [
            "40a2f957-d007-4f71-8d2b-90b2d3aa1fe2"
          ]
        },
        {
          "uuid": "08ea6463-4819-47d7-9693-4521bfcd1056",
          "code": "262-309-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.056.627",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "40a2f957-d007-4f71-8d2b-90b2d3aa1fe2"
          ]
        },
        {
          "uuid": "52216f8c-970a-a04b-bffc-c4eae344cf13",
          "code": "DTXSID70209386",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70209386",
          "code_system": "EPA CompTox",
          "references": [
            "76ea8858-78fb-eb44-39fa-db897a6e2ea8"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "26f8f628-e088-48f6-8784-d8d726949ed4",
          "amount": {
            "uuid": "2862f68f-b68e-4930-9560-5f6b542e2896"
          },
          "type": "PARENT->SALT/SOLVATE",
          "references": [
            "ce31724a-00c1-4697-9d8d-8ee726add596"
          ],
          "related_substance": {
            "uuid": "143290d6-31ca-4796-b070-fdb255a065da",
            "refuuid": "9087196c-638f-4338-ba26-6f26eb6540d9",
            "name": "5-Nitroisophthalic acid",
            "unii": "G7RZ7LC76U",
            "linking_id": "G7RZ7LC76U",
            "ref_pname": "5-Nitroisophthalic acid",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "7df9c239-6f19-4b58-859c-83267339aff7",
          "name": "1,3-Benzenedicarboxylic acid, 5-nitro-, zinc salt (1:1)",
          "stdName": "1,3-BENZENEDICARBOXYLIC ACID, 5-NITRO-, ZINC SALT (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ce31724a-00c1-4697-9d8d-8ee726add596"
          ],
          "display_name": false
        },
        {
          "uuid": "b1ae0e6c-73a8-47c5-bc04-1d91c09f29d5",
          "name": "Alcophor 827",
          "stdName": "ALCOPHOR 827",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ce31724a-00c1-4697-9d8d-8ee726add596"
          ],
          "display_name": false
        },
        {
          "uuid": "f38a80af-c63b-4a88-8648-57a234167800",
          "name": "Heucorin RZ",
          "stdName": "HEUCORIN RZ",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ce31724a-00c1-4697-9d8d-8ee726add596"
          ],
          "display_name": false
        },
        {
          "uuid": "d3e08ac3-ed04-489f-bc9d-ee77297befa8",
          "name": "Zinc 5-nitroisophthalate",
          "stdName": "ZINC 5-NITROISOPHTHALATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "59d528a8-4c84-440a-a144-e9bbee09b59a",
            "e11975b8-d839-40da-854a-745d8b268913"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "59d528a8-4c84-440a-a144-e9bbee09b59a",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e11975b8-d839-40da-854a-745d8b268913",
          "citation": "EPA",
          "doc_type": "EPA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "40a2f957-d007-4f71-8d2b-90b2d3aa1fe2",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393756000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "76ea8858-78fb-eb44-39fa-db897a6e2ea8",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=60580-61-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ce31724a-00c1-4697-9d8d-8ee726add596",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2fa8f288-d595-4bb6-8647-6336f64b4452",
          "id": "2fa8f288-d595-4bb6-8647-6336f64b4452",
          "molfile": "\n  Marvin  01132102332D          \n\n  1  0  0  0  0  0            999 V2000\n    3.1458   -4.6250    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Zn+2]",
          "formula": "Zn",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7b571ccd-e810-4b77-a81d-0f0806796952"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "65.3956",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "88f4b740-8813-49c0-ab87-edfa829d56b1",
          "id": "88f4b740-8813-49c0-ab87-edfa829d56b1",
          "molfile": "\n  Marvin  01132107062D          \n\n 15 15  0  0  0  0            999 V2000\n    8.5917   -2.1333    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.7667   -2.1333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3542   -1.4208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3542   -2.8458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5292   -2.8458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1167   -3.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5292   -4.2750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3542   -4.2750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7667   -3.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7667   -4.9917    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    7.3542   -5.7042    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.5917   -4.9917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2917   -3.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8792   -4.2750    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.8792   -2.8458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  9  2  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n 13  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9  8  1  0  0  0  0\n  8 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 10  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 13  2  0  0  0  0\nM  CHG  4   1  -1  10   1  11  -1  14  -1\nM  END",
          "smiles": "c1c(cc(cc1C(=O)[O-])[N+](=O)[O-])C(=O)[O-]",
          "formula": "C8H3NO6",
          "atropisomerism": "No",
          "charge": -2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b702596a-a2ba-448b-ac7e-917d4fc81812"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "209.1128",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "39b6759e-5dff-415f-8e02-0dbf0c6baed1",
      "version": "6",
      "structure": {
        "id": "b8dcc06c-b1fc-416b-ac00-982aae449c8d",
        "molfile": "\n  Marvin  01132109342D          \n\n 16 15  0  0  0  0            999 V2000\n    7.7667   -4.9917    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    7.3542   -4.2750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1167   -3.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3542   -2.8458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2917   -3.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7667   -2.1333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5292   -4.2750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7667   -3.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5292   -2.8458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3542   -5.7042    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.5917   -4.9917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5917   -2.1333    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.8792   -4.2750    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.8792   -2.8458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3542   -1.4208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1458   -4.6250    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  7  2  0  0  0  0\n  4  8  1  0  0  0  0\n  5  3  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  2  1  0  0  0  0\n  8  2  2  0  0  0  0\n  9  3  1  0  0  0  0\n 10  1  1  0  0  0  0\n 11  1  2  0  0  0  0\n 12  6  1  0  0  0  0\n 13  5  1  0  0  0  0\n 14  5  2  0  0  0  0\n 15  6  2  0  0  0  0\n  4  9  2  0  0  0  0\nM  CHG  5   1   1  10  -1  12  -1  13  -1  16   2\nM  END",
        "smiles": "c1c(cc(cc1C(=O)[O-])[N+](=O)[O-])C(=O)[O-].[Zn+2]",
        "formula": "C8H3NO6.Zn",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "274.5084",
        "optical_activity": "NONE",
        "references": [
          "59d528a8-4c84-440a-a144-e9bbee09b59a",
          "ce31724a-00c1-4697-9d8d-8ee726add596"
        ],
        "stereo_centers": 0
      },
      "unii": "S7T8YL727Z"
    }
  ]
}