{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "20289812-11d0-4cdd-96c6-d7631d68261a",
          "code": "321-97-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=321-97-1",
          "code_system": "CAS",
          "references": [
            "19765301-2685-4bf7-9571-b40c89cfb224",
            "ecef0569-124c-4640-a7b5-29d9352dd286"
          ]
        },
        {
          "uuid": "f7769fed-492a-4383-8a36-7910119097af",
          "code": "206-292-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.005.722",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "19765301-2685-4bf7-9571-b40c89cfb224"
          ]
        },
        {
          "uuid": "5d4e2e3c-fd92-46a9-ae48-198b9b219675",
          "code": "62946",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/62946",
          "code_system": "PUBCHEM",
          "references": [
            "19765301-2685-4bf7-9571-b40c89cfb224"
          ]
        },
        {
          "uuid": "66436a07-71a4-4c43-83b0-2360bc92e0ed",
          "code": "S76J9U46ST",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "891e9763-a0ce-5e39-9c04-4621dea196fc",
          "code": "DTXSID90185895",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90185895",
          "code_system": "EPA CompTox",
          "references": [
            "9a98a5d7-32d7-0682-1a12-5d1057f11030"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "8f49d5d8-e6d3-499e-b6da-c4ef39aad7bb",
          "amount": {
            "uuid": "b3402e01-3008-4e78-9784-8bb39e3f182c"
          },
          "type": "DIASTEREOISOMER->DIASTEREOISOMER",
          "references": [
            "f9889e8e-7515-4b09-bb8b-8618453e55f7"
          ],
          "related_substance": {
            "uuid": "e9d7d25c-dbe1-4741-a6d8-f6713465e9fd",
            "refuuid": "82f7c014-a33a-4e99-af63-38fef0453618",
            "name": "Ephedrine",
            "unii": "GN83C131XS",
            "linking_id": "GN83C131XS",
            "ref_pname": "Ephedrine"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e0f8a375-0680-4631-afdf-ed93f98b1bdb",
          "name": "(-)-THREO-EPHEDRINE",
          "stdName": "(-)-THREO-EPHEDRINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ac43dc5c-d6be-4337-bad7-9006c2bc7438"
          ],
          "display_name": false
        },
        {
          "uuid": "54189025-b3f0-4dd2-a5ac-7fa01b85dae5",
          "name": "(.ALPHA.R)-.ALPHA.-((1R)-1-(METHYLAMINO)ETHYL)BENZENEMETHANOL",
          "stdName": "(.ALPHA.R)-.ALPHA.-((1R)-1-(METHYLAMINO)ETHYL)BENZENEMETHANOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ac43dc5c-d6be-4337-bad7-9006c2bc7438"
          ],
          "display_name": false
        },
        {
          "uuid": "c9c811ff-f6fc-4300-b840-95c0197e9c50",
          "name": "(1R,2R)-(-)-PSEUDOEPHEDRINE",
          "stdName": "(1R,2R)-(-)-PSEUDOEPHEDRINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d79b792d-acd9-48b6-bb6d-5ef9492ae872"
          ],
          "display_name": false
        },
        {
          "uuid": "e124fc5e-3f82-46c2-9b56-a531da724342",
          "name": "CPDD-0049",
          "stdName": "CPDD-0049",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ac43dc5c-d6be-4337-bad7-9006c2bc7438"
          ],
          "display_name": false
        },
        {
          "uuid": "c0ca9600-7e21-4009-8089-960678bf478b",
          "name": "D-(-)-PSEUDOEPHEDRINE",
          "stdName": "D-(-)-PSEUDOEPHEDRINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ac43dc5c-d6be-4337-bad7-9006c2bc7438"
          ],
          "display_name": false
        },
        {
          "uuid": "dd6cdfb4-aeae-489a-83c8-8f247c1c80ea",
          "name": "PSEUDOEPHEDRINE, (-)-",
          "stdName": "PSEUDOEPHEDRINE, (-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9174b4be-eded-4a65-a622-bfb76f2ca322"
          ],
          "display_name": true
        },
        {
          "uuid": "7c555593-db0f-4d7e-bc6c-8736af80b0be",
          "name": "PSEUDOEPHEDRINE, L-",
          "stdName": "PSEUDOEPHEDRINE, L-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c6f81831-876e-4d41-a253-99c73f036cab"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c6f81831-876e-4d41-a253-99c73f036cab",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d79b792d-acd9-48b6-bb6d-5ef9492ae872",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ac43dc5c-d6be-4337-bad7-9006c2bc7438",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9174b4be-eded-4a65-a622-bfb76f2ca322",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "19765301-2685-4bf7-9571-b40c89cfb224",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393163000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0ac97da5-908a-419e-a3e9-fd3b6b045448",
          "citation": "SRS import [S76J9U46ST]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=S76J9U46ST",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393163000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9a98a5d7-32d7-0682-1a12-5d1057f11030",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=321-97-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ecef0569-124c-4640-a7b5-29d9352dd286",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f9889e8e-7515-4b09-bb8b-8618453e55f7",
          "citation": "WIKIPEDIA",
          "url": "https://en.wikipedia.org/wiki/Ephedrine",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b149b13d-901a-4839-8431-8edeba7eb41c",
          "id": "b149b13d-901a-4839-8431-8edeba7eb41c",
          "molfile": "\n  Marvin  01132109112D          \n\n 12 12  0  0  1  0            999 V2000\n    6.4545   -4.7412    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.1691   -4.3289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4545   -5.7719    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1292   -6.1615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7000   -4.3516    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.7000   -3.5725    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0253   -4.7412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3106   -4.3289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5960   -4.7412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5960   -5.5658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3106   -5.9781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0253   -5.5658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  1  5  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n  7  5  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 12  2  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\nM  END",
          "smiles": "C[C@H]([C@@H](c1ccccc1)O)NC",
          "formula": "C10H15NO",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "01d40b2a-195c-4fbf-9fa6-98fc48938174"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "165.2326",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d45f19a4-f4cc-41f3-a061-698b5834e6ab",
      "version": "5",
      "structure": {
        "id": "f8d5a194-1276-4d8a-90dd-95eedeb14381",
        "molfile": "\n  Marvin  01132112542D          \n\n 12 12  0  0  1  0            999 V2000\n    5.7000   -4.3516    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.4545   -4.7412    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.4545   -5.7719    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1691   -4.3289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3106   -4.3289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5960   -4.7412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5960   -5.5658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3106   -5.9781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0253   -5.5658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0253   -4.7412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7000   -3.5725    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1292   -6.1615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  1  0  0  0\n  2  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10  5  2  0  0  0  0\n 10  1  1  0  0  0  0\n  1 11  1  1  0  0  0\n  3 12  1  0  0  0  0\nM  END",
        "smiles": "C[C@H]([C@@H](c1ccccc1)O)NC",
        "formula": "C10H15NO",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "165.2326",
        "optical_activity": "( - )",
        "references": [
          "0ac97da5-908a-419e-a3e9-fd3b6b045448",
          "d79b792d-acd9-48b6-bb6d-5ef9492ae872"
        ],
        "stereo_centers": 2
      },
      "unii": "S76J9U46ST"
    }
  ]
}